4. I'm the "brain" of the cell or so they say. I regulate activities from day to day...​

Answers

Answer 1

Answer:

nucleus

Explanation:

it holds information needed to regulate most of the cell functions

Answer 2

The 'brain' of the cell is the nucleus, which regulates cell activities by managing genetic material and essential functions like growth and protein synthesis. It ensures the proper functioning of the cell, similar to the role of the human brain, which controls both mental and physical processes.

The "brain" of the cell is commonly referred to as the nucleus. Like the human brain, which is the control center of the body, the nucleus regulates the activities of the cell. It holds the cell's genetic material and is responsible for managing activities such as growth, metabolism, protein synthesis, and cell division.

The human brain, on the other hand, controls mental processes such as reasoning, imagination, memory, and language as well as physical processes like breathing and heartbeat. Both the nucleus and the human brain are essential for the proper functioning of their respective systems.

A typical day in the life of a cell involves the nucleus sending instructions for protein synthesis, which are necessary for the cell to carry out specific functions. Without the nucleus, a cell would not be able to operate efficiently, just as without the human brain, a body could not function.


Related Questions

Explain how an owl captures energy from the sun when it eats a mouse​

Answers

Answer:

The mouse Eats plants that use the sun as a food source

Explanation:

Final answer:

An owl indirectly captures sun's energy by consuming a mouse, which has fed on plants that perform photosynthesis, illustrating energy transfer through a food chain.

Explanation:

An owl captures energy from the sun indirectly by eating a mouse. This process begins with plants using photosynthesis to convert solar energy into chemical energy stored within carbohydrate molecules. A mouse then eats these plants, and the energy from the plants is used to fuel the mouse's body. When an owl eats the mouse, it obtains this energy and transforms it through biochemical reactions to sustain its own life processes. This sequence illustrates energy transfer through a food chain, with the sun as the original energy source.

Learn more about Energy Transfer through Food Chain here:

https://brainly.com/question/15021598

#SPJ2

how many mol are in 8.23 x 10^24 formula units of calcium carbonate

Answers

Answer:

13.7 moles

Explanation:

Given data:

Number of moles calcium carbonate = ?

Formula units calcium carbonate= 8.23 × 10²⁴

Solution:

The given problem will solve by using Avogadro number.

It is the number of atoms , ions and molecules in one gram atom of element, one gram molecules of compound and one gram ions of a substance.

The number 6.022 × 10²³ is called Avogadro number.

For example,

18 g of water = 1 mole = 6.022 × 10²³ molecules of water

1.008 g of hydrogen = 1 mole = 6.022 × 10²³ atoms of hydrogen

For 8.23 × 10²⁴ formula units:

one mole = 6.022 × 10²³ formula units

8.23 × 10²⁴ formula units × 1 mole /6.022 × 10²³ formula units

13.7 moles

In an ionic crystal, these attract each other.
a. negative ions
b. positive and negative atoms
c. positive and negative ions
d. positive ions

Answers

C

Ionic crystals are made from ions that are bonded together by ionic bonds. An example is salt crystals that are made of sodium and chloride ions.  

Explanation:

An ionic bond is formed when one atom donates electrons to another atom so they both attain stable electron configuration. The two atoms are then bound by their acquired charges. For example sodium atom2.8.1) donates its valence electrons to chlorine atom (2.8.7). They both achieve stable electron configuration of 2.8  and 2.8,8 respectively. Because sodium ion will now have a positive charge (because it has more protons than electrons) and chloride ion will have a negative charge because it has more electrons than protons, the two are bonded together electrostatically forming ionic bonds.

Learn More:

For more on ionic bonds check out;

https://brainly.com/question/957239

https://brainly.com/question/2234173

#LearnWithBrainly

the mass-to charge ratio of the proton is found to be
[tex]1.044 \times {10}^{ - 8} kgc[/tex]
the charge on the proton is
[tex]1.602 \times {10}^{ - 19} c[/tex]
calculate the mass of the proton?

​​​​​​​​​​​​​​

Answers

Answer:

47 degrees

Explanation:

Answer:

47 degrees is your answer

What volume of 0.20MNaCl(aq) contains 10.0g of NaCl (molar mass 58g/mol)?

Answers

We have that for the Question "What volume of 0.20MNaCl(aq) contains 10.0g of NaCl (molar mass 58g/mol)?" it can be said that The volume of 0.20MNaCl(aq) contains 10.0g of NaCl (molar mass 58g/mol) is

V=0.862L

From the question we are told

What volume of 0.20MNaCl (aq) contains 10.0g of NaCl (molar mass 58g/mol)?

Generally the equation for the  morality  is mathematically given as

[tex]M=\frac{moles of NaCl}{Volume of sol}\\\\0.20=\frac{10/58}{V}\\\\[/tex]

V=0.862L

Therefore

The volume of 0.20MNaCl(aq) contains 10.0g of NaCl (molar mass 58g/mol) is

V=0.862L

For more information on this visit

https://brainly.com/question/23379286

Final answer:

To find the volume of 0.20 M NaCl solution containing 10.0 g of NaCl, calculate the number of moles of NaCl and divide by the molarity. It results in a volume of 0.862 liters.

Explanation:

To calculate the volume of 0.20 M NaCl solution that contains 10.0 g NaCl, we will begin by converting the mass of NaCl into moles. Next, we will use the molarity of the solution to find out the volume that contains these moles.

Step 1: Convert mass of NaCl to moles

Using the molar mass of NaCl (58 g/mol), we calculate the number of moles of NaCl:

Number of moles of NaCl = mass (g) / Molar mass (g/mol)
Number of moles of NaCl = 10.0 g / 58 g/mol
Number of moles of NaCl = 0.1724 mol

Step 2: Calculate the volume of the solution

Molarity (M) is defined as the number of moles of solute per liter of solution. We rearrange the molarity equation to solve for volume:

Volume (L) = Number of moles of solute / Molarity (M)
Volume (L) = 0.1724 mol / 0.20 M
Volume = 0.862 L

Therefore, 0.862 liters (or 862 milliliters) of 0.20 M NaCl solution contains 10.0 grams of NaCl.

Learn more about Molarity Calculations here:

https://brainly.com/question/15948514

#SPJ3

Three examples why cell division is important

Answers

Answer:

Cell division is important for growth,maintenance of proper chromosome number,wound healing

Explanation:

1 Cell division results in the formation of new cells which further undergo division to form new cells and so forth.Thus many cells are formed which are organized in tissues.Tissues then builds up organs and a number of organs builds up total body.

2 Cell division helps to maintain its chromosome number within the newly formed daughter cells.

3 Division of cells result in the formation of new cells in the site of wound and this accumalation of new cells in the wound region replace damaged and dead cells thus ultimately results in wound healing.

Guys, why is aluminum used for making aerocrafts and cooking pots?​

Answers

Answer:

Aluminium alloys are used extensively in aircraft due to their high strength-to-weight ratio.

Explanation:

Answer:because it is light and cheap

Explanation:

A 25.0 mL sample of H3PO4 requires 50.0 mL of 1.50 M NaOH for complete neutralization. What is the molarity of the acid?

Answers

Answer:

The molarity of acid is 3 M.

Explanation:

Given data:

Volume of H₃PO₄ = 25 mL

Volume of NaOH = 50 mL

Molarity of NaOH = 1.50 M

Molarity of  H₃PO₄ = ?

Solution:

Formula:

M₁V₁  =  M₂V₂

M₁ = M₂V₂ / V₁

M₁ = 1.50 M ×50 mL / 25 mL

M₁ = 75 M. mL / 25 mL

M₁ = 3 M

The molarity of acid is 3 M.

Final answer:

To determine the molarity of the acid, we can use the mole ratio between H3PO4 and NaOH in the neutralization reaction. By calculating the moles of NaOH used and using the mole ratio, we can find the moles of H3PO4. Finally, dividing the moles of H3PO4 by the volume of the sample gives us the molarity of the acid, which is 9.00 M.

Explanation:

In order to determine the molarity of the acid, we will use the equation:



H3PO4(aq) + 3NaOH(aq) → Na3PO4(aq) + 3H2O(l)



From the equation, we can see that the mole ratio between H3PO4 and NaOH is 1:3. Since 50.0 mL of 1.50 M NaOH was required to neutralize the 25.0 mL sample of H3PO4, we can calculate the moles of NaOH used:



Moles of NaOH = 1.50 M x 0.0500 L = 0.0750 mol



Since the mole ratio between H3PO4 and NaOH is 1:3, we can calculate the moles of H3PO4:



Moles of H3PO4 = 3 x 0.0750 mol = 0.225 mol



Finally, we can calculate the molarity of the acid by dividing the moles of H3PO4 by the volume of the sample:



Molarity = Moles/Volume = 0.225 mol/0.0250 L = 9.00 M

Learn more about Molarity of acids here:

https://brainly.com/question/32730049

#SPJ11

this means that if there are 15.0 g of starting chemicals, also known as

Answers

Answer:

Reactants

Explanation:

"Starting chemicals", the substances present before a reaction occurs, are called reactants.

The results of the reaction are called products, which you would also have 15.0g.

What causes the emission of radiant energy that produces characteristic spectral lines for a given element?​

Answers

Answer:

When electrons move from a higher energy level to a lower one, photons are emitted, and an emission line can be seen in the spectrum. Absorption lines are seen when electrons absorb photons and move to higher energy levels. ... An atom in its lowest energy level is in the ground state.

In an emission spectrum when an electron moves from higher energy level to lower energy level it causes emission of radiant energy that produces characteristic spectral lines for a given element.

What is an emission spectrum?

Emission spectrum is defined as a spectrum of a chemical compound or substance composed of frequencies of electromagnetic radiation. Radiations which are emitted while electron make transition from higher to lower energy level.

Energy of photon is equal to the difference between the two energy states . There are many possible electronic transitions in an atom and every transition has a specific wavelength.

Collection of different transitions with respect to different wavelengths makes up an emission spectrum.Emission spectrum of each element is unique and therefore spectroscopy is used to identify elements which are present in different substances.

Learn more about emission spectrum,here:

https://brainly.com/question/27268130

#SPJ2

PLEASE HELP ASAP
Half equation for zinc atoms changing into zinc ions

Answers

Answer:

Zn(s) -> Zn2+(aq) + 2e

Explanation:

Zinc atoms = no charge

Zinc ions = +ve charge

The process of half equation for zinc is called oxidation .

(oxidation means loss of electrons)

Balance the chemical equation below using the smallest possible whole number stoichiometric coefficients. C(s) + H2(g) --> C2H6(g)?

Answers

Answer:

2C(s) + 3H2(g) --> C2H6(g)

Answer: 2C(s) + 3H2(g) = C2H6(g)

Explanation:

In balancing chemical equations, the reactant must be equal to the product. I.e law of conservation of matter must hold.

2 moles of carbon would react with 3 moles of hydrogen to give 1 mole of methane

2C(s) + 3H2(g) = C2H6(g)

Oxidation for Na+Cl2>NaCl

Answers

Answer:

The oxidation state of sodium is +1 and chlorine is -1.

Explanation:

Oxidation:

Oxidation involve the removal of electrons and oxidation state of atom of an element is increased.

Reduction:

Reduction involve the gain of electron and oxidation number is decreased.

Consider the following reactions.

2Na + Cl₂ → 2NaCl

The oxidation state of chlorine and sodium on left side is 0. After the reaction between them oxidation state is changed. Sodium is oxidized and chlorine is reduced. The oxidation sate of sodium is +1 while that of chlorine is -1. Sodium is reducing agent while chlorine is oxidizing agent.

