2.75+3x=4.25+2.50x

can somone help please im confused on what to do

Answers

Answer 1

2.75+3x=4.25+2.50x

3x - 2.50x = 4.25 - 2.75

0.50x = 1.50

x = 1.50 ÷ 0.50

x = 3

Understand?


Related Questions

What are the possible rational roots of the polynomial equation?

0=2x7+3x5−9x2+6

Answers

Answer: [tex]\pm\frac{1}{1}, \pm\frac{1}{2},\pm\frac{2}{1},\pm\frac{3}{1}, \pm\frac{3}{2}[/tex]

Step-by-step explanation:

We can use the Rational Root Test.

Given a polynomial in the form:

[tex]a_nx^n +a_{n- 1}x^{n - 1} + … + a_1x^1 + a_0 = 0[/tex]

Where:

- The coefficients are integers.

- [tex]a_n[/tex] is the leading coeffcient ([tex]a_n\neq 0[/tex])

- [tex]a_0[/tex] is the constant term [tex]a_0\neq 0[/tex]

Every rational root of the polynomial is in the form:

[tex]\frac{p}{q}=\frac{\pm(factors\ of\ a_0)}{\pm(factors\ of\ a_n)}[/tex]

For the case of the given polynomial:

[tex]2x^7+3x^5-9x^2+6=0[/tex]

We can observe that:

- Its constant term is 6, with factors 1, 2 and 3.

- Its leading coefficient is 2, with factors 1 and 2.

 Then, by Rational Roots Test we get the possible rational roots of this polynomial:

[tex]\frac{p}{q}=\frac{\pm(1,2,3,6)}{\pm(1,2)}=\pm\frac{1}{1}, \pm\frac{1}{2},\pm\frac{2}{1},\pm\frac{3}{1}, \pm\frac{3}{2}[/tex]

The possible rational roots of the polynomial equation [tex]0 = 2x^7 + 3x^5 - 9x^2 + 6.[/tex] are ±1, ±2, ±3, ±6, ±1/2, ±1, ±3/2, and ±3.

Given equation [tex]0 = 2x^7 + 3x^5 - 9x^2 + 6[/tex].

The Rational Root Theorem states that if there are any rational roots (fractions in the form p/q) for the polynomial equation, then p must be a factor of the constant term (in this case, 6), and q must be a factor of the leading coefficient (in this case, 2).

So, the possible rational roots (fractions p/q) for this polynomial are all the combinations of p and q, where:

p is a factor of 6, and

q is a factor of 2.

The factors of 6 are ±1, ±2, ±3, and ±6.

The factors of 2 are ±1 and ±2.

So, the possible rational roots are all the combinations of these factors:

±1/1, ±2/1, ±3/1, ±6/1, ±1/2, ±2/2, ±3/2, and ±6/2.

Simplify these fractions:

±1, ±2, ±3, ±6, ±1/2, ±1, ±3/2, and ±3.

Learn more about Rational Roots here:

https://brainly.com/question/29551180

#SPJ3

HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16​

Answers

Answer:

Step-by-step explanation:

Oof, all 6?  That's not fun.  

I'm going to show you one for the first bunch, (4-12) and hopefully you can get the rest.  If not let me know and I can more carefully work you through some others on here.

4)  So first we need the angle.  How do we find that?  Well, we know it's somewhere between 270 and 360 degrees (or 3pi/2 and 2pi radians) since it's in the fourth quadrant.    The method to finding the angle is ifferent for each quadrant, but it's nice to know around where you'll get.  Anyway,, if we take 360 and subtract that little space  that is unlabeled  we will know  the rest.    Hopefully that makes sense, but let me know if not, it's important to understand.  Maybe think of what happens if you add the two together, you get around the whole circle then.  

Anyway, to find that little sliver, we are going to construct a right triangle wherethe x axis is one side.  If you draw a line connecting point p and the x axis you have this right triangle.  I am going to call this sliver we don't know s.  ANyway, now we use trig here.  

s = arcsin(3/5) (you can find 5 pretty easily but let me know if you don't see it.)

You may think to use -3 instead of 3, and  it wouldn't be a huge mistake, it will just give you the negative version of what we want.  

Anyway, now we know theta is 360-s (or 2pi-s).  You can solve s or leave it as arcsin(3/5) so you don't have to round.

Now we can solve the trig functions.  If you don't know the sum and difference trig identities  you will have to round.  They are pretty simple formula though.  For instance, sin(2pi - arcsin(3/5)) = sin(2pi)cos(arcsin(3/5))-cos(2pi)sin(arcsin(3/5)) = 0 - 3/5 = -3/5  You will also want to know that s = arcsin(3/5) = arccos(4/5) = arctan(3/4).  ROunding will get you close but not exact.

Again, let me know ifyou need any more help, they should just be a lot of doing the same thing over and over and over again though.  

14)  For 14 and 16 you just need to know how the graphs of sin, cos and tan look.  Is this something you have trouble with?  Like could you draw the graphs at the intervals of increasing/ decrasing and all.  if not I can give a quick explanation.

Name: cuiusly thens
Date: _9-1119
Bell: Berat
Unit 6: Exponents & Exponential Functions
Homework 1: Adding, Subtracting,
& Multiplying Monomials
Directions: Simplify the following monomials.
1.-3a + 52a
2.-12x²y – 3x²y
3. 16ab3 – 43ab3
4.-15m - (-15m)
5. 11c2d? – 20cd
6. 4ab + 13bc
7. -5a2b2 – a62
8. 8x2 – x2 – 12x2 + 2x2
9. 16x²y – 4xy2 – 5x2y + 10xyz
10. Subtract -2x from -8x.
11. From 13xy2, subtract 21xy? 12. Subtract 17a_b from 2a4b.
Directions: Use the product rule to simplify the following monomials.
13. bº.64
14. (rºy5) (183,10)
15. 3a*.5a
16. 5a(-35)(-2a63)
17. 11(4cd)(-cd5)
18. (-xy3)(4x2y)
19. (-1563). (43*)
20. (Saľbe”). E abe
21. }(2a?b)(65")
22. (7a)(3ab) - 4a4b
23. (2y2)(4xy3) + (3xy+)(5y)
24. (2xy)(-4x2) + (6x)(6r?y)
25. (2ab?)(4a²b3) - (10a3b)(664)
© Gina Wilson (All Things Algebro. LLC), 2012-2013​

Answers

Final answer:

This set of problems revolves around simplifying monomials by adding, subtracting, and multiplying them. For example, the subtraction of -2x from -8x would simply result into -6x. A similar approach can be used for other problems.

Explanation:

The question primarily deals with exponents and exponential functions, specifically about simplifying monomials by using the rules of addition, subtraction, and multiplication. Additionally, it wants us to utilize the product rule to simplify further monomials. For instance if we look at problem 10, which asks to subtract -2x from -8x. The subtraction of a negative number is equivalent to addition. So, -8x - (-2x) becomes -8x + 2x which simplifies to -6x. This is just an example, and the similar approach can be used to solve the remainder of the problems.

Learn more about Simplifying Monomials here:

https://brainly.com/question/35532396

#SPJ6

If y(x) = 3(x+5) +-, what is
a + 2)?

Answers

Answer:

f(a + 2) = 3a + 21

Step-by-step explanation:

f(x) = 3(x+5)

x = a + 2

f(a + 2) = 3(a + 2 + 5)

f(a + 2) = 3(a + 7)

f(a + 2) = 3a + 21

It took Reza 2 hours to edit 6 math
problems. At that rate, how many math
problems could Reza edit in 45 hours?

Answers

Answer:

135

Step-by-step explanation:

My method 45 hours - 1  so i could divide by 2 because its 2 hours every 6 problems and 1 hour would be 3 math problems we can add that to the total

44 / 2 = 22, 22 * 6 = 132, 132 + 3 = 135

Alternate method

45 * 3 = 135

135
45/2 =22.5x 6 = 135

What is the lower quartile of 27,5,11,13,10,8,14,18,7 a. 7 b. 7.5 c. 8 d. 8.5

Answers

Answer:

Lower Quartile = 7.

Step-by-step explanation:

Given  : 27,5,11,13,10,8,14,18,7

To find : What is the lower quartile .

Solution : We have given 27, 5, 11, 13, 10, 8,  14 , 18 , 7.

Step 1 : Arrange in order

5 , 7 ,8 ,10 ,11, 13 , 14 ,18 , 27.

Step 2 : divide in to Quartile

Lower Q1 = 5 ,7 ,8

Middle Q2 = 10, 11 , 13.

Highest Q3 = 14 ,18 , 27.

Hence Lower Quartile = 7.

Therefore, Lower Quartile = 7.

Answer:

A=7!

Step-by-step explanation:

In A ABC and ARST, BC = 15, AC = 9, and RS = 6. Find the lengths of the missing sides of AABC and
ARST that would make a ABC ~ ARST by a scale factor of Include a sketch and show your work.

Answers

Picture how you show picture if it not paper to sketch on

The following system has a solution: x= 10,y=-3,z = 14
3x + 7y-z= -5
9x-y-4z = 17
5x - 12y-z=0

Answers

Answer:

3x + 7y - z = -5

Step-by-step explanation:

[tex]3(10) + 7(-3) - 14 = -5 \\ \\ 30 - 21 - 14 = -5[/tex]

I am joyous to assist you anytime.

Fill in the table using this function rule.
y=28 - 3x
X Y
1
3
4
6

Answers

Answer:

So, you just end up plugging in your numbers.

y = 28 - 3(1)

y = 28-3

y = 25

Y = 28 - 3(3)

y = 28 - 9

y = 19

y = 28 - 3x

y = 28 - 3(4)

y = 28 - 12

y = 16

y = 28 - 3x

y = 28 - 3(6)

y = 28 - 18

y = 10

Step-by-step explanation:

The completed table is:

X   Y

1   25

3   19

4   16

6   10

How to fill the table

To fill in the table using the function rule y = 28 - 3x, we can substitute the given values of x into the equation to find the corresponding values of y.

X Y

1 28 - 3(1) = 28 - 3 = 25

3 28 - 3(3) = 28 - 9 = 19

4 28 - 3(4) = 28 - 12 = 16

6 28 - 3(6) = 28 - 18 = 10

So, the completed table is:

X Y

1 25

3 19

4 16

6 10

For each value of x, we substituted it into the function rule and performed the necessary calculations to determine the corresponding value of y.

Learn more about function rule at

https://brainly.com/question/30139621

#SPJ6

What is -1/4 x (-8/9) in simplest form??

Answers

Answer:

The right answer is [tex]\frac{2}{9}[/tex].

Step-by-step explanation:

To multiply two fractions we multiply numerator by numerator and denominator by denominator. In this case:

[tex]\frac{-1}{4} x\frac{-8}{9} = \frac{8}{36}[/tex]

Notice that both numerator and denominator are divisible by 4. Dividing both by 4 we get [tex]\frac{8}{36} = \frac{2}{9}[/tex]  

The coordinates of the verticals of JKL are J(-2,1), K(-1,3) and L(-3,4). Can someone please check my answer?

Answers

Your answer is correct

Assume that a bacteria population doubles every second. Which of the following tables of data, with X representing time in seconds and y representing the count of bacteria, could represent the bacteria population with respect for time?
(answers in the pic)​

Answers

Answer: Table A

Step-by-step explanation:

Because it doubles every second. At 0s, its 3. Then at 1s, it doubles which means 3x2=6, which is in table. then at 2s, that doubles to 6x2=12....and so on

What is a interrogative sentence

Answers

Answer:

A sentence that has  or is conveying  a question.

Step-by-step explanation:

Answer:

Step-by-step explanation:

sentence that asks a question.

what is the numerical coefficient of the term 10x

Answers

Answer:

10

Step-by-step explanation:

10x = 10 · x =(10)(x)

The numerical coefficient of the term 10x is 10.

you are planting a vegetable garden with 10 rows. if it took 24 minutes to plant the first 3 rows, how many minutes will it take to plant all 10 rows of the garden

Answers

Answer:

it will take 80 minutes

Step-by-step explanation:

Total no.of rows=10

Time taken to plant 3 rows = 24 min

So,find time taken for planting 1 row

which is =24/3=8min

total time taken to plant 10 rows=8×10=80min

so it takes 80 min to plant 10 rows

Final answer:

It takes 8 minutes to plant one row of the garden and therefore to plant all 10 rows, it will take a total of 80 minutes.

Explanation:

This question is asking for the total time it would take to plant a garden with 10 rows of vegetables if it took 24 minutes to plant the first 3 rows. First, we need to understand how long it takes to plant one row. To find this out, we divide the total amount of time (24 minutes) by the number of rows planted in that time (3 rows). This gives us how long it takes to plant one row: 24 minutes ÷ 3 rows = 8 minutes per row. Now that we know this, we can work out how long it would take to plant all 10 rows. We do this by multiplying the time it takes to plant one row (8 minutes) by the total number of rows we need to plant (10 rows). This gives us the total time: 8 minutes per row x 10 rows = 80 minutes. So, it would take 80 minutes to plant all 10 rows of the garden.

Learn more about Time Calculation for Planting here:

https://brainly.com/question/34836483

#SPJ2

in the diagram below, <AFB = <EFD. if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)°, find m<AFE​

Answers

Answer:

m<AFE​ =  128°.

Step-by-step explanation:

Step 1: Find the value of x

Angle EFD + Angle DFC = Angle EFC

5x + 6 + 19x - 15 = 17x + 19

24x - 9 = 17x + 19

7x = 28

x = 4

Step 2: Find all angles

Angle AFB=Angle EFD= 5x + 6

5(4) + 6 = 26°

Angle DFC = 19x - 15

19(4) - 15 = 61°

Step 3: Find angle AFE

Line BD is a straight line and all angles on a straight line are equal to 180°.

Angle AFB + Angle AFE + Angle EFD = 180°

26 + BFC + 26 = 180°

BFC = 180 - 52

BFC = 128°

Therefore, m<AFE​ is equal to 128°.

!!

The measure of m<AFE  if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)° is 128degrees

Angle is the point where two or more lines meet. From the given diagram:

m<EFC = m<EFD + m<DFC

Given the following:

m<EFC = 17x + 19

m<EFD = 5x+6

m<DFC = 19x - 15

Substitute the given values into the expression

17x + 19 = 5x + 6 + 19x - 15

17x - 5x - 19x = -19 - 9

12x - 19x = -28

-7x = - 28

x = 28/7

x= 4

Get the angle m<AFE

m<AFE  + m<ABF + m<EFD = 180

Since  <AFB = <EFD

m<AFE  + m<EFD + m<EFD = 180

m<AFE + 2m<EFD = 180

m<AFE + 2(5x+6) = 180

m<AFE + 2(5(4) + 6) = 180

m<AFE +2(26) = 180

m<AFE + 52 = 180

m<AFE = 180 - 52

m<AFE = 128 degrees

Hence the measure of m<AFE is 128degrees

Learn more here: https://brainly.com/question/16686601

I can’t do math someone help me out lol 6.51-9.32+h=1.02

Answers

Answer:

h = 3.83

Step-by-step explanation:

Solve for h:

h - 2.81 = 1.02

Add 2.8100000000000005` to both sides:

h + (-2.81 + 2.81) = 2.81 + 1.02

2.81 - 2.81 = 0:

h = 1.02 + 2.81

1.02 + 2.81 = 3.83:

Answer: h = 3.83

What is bigger 5/12 or 4/7

Answers

Answer:

4/7

Step-by-step explanation:

Given 5/12 and 4/7

we see that a common denominator for both fractions could be 12 x 7 = 84, hence we can express both fractions with a denominator of 84

5/12 = (5/12) x (7/7) =  35/84

4/7 = (4/7) x (12/12) = 48/84

now comparing 35/84 and 48/84, we can see that 48/84 is larger, which corresponds to 4/7, hence 4/7 is larger

Need help ASAP 3 question. WILL GIVE BRAINLIEST

Answers

Answer:

Exact form: 11/125

Decimal Form: 0.088

Step-by-step explanation:

9(8d-5)+13=12d-2 solve with steps

Answers

Answer:

d=1/2

Step-by-step explanation:

9(8d-5)+13=12d-2

1) Use the distributive property:

72d-45+13=12d-2

2) Combine alike terms:

72d-32=12d-2

3) Add 32 to both sides:

72d=12d+30

4) Subtract 12d on both sides:

60d=30

5) Divide both sides by 60:

d=30/60

6) Simplify 30/60 to 1/2

What is the product 7,000 x 50 written as the product of a whole number and a power of 10 ?

Answers

Answer:

35,000^10

Step-by-step explanation:

multiply 7,000 and 50 first (350,000) then erase the last 0 (35,000) then raise it to 10 (35,000^10)

Solve the system of equations:
y = 2x - 5
y = x2 - 5​

Answers

Final answer:

To solve the system of equations y = 2x - 5 and y = x² - 5, use algebraic methods such as factoring or the quadratic formula to find the x-values. Then plug these values back into one of the original equations to find the corresponding y-values. The solutions to the system of equations are (5, 5) and (-2, -9).

Explanation:

To solve the system of equations y = 2x - 5 and y = x² - 5, we can set the two equations equal to each other since they both equal y. This gives us the quadratic equation x² - 2x - 10 = 0. We can solve this quadratic equation by factoring, completing the square, or using the quadratic formula.

Factoring the quadratic equation, we get (x - 5)(x + 2) = 0. This means that x - 5 = 0 or x + 2 = 0. Solving these two equations gives us x = 5 or x = -2. Substituting these values back into either of the original equations, we can find the corresponding y-values. For x = 5, y = 2(5) - 5 = 5. For x = -2, y = 2(-2) - 5 = -9. Therefore, the solutions to the system of equations are (5, 5) and (-2, -9).

Learn more about systems of equations here:

https://brainly.com/question/29050831

#SPJ12

How to use Distributive property for -3 (z+2)

Answers

Answer:

Step-by-step explanation:

First multiply the number outside of the parentheses (-3) by the first number inside the parentheses (z). Next you can do that same thing but with multiplying the number outside of the parentheses by the second number in the parentheses (2). Then you add your two answers, but since you have a variable in there you just put down the simplified version which is just your two products from before.

If every 9 Points Equals 1 Dollar How Many Points Do I Need To Make One Thousand Dollars?


First One To Answer Correctly Gets Brainliest!


It has to be correct.

pls hurry

Answers

Since 9 points is a dollar and you need a thousand dollars multiply 1000 by 9

9*1000=9000

Answer: 9,000$

Step-by-step explanation: if 9 = $1

You multiply 9 by $1,000 and get 9,000

The table shows the favorite subjects of students in a recent survey
Did more students choose art or math,Explain
Art:4/25
Math:0.28

Answers

Answer:

More students chose math

Step-by-step explanation:

4/25 can be converted into a percent and percents are out of 100, so 25x4 is equal to 100 and 4 x 4 is equal to 16

so 4/25 is 16%

    0.28 is 28%    Because you move the decimal to places to the right

A square painting measures 2 meters on each side. What is the area of the painting square centimeters?

Answers

Answer:

40,000cm

Step-by-step explanation:

there are 100cm in every meter, so each side of the square is 200cm long. to find the area multiply length times height (the length and the height are equal on a square)

200x200 = 40,000

Answer:

[tex]\boxed{\text{40 000 cm}^{2}}[/tex]

Step-by-step explanation:

A = l²

[tex]A = (\text{2 m})^{2} \times \left (\dfrac{\text{100 cm}}{\text{1 m}}\right )^{2} = \textbf{40 000 cm}^{2}\\\\\text{The area of the painting is $\boxed{\textbf{40 000 cm}^{2}}$}[/tex]

find the product 1/6 × 2/3

Answers

Answer:

1/9

Step-by-step explanation:

multiple the two top numbers then multiple the bottom numbers which equals 2/18 and in other forms is 1/9

Someone please help me with this question asap.

Answers

Answer:

-1<x<1 and 1<x

Step-by-step explanation:

We are asked to determine the interval in which our function shown in the graph has positive values.

In order to do so, we have to see for what values of x on x axis, the graph is above x axis.

As we can see in the graph, when we move from x = -1 towards right, the graph is above x axis. And towards left of x=-1 , the graph is below x axis. Hence answer is

-1<x<1 and 1<x

you are traveling on a bus to camp, which is 200 miles away, at 50 mph. The number of miles, n, that you have left to travel after t hours

Answers

The answer is 4 hours

The equation that represents the number of miles covered in time t will be n = 50t.

What is speed?

The distance covered by the particle or the body in an hour is called speed. It is a scalar quantity. It is the ratio of distance to time.

We know that the speed formula

Speed = Distance/Time

you are traveling on a bus to camp, which is 200 miles away, at 50 mph. The number of miles, n, that you have left to travel after t hours. Then the equation will be

50 = n / t

n = 50t

The equation that represents the number of miles covered in time t will be n = 50t.

More about the speed link is given below.

https://brainly.com/question/7359669

#SPJ6

Find the sum. Write the addition property you used. 28+29+42=

Answers

Step-by-step explanation:

28+29=57

57+42=99 so 99 should be your answer

Answer:

Step-by-step explanation:

First your gonna brake up each number and seperate them for example

28

29

42

then your going to add up the ones side, 8,9,2, to get 19.

Then your going to add the tens side, 2,2,4, to get 8.

take the one from 19 and put it in the tens place to get 9 in the tens and 9 in the ones.

put 9 and 9 together to get 99.

Other Questions
As a technician in a large pharmaceutical research firm, you need to produce 350. mL of 1.00 M potassium phosphate buffer solution of pH = 7.07. The pKa of H2PO4 is 7.21. You have the following supplies: 2.00 L of 1.00 M KH2PO4 stock solution, 1.50 L of 1.00 M K2HPO4 stock solution, and a carboy of pure distilled H2O. How much 1.00 M KH2PO4 will you need to make this solution? A slice of pizza has 500 kcal. If we could burn the pizza and use all the heat to warm a 50-L container of cold water, what would be the approximate increase in the temperature of the water? (Note: A liter of cold water weighs about 1 kg.)a.50C c.100Cb. 5C d.10C A 3 kg ball rolls off a 33 m high cliff, and lands 23 m from the base of the cliff. Express the displacement and the gravitational force in terms of vectors and calculate the work done by the gravitational force. Note that the gravitational force is < 0, -mg, 0 >, where g is a positive number (+9.8 N/kg). (Let the origin be at the base of the cliff, with the +x direction towards where the ball lands, and the +y direction taken to be upwards.) Which ancient civilization was not a part of northeastern Africa? Mali Kush Axum Egypt Write a program which asks the user to enter N numbers. The program will print out their average. Try your program with the following numbers: 20.5, 19.7, 21.3, 18.6 and 22.1 Find the equation of a line that is perpendicular to the line y=(1/3)x+4 and contains the point (-9,0)? Rope: 15 feet, cut 4 sections how long is each section of rope? If a is an integer, prove that (14a +3,21a + 4) 1 Suppose that y is directly proportional to x, and y = 150 when x = 15. What is the constant of proportionality? For what values of y : is the value of the binomial 5y1 greater than the value of the fraction 3y1/4PLEASE HELP ASAP A hypothetical element has an atomic weight of 48.68 amu. It consists of three isotopes having masses of 47.00 amu, 48.00 amu, and 49.00 amu. The lightest-weight isotope has a natural abundance of 10.0%. What is the percent abundance of the heaviest isotope? What are the two main types of audiences one would encounter when giving a speech? Jordan received 9 text messages last week.She received 3 times more text message this week than last week. How many text messages did Jordan received this week? Relative to prokaryotic cells, eukaryotic cells are usually ______. Relative to prokaryotic cells, eukaryotic cells are usually ______. larger and more complex smaller and more complex smaller and simpler larger and equally complex When trading with more developed countries, less developed countries have a comparative advantage in the production of all goods or services. less developed countries do not have a comparative advantage in the production of any goods or services. less developed countries have a comparative advantage in the production of some goods or services. A snack package has 4 cheese sticks. How many cheese sticks are in 4 packages? A scientist, Dr. Sigma, states that a chemical taken internally once a day will prevent the common cold. However, no other scientist is able to duplicate the results. The statement by Dr. Sigma is ___.a. a lawb. a hypothesisc. a theoryd. not valid What is the lateral area of the prism?A triangular prism has bases with three congruent sides,each measuring 4 feet. The height of each triangle isapproximately 3.5 feet. The distance between the triangularbases is 7 feet.73.5 feet73.5 square feet84 feet84 square feet4 ft What is the mass of a liquid having a density of 1.40g/ml and volume of 30ml Short-term financing transactions commonly occur in the: A. primary markets. B. secondary markets. C. capital markets. D. money markets