A buret is filled with 0.1517 M naoh A 25.0 mL portion of an unknown acid and two drops of indicator are added to an Erlenmeyer flask, and the titration experiment is carried out. If the initial buret reading was 0.55 mL, and the buret reading at the end point was 22.50 mL, what is the molarity of the unknown acid?

Answers

Answer 1

Answer:

molarity of acid =0.0132 M

Explanation:

We are considering that the unknown acid is monoprotic. Let the acid is HA.

The reaction between NaOH and acid will be:

[tex]NaOH+HA--->NaA+H_{2}O[/tex]

Thus one mole of acid will react with one mole of base.

The moles of base reacted = molarity of NaOH X volume of NaOH

The volume of NaOH used = Final burette reading - Initial reading

Volume of NaOH used = 22.50-0.55= 21.95 mL

Moles of NaOH = 0.1517X21.95=3.33 mmole

The moles of acid reacted = 3.33 mmole

The molarity of acid will be = [tex]\frac{mmole}{volumne(mL)}=\frac{0.33}{25}=0.0132M[/tex]

Answer 2
Final answer:

The problem is about acid-base titration used in Chemistry. A 1:1 reaction between NaOH and the unknown acid is assumed. The molarity of the unknown acid is calculated as 0.1332 M.

Explanation:

This problem pertains to acid-base titration, a common method in Chemistry for determining the concentration of an unknown acid or base. The initial and final buret readings indicate the volume of NaOH used in the reaction: 22.50 mL - 0.55 mL = 21.95 mL, which is 0.02195 L. Using the molarity of NaOH (0.1517 M), we can find the moles of NaOH used: 0.1517 M * 0.02195 L = 0.00333 mol. Since the reaction between NaOH and the unknown acid is assumed to be 1:1, the moles of the unknown acid should also be 0.00333. Therefore, to obtain the molarity of the unknown acid, divide the moles of the acid by the volume of the acid in liters (25.0 mL = 0.025 L): 0.00333 mol / 0.025 L = 0.1332 M. Therefore, the molarity of the unknown acid is 0.1332 M.

Learn more about Acid-Base Titration here:

https://brainly.com/question/40172894

#SPJ12


Related Questions

Which of the following best describe the particles present in a 2.0 M aqueous solution of Al(NO3)3?2 M Al3+(aq) and 18 M NO3-(aq)2 M Al(NO3)3(aq)2 M Al3+(aq) and 6 M NO3-(aq)2 M Al3+(aq) and 3 M NO3-(aq)

Answers

Answer:

The correct answer is: 2M Al3+(aq) and 6 M NO3-(aq)

Explanation:

Step 1: Data given

2.0 M Al(NO3)3

Step 2:

Al(NO3)3 in water will dissociate as following:

Al(NO3)3 → Al^3+ + 3NO3^-

For 1 mol of Al(NO3)3 we will have 1 mol of Al^3+ and 3 moles of NO3^-

We know that the molarity of Al(NO3)3 = 2.0 M, this means 2.0 mol/ L

The mol ratio Al(NO3)3 and Al^3+ is 1:1 so the molarity of Al^3+ is 2.0 M

The mol ratio Al(NO3)3 and NO3^- is 1:3 so the molarity of NO3^- is 6.0M

The correct answer is: 2M Al3+(aq) and 6 M NO3-(aq)

Which of the following statements about organic chemistry is correct? Be careful, there may only be one word incorrect.
a. Organic compounds only contain carbon and hydrogen.
b. In a condensed structural formula, each carbon atom and its attached hydrogen atoms are written as a group in linear form.
c. Alkanes are a type of organic compound that have at least one multiple bond between two carbon atoms.
d. The different arrangements of alkanes, known as conformations, are the three-dimensional rotation around the double bond.

Answers

In "condensed structural formula" each carbon atom and its attached hydrogen atoms are written in group in the linear form is correct about organic chemistry.

Option B

Explanation:

"condensed structural formula" is a method of writing or presenting organic structures in line of text. It presents all the atoms, but excludes the vertical bonds and all the horizontal single bonds. In condensed structural formula, or we can say semi-structural formula, covalent bonds are not always presented or shown. When the formula or representation is written in line with covalent bonds being shown, then it is referred to as linear formula. For example- the condensed structural formulas of ethane, propane, and ethanol is written as follows:-  

[tex]\mathrm{CH}_{3} \mathrm{CH}_{3},\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{3},\text { and } \mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{OH}[/tex]

Apart from these Statement, all others are false because they do not have any logic with respect to organic chemistry.

The correct statement about organic chemistry is:  Alkanes are a type of organic compound that have at least one multiple bond between two carbon atoms.

The correct answer is option C.

a. Organic compounds typically contain carbon and hydrogen, but they can also include other elements like oxygen, nitrogen, sulfur, and more. So, the word "only" in this statement is incorrect.

b. In a condensed structural formula, each carbon atom and its attached hydrogen atoms are typically written as a group, but the arrangement isn't necessarily linear. It represents a simplified way to depict the structure of organic compounds, but the linear form is not a strict requirement. The statement is generally correct but could be misleading due to the term "linear."

c. Alkanes are a type of organic compound that consists of single bonds between carbon atoms, not multiple bonds. The statement is correct.

d. Conformations in organic chemistry refer to the different three-dimensional arrangements of atoms or groups around single bonds, such as in alkanes. The statement is incorrect because it mistakenly refers to the "double bond," which is not characteristic of alkanes.

In summary, statement (c) is the correct one. Alkanes are indeed organic compounds with only single bonds between carbon atoms. The other statements have minor inaccuracies or incorrect terms that make them less precise or entirely incorrect.

For more such information on: organic chemistry

https://brainly.com/question/704297

#SPJ3

Tarnish on copper is the compound CuO. A tarnished copper plate is placed in an aluminum pan of boiling water. When enough salt is added so that the solution conducts electricity, the tarnish disappears. Imagine that the two halves of this redox reaction were separated and connected with a wire and a salt bridge.

Calculate the standard cell potential given the following standard reduction potentials:

Al3++3e-?Al; E?=?1.66 V
Cu2++2e-?Cu; E?=0.340 V

Answers

Answer:  2.00 V

Explanation:

The balanced redox reaction is:

[tex]2Al+3Cu^{2+}\rightarrow 2Al^{3+}+3Cu[/tex]

Here Al undergoes oxidation by loss of electrons, thus act as anode. Copper undergoes reduction by gain of electrons and thus act as cathode.

[tex]E^0=E^0_{cathode}- E^0_{anode}[/tex]

Where both [tex]E^0[/tex] are standard reduction potentials.

[tex]Al^{3+}+3e^-\rightarrow Al[/tex] [tex]E^0_{[Al^{3+}/Al]}=-1.66V[/tex]

[tex]Cu^{2+}+2e^-\rightarrow Cu[/tex] [tex]E^0_{[Cu^{2+}/Cu]}=0.340V[/tex]

[tex]E^0=E^0_{[Cu^{2+}/Cu]}- E^0_{[Al^{3+}/Al]}[/tex]

[tex]E^0=+0.34- (-1.66V)=2.00V[/tex]

Thus the standard cell potential is 2.00 V

Consider the dissolution of AB(s):AB(s)⇌A+(aq)+B−(aq)Le Châtelier's principle tells us that an increase in either [A+] or [B−] will shift this equilibrium to the left, reducing the solubility of AB. In other words, AB is more soluble in pure water than in a solution that already contains A+ or B− ions. This is an example of the common-ion effect.The generic metal hydroxide M(OH)2 has Ksp = 1.05×10−18. (NOTE: In this particular problem, because of the magnitude of the Ksp and the stoichiometry of the compound, the contribution of OH− from water can be ignored. However, this may not always be the case.)What is the solubility of M(OH)2 in pure water?

Answers

Answer:

S = 6.40 × 10⁻⁷ M

Explanation:

In order to calculate the solubility (S) of M(OH)₂ in pure water we will use an ICE Chart. We recognize 3 stages: Initial, Change and Equilibrium, and we complete each row with the concentration or change in concentration.

            M(OH)₂(s) ⇄ M²⁺(aq) + 2 OH⁻(aq)

I                                   0                  0

C                                 +S               +2S

E                                   S                 2S

The solubility product (Kps) is:

Kps = 1.05 × 10⁻¹⁸ = [M²⁺].[OH⁻]²=S.(2S)²

1.05 × 10⁻¹⁸ = 4S³

S = 6.40 × 10⁻⁷ M

A metal sample weighing 129.00 grams and at a temperature of 97.8 degrees Celsius was placed in 45.00 grams of water in a calorimeter at 20.4 degrees Celsius. At equilibrium the temperature of the water and metal was 39.6 degrees Celsius. Calculate the specific heat of the metal. The specific heat of the water is 4.184 J/g/C

Answers

Answer : The specific heat of metal is [tex]0.481J/g^oC[/tex].

Explanation :

In this problem we assumed that heat given by the hot body is equal to the heat taken by the cold body.

[tex]q_1=-q_2[/tex]

[tex]m_1\times c_1\times (T_f-T_1)=-m_2\times c_2\times (T_f-T_2)[/tex]

where,

[tex]c_1[/tex] = specific heat of metal = ?

[tex]c_2[/tex] = specific heat of water = [tex]4.184J/g^oC[/tex]

[tex]m_1[/tex] = mass of metal = 129.00 g

[tex]m_2[/tex] = mass of water = 45.00 g

[tex]T_f[/tex] = final temperature = [tex]39.6^oC[/tex]

[tex]T_1[/tex] = initial temperature of metal = [tex]97.8^oC[/tex]

[tex]T_2[/tex] = initial temperature of water = [tex]20.4^oC[/tex]

Now put all the given values in the above formula, we get

[tex]129.00g\times c_1\times (39.6-97.8)^oC=-45.00g\times 4.184J/g^oC\times (39.6-20.4)^oC[/tex]

[tex]c_1=0.481J/g^oC[/tex]

Therefore, the specific heat of metal is [tex]0.481J/g^oC[/tex].

Final answer:

To calculate the specific heat of the metal, the heat transfer equation q=mcΔT is used. By setting the heat lost by the metal equal to the heat gained by the water, and substituting the known values into the equation, we can solve for the specific heat of the metal.

Explanation:

The specific heat of a metal can be calculated by using the concept of heat transfer, where heat lost by the metal is equal to the heat gained by the water in a calorimetry experiment. The equation is q = mcΔT, where q is the heat transfer, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature. For the water, the heat gained can be calculated as qwater = mwatercwaterΔTwater. For the metal, the heat lost is qmetal = mmetalcmetalΔTmetal. Given that the heat lost by the metal equals the heat gained by the water, the equation can be set up to solve for the specific heat of the metal, cmetal = (qwater / (mmetalΔTmetal)). We know the following: mwater = 45.00 g, cwater = 4.184 J/g/C, ΔTwater = final temperature - initial temperature of water, mmetal = 129.00 g, ΔTmetal = initial temperature of metal - final temperature. By substituting these values into the equation, we can find the specific heat of the metal.

Identify the option that is not a characteristic of esters:

1.They are prepared by reacting acids with alcohols.

2.They each contain a carbonyl group with an attached oxygen atom that is bonded to a carbon substituent.

3.They are responsible for the odors and flavors of many flowers, perfumes, and ripe fruits.

4.They are prepared by reducing alcohols or aldehydes whose -OH functional group is located on the carbon atom in the middle of the carbon chain.

Answers

Answer:

Option 4 is not the characteristics of esters

Explanation:

Esters :

They are organic compound derived from an organic or inorganic acid. in which one Hydroxyl (OH) group is replaced by an organic alkoxy (-O-R) group.

General formula of Esters:

Easter can be represented by a general formula that is

                                       RCOOR

where R is any alkyl group

No to look at the characteristics of the Esters an find out the odd one option that is not correct.

Option 1 is the characteristics of esters.

Esters are obtained from the reaction of carboxylic acid and an alcohol.

          CH₃COOH + CH₃OH -------------> CH₃COOCH₃ + H₂O

Option 2 is the characteristics of esters.

This option is also correct as if we see at its general formula

The carbonyl group attached to an Oxygen atom and this oxygen is attached to carbon of alkyl group

                                  O==C------OR

Option 3 is also the characteristics of esters

The odors and flavors of many flowers, perfumes, and ripe fruits is due to the presence of ester. as ester have now hydrogen bonding and low vapor pressure and highly volatile that's why it is responsible for odors.

Option 4 is not the characteristics of esters

This option is wrong, as the carbon atom in the middle of the carbon chain can not be easy to replace, also the carbonyl carbon is directly attached to oxygen group and not Carbon group.                    

What change occurs during the reaction:MnO4- --->Mn2+?Five electrons are lost.Three electrons are lost.Five electrons are gained.Three electrons are gained.

Answers

Answer:

Five electrons are gained.

Explanation:

Oxidation number or oxidation state of an atom in a chemical compound is  the number of electrons lost or gained. It is also defined as the degree of oxidation of the atom in the compound.

This is a theoretical number which can help to decipher the oxidation and reduction in a redox reaction.

Oxidation is the loss of electrons. The specie which is oxidized has has elevation in its oxidation state as compared in the reactant and the products.

The given reaction is shown below as:

[tex]MnO_4^-\rightarrow Mn^{2+}[/tex]

Manganese in [tex]MnO_4^-[/tex] has oxidation state of +7

Manganese in [tex]Mn^{2+}[/tex] has an oxidation state of +2

It reduces from +7 to +2 . It means that 5 electrons are gained.

The vapor pressure of the liquid SO2 is measure at different temperatures. the following vapor pressure data are obtained.Temp (K) Pressure mmHg241.3 271.2259.3 641.8Calculate the enthalpy of vaporization(delta H vap) in KJ/mol for this liquid.

Answers

Answer:

24.895 kJ/mol

Explanation:

The expression for Clausius-Clapeyron Equation is shown below as:

[tex]\ln P = \dfrac{-\Delta{H_{vap}}}{RT} + c [/tex]

Where,  

P is the vapor pressure

ΔHvap  is the Enthalpy of Vaporization

R is the gas constant (8.314 J /mol K)

c is the constant.

For two situations and phases, the equation becomes:

[tex]\ln \left( \dfrac{P_1}{P_2} \right) = \dfrac{\Delta H_{vap}}{R} \left( \dfrac{1}{T_2}- \dfrac{1}{T_1} \right)[/tex]

Given:

[tex]P_1[/tex] = 271.2 mmHg

[tex]P_2[/tex] = 641.8 mmHg

[tex]T_1[/tex] = 241.3 K  

[tex]T_2[/tex] = 259.3 K

So,  

[tex]\ln \:\left(\:\frac{271.2}{641.8}\right)\:=\:\frac{\Delta \:H_{vap}}{8.314}\:\left(\:\frac{1}{259.3}-\:\frac{1}{241.3}\:\right)[/tex]

[tex]\Delta \:H_{vap}=\ln \left(\frac{271.2}{641.8}\right)\frac{8.314}{\left(\frac{1}{259.3}-\:\frac{1}{241.3}\right)}\ J/mol[/tex]

[tex]\Delta \:H_{vap}=\left(-\frac{520199.41426}{18}\right)\left(\ln \left(271.2\right)-\ln \left(641.8\right)\right)\ J/mol[/tex]

ΔHvap = 24895.015 J/mol = 24.895 kJ/mol ( 1 J = 0.001 kJ )

Final answer:

This detailed answer explains how to calculate the enthalpy of vaporization for liquid SO2 using the Clausius-Clapeyron equation and vapor pressure data at different temperatures.

Explanation:

The enthalpy of vaporization (ΔHvap) can be calculated using the Clausius-Clapeyron equation:

In this case, the enthalpy of vaporization for SO2 can be calculated using the given vapor pressure data at different temperatures:

Convert temperatures to Kelvin.

Use the Clausius-Clapeyron equation to find ΔHvap.

By applying the equation with the provided data, the calculated enthalpy of vaporization for liquid SO2 is 24.895 kJ/mol.

Standard Reduction Potentials in Aqueous Solution at 25 °C

Acidic Solution (V) 1.77 1.68 1.50 1.08 0.96 0.799 0.789 0.337 0.27
–0.14 –0.25 –0.28 –0.41 –0.44 –0.763 –0.91 –1.66 –2.37

Which metal ion from the selection is the weakest oxidizing agent? Which metal ion from the selection is the strongest oxidizing agent? Which metal from the selection is the strongest reducing agent? Which metal from the selection is the weakest reducing agent? Will reduce to ? yes no Will reduce to ? yes no Which metal from the selection can be oxidized by ?

Answers

Answer:

Hope this helps:)

Explanation:

The values for the table entries are reduction potentials, so lithium at the top of the list has the most negative number, indicating that it is the strongest reducing agent. The strongest oxidizing agent is fluorine with the largest positive number for standard electrode potential.

Elemental fluorine, for example, is the strongest common oxidizing agent.

Lithium metal is therefore the strongest reductant (most easily oxidized) of the alkali metals in aqueous solution. The standard reduction potentials can be interpreted as a ranking of substances according to their oxidizing and reducing power

Carboxylic acids boil at considerably higher temperatures than do alcohols, ketones, or aldehydes of similar molecular weights. This is because they: A. have a greater oxygen content. B. are more acidic. C. form stable hydrogen-bonded dimers. D. are hydrophobic. E. none of the above

Answers

Answer:

The correct option is: C. form stable hydrogen-bonded dimers

Explanation:

Boiling point is the temperature at which a particular substance changes from liquid state to vapor state.

The boiling point of a chemical substance depends upon the intermolecular forces present between the molecules.

Carboxylic acids are the organic molecules containing carboxyl functional group (COOH). They tend to have greater boiling point than alcohols, ketones, or aldehydes.

This is because only carboxylic acids are capable of forming dimers that are stabilized by hydrogen bonding.

An atom of 105In has a mass of 104.914558 amu. Calculate the binding energy in MeV per NUCLEON. Enter your answer with 3 significant figures and no units. Use the masses:
mass of 1H atom = 1.007825 amu
mass of a neutron = 1.008665 amu
1 amu = 931.5 MeV

Answers

Answer:

8.46

Explanation:

Atomic number : It is defined as the number of electrons or number of protons present in a neutral atom.

Also, atomic number of I = 549

Thus, the number of protons = 49

Mass number is the number of the entities present in the nucleus which is the equal to the sum of the number of protons and electrons.

Mass number = Number of protons + Number of neutrons

105 =  49 + Number of neutrons

Number of neutrons = 56

Mass of neutron = 1.008665 amu

Mass of proton = 1.007825 amu

Calculated mass = Number of protons*Mass of proton + Number of neutrons*Mass of neutron

Thus,

Calculated mass = (49*1.007825 + 56*1.008665) amu = 105.868665 amu

Mass defect = Δm = |105.868665 - 104.914558| amu = 0.954107 amu

The conversion of amu to MeV is shown below as:-

1 amu = 931.5 MeV

So, Energy = 0.954107*931.5 MeV/atom = 888.750671 MeV/atom

Also, 1 atom has 105 nucleons (Protons+neutrons)

So, Energy = 888.750671 MeV/105nucleons = 8.46 MeV/nucleon

Answer:- 8.46

Final answer:

The binding energy per nucleon for an atom of 105In is calculated by determining the mass defect, converting it to energy using Einstein's mass-energy equivalence, and dividing by the number of nucleons.

Explanation:

To calculate the binding energy per nucleon in MeV for an atom of 105In with a mass of 104.914558 amu, we must first identify the number of protons and neutrons in the nucleus. Indium-105 has 49 protons (since In is the element with atomic number 49), and subtracting this from the mass number 105 gives us 56 neutons. The mass of the protons is 49 x 1.007825 amu, and the mass of the neutrons is 56 x 1.008665 amu.

Next, we calculate the mass defect by subtracting the atomic mass of the 105In from the combined mass of the protons and neutrons. To convert the mass defect into energy, we multiply by 931.5 MeV/amu, according to Einstein’s mass-energy equivalence principle (E=mc2). Lastly, we divide this energy by the total number of nucleons (protons + neutrons) to find the binding energy per nucleon.

You are running a rather large scale reaction where you prepare the grignard reagent phenylmagnesium bromide by reacting 210.14 grams of magnesium with 772 ml of bromobenzene. How many moles of grignard reagent would you expect to form? (the density of bromobenzene is 1.495 g/ml, Mg = 24.3 g/mol, bromobenzene=157.01 g/mol)

Answers

Answer:

We would expect to form 7.35 moles of grignard reagent.

Explanation:

Step 1: Data given

Mass of magnesium = 210.14 grams

Volume bromobenzene = 772 mL

Density of bromobenzene = 1.495 g/mL

Molar mass of Mg = 24.3 g/mol

Molar mass of bromobenzene = 157.01 g/mol

Step 2: The balanced equation

C6H5Br + Mg ⇒ C6H5MgBr

Step 3: Calculate mass of bromobenzene

Mass bromobenzene = density bromobenzene * volume

Mass bromobenzene = 1.495 g/mL * 772 mL

Mass bromobenzene = 1154.14 grams

Step 4: Calculate number of moles bromobenzene

Moles bromobenzene = mass bromobenzene / molar mass bromobenzene

Moles bromobenzene = 1154.14g / 157.01 g/mol

Moles bromobenzene = 7.35 moles

Step 5: Calculate moles of Mg

Moles Mg = 210.14 grams /24.3 g/mol

Moles Mg = 8.65 moles

Step 6: The limiting reactant

The mole ratio is 1:1 So the bromobenzene has the smallest amount of moles, so it's the limiting reactant. It will be completely consumed ( 7.35 moles). Magnesium is in excess, There will react 7.35 moles. There will remain 8.65 - 7.35 = 1.30 moles

Step 7: Calculate moles of phenylmagnesium bromide

For 1 mole of bromobenzene, we need 1 mole of Mg to produce 1 mole of phenylmagnesium bromide

For 7.35 moles bromobenzene, we have 7.35 moles phenylmagnesium bromide

We would expect to form 7.35 moles of grignard reagent.

Cytochromes are critical participants in the electron transport chains used in photosynthesis and cellular respiration. How do cytochromes donate and accept electrons?
1) Every cytochrome's iron‑containing heme group accepts electrons from oxygen and donates the electrons to the next cytochrome in the chain.
2) The cytochromes donate electrons excited by photons to other cytochromes that accept electrons as replacements for lost electrons.
3) Cytochromes donate electrons directly to the energy‑carrier molecules and and accept electrons from less electronegative substances.
4) Each cytochrome has an iron‑containing heme group that accepts electrons and then donates the electrons to a more electronegative substance.

Answers

Answer:

4) Each cytochrome has an iron‑containing heme group that accepts electrons and then donates the electrons to a more electronegative substance.

Explanation:

The cytochromes are proteins that contain heme prosthetic groups. Cytochromes undergo oxidation and reduction through loss or gain of a single electron by the iron atom in the heme of the cytochrome:

[tex]Cytochrome-Fe²⁺ ⇄ cytochrome-Fe³⁺-e⁻[/tex]

The reduced form of ubiquinone (QH₂), an extraordinarily mobile transporter, transfers electrons to cytochrome reductase, a complex that contains cytochromes b and c₁, and a Fe-S center. This second complex reduces cytochrome c, a water-soluble membrane peripheral protein. Cytochrome c, like ubiquinone (Q), is a mobile electron transporter, which is transferred to cytochrome oxidase. This third complex contains the cytochromes a, a₃ and two copper ions. Heme iron and a copper ion of this oxidase transfer electrons to O₂, as the last acceptor, to form water.

Each transporter "downstream" is more electronegative than its neighbor "upstream"; oxygen is located in the inferior part of the chain. Thus, the electrons fall in an energetic gradient in the electron chain transport to a more stable localization in the electronegative oxygen atom.

Consider a sample of helium gas in a container fitted with a piston as pictured below. The piston is frictionless, but has a mass of 10.0 kg. How many of the following processes will cause the piston to move away from the base and decrease the pressure of the gas? Assume ideal behavior.
I. Heating the helium.
II. Removing some of the helium from the container.
III. Turning the container on its side.
IV. Decreasing the pressure outside the container.
a) 0
b) 1
c) 2
d) 3
e) 4

Answers

Answer:

I. heating the helium

Explanation:

Final answer:

(I) Heating the helium and (IV) decreasing the pressure outside the container are the two processes that will cause the piston to move away from the base and decrease the pressure of the gas. Hence, (c) is the correct option.

Explanation:

Assuming ideal gas behavior, the question asks which processes will lead the piston to travel away from the base and lower the helium gas's pressure. Let's examine each of the scenarios that are presented:

I. Heating the helium: Heating increases the internal energy of the gas molecules, making them move faster. This increases the force they exert against the piston, pushing it outward and increasing the volume, thus reducing the pressure according to Boyle's Law (P₁V₁ = P₂V₂).

II. Removing some of the helium from the container: If you remove some of the helium, there will be fewer molecules to exert force on the piston, leading to a decrease in pressure. However, the piston will not necessarily move since the external pressure remains the same. Without a corresponding change in external pressure, there is no force to move the piston outward.

III. Turning the container on its side: Turning the container on its side will have no effect on the pressure or volume of the gas if the external conditions remain the same. The position of the piston is influenced by forces and pressures, not by its orientation in space.

IV. Decreasing the pressure outside the container: Decreasing the external pressure acting on the piston will allow the internal pressure of the gas to push the piston outward, increasing the volume and therefore decreasing the gas pressure, as explained by the ideal gas law (PV = nRT).

Therefore, the processes that will cause the piston to move away from the base and decrease the pressure of the gas are heating the helium and decreasing the pressure outside the container. So the correct answer to the question is (c) 2.

For each reaction, find the value of ΔSo. Report the value with the appropriate sign. (a) 3 NO2(g) + H2O(l) → 2 HNO3(l) + NO(g)

Answers

Answer:

ΔS° = -268.13 J/K

Explanation:

Let's consider the following balanced equation.

3 NO₂(g) + H₂O(l) → 2 HNO₃(l) + NO(g)

We can calculate the standard entropy change of a reaction (ΔS°) using the following expression:

ΔS° = ∑np.Sp° - ∑nr.Sr°

where,

ni are the moles of reactants and products

Si are the standard molar entropies of reactants and products

ΔS° = [2 mol × S°(HNO₃(l)) + 1 mol × S°(NO(g))] - [3 mol × S°(NO₂(g)) + 1 mol × S°(H₂O(l))]

ΔS° = [2 mol × 155.6 J/K.mol + 1 mol × 210.76 J/K.mol] - [3 mol × 240.06 J/K.mol + 1 mol × 69.91 J/k.mol]

ΔS° = -268.13 J/K

Final answer:

The entropy change ΔSo for a reaction can be obtained by considering the sum of decompositions and formations of reactants and products. In this scenario, while we were only able to compute the enthalpy change ΔHxn of -136.80 kJ, the entropy change, ΔSo, cannot be calculated without additional data.

Explanation:

To find the entropy change ΔSo for the reaction 3 NO2(g) + H2O(l) → 2 HNO3(l) + NO(g), we start by writing this as the sum of decompositions of 3NO₂(g) and 1H₂O(1) into their constituent elements. Similarly, we identify the formation of 2HNO3(aq) and 1NO(g) from their constituent elements. By summing the enthalpy changes obtained from standard enthalpy changes of formation (ΔHf) for these compounds, we find the result for ΔHxn, which in this case equates to -136.80 kJ. However, the original question asked for ΔSo, not ΔHxn. Without knowing the ΔSo for the individual substances in this reaction, we cannot calculate ΔSo for the entire reaction.

Learn more about Entropy Change here:

https://brainly.com/question/32484278

#SPJ3

In the water molecule, the H-O-H bond angle is 105º. Which distribution of electrons around the central atom provides the best explanation for this bond angle?