Oxidizing agents:

Oxidizing agents oxidize the other elements and itself gets reduced.

Reducing agents:

Reducing agents reduced the other element are it self gets oxidized.

What is the oxidation number of neon

Answers

Answer:

Electron Configuration and Oxidation States of Neon. Electron configuration of Neon is [He] 2s2 2p6. Possible oxidation states are 0. so the answer is 0.

Explanation:

Question 14(Multiple Choice Worth 5 points)
(01.03 LC)
Which of the following quantities for an object should be known to calculate its density?
The space it occupies
The heat present in it
O The force of gravity acting on the object
O How long it takes for an object to travel a certain distance

Answers

Final answer:

To calculate an object's density, you need to know its mass and volume. Mass measures the total quantity of matter, and volume measures the space it occupies. Density is found by dividing mass by volume.

Explanation:

To calculate the density of an object, you need to know two specific quantities: mass and volume. Mass is a measure of the total quantity of matter in the object and is often measured in grams or kilograms. Volume, on the other hand, is a measure of the space occupied by the object, which can be measured in cubic centimeters, liters, or other units of volume. Density is then calculated by dividing the mass by the volume of the object. Therefore, knowing the space it occupies and the total quantity of matter is essential for calculating density.

a sample of carbon monoxide gas occupies 150.0mL at 25.0 degrees Celsius. It is then cooled at a constant pressure until it occupies 100.0mL. What is the new temperature in degrees Celsius?

Answers

Answer:

T₂ = 16.7  °C

Explanation:

Given data:

Initial volume = 150.0 mL

Temperature = 25.0 °C

Final volume = 100 mL

Final temperature = ?

Solution:

V₁ /T₁ = V₂/T₂

T₂ = V₂ . T₁/V₁

T₂ = 100 mL .25 °C / 150.0 mL

T₂ = 2500 mL.  °C / 150.0 mL

T₂ = 16.7  °C

Final Answer:

Upon cooling from a volume of 150.0 mL to 100.0 mL at constant pressure, the temperature of the carbon monoxide gas is estimated to be approximately -74.4 °C, as determined using Charles's Law.

Explanation:

To ascertain the new temperature of carbon monoxide as it undergoes cooling from 150.0 mL to 100.0 mL at a constant pressure, Charles's Law is applied. Charles's Law asserts that the volume of a gas is directly proportional to its temperature when pressure remains constant, and this relationship can be expressed mathematically as V1/T1 = V2/T2, where V1 is the initial volume, T1 is the initial temperature, V2 is the final volume, and T2 is the final temperature.

Given an initial temperature (T1) of 25.0 °C, it needs conversion into kelvins by adding 273.15 to the Celsius temperature, resulting in T1 = 25 + 273.15 = 298.15 K. The initial volume (V1) is 150.0 mL, and the final volume (V2) is 100.0 mL. Utilizing Charles's Law, we can now determine the final temperature (T2).

Applying Charles's Law, we derive:

V1/T1 = V2/T2

(150.0 mL) / (298.15 K) = (100.0 mL) / (T2)

T2 = (100.0 mL) * (298.15 K) / (150.0 mL)

T2 = 198.7667 K

To express the temperature in Celsius, we subtract 273.15 from the temperature in kelvins:

T2 = 198.7667 K - 273.15

T2 ≈ -74.3833 °C

Thus, the new temperature of the carbon monoxide after cooling is approximately -74.4 °C.

When a plant is entering the Calvin cycle of photosynthesis_____.
A). light energy is required to proceed
B). light energy is not required to proceed
C). light energy and stored energy is required to proceed
D). light energy cannot be present to proceed

Answers

Answer:

The answer is B, light energy is not required to proceed

Explanation:

I got it right on my assignment

Answer:

light energy

Explanation:

A diamond is made of pure carbon. A 1.6-cm³ sample of diamond has a mass of 5.6 g.what is the density of carbon?

