A is directly proportional to B when A =12 and B =3
A.)find a formula for A in terms of B
B.)find the value of A when B =5
C.)find the value of B when A =36

Answers

Answer 1

A) To find A in terms of B, we need to find A = xB. One given is A = 12 and B = 3. We substitute, which gives us 12 = x4. Divide both sides by 4, which gives us x = 3. This means that A = 3B.

B) For this, we can just plug in 5 as B in our equation. A = 3*5 -> A = 15.

C) We can plug in A as 36. 36 = 3B -> B = 12.

Answer 2
Final answer:

A.) The formula for A in terms of B is A = 4B. B.) When B = 5, A = 20. C.) When A = 36, B = 9.

Explanation:

A.) To find the formula for A in terms of B, we can set up a proportion using the given values. Since A is directly proportional to B, we can write the proportion as A/B = k, where k is the constant of proportionality. Substituting the values A = 12 and B = 3, we have 12/3 = k. Solving for k, we find k = 4. Therefore, the formula for A in terms of B is A = 4B.

B.) To find the value of A when B = 5, we can substitute B = 5 into the formula A = 4B. A = 4(5) = 20.

C.) To find the value of B when A = 36, we can rearrange the formula A = 4B to solve for B. Dividing both sides by 4, we get B = A/4. Substituting A = 36, we have B = 36/4 = 9.

Learn more about Proportion here:

https://brainly.com/question/28730073

#SPJ2


Related Questions

When simplifying the quadratic formula to solve the equation x 2 + 6x - 55 = 0, the number under the radical sign will be:

-184
232
256

Answers

Answer:   256

Step-by-step explanation:

x² + 6x - 55 = 0

The values under the radical are: b² - 4ac

(6)² - (4)(1)(-55)

= 36 - (-220)

= 36 + 220

= 256

Work out
³√−64
Please help

Answers

Answer:

-4

Step-by-step explanation:

Cube Root is an odd number so your answer will still be negative in the end. 4x4x4= 64 so cube root 64 will be -4

The jacket is on sale for $36 which Is 80% of the original cost. What is the original price of the Jacket?

Part,whole and percent

Answers

Answer:

$45

Step-by-step explanation:

To find the discount price, you make the discount a decimal and multiply, like so

.8x=36

then divide and your answer is 45

Out of 6700 students of a school only 90% passed. Find how many students passed?

Answers

Answer:

6030 students passed.

Step-by-step explanation:

First: We must convert all percentages to decimals:

So, why do we need to convert all percentages to decimals. Well, you don't have to. It's just that it's easier to work with decimals than percentages. So I'll bold out all of the percents in this problem:

Out of 6700 students of a school only 90% passed. Find how many students passed?

So how do we convert  that to a decimal. Well...

A: We have to take out the percent sign:

90

B: We have to move the decimal point 2 spaces to the left:

0.90

Now that we have our percent displayed as a decimal, we need to multiply it by the total number of students to find the fraction of people that passed.

So 0.90 [or 0.9] multiplied by 6700

[tex]0.9*6700 = 6030[/tex]

So, out of the 6700 students, 6030 passed.

Topic: Percentages

Add. Simplify the answer and write the answer as a mixed number if appropriate 1/9 + 5/6

Answers

Final answer:

To add fractions 1/9 and 5/6, find the least common denominator, which is 18, and then add the numerators of the equivalent fractions with the same denominator. The sum is 17/18, a simplified fraction.

Explanation:

To add fractions with different denominators, you must first find a common denominator. For the fractions 1/9 and 5/6, the least common denominator is 18. Multiply each fraction by a form of 1 that will give them this new denominator without changing their value.

For 1/9, you multiply it by 2/2 to get 2/18. For 5/6, you multiply it by 3/3 to get 15/18. Now that the fractions have the same denominator, you can add the numerators together: 2/18 + 15/18 equals 17/18. Since 17/18 is less than 1, it is already simplified and there is no mixed number to write.

Bob bought 24 hockey tickets for $83. Adult tickets cost $5.50, and child tickets cost $2.00. How many child tickets did he buy

Answers

Answer:

14

Step-by-step explanation:

This can be solved by writing 2 equations and solving simultaneously.

Let number of Adult tickets be A, and number of child tickets be C.

"Bob bought 24 hockey tickets":

[tex]A+C=24[/tex]

"Adult tickets cost $5.50, and child tickets cost $2.00...Bob bought 24 hockey tickets for $83":

[tex]5.5A+2C=83[/tex]

Now we can solve the first equation for A and substitute in 2nd equation and get the value of C.

A + C = 24

A = 24 - C

Now,

5.5 A + 2 C = 83

5.5 (24 - C) + 2C = 83

132 - 5.5C + 2C = 83

-3.5 C = 83 - 132

-3.5C = - 49

C = 14

Hence, Bob bought 14 child tickets

Jessica bought 12 pieces of candy at the store for $0.65 each. How much did she spend in all?
Please respond without using google

Answers

Jessica purchased 12 pieces of sweets for $7.8. Use multiplication, In mathematics, one finds the product of two or more numbers.

Calculate how much she spend?

Multiplying in math is the same as adding equal groups. The number of items in the group grows as we multiply. Parts of a multiplication issue include the product, the two factors, and the product. The factors in the multiplication problem 12x 65 = 780 are the numbers 12 and 65, and the product is the number780.

Detailed explanation:

Using the formulas 12•65 or 12x65 = 780

Step-by-step explanation: The solution is 780 if you enter 12•65 or 12x65=78. ie , $7.8.

Jessica purchased 12 pieces of sweets for $7.8.  

To learn more about Multiplication refer to:

https://brainly.com/question/10873737

#SPJ2

Final answer:

To find the total cost of the candy Jessica bought, we multiply the quantity (12 pieces) by the price per piece ($0.65) to get a total of $7.80 spent.

Explanation:

Jessica bought 12 pieces of candy at the store for $0.65 each. To find out how much she spent in all on the candy, we simply multiply the number of pieces of candy by the price per piece.

Using the equation:
total cost = (number of pieces) × (price per piece),
we get:
total cost = 12 × $0.65.

By doing the multiplication, we find that:
total cost = $7.80.

Therefore, Jessica spent $7.80 on the 12 pieces of candy.

7 square root of 75 simplify

Answers

7√75 = 7√25√3 = 35√3.

Final answer:

The simplification of the expression 7 * square root of 75 is 35 * square root of 3. This is achieved by factoring 75 into prime factors and finding pairs of those factors to take out from under the square root.

Explanation:

To simplify the expression 7 * square root of 75, we first need to break down 75 into a product of prime factors:

75 = 5*5*3.

Since the square root of a number is the factor that, when squared, equals the original number, we can take out a pair of 5s from the square root:

Square root of 75 = 5 * square root of 3.

Finally, multiply this by 7 to get:

7* square root of 75 = 7 * 5 * square root of 3 = 35 * square root of 3.

Learn more about Square Root here:

https://brainly.com/question/1540542

#SPJ2

given the similar figures name all pairs of corresponding sides and angles​

Answers

Answer:

Step-by-step explanation:

Simplify the expