A community theater sold a total of 400 for price tickets for adults and children the price was $8.00 per adult to get in $5.00 per children’s ticket and the total revenue was $2750 how many adult tickets and how many Childers tickets were sold

Answers

Answer 1

Answer:

Number of  children's tickets sold  =  150

Number of adult's tickets sold = 250

Step-by-step explanation:

The total number of tickets sold  = 400

Let us assume the number of children's tickets   = m

So, the number of adult's ticket's sold  = 400 - m

Here, the cost of 1 movie ticket for adult  = $8.00

So, the cost of (400 -m) adult tickets = (400 - m) ( Cost of 1 adult ticket)

= (400 - m) ($8) = 3200 - 8 m

The cost of each ticket for child = $5.00

The cost of m children  tickets = m ( Cost of 1 children ticket)

= m($5) = 5 m

Now, total cost of tickets = Money spend on (Adult's + children's) Ticket

2750 =  (3200 - 8 m) +  (5 m)

or,  2750 - 3200 = -8 m + 5 m

or, -450 = -3 m

or, m = 450/3 = 150

or, m = 150

Hence, the number of  children's tickets = m = 150

The number of adult's tickets sold =  400 - m = 400 -150 = 250


Related Questions

line m contains the points -3,4 and 1,0. write the equation of a line that would be perpendicular to this one and pass through the point -2,6 answer for algebra 1 need help

Answers

The equation of line perpendicular to line containing points (-3, 4) and (1, 0) and passes through (-2, 6) in point slope form is y = x + 8

Solution:

Given that line m contains points (-3, 4) and (1, 0)

We are asked to find the equation of line perpendicular to line containing points (-3, 4) and (1, 0) and passes through (-2, 6)

Let us first find slope of the line "m"

Given two points are (-3, 4) and (1, 0)

[tex]m = \frac{y_2 - y_1}{x_2 - x_1}[/tex]

[tex]\left(x_{1}, y_{1}\right)=(-3,4) \text { and }\left(x_{2}, y_{2}\right)=(1,0)[/tex]

[tex]m=\frac{0-4}{1-(-3)}=-1[/tex]

Thus slope of line m is -1

We know that product of slope of given line and perpendicular line are always -1

So, we get

[tex]\begin{array}{l}{\text { slope of line } m \times \text { slope of perpendicular line }=-1} \\\\ {-1 \times \text { slope of perpendicular line }=-1} \\\\ {\text { slope of perpendicular line }=1}\end{array}[/tex]

So we have got the slope of perpendicular line is 1 and it passes through (-2, 6)

Let us use the point slope form to find the required equation

The point slope form is given as:

[tex]y - y_1 = m(x - x_1)[/tex]

[tex](x_1, y_1) = (-2, 6)[/tex] and m = 1

y - 6 = 1(x - (-2))

y - 6 = x + 2

y = x + 8

Thus equation of required line in point slope form is y = x + 8

A beluga whale is 5 yards and 3 inches long, and a gray whale is 15 yards and 5 inches long. What is the difference in length between the two whales? how many yards and how many inches​

Answers

Answer:

10 yards 2 inches

Step-by-step explanation:

To get the answer, you must subtract the amount of the smaller whale from the larger one:

Gray whale. 15 yards 5 inches

beluga whale. - 5 yards 3 inches

= 10 yards 2 inches

The sum of two numbers is 50 . The larger number is 10 more than the smaller number. What are the numbers?

Answers

Answer:

the numbers are 20 and 30

how many pencils measure 6 inches​

Answers

Answer:

Plz show the picture that goes long with the question!

Step-by-step explanation:

What’s 39,204 divided by 54

Answers

Answer:

726

Step-by-step explanation:

39204/54=726

A classroom library has 100 books. half of the books are fiction. of the books left, a tenth are about animals. how many animals. books does the library contain?

Answers

Answer:

5

Step-by-step explanation:

100 books, half of them are fiction. So 50 of them are fiction. There are 50 books remaining. 10% of them are animal books. What is 10% of 50?

Convert 10% to a decimal: .10

Multiply .10 by 50

.10×50=5

5 books are animal books.

The classroom library contains 5 animal books.

What is the percentage?

The percentage is defined as a ratio expressed as a fraction of 100.

What are Arithmetic operations?

Arithmetic operations can also be specified by adding, subtracting, dividing, and multiplying built-in functions.

The operator that performs the arithmetic operations is called arithmetic operators.

* Multiplication operation: Multiplies values on either side of the operator

For example 4*2 = 8

/ Division operation: Divides left-hand operand by right-hand operand

For example 4/2 = 2

Given that the classroom library has 100 books.

And half of the books are fiction.

There are 50 books remaining and a tenth is about animals

So 10% of them are animal books.

To calculate 10% of 50 :

⇒ 10% of 50

⇒ 10%(50)

Convert 10% to a decimal,

⇒ 0.10×(50)

Multiply 0.10 by 50

⇒ 5

Hence, the classroom library contains 5 animal books.

Learn more about Arithmetic operations here:

brainly.com/question/25834626

#SPJ2

PLEASE HELP ME ITS ALREADY LATE AND ITS BRINGING MY GRADE WAY DOWN PLEASE HELP ME PLEASE!!!!
The following graph is of an exponential function of the form y=a*bx.
What values of a and b would make this equation work?
a=
b=

Answers

Answer:

I think a=15 and b=9

Step-by-step explanation:

I think that's it could be wrong

there we go ;)

the height of a triangle is 7 cm greater than the base. the area of the triangle is 147 square centimeters. find the length of the base and the height of the triangle​

Answers

Answer:

height is 21cm and the base is 14cm

Step-by-step explanation:

Take a look at the equation for the area of a triangle [tex]A = \frac{bh}{2}[/tex]

Write "height of a triangle is 7 cm greater than the base" as an equation:

h = b + 7

Substitute h and the area of the triangle, 147 into the equation for area.

[tex]A = \frac{bh}{2}[/tex]

[tex]147 = \frac{b(b+7)}{2}[/tex] distribute over brackets

[tex]147 = \frac{b²+7b)}{2}[/tex]  get rid of fractions

[tex]147*2 = b²+7b[/tex]

[tex]294 = b²+7b[/tex]

Rearrange to standard for for quadratic equations

0 = b²+7b - 294

standard form is 0 = ax² + bx + c

In this base, the x variable is replaced by "b".

Use the quadratic formula to solve for b. Substitute the other three values.

[tex]x = \frac{-b ±\sqrt{b^{2}-4ac} }{2a}[/tex]

[tex]x = \frac{-(7) ±\sqrt{7^{2}-4(1)(-294)} }{2(1)}[/tex] Simplify

[tex]x = \frac{-7 ±\sqrt{1225} }{2}[/tex]

[tex]x = \frac{-7 ±35 }{2}[/tex]

Split the equation at ±

[tex]x = \frac{-7 +35 }{2}[/tex]

[tex]x = \frac{28}{2}[/tex]

[tex]x = 14[/tex]  <=base

[tex]x = \frac{-7 -35 }{2}[/tex]

[tex]x = \frac{-42}{2}[/tex]

[tex]x = -21[/tex]  <=We know this number is not possible, so its inadmissible.

The base is 14 cm.

Substitute base = 14 in h = b + 7

h = b + 7

h = 14 + 7

h = 21

The height is 21cm.

Therefore, the height is 21cm and the base is 14cm.

I need help if you look at the answers, b and c are the same. What do I pick?

Answers

Answer:

We have to choose any one from option B and option C

Step-by-step explanation:

We have to perform a subtraction of two decimal numbers.

(9.43 - 4.286) = (9.430 - 4.286) = 5.144.

Hence, the answer is 5.144 which is given both options B and C.  

In case there are two options with the same value and the value is the answer, then you choose any one of them but not both.

Here in our case, we have to choose any one from option B and option C and we will be rewarded full marks. (Answer)

please ineed help --------------------

Answers

Answer:

9 × 5= 45 .Frankie has 9 nickles.

Step-by-step explanation:

Because 5 divided by 45 equals to 9.

A 30m high pole was standing at a point of the length side of a rectangle garden. If the angles of elevation of that pole form end points of that length are found 60 degree and 30 degree,find the length of that garden.​

Answers

Answer:

Length of the garden = 69.28 meters.

Step-by-step explanation:

See the attached diagram.

Let CD is the pole with a height of 30 m and the elevation of the top of the pole from the endpoints of the length A and B are 60° and 30° respectively.

So, ∠ DAC = 60° and ∠ DBC = 30°  

Now, Δ ACD is a right triangle and [tex]\tan 60 = \frac{CD}{AC}[/tex]

⇒ [tex]AC = \frac{CD}{\tan 60} = \frac{30}{\tan 60} = 17.32[/tex] meters.

Now, from Δ BCD which is a right triangle, [tex]\tan 30 = \frac{CD}{CB}[/tex]

⇒ [tex]CB = \frac{30}{\tan 30} = 51.96[/tex] meters.

Hence, AB = AC + CB = 17.32 + 51.96 = 69.28 meters. (Answer)

Answer:

The length of the rectangle garden is 20 [tex]\sqrt{3}[/tex] i.e 34.64 meters .

Step-by-step explanation:

Given as :

The height of the pole = H = 30 m

The two angles of elevation as 60° and 30°

Let The length of the rectangle garden = L m

Now, From figure

The measure from pole ground to first elevation 60° = x m

The measure from pole ground to second elevation 30° = (L + x ) m

Now, from triangle BOC

Tan Ф = [tex]\dfrac{\textrm perpendicular}{\textrm base}[/tex]

I.e Tan 60° = [tex]\dfrac{\textrm 30}{\textrm x}[/tex]

Or, [tex]\sqrt{3}[/tex] = [tex]\dfrac{\textrm 30}{\textrm x}[/tex]

or, x = [tex]\frac{30}{\sqrt{3} }[/tex]

I.e x = 10[tex]\sqrt{3}[/tex] meter      ...1

Again From triangle BAC

Tan Ф = [tex]\dfrac{\textrm perpendicular}{\textrm base}[/tex]

I.e Tan 30° = [tex]\dfrac{\textrm 30}{\textrm L + x}[/tex]

Or, [tex]\frac{1}{\sqrt{3} }[/tex] = [tex]\dfrac{\textrm 30}{\textrm L + x}[/tex]

Or, L + x = 30 × [tex]\sqrt{3}[/tex]   ....2

Put the value of x from  1 into 2

i.e L + 10[tex]\sqrt{3}[/tex] meter   = 30 × [tex]\sqrt{3}[/tex]

or, L = 30 [tex]\sqrt{3}[/tex] - 10 [tex]\sqrt{3}[/tex]  

Or, L = 20 [tex]\sqrt{3}[/tex] = 34.64 meters

I.e length of garden is 20 [tex]\sqrt{3}[/tex]

Hence The length of the rectangle garden is 20 [tex]\sqrt{3}[/tex] i.e 34.64 meters . answer

What is the equation of the function shown in the graph, given the equation of the parent function is f(x)=1.5x ?




g(x)=1.5x−2

g(x)=1.5x−3

g(x)=1.5x−4

g(x)=1.5x+2
An exponential function on a coordinate plane with x and y axis in increments of 1 increasing from negative 5 to 5. The function increases from left to right beginning infinitely close in the third quadrant to a dashed horizontal line at y equals negative 4. The function increases through begin ordered pair 0 comma negative 3 end ordered pair and continues to increase through begin ordered pair 2 comma negative 1.75 end ordered pair. The function continues to increase through the second quadrant and out of the first quadrant.

Answers

Answer:

[tex]g(x)=1.5^{x}-4[/tex]

Step-by-step explanation:

Given:

The parent function is given as:

[tex]f(x)=1.5^{x}[/tex]

Let us consider a point on [tex]f(x)\ and\ g(x)[/tex] and compare their transformation.

The easiest point to consider is the y-intercept. At the y-intercept, the value of 'x' is 0.

The y-intercept of the function [tex]f(x)[/tex] is for [tex]x=0[/tex]. So,

[tex]f(0)=1.5^{0}=1[/tex]

The y-intercept of [tex]f(x)[/tex] is the point (0, 1).

Now, as per question, the transformed function [tex]g(x)[/tex] passes through the point (0, -3). Therefore,

The function [tex]g(x)[/tex] in the graph has the y-intercept equal to -3  as at y-intercept, the 'x' value is 0.

Therefore, the y-intercept of [tex]g(x)[/tex] is the point (0,-3).

Now, consider the transformation for the points (0, 1) and (0, -3).

[tex](0,1)\rightarrow (0,-3)[/tex]

Here, the 'x' value remains the same but the 'y' values decreases by 4 units. So, the rule will be:

[tex](x,y)\rightarrow (x,y-4)[/tex]

As per translation rules, if C units is added to 'y' value, then the graph moves up if 'C' is positive and moves down if 'C' is negative.

Also, the equation is of the form: [tex]g(x)=f(x)+C[/tex]

Here, [tex]C=-4[/tex].

Therefore, the graph shifts down by 4 units.

The equation of the function [tex]g(x)[/tex] is given as:

[tex]g(x)=f(x)+C=1.5^{x}-4[/tex]

Answer:

D

Step-by-step explanation:

Water constitutes approximately 8/25 of the body of an average adult female.About what percent of the average adult female body is made out of water?

Answers

Answer: About 32% of the average adult female body is made out of water.

Step-by-step explanation:

According to the data given in the exercise [tex]\frac{8}{25}[/tex] of the body of an average adult female is made out of water.

Then, you need to convert from fraction to percent. The steps are:

1. Divide the numerator of the fraction (In this case the numerator is  8) by the denominator of the fraction (In this case the denominator is 25). Then:

[tex]\frac{8}{25}=0.32[/tex]

2. Multiply the result 0.32 by 100:

[tex]0.32*100=32\%[/tex]

Therefore,  about 32% of the average adult female body is made out of water.

HELP
Solve 3(x-2)<18

Answers

Answer:

x<8

Step-by-step explanation:

Open parenthesis first:

3x-6<18

Put all like terms on one side:

3x<18+6

3x<24

Simplify:

3x<24 -----> Divide both sides by 3 to cancel out the 3 in 3x.

x<8

~Stay golden~ :)

Answer: x<8

Step-by-step explanation:

3(x-2)<18

3x-6<18

+6 +6

3x<24

———-

3 3

x<8

Kay has 28 coins which includes nickels and dimes if the total is 2.35$, how many of each coin does Kay have?

Answers

Answer:

19 dimes and 9 nickels

Step-by-step explanation:

Model the situation using two equations, then solve the system.

let n be number of nickels and d be number of dimes.

n + d = 28     <= This equation is about the number of coins.

0.05n + 0.10d =  2.35   <=This equation is about the worth in dollars.

Rearrange n + d = 28.

n = 28 - d

Now we can substitute this equation into the other one.

Sub n =28-d at the "d" variable for the equation 0.05n + 0.10d =  2.35

0.05n + 0.10d =  2.35

Now there is only one variable.

0.05(28 - d) + 0.10d =  2.35   <=distribute this

0.05(28 - d) + 0.10d =  2.35

1.4 - 0.05d + 0.10d = 2.35   <=combine like terms

1.4 + 0.05d = 2.35    <= begin to isolate d

0.05d = 2.35 - 1.4

0.05d = 0.95

d = 0.95/0.05

d = 19

Now that we know d=19, we can substitute it into any equation.

Choose the equation n + d = 28 because the numbers are easier.

n + d = 28

n + 19 = 28    <=isolate n

n = 28 - 19

n = 9

Since n=9 and d=19, Kay has 9 nickels and 19 dimes.

Hey! How are you? My name is Maria, 19 years old. Yesterday broke up with a guy, looking for casual sex.

Write me here and I will give you my phone number - *pofsex.com*

My nickname - Lovely

the value of y varies directly with x, and y= -3 when x=1. Find y when x=-6

Answers

Answer:

  y = 18

Step-by-step explanation:

Direct variation means y varies by the same factor x does. Here, x has changed by a factor of -6, so the new value of y is ...

  y = (-6)(-3) = 18

Final answer:

If y varies directly with x, and y = -3 when x = 1, the value of y when x = -6 is found using the formula y = kx. The value of y when x = -6 is 18.

Explanation:

In mathematics, if y varies directly with x, it means y = kx for some constant k. To find k, we substitute the given values of x and y into the equation, so -3 = k(1) gives k = -3.

Now that we have the value of k, we can find the value of y when x = -6. Substituting these values into our equation y = kx, we get y = -3*(-6), which simplifies to y = 18.

So when x = -6 and y varies directly with x, the value of y is 18.

Learn more about Direct Variation here:

https://brainly.com/question/34355670

#SPJ2

ASAP 20 POINTS
On the first day of​ June, there were about 18.49 h of daylight in a city. Five months​ later, there were about 5.40 h of daylight. What was the percent​ decrease?

Answers

Answer:

I think it is 70.795% decrease

Hope that helps:)

I have a question for u

What is your fav?

Adrinette

LadyNoir

Marichat

Ladrien

x+5y; use x = 1 5/6, and y = 3 1/6

Answers

Answer:

53/3

Step-by-step explanation:

1 5/6=11/6

3 1/6=19/6

---------------

11/6+5(19/6)=11/6+95/6=106/6

simplify

53/3

What is thg e alebracir equation for m=1 (3,3)

Answers

The algebraic equation for the line whose slope is m = 1 and passes through point (3 , 3) is y = x

Step-by-step explanation:

The algebraic equation of a line whose slope is m and passes

through point [tex](x_{1},y_{1})[/tex] is

[tex]y-y_{1}=m(x-x_{1})[/tex]This form is the slope-point form of the equation of a line

∵ The slope of the line is m = 1

∵ The line passes through point (3 , 3)

∴ [tex]x_{1}[/tex] = 3

∴ [tex]y_{1}[/tex] = 3

- Substitute these values in the form of the equation

∵ [tex]y-y_{1}=m(x-x_{1})[/tex]

∴ y - 3 = (1)(x - 3)

- Simplify it

∴ y - 3 = x - 3

- Add 3 to both sides

∴ y = x

The algebraic equation for the line whose slope is m = 1 and passes through point (3 , 3) is y = x

Learn more:

You can learn more about the linear equation in brainly.com/question/3965451

#LearnwithBrainly

Find the slope of the line y =
x + 1.

Answers

Answer:

The slope is 1

Step-by-step explanation:

The slope is 1
Because the slope is the constant in front of the x when it is in slope intercept form

Evaluate each expression for the given value. 5/6 for x = -8

Answers

Answer:

x= -9.3

Step-by-step explanation:

assuming i have to calculate x from the given equation that is

[tex]\frac{5}{6} of x= -8[/tex]

⇒[tex]5x= -48[/tex]

⇒x= -48/5= -9.3

therefore x= -9.3

There was a bowl with 120 candies in it. Billy, Bob and Buck found the bowl. Billy ate 2/12 of the candies, Bob ate 3/12 and Buck had 5/12. How many candies were left?

Answers

Final answer:

Billy ate 1/6, Bob ate 1/4, and Buck ate 5/12 of the candies. To find the number of candies left, subtract the total fraction eaten from the total.

Explanation:

To find out how many candies were left, we need to subtract the candies that Billy, Bob, and Buck ate from the total number of candies in the bowl.

Billy ate 2/12 of the candies, which is equivalent to 1/6 of the candies because 2/12 can be simplified to 1/6.

Bob ate 3/12 of the candies, which is equivalent to 1/4 of the candies because 3/12 can be simplified to 1/4.

Buck ate 5/12 of the candies.

To find the total fraction of candies eaten, we add the fractions: 1/6 + 1/4 + 5/12. The common denominator for these fractions is 12.

Converting all the fractions to have a denominator of 12, we have: 2/12 + 3/12 + 5/12 = 10/12 = 5/6.

So, the three boys ate 5/6 of the candies.

To find the number of candies left, we subtract 5/6 from the total number of candies in the bowl:

120 - (5/6 * 120) = 120 - (5/6 * 120/1) = 120 - (5 * 120/6) = 120 - 100 = 20.

Therefore, there are 20 candies left in the bowl.

Simplify. Type your answer in the box. Use a slash (/) to show a fraction. Do not add any spaces.

–7'2

Answers

Answer:

you mean

[tex] - 7.2[/tex]

?

if so, then,

[tex] - 7.2 = - \frac{72}{10} [/tex]

[tex] - \frac{36}{5} [/tex]

...

I NEED HELP FAST
what is y-2=5(x+7) in standard form?

Answers

Answer: y = 5x + 33

Step-by-step explanation:

y-2=5(x+7)

y-2 = 5*x + 35

y = 5x + 33

Answer: y = 5x + 33

Explanation:

First you must write the equation as you see it:

y-2=5(x+7)

Then do the math in side of the parentheses:

y-2 = 5*x + 35

Once you do the rest of the math, you shall have you answer:

y = 5x + 33

Hope this helps! :)

Please Help Identify each angle pair. Choose from the list below.
Corresponding, Alternate Interior, Alternate Exterior, Same-side Interior, Linear Pair, Vertical


∠1 and ∠6:
∠1 and ∠3:
∠3 and ∠6:
∠4 and ∠8:
∠4 and ∠5:
∠5 and ∠6:

Answers

Answer:

The answer is given below.

Step-by-step explanation:

Alternate exterior angles: I is a pair of angles on the outer side of the each of two parallel lines but on opposite side of the transversal.

Vertically opposite angles: They are angles opposite each other when two lines intersect each other or cross each other.

Corresponding angles:  The angles which occupy the same relative position at each intersection where a transversal intersect the two parallel lines.

Same side interior angles: These are the angles between the parallel lines with the transversal.

Alternate interior angles: These are those angles that are alternate to each other and lie inside the parallel lines forming in Z shape.

Linear pair angles: It is a pair of adjacent angles formed by two intersecting lines

[tex]\angle 1\ and\ \angle 6:\ \textrm{alternate exterior angles}\\\angle 1\ and\ \angle 3:\ \textrm{Vertical opposite angles}\\\angle 3\ and\ \angle 6:\ \textrm{corresponding angles}\\\angle 4\ and\ \angle 8:\ \textrm{same side interior angles}\\\angle 4\ and\ \angle 5:\ \textrm{alternate interior angles}\\\angle 5\ and\ \angle 6:\ \textrm{linear pair angles}[/tex]

Answer:

A

Step-by-step explanation:

A

Math problem: a light-blocking screen transmits 18% of the light and reflects back the rest. how much light is transmitted through 2 screens?

Answers

Step-by-step explanation:

Paolo's expression 3(x+2)+3

Final answer:

To find how much light is transmitted through two screens that each transmit 18% of the light, multiply 18% by itself (0.18 x 0.18), which results in 3.24% of the original light being transmitted through both screens.

To determine how much light is transmitted through two light-blocking screens, we need to calculate the percentage of light that makes it through both screens. The first screen transmits 18% of the light. This means that only 18% of the initial light intensity will pass through the first screen.

When the light that has passed through the first screen encounters the second screen, again only 18% of that light will be transmitted. To find the total amount of light transmitted through two screens, we multiply the transmission rates of each screen:

Transmitted light through two screens = 18% of initial light * 18% = (0.18) * (0.18)

To get the final percentage, we multiply those two percentages:

Final transmission percentage = 0.18 * 0.18 = 0.0324 or 3.24%

Therefore, only 3.24% of the initial light is transmitted through two screens.

A bedroom is in the shape of a rectangle. The length of the bedroom is represented by 3x^2 and the width is represented by 7x+14. The square rug has a length of 4x +3 what is the area of the bedroom that is not covered by the rug?

PLEASE HELP

Answers

The area of the room that is not covered by the rug is: [tex]21x^3+26x^2-24x+9[/tex]

Step-by-step explanation:

Let L be the length of the room

and

W be the width of the room

Then

L = 3x^2

W = 7x+14

Area of the bedroom:

[tex]A_r = L*W\\=3x^2(7x+14)\\=21x^3+42x^2[/tex]

Area of Rug:

Let S be the side of rug

S = 4x+3

[tex]A_{rug} =S^2\\=(4x+3)^2\\=(4x)^2+2(4x)(3)+(3)^2\\=16x^2+24x+9[/tex]

The area of the room that is not covered by the rug will be obtained by subtracting the area of the rug from the area of the room.

So,

[tex]Area\ of\ room\ not\ covered\ by\ rug =A_r - A_{rug}\\= 21x^3+42x^2-(16x^2+24x+9)\\=21x^3+42x^2-16x^2-24x-9\\=21x^3+26x^2-24x+9[/tex]

Hence,

The area of the room that is not covered by the rug is: [tex]21x^3+26x^2-24x+9[/tex]

Keywords: Rectangle, square

Learn more about area at:

brainly.com/question/10703930brainly.com/question/10772025

#LearnwithBrainly

The interior angles of a pentagon are x,x,2x, and 2x. What is the measure of the larger angles

Answers

Answer:

The measure of larger angle is 180°

Step-by-step explanation:

Given as :

For the pentagon

The measure of interior angles are

∠A = x ,

∠B = x ,

∠C = 2 x ,

∠D = 2 x ,

∠E = 3 x

We know, The sum of measure of all interior angles of pentagon = 540°

So, x + x + 2 x + 2 x + 3 x =   540°

or, 9 x =  540°

∴  x = [tex]\frac{540}{9}[/tex]

I.e x = 60°

So, The measure of angles are

∠A =  60°  ,

∠B =  60° ,

∠C = 2 ×  60° = 120° ,

∠D = 2 ×  60° = 120°,

∠E = 3  ×  60° = 180°

So, the measure of larger angle is 180°

Hence The measure of larger angle is 180° Answer

which triangles are congruent by asa

Answers

Check the picture below.

Andrew’s math teacher entered the seventh-grade students in a math competition. There was an enrollment fee of $30 and also an $11 charge for each packet of 10 tests. The total cost was $151. How many tests were purchased?

Answers

Answer:

11 Test Packets

Step-by-step explanation:

151-30=121/11=11

Final answer:

The teacher purchased 11 packets of tests for the math competition.

Explanation:

The question is about calculating the number of test packets Andrew's teacher purchased for the math competition. We know that there was a basic enrollment fee of $30, and each packet of 10 tests cost an additional $11. The total cost was $151. To find out how many test packets the teacher purchased, the first step is to subtract the enrollment fee from the total amount spent. Therefore, $151 - $30 = $121 was spent on test packets.

Then, we divide this amount by the cost of each test packet. So $121/$11 gives us 11. Hence, the teacher purchased 11 packets of tests for Andrew's math competition.

Learn more about Practical Arithmetic here:

https://brainly.com/question/31160285

#SPJ3

Other Questions
How do you think the Gilded Age and Progressive Era will change the country after Reconstruction? Which example describes biological evolution?a.Over time, a caterpillar species becomes as green as the leaves it eats.b.The average woman's dress size has increased over the last 50 years.c.You are vaccinated against polio and are protected against the disease.d.A tree branch is broken off and another grows in its place. Knowing his last days were near, Harrison chose to die at home. He was clear-minded during his final hours, allowing him to review his life and say farewell. Like Harrison, about 20 percent of people experience a gentle death. about 25 percent of people experience a long and drawn-out death. most Americans die at home. most people experience a quick, agony-free death. In which circumstances is a person most likely to be entranced?Awhen watching a beautiful sunsetB. when hearing a window break in a stormC. when looking for a lost walletD. when saying goodbye to old friends A survey questioned 1000 people regarding raising the legal drinking age from 18 to 21. Of the 540 who favored raising the age, 390 were female. Of the 460 opposition responses, 130 were female. If a person selected at random from this group is a man, what is the probability that the person favors raising the drinking age? Which of the following is NOT a political right? what is the slope for (12,5) (9,8) I need help putting these sentences in present progressive form. pleeeease help me1. Nosotros / practicar deportes2. Carmen / comer en casa3. Nuestro equipo / ganar el partido4. Yo / leer el peridico5. l / pensar comprar una bicicleta roja6. Ustedes / jugar a las cartas7. Jos y Francisco / dormir8. Marisa / leer el correo electrnico9. Yo / preparar sndwiches10. Carlos / tomar fotos11. dormir / t? A product modification differs from a line extension in that _______. The U.S. Congress enacted the CAN-SPAM Act in 2003. This act: a. limits advertisers from sending more than one ad per month per email address. b. does not view sending multiple spam emails with the use of a hijacked computer as an offense. c. prohibits the use of false or misleading subject lines on emails used for advertising. d. requires spammers to register with the Federal Trade Commission. All of the following statements are consistent with the kinetic molecular theory of gases EXCEPT: A. The gas molecules collide with each other and with the surfaces around them.B. Strong attractive forces hold the gas molecules together. C. The average kinetic energy of the molecules of a gas is proportional to the temperature of the gas in kelvins. D. The size of the gas molecules is negligible compared to the total volume of the gas. E. none of the above. What is a non-example of unit rate 14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line Linda says she values education. Over the years she has had several employees who worked for her and earned their degrees at the same time. To support them, Linda allowed them to flex their daily work hours. In this example, Linda demonstrates_____________.