Answers

Answer:

d = 3.5 g/cm³

Explanation:

Density:

Density is equal to the mass of substance divided by its volume.

Units:

SI unit of density is Kg/m3.

Other units are given below,

g/cm3, g/mL , kg/L

Formula:

D=m/v

D= density

m=mass

V=volume

Symbol:

The symbol used for density is called rho. It is represented by ρ. However letter D can also be used to represent the density.

Given data:

Mass of diamond = 5.6 g

Volume = 1.6 cm³

Density = ?

Solution:

d = m/v

d = 5.6 g/ 1.6 cm³

d = 3.5 g/cm³

If you multiply an object's weight by its height, what value do you compute?

A. total momentum
B. gravitational potential energy
C. kinetic energy
D. nonconservative energy​

Answers

Answer: gravitational potential energy

Write a balanced equation for the transmutation that occurs when a scandium-48 nucleus undergoes beta decay.

Answers

Answer:

A scandium-48 nucleus undergoes beta-minus decay to produce a titanium-48 nucleus.

[tex]\rm ^{48}_{21}Sc \to ^{48}_{22}Ti + ^{\phantom{1}\,0}_{-1}e^{-} + \bar{\mathnormal{v}}_e[/tex].

Explanation:

There are two types of beta decay modes: beta-minus and beta-plus.

In both decay modes, the mass number of the nucleus stays the same.

However, in a beta-minus decay, the atomic number of the nucleus increases by one. In a beta-plus decay, the atomic number decreases by one.

Each beta-minus decay releases one electron and one electron antineutrino. Each beta-plus decay releases one positron and one electron neutrino.

Look up the atomic number and relative atomic mass for the element scandium.

The atomic number of [tex]\rm Sc[/tex] is [tex]21[/tex].The relative atomic mass of [tex]\rm Sc[/tex] is approximately [tex]45.0[/tex].

This question did not specify whether the decay here is beta-plus or a beta-minus. However, the relative atomic mass of this element can give a rough estimate of the mode of decay.

Each element (e.g, [tex]\rm Sc[/tex]) can have multiple isotopes. These isotopes differ in mass. The relative atomic mass of an element is an average  across all isotopes of this element. This mass is weighted based on the relative abundance of the isotopes. Its value should be closest to the most stable (and hence the most abundant) isotope.

The mass number of scandium-48 is significantly larger than the relative atomic mass of this element. In other words, this isotope contains more neutrons than isotopes that are more stable. There's a tendency for that neutron to convert to a proton- by beta-minus decay, for example.

The atomic number of the nucleus will increase by 1. [tex]21 + 1 = 22[/tex]. That corresponds to titanium. The mass number stays the same at [tex]48[/tex]. Hence the daughter nucleus would be titanium-48. Note that two other particles: one electron and one electron [tex]\rm e^{-}[/tex] and one antineutrino [tex]\bar{v}_{\text{e}}[/tex] (note the bar.) The neutrino helps balance the lepton number of this reaction.

The balanced equation for the transmutation that occurs when a scandium-48 nucleus undergoes beta decay is:[tex]\[ \ce{^48_21Sc - > ^48_22Ti + ^0_{-1}e} \][/tex]

  Beta decay is a type of radioactive decay in which a beta particle (an electron or a positron) is emitted from an atomic nucleus. In the case of scandium-48 [tex](\( \ce{^48_21Sc} \))[/tex], beta decay means that a neutron in the nucleus is converted into a proton, an electron (beta particle), and an electron antineutrino. The proton remains in the nucleus, increasing the atomic number by one, while the electron and antineutrino are emitted.

 The atomic number of scandium is 21, and after beta decay, the atomic number increases by one to become 22, which corresponds to the element titanium (Ti). The mass number (the total number of protons and neutrons in the nucleus) remains unchanged at 48 because a neutron is converted into a proton without any change in the number of nucleons.

 The symbol [tex]\( \ce{^0_{-1}e} \)[/tex] represents the beta particle, which is an electron. The charge of the electron is -1, and it has essentially no mass compared to a proton or neutron, hence the mass number being 0.

Therefore, the product of the beta decay of scandium-48 is titanium-48 [tex](\( \ce{^48_22Ti} \))[/tex], and the balanced equation includes the original nucleus, the resulting nucleus, and the emitted beta particle:

[tex]\[ \ce{^48_21Sc - > ^48_22Ti + ^0_{-1}e} \][/tex]

 This equation shows the conservation of mass and charge, which are fundamental principles in nuclear reactions. The mass number (48) is conserved, and the total charge is also conserved, with the scandium nucleus having a charge of +21, the titanium nucleus having a charge of +22, and the electron having a charge of -1, balancing the total charge before and after the decay.

PLEASE HELP WILL GIVE BRAINLIEST...
Match each of the unknown ions to its appropriate description.

1. Y3−
2. V2+
3. Z2−
4. X3+


a) A metal that lost two electrons

b) A metal that lost three electrons

c) A nonmetal that gained three electrons

d) A nonmetal that gained two electrons

Answers

Answer:

Y³⁻  A non metal that gained three electrons.

V²⁺ A metal that lost two electron

Z²⁻ A non metal that gained two electrons

X³⁺ A metal that lost three electrons

Explanation:

Metals lost the electrons and form cation

while non metals gain the electrons and form anion.

Y³⁻

c) A non metal that gained three electrons.

Non metal gain three electrons and form anion with the charge of -3.

V²⁺

a) A metal that lost two electron

A metal lost two electrons and form cation with charge of +2.

Z²⁻

d) A non metal that gained two electrons

A non metal that gained two electrons and form anion with charge of -2.

X³⁺

b) A metal that lost three electrons

A metal that lost three electrons and form cation with charge of +3.

Y³⁻  A non metal that gained three electrons.

V²⁺ A metal that lost two electron

Z²⁻ A non metal that gained two electrons

X³⁺ A metal that lost three electrons

What is the base ionization constant expression for ammonia?

Answers

Final answer:

The base ionization constant expression for ammonia is represented as NH3(aq) + H₂O(l) ⇌ NH4+(aq) + OH¯(aq). The ionization constant, Kb, can be calculated using the formula Kb = [NH4+][OH-] / [NH3]. This is important for understanding ammonia's behavior in various reactions and solutions.

Explanation:

The base ionization constant expression for ammonia (NH3), a weak base, is represented as follows: NH3(aq) + H₂O(l) ⇌ NH4+(aq) + OH¯(aq). In this case, the equilibrium of the ionization reaction of ammonia with water results in an ammonium ion (NH4+) and a hydroxide ion (OH-).

The ionization constant for this base is denoted as Kb. The specific value of Kb for ammonia can be found in tables of ionization constants for weak bases or calculated using the formula Kb = [NH4+][OH-] / [NH3], where the square brackets denote the equilibrium concentrations of the respective species.

The ionization of ammonia in water is a fundamental concept in acid-base chemistry and is vital for understanding its behavior in various chemical reactions and solutions.

Learn more about Ammonia Ionization here:

https://brainly.com/question/13977468

#SPJ12

Which tool is used to measure mass?

A:ruler
B:balance
C:graduated cylinder
D:liquid thermometer

Answers

Answer: c. balance

Explanation: Mass is the amount of matter contained in a body.

Relative and average atomic mass both describe properties of an element related to its different isotopes. Out of these two Relative atomic mas is more accurate. Therefore, the correct option is option B.

What is mass?

Mass defines the quantity of a substance. It is measured in gram or kilogram. Average mass is the mass of atoms of an element that are isotopes. It can be calculated by multiplying mass of a isotope to natural abundance of that isotope.

Average atomic mass = (mass of first isotope× percent abundance of first isotope)+(mass of second isotope× percent abundance of second isotope)

The relative mass is the mass that is with respect to mass of a matter that is considered as standard. In chemistry relative mass is equal to the mass of one-twelfth the mass of C-12 isotope . Balance is the tool that is used to measure mass.

Therefore, the correct option is option B.

To learn more about mass, here:

https://brainly.com/question/28704035

#SPJ5

7. HgO → Hg + O2
moles of oxygen?
0.5 moles of HgO decompose to produce how many moles of oxygen​

Answers

Answer:

0.5 moles of HgO will produced 0.25 moles of oxygen

Explanation:

Given data:

Number of moles of HgO = 0.5 mol

Number of moles of oxygen = ?

Solution:

Chemical equation;

2HgO   →  2Hg + O₂

WE will compare the moles of HgO with oxygen from balance chemical equation.

                                HgO        :         O₂

                                   2           :          1

                                    0.5       :          1/2×0.5 =0.25 mol

So 0.5 moles of HgO will produced 0.25 moles of oxygen.

When water freezes it forms a lattice pattern and

a. expands

b. sinks

c. evaporates

Answers

Answer:

A. expands

Ice molecules come closer together becoming more compact ^^

Please help!!
What is the reactant(s) in the chemical equation below?
Cu(s) + 2AgNO3(aq) → 2Ag(s) + Cu(NO3)2(aq)

A. 2Ag(s) + Cu(NO3)2(aq)
B. 2Ag(s)
C. Cu(s) + 2AgNO3(aq)
D. Cu(s)

Answers

Answer:

C ) Cu(s) + 2AgNO3(aq)

Explanation:

A chemical reaction is represented by a chemical equation which show the reactant and products. Reactants are written on left side of arrow while products are written on right side. The number of atoms are remain same however arrangement of atoms is different on both side.

For example:

Cu(s) + 2AgNO3(aq) →   2Ag + Cu(NO3)2

In this reaction Cu and AgNO3 are reactants while Ag and Cu(NO3)2 are products.The number of atoms are same on both side however arrangement of atoms is different.

Answer: A & C

Explanation:

How many molecules are in 2.34 mol H2O?

Answers

Answer:

Avogadro says one mole of particles contain 6.02 x 10^23 particles. Hence, 2 moles of water molecules contains 2 x 6.02 x 10^23 molecules.

Explanation:

Answer:

one mole of particles contain 6.02 x 10^23 particles. Consequently, 2 moles of water particles contain 2 x 6.02 x 10^23 atoms.

Explanation:

Maria wants to determine which type of disinfectant kills the most bacteria.

Which of the following is the best way for Maria to determine this

Answers

Answer:

well she can test both of the soap by putting one on and plate and another on the other plate and which ever is cleaner is your answer

In general, what is the effect of the number of energy levels on the radius of an atom

Answers

Answer:

The number of energy levels increased atomic radius also goes to increase.

Explanation:

Atomic radius  trend along period.

As we move from left to right across the periodic table the number of valance electrons in an atom increase. The atomic size tend to decrease in same period of periodic table because the electrons are added with in the same shell. When the electron are added, at the same time protons are also added in the nucleus. The positive charge is going to increase and this charge is greater in effect than the charge of electrons. This effect lead to the greater nuclear attraction. The electrons are pull towards the nucleus and valance shell get closer to the nucleus. As a result of this greater nuclear attraction atomic radius decreases and ionization energy increases because it is very difficult to remove the electron from atom and more energy is required.

Atomic radii trend along group:

As we move down the group atomic radii increased with increase of atomic number. The addition of electron in next energy level cause the atomic radii to increased. The hold of nucleus on valance shell become weaker because of shielding of electrons thus size of atom increased.

Final answer:

The number of energy levels in an atom affects its radius. Moving down a group increases the energy levels and atomic radius, while moving across a period increases the effective nuclear charge and decreases the atomic radius.

Explanation:

The number of energy levels in an atom has an effect on its radius. As we move down a group in the periodic table, the number of energy levels increases, leading to an increase in the atomic radius. As we move across a period, the number of energy levels remains the same, but the effective nuclear charge experienced by the electrons increases. This causes the electrons to be pulled in tighter to the nucleus and results in a decrease in the atomic radius.

Learn more about Effect of energy levels on atomic radius here:

https://brainly.com/question/12062232

#SPJ11

Determine which type of property each statement describes by typing “physical” or “chemical” in the blank.

Hydrogen is a colorless, tasteless, and odorless gas.

Hydrogen is very combustible in the presence of oxygen.

Hydrogen is very reactive with most elements.

Hydrogen is the least dense of all elements.

Answers

Answer:

Explanation:

Physical property:

Physical properties involve that property of matter which can be observed without changing the identity or undergoing chemical change or any other reaction. For example, taste, color, odor, density etc.

Chemical property:

Chemical properties observed during the chemical reaction. These properties changed the identity of substance.  For example, reactivity, stability, oxidation state, flammability etc.

A) Hydrogen is a colorless, tasteless, and odorless gas.

This statement shows the physical property of hydrogen.

B) Hydrogen is very combustible in the presence of oxygen.

This statement shows the chemical property of hydrogen

C) Hydrogen is very reactive with most elements.

This statement shows the chemical property of hydrogen

D) Hydrogen is the least dense of all elements.

This statement shows the physical property of hydrogen.

Answer:

for people doing ed

Explanation:

1. physical

2. chemical

3. chemical

4. physical

Other Questions
what is the slope for (12,5) (9,8) I need help putting these sentences in present progressive form. pleeeease help me1. Nosotros / practicar deportes2. Carmen / comer en casa3. Nuestro equipo / ganar el partido4. Yo / leer el peridico5. l / pensar comprar una bicicleta roja6. Ustedes / jugar a las cartas7. Jos y Francisco / dormir8. Marisa / leer el correo electrnico9. Yo / preparar sndwiches10. Carlos / tomar fotos11. dormir / t? A product modification differs from a line extension in that _______. The U.S. Congress enacted the CAN-SPAM Act in 2003. This act: a. limits advertisers from sending more than one ad per month per email address. b. does not view sending multiple spam emails with the use of a hijacked computer as an offense. c. prohibits the use of false or misleading subject lines on emails used for advertising. d. requires spammers to register with the Federal Trade Commission. All of the following statements are consistent with the kinetic molecular theory of gases EXCEPT: A. The gas molecules collide with each other and with the surfaces around them.B. Strong attractive forces hold the gas molecules together. C. The average kinetic energy of the molecules of a gas is proportional to the temperature of the gas in kelvins. D. The size of the gas molecules is negligible compared to the total volume of the gas. E. none of the above. What is a non-example of unit rate 14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line Linda says she values education. Over the years she has had several employees who worked for her and earned their degrees at the same time. To support them, Linda allowed them to flex their daily work hours. In this example, Linda demonstrates_____________. A 1.00-L gas sample at 100.C and 500. torr contains 52.0% helium and 48.0% xenon by mass. What are the partial pressures of the individual gases? Consider this simplified balance sheet for Geomorph Trading: Current assets $ 275 Current liabilities $ 210 Long-term assets 650 Long-term debt 205 Other liabilities 120 Equity 390 $ 925 $ 925 a. What is the companys debt-equity ratio? 6% of what number is 2.36 GEICO has decided that everyone will work in units with people who perform similar jobs. All of the procurement employees work in one department. All of the human resource employees work in one department and all of the printing employees work in the print shop. This type of structure is called_________. Consider the reaction 2Na(s) + 2H2O(l)2NaOH(aq) + H2(g) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 1.74 moles of Na(s) react at standard conditions. Ssurroundings = J/K g A two party political system is defined as having: a. two parties on the ballot c. two dominant parties with numerous minor parties b. three parties at any given time d. two minor parties with multiple dominant parties