4 shared pairs
2 shared pairs, 2 lone pairs
1 shared pair, 3 lone pairs
3 shared pairs, 1 lone pair

Answers

Final answer:

The water molecule has an H-O-H bond angle of 104.5° which is due to the central oxygen atom having 2 shared pairs and 2 lone pairs of electrons, resulting in a bent molecular geometry due to the repulsion of lone pairs and sp³ hybridization.

Explanation:

The bond angle in a water molecule is closer to 104.5° rather than the stated 105°, and the distribution of electrons around the central oxygen atom that best explains this bond angle is 2 shared pairs, 2 lone pairs.

In the water molecule, the central oxygen atom is sp³ hybridized, with its four hybrid orbitals occupied by two lone pairs of electrons and two bonding pairs that form covalent bonds with hydrogen atoms.

Lone pairs require more space than bonding pairs, which leads to a repulsion that pushes the hydrogen atoms closer together, resulting in the H-O-H bond angle being slightly less than the ideal 109.5° angle of a tetrahedron.

Complexes containing metals with d10 electron configurations are typically colorless because:

a) there are no d electrons to form bonds to ligands.

b) here is no d electron that can be promoted via the absorption of visible light.

c) d electrons must be emitted by the complex in order for it to appear colored.

d) a complex must be charged to be colored.

Answers

Answer:

d

Explanation:

The complexes that involve metal having d10 electrons arrangement are usually colorless because:

A). There is no d electron that can be promoted via the absorption of visible light.

The reason for which the complexes that have been made with metal possessing electron configuration of d10 being colorless is that no d electron could be encouraged through absorption of viewable light.The absence of d electron will result in leaving the arrangement to remain colorless.The key cause of d electrons' absence is that no d electron could be inspired for absorbing light that is viewable.

Thus, option A is the correct answer.

Learn more about 'Metals' here:

brainly.com/question/18153051

Part A Name the complex ion [Fe(CN)6]^3- . The oxidation number of iron is +3. Part B Name the complex ion [Cu(NH3)2(H2O)4]^2+ . The oxidation number of copper is +2. Part C Name the complex CrCl2(en)2 . The oxidation number of chromium is +2. Part D Name the salt [Ni(H2O)3(Co)]SO4 . The oxidation number of nickel is +2. Part E Name the salt K4[Pt(CO3)2F2] given that the carbonate ion acts as a monodentate ligand in the complex. The oxidation number of platinum is +2.

Answers

Final answer:

The complexes are sodium hexachloroplatinate(IV), potassium trisoxalatoferrate(III), and pentaamminechlorocobalt(III) chloride.

Explanation:

(a) There are two Na+ ions, so the coordination sphere has a negative two charge: [PtCl6]². There are six anionic chloride ligands, so -2 = -6 + x, and the oxidation state of the platinum is 4+. The name of the complex is sodium hexachloroplatinate(IV), and the coordination number is six.

(b) The coordination sphere has a charge of 3- (based on the potassium) and the oxalate ligands each have a charge of 2-, so the metal oxidation state is given by -3 = -6+ x, and this is an iron(III) complex. The name is potassium trisoxalatoferrate(III) (note that tris is used instead of tri because the ligand name starts with a vowel). Because oxalate is a bidentate ligand, this complex has a coordination number of six.

(c) In this example, the coordination sphere has a cationic charge of 2+. The NH3 ligand is neutral, but the chloro ligand has a charge of 1-. The oxidation state is found by +2 = -1 + x and is 3+, so the complex is pentaamminechlorocobalt(III) chloride and the coordination number is six.

Draw a structure for the product of nucleophilic substitution obtained on solvolysis of tert−butyl bromide in methanol, and arrange the correct mechanism for its formation. Be sure to answer all parts.

Answers

Answer:

2-methoxy-2-methylpropane

Explanation:

The first step for this reaction is the carbocation formation. In this step, a tertiary carbocation is formed. Also, we will have a good leaving group so bromide will be formed. Then the methanol acts as a nucleophile and attacks the carbocation. Next, a positive charge is generated upon the oxygen, this charge can be removed when the hydrogen leaves the molecule as [tex]H^+[/tex]. (See figure)

In calculating the concentration of [Cu(NH3)4]2+ from [Cu(H2O)4]2+, the stepwise formation constants are as follows: K1=1.90×104 K2=3.90×103 K3=1.00×103 K4=1.50×102 Calculate the overall formation constant (Kf) for the formation of [Cu(NH3)4]2+ from [Cu(H2O)4]2+.

Answers

Answer:

Kf = 1.11x10¹³

Explanation:

The value of Kf for a multistep process that involves an equilibrium at each step, is the multiplication of the constant of the equilibrium of each step.

Kf = K1xK2xK3xK4

Kf = 1.90x10⁴ x 3.90x10³ x 1.00x10³ x 1.50x10²

Kf = 1.11x10¹³

Final answer:

The overall formation constant (Kf) for the formation of [Cu(NH3)4]2+ from [Cu(H2O)4]2+ is 2.1 x 10^13.

Explanation:

The overall formation constant (Kf) for the formation of [Cu(NH3)4]2+ from [Cu(H2O)4]2+ can be calculated by multiplying the stepwise formation constants (K1, K2, K3, K4). In this case, the value of Kf is calculated as follows:

Kf = K1 * K2 * K3 * K4 = 1.90×10^4 * 3.90×10^3 * 1.00×10^3 * 1.50×10^2 = 2.1 x 10^13

Therefore, the overall formation constant (Kf) for the formation of [Cu(NH3)4]2+ from [Cu(H2O)4]2+ is 2.1 x 10^13.

For which process is ΔS negative? Group of answer choices A. grinding a large crystal of KCl to powder B. raising the temperature of 100 g Cu from 275 K to 295 K C. compressing 1 mol Ne at constant temperature from 1.5 L to 0.5 D. mixing 5 mL ethanol with 25 mL water E. evaporation of 1 mol of CCl4(l)

Answers

Answer:

C.

Explanation:

The entropy (S) is the measure of the randomness of a system, and ΔS = Sfinal - Sinitial. As higher is the disorder of the system, as higher is the entropy.

A. When KCl is fractionated in power, there'll be more portions of it, so, the disorder must be higher, then ΔS is positive.

B. As higher is the temperature, higher is the kinetic energy of the system, and because of that, the disorder is also higher, so ΔS is positive.

C. The decrease in the volume (compression) decreases the distance between the molecules, so the system will be more organized, then ΔS is negative.

D. The volume before the mixing will be higher, and the ethanol will dissociate, so it will be more particles, the disorder will increase, and ΔS is positive.

E. Sgas > Sliquid > Ssolid because of the disorder of the molecules, then ΔS is positive.

Final answer:

The process with a negative change in entropy (ΔS) is compressing 1 mol Ne at constant temperature from 1.5 L to 0.5 L, as it leads to a decrease in volume and increases the orderliness of the system.

Explanation:

The question asks for which process the change in entropy (ΔS) is negative. Entropy generally refers to the measure of disorder or randomness in a system. A negative ΔS indicates a decrease in entropy, meaning the system becomes more ordered. Considering the options:

A. grinding a large crystal of KCl to powder - Increases disorder by breaking down the crystal structure, so ΔS is positive.

B. raising the temperature of 100 g Cu from 275 K to 295 K - Increases thermal motion and disorder, so ΔS is positive.

C. compressing 1 mol Ne at constant temperature from 1.5 L to 0.5 L - Decreases the volume and increases order, so ΔS is negative.

D. mixing 5 mL ethanol with 25 mL water - Mixing increases disorder, so ΔS is positive.

E. evaporation of 1 mol of CCl4(l) - Changing from liquid to gas increases disorder, so ΔS is positive.

Therefore, the process with a negative ΔS is C. compressing 1 mol Ne at constant temperature from 1.5 L to 0.5 L.

Given these reactions, X ( s ) + 1 2 O 2 ( g ) ⟶ XO ( s ) Δ H = − 665.9 k J / m o l XCO 3 ( s ) ⟶ XO ( s ) + CO 2 ( g ) Δ H = + 190.1 k J / m o l what is Δ H for this reaction? X ( s ) + 1 2 O 2 ( g ) + CO 2 ( g ) ⟶ XCO 3 ( s )

Answers

Answer:

ΔH of reaction is -856 kJ/mol

Explanation:

The property ΔH is property which can be added to find the net change in enthalpy of reaction.

ΔH of first reaction is -665.9 kJ/mol

ΔH of second reaction is 190.1 kJ/mol

carefully looking at the third equation,

it is first reaction - second reaction.

thus, by Hess's law,

Hess's Law of Constant Heat Summation (or just Hess's Law) states that regardless of the multiple stages or steps of a reaction, the total enthalpy change for the reaction is the sum of all changes.

ΔH of third reaction is = [tex]-665.9 - (190.1)[/tex]

ΔH =  -856 kJ/mol

Why is a mechanism needed to remove carbon dioxide gas from your cells?

Answers

Answer:

Respiration is responsible for removing carbon dioxide and providing oxygen to our body cells. Carbondioxide is eliminated from the body as a byproduct.  

Explanation:

A mechanism is needed because if carbon dioxide were to simply diffuse into our bloodstream to be carried all the way to the lungs, carbon dioxide would dissolve in our blood to form HCO3-, which is acidic and decrease the pH of our blood. This would be fatal for us as our body needs to maintain at a relatively neutral pH. Hence carbon dioxide is removed via hemoglobin from our cells

Define A, Z, and X in the following notation used to specify a nuclide: AZX. Check all that apply.

(A) Z is the mass number (number of protons - neutrons).
(B) A is the chemical symbol of the element.
(C) Z is the chemical symbol of the element.
(D) A is the atomic number (number of protons).
(F) X is the chemical symbol of the element.
(G) X is the mass number (number of protons neutrons).
(H) Z is the atomic number (number of protons).
(I) A is the mass number (number of protons neutrons).
(J) X is the atomic number (number of protons).

Answers

Answer:

X is the chemical symbol of the element.

A is the mass number (number of protons neutrons).

Z is the atomic number (number of protons).

Explanation:

In stating the chemical representation of an element, the AZX symbol is used.

The symbol of the element may either come from its Latin or English name. For instance, the symbol of the element sodium, comes from its Latin name natrium (Na).

Its atomic number is the number of protons in the nucleus of the atom. For sodium, the atomic number is 11.

The mass number refers to the sum of the number of protons and neutrons in the atom. For sodium the mass number is 23.

Hence the AZX symbol for sodium is

23_11Na.

The correct option as regarding the definition of A, Z and X in ᴬ₂X are:

A is the mass number (option I)Z is the atomic number (option H)X is the chemical symbol of the element (option F)

How to determine what A, Z and X represents?

Nuclide of elements are generally represented according to the following notation:

ᴬ₂X

Where

A is defined as the mass number of the element and it the sum of the protons and neutrons in the nucleus of the atom.Z is the atomic number element which is equally the proton number of the elementX is the symbol of the element which is used to identity the element

With the above information, we can determine the options that is correct from the question.

Thus, the correct options are:

Option I A is the mass number (number of protons + neutrons)Option H Z is the atomic number (number of protons)Option F X is the chemical symbol of the element.

Learn more about nuclide notation:

https://brainly.com/question/12887649

#SPJ6

Carbon can bond to itself to form which of the following?
A)Branched-chain structures
B)Structures with both single and double bonds
C)Cyclic ring structures
D) Structures containing up to six bonds per carbon

Answers

B

Carbon has 4 valence electrons that can be involved in the formation of a covalent bond. This is why it can form various types of bonds with itself or other elements. Depending on the number of valence electrons involved in the binding, the bond can be a single, double or triple bond.

Explanation:

Remember the atoms sharing electrons in a covalent bond are aimed at achieving stable electron configuration. Carbon (2.4) being in the middle of the 2nd period seeks to be either 2 or 2.8.

This is why carbon based structures can vary so much due to the large variability in which the carbon atoms can bond. Remember carbon is the same element that forms graphite, diamond, and coal.

Learn More:

For more on the carbon atom check out;

https://brainly.com/question/13255170

https://brainly.com/question/12882572

#LearnWithBrainly

A solenoid 2 cm long consists of 5653 loops of wire. If the magnetic field inside the solenoid is 4 T, what is the magnitude of the current that flows through it? A solenoid 2 cm long consists of 5653 loops of wire. If the magnetic field inside the solenoid is 4 T, what is the magnitude of the current that flows through it? 140 A 9.1×10−2 A 11 A 2.0 A

Answers

Answer:

11 A

Explanation:

The magnetic field inside a solenoid can be calculated by the equation:

B = μ*(N/L)*i

Where B is the magnetic field, μ is the magnetic permeability (which is 1.256x10⁻⁶ T/m.A at vacuum), N is the number os loops, L is the length of the solenoid (2 cm = 0.02 m), and i the current.

4 = 1.256x10⁻⁶ *(5653/0.02)*i

0.355i = 4

i ≅ 11 A

At a particular temperature, 12.6 mol of SO3 is placed into a 4.0-L rigid container, and the SO3 dissociates by the reaction given below. 2 SO3(g) equilibrium reaction arrow 2 SO2(g) + O2(g) At equilibrium, 3.4 mol of SO2 is present. Calculate K for this reaction.

Answers

Answer:

At equilibrium, Kc = 0.058

Explanation:

Step 1: Data given

Mol SO3 = 12.6

Volume = 4.0 L

At equilibrium we have:

3.4 mol of SO2

Step 2: The balanced equation

2SO3(g) + ⇆ 2SO2(g) + O2(g)

Step 3: ICE-chart

The initial number of moles are:

SO3: 12.6 moles

SO2 : 0 mol

O2: 0 mol

There will react:

SO3: -2x

SO2: +2x

O2: +x

The number of moles at the equilibrium are:

SO3: 12.6 - 2x

SO2: 2x  = 3.4 mol

O2: x

Since at the equilibrium, we have 2x = 3.4 mol. x = 1.7 mol

This means at the equilibrium we have 1.7 mol of O2 and 12.6 -3.4 = 9.2 mol of SO3

Step 4: Calculate the equilibrium constant Kc

Kc = [3.4/4]² *[1.7/4] / [9.2/4]²

Kc = 0.058

At equilibrium, Kc = 0.058

What problem would arise if the excess acetyl‑CoA were not converted to ketone bodies?

A. Although acetyl‑CoA is not toxic, it inhibits D‑β‑hydroxyacyl‑CoA dehydrogenase.
B. Although acetyl‑CoA is not toxic, it prevents transfer of fatty acids into the mitochondria by forming acetyl carnitine.
C. Fatty acid oxidation would stop when all of the CoA is bound as acetyl‑CoA.
D. Formation of acetyl‑CoA requires uptake of a proton, and the increased pH inhibits further oxidation.

Answers

Answer:

The correct answer is C fatty acid oxidation would stop when all of the CoA is bound as acetyl CoA.

Explanation:

Acetyl CoA is the principle end product of beta oxidation of even chain fatty acid such as palmitic acid.

    When the cellelar label of actyl CoA increases at that time the excess acetyl CoA is converted to ketone bodies by the process called ketogenesis.

 According to the question if the excess acetyl CoA is not converted to ketone bodies then it will interfere with the oxidation of fatty acid because fatty acid molecules will not get any CoA SH molecule to activate themselves to initiate a new round of beta oxidation.

As a result fatty acid oxidation will stop.

Answer:

C. Fatty acid oxidation would stop when all of the CoA is bound as acetyl‑CoA.

Explanation:

Hello,

In this case, due to the fact that the mitochondrial pool of the CoA is short, thus, such cofactor must be recycled from acetyl-CoA through the production of ketone-like bodies. Therefore, the operation of the beta-oxidation pathway is performed, as it is necessary for energy production, in such a way one concludes that fatty acid oxidation would stop when all of the CoA is bound as acetyl‑CoA.

Best regards.

The normal freezing point of a certain liquid

X

is

0.4°C

, but when

5.90g

of urea

NH22CO

are dissolved in

450.g

of

X

, it is found that the solution freezes at

−0.5°C

instead. Use this information to calculate the molal freezing point depression constant

Kf

of

X

Answers

the molal freezing point depression constant [tex](\(K_f\))[/tex] of liquid X is approximately [tex]\(4.13 \, \text{°C/molal}\)[/tex].

To calculate the molal freezing point depression constant (\(K_f\)) of liquid X, we can use the formula:

[tex]\[ \Delta T_f = K_f \times m \][/tex]

Where:

- [tex]\( \Delta T_f \)[/tex] is the freezing point depression (given as [tex]\(0.4^\circ \text{C} - (-0.5^\circ \text{C}) = 0.9^\circ \text{C}\)[/tex]),

- [tex]\( m \)[/tex] is the molality of the solution,

- [tex]\( K_f \)[/tex] is the molal freezing point depression constant.

First, we need to calculate the molality of the solution, which is defined as the number of moles of solute per kilogram of solvent.

Given:

- Mass of urea [tex](\( \text{NH}_2\text{CO} \))[/tex] = 5.90 g

- Mass of liquid X = 450.0 g

We need to find the moles of urea first:

[tex]\[ \text{moles of urea} = \frac{\text{mass of urea}}{\text{molar mass of urea}} \][/tex]

The molar mass of urea [tex](\( \text{NH}_2\text{CO} \))[/tex] is the sum of the molar masses of nitrogen, hydrogen, carbon, and oxygen:

[tex]\[ \text{molar mass of urea} = 14.01 + 2(1.01) + 12.01 + 16.00 = 60.03 \, \text{g/mol} \][/tex]

[tex]\[ \text{moles of urea} = \frac{5.90 \, \text{g}}{60.03 \, \text{g/mol}} = 0.0983 \, \text{mol} \][/tex]

Now, we can calculate the molality of the solution:

[tex]\[ \text{molality} = \frac{\text{moles of solute}}{\text{mass of solvent (in kg)}} \][/tex]

[tex]\[ \text{molality} = \frac{0.0983 \, \text{mol}}{0.450 \, \text{kg}} = 0.218 \, \text{mol/kg} \][/tex]

Now, we can rearrange the formula for [tex]\(K_f\)[/tex] and solve for it:

[tex]\[ K_f = \frac{\Delta T_f}{m} \][/tex]

[tex]\[ K_f = \frac{0.9^\circ \text{C}}{0.218 \, \text{mol/kg}} \][/tex]

[tex]\[ K_f \approx 4.13 \, \text{°C/molal} \][/tex]

Therefore, the molal freezing point depression constant [tex](\(K_f\))[/tex] of liquid X is approximately [tex]\(4.13 \, \text{°C/molal}\)[/tex].

The molal freezing point depression constant [tex]\( K_f \)[/tex] of liquid X is 4.124 °C/(mol/kg).

To calculate the molal freezing point depression constant [tex]\( K_f \)[/tex] of liquid X, we can use the formula for freezing point depression:

[tex]\[ \Delta T_f = i \cdot K_f \cdot m \][/tex]

where:

[tex]\( \Delta T_f \)[/tex] is the freezing point depression, which is the difference between the normal freezing point of the solvent and the freezing point of the solution.

i is the van 't Hoff factor, which is the number of moles of solute particles per mole of solute dissolved. For urea, i is typically 1 because urea does not dissociate in solution.

[tex]\( K_f \)[/tex] is the molal freezing point depression constant for the solvent.

m is the molality of the solution, which is the number of moles of solute per kilogram of solvent.

First, we calculate the freezing point depression [tex]\( \Delta T_f \)[/tex]:

[tex]\[ \Delta T_f = T_f^0 - T_f = 0.4C - (-0.5C) = 0.9C \][/tex]

Next, we need to calculate the molality m of the solution. The molar mass of urea [tex]\( NH_2CONH_2 \)[/tex] is 60.06 g/mol. The number of moles of urea is:

[tex]\[ n_{urea} = \frac{\text{mass of urea}}{\text{molar mass of urea}} = \frac{5.90 \text{ g}}{60.06 \text{ g/mol}} \] \[ n_{urea} = 0.0982 \text{ mol} \][/tex]

The molality m is:

[tex]\[ m = \frac{n_{urea}}{\text{mass of solvent in kg}} = \frac{0.0982 \text{ mol}}{0.450 \text{ kg}} \] \[ m = 0.2182 \text{ mol/kg} \][/tex]

Now we can rearrange the freezing point depression formula to solve for [tex]\( K_f \)[/tex]:

[tex]\[ K_f = \frac{\Delta T_f}{i \cdot m} \] Since \( i = 1 \) for urea, we have: \[ K_f = \frac{0.9C}{1 \cdot 0.2182 \text{ mol/kg}} \] \[ K_f = 4.124 \text{ C/(mol/kg)} \][/tex]

Therefore, the molal freezing point depression constant [tex]\( K_f \)[/tex] of liquid X is 4.124 °C/(mol/kg).

When 100 mL of 0.200 M NaCl(aq) and 100 mL of 0.200 M AgNO3(aq), both at 21.9 °C, are mixed in a coffee cup calorimeter, the temperature increases to 23.5 °C as solid AgCl forms. How much heat is produced by this precipitation reaction? What assumptions did you make to determine your value?

Answers

Answer:

There is 1.3 kJ heat produced(released)

Explanation:

Step 1: Data given

Volume of a 0.200 M Nacl solution = 100 mL = 0.1 L

Volume of a 0.200 M AgNO3 solution = 100 mL = 0.1 L

Initial temperature = 21.9 °C

Final temperature = 23.5 °C

Solid AgCl will be formed

Step 2: The balanced equation:

AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq)

AgCl(s) + NaNO3(aq) → Na+(aq) + NO3-(aq) + AgCl(s)

Step 3: Define the formula

Pressure is constant.  → the heat evolved from the reaction is equivalent to the enthalpy of reaction.  

Q=m*c*ΔT

⇒ Q = the heat transfer (in joule)

⇒ m =the mass (in grams)

⇒ c= the heat capacity (J/g°C)

⇒ ΔT = Change in temperature = T2- T1

Step 4: Calculate heat

Let's vonsider the density the same as the density of water (1g/mL)

Mass = volume * density

Mass = 200 mL * 1g/mL

Mass = 200 grams

Q= m*c*ΔT

⇒ m = 200 grams

⇒ c = the heat capacity (let's consider the heat capacity of water) = 4.184 J/g°C

⇒ ΔT = 23.5 -21.9 = 1.6°C

Q = 200 * 4.184 * 1.6 = 1338 .9 J = 1.3 kJ

There is 1.3 kJ heat produced(released)

Therefore, we assumed no heat is absorbed by the calorimeter, no heat is exchanged between the  calorimeter and its surroundings, and the specific heat and mass of the solution are the same as those for  water (1g/mL and 4.184 J/g°C)

Final answer:

The increased temperature after the precipitation reaction of NaCl and AgNO3 in a coffee cup calorimeter indicates that heat is released. Calculation of the heat released depends on the specific heat capacity of the solution and its mass. Some assumptions made include the solution having the same heat capacity and density as water, and perfect insulation of the calorimeter.

Explanation:

The heat released by the precipitation reaction of NaCl and AgNO3 to form AgCl can be deduced from the increase of temperature observed in the coffee cup calorimeter. The process happens when Ag+ from AgNO3(aq) and Cl- ion from NaCl(aq) react to form the solid AgCl. This reaction is exothermic as it leads to an increase in the temperature of surroundings, that is, the solution in the calorimeter.

To calculate the heat produced, we need the specific heat capacity of the solution, which is assumed to be approximately equal to that of water (4.18 J/g°C), and the total mass of the solution which is calculated by adding the volumes of the two solutions since the density of the solution is assumed to be approximately 1 g/mL (same as water).

The approximations made in this calculation include treating the solution as having the same specific heat capacity and density as pure water, and assuming that the calorimeter perfectly insulates the solution so that no heat is lost to the environment.

Learn more about Heat of Reaction here:

https://brainly.com/question/30464598

#SPJ11

Other Questions
As heat is added to water, is it possible for the temperature measured by a thermometer in the water to remain constant? a. Maybe; it depends on the rate at which the heat is added. b. No, adding heat will always change the temperature. c. Yes, the water could be changing the phase. d. Maybe; it depends on the initial water temperature. Use the value of the linear correlation coefficient to calculate the coefficient of determination. What does this tell you about the explained variation of the data about the regression line? About the unexplained variation? requals=negative 0.387 After Frank Palko was sentenced to death by the state of Connecticut the Supreme Court ruled ______ is control of one country by another, more powerful country. Question 12 options: Nationalism Imperialism Militarism Industrialism After the main meeting, the meeting planner would like attendees to attend smaller breakout sessions designed to provide more detailed instructions about the company's products, and participants will be taking extensive notes. What type of meeting room setup would you suggest? Long-Term MehlumThe boiling point of water Tby the function T(a) = -0water T (measured in degrees), at altitude a (measured in feet) is mod-0.0018a + 212. In terms of altitude and temperature, whichnt describes the meaning of the slope?A. The boiling point decreases byB. The boiling point decreaC. The boiling point decreases by 10D. The boiling point decrea:decreases by 18 degrees as the altitude Increases by 1,000 feet.reases by 1.8 degrees as the altitude increases by 1,000 feet.decreases by 18 degrees as the altitude Increases by 1,000 feet.t decreases by 1.8 degrees as the altitude increases by 1,000 feet. 3. The angular dispersion of a prism depends onA. the index of refraction only B. the angle ofincidence as well as the index of refraction C. theangle of incidence only D. the hi thickness of theprism E, the prism angie. In October, Pine Company reports 18,600 actual direct labor hours, and it incurs $126,540 of manufacturing overhead costs. Standard hours allowed for the work done is 22,200 hours. The predetermined overhead rate is $5.75 per direct labor hour. Compute the total overhead variance. A metallurgist has one alloy containing 34% copper another containing 48% copper. How many pounds of each alloy must he use to make 46 pounds of the third alloy containing 37% copper A 1.2 kg ball drops vertically onto a floor from a height of 32 m, and rebounds with an initial speed of 10 m/s. (a) What impulse acts on the ball during the contact? (b) If the ball is in contact with the floor for 0.020 s, what is the magnitude of the average force on the floor from by the ball? Neglect air resistance The nine basic training principles are specificity, overload, progression, recovery, variation, transfer, balance, individualization, and reversibility. How can the basic training principles influence the type of location that you choose? Select at least three of nine training principles to write about. On January 1, Innovative Solutions, Inc. issued $220,000 in bonds at face value. The bonds have a stated interest rate of 5 percent. The bonds mature in 10 years and pay interest once per year on December 31.Required:1, 2 & 3. Complete the required journal entries to record the bond issuance, interest payment on December 31, early retirement of the bonds. Assume the bonds were retired immediately after the first interest payment at a quoted price of 103. (If no entry is required for a transaction/event, select "No Journal Entry Required" in the first account field.) Mark Welsch deposits $8,000 in an account that earns interest at an annual rate of 8%, compounded quarterly. The $8,000 plus earned interest must remain in the account 4 years before it can be withdrawn. How much money will be in the account at the end of 4 years? Cousin Hector drove 1,851 miles to the reunion. He lives in Mexico and drove 747 miles through that country to the United States border. How many miles did he drive in the United States? 3.Mitosis and meiosis are similar processes, but they have some very important differences. Explain how mitosis and meiosis are alike and how they are different. Provide at least two similarities and three differences. The height of your success is equal to the depth of your gratitude. Explain this quote A total of $150000 is invested in two funds paying 6.25% and 6% simple interest. If the total interest for the year is $9212.50, how much is invested at each rate? I need help on these three. A car originally priced at $8,900 is on sale at 15% off. If the sales tax rate is 8.25%, what is the sale price of the car? alculate the enthalpy of the reaction 4B(s)+3O2(g)2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)3O2(g)+B2H6(g), HA=+2035 kJ 2B(s)+3H2(g)B2H6(g), HB=+36 kJ H2(g)+12O2(g)H2O(l), HC=285 kJ H2O(l)H2O(g), HD=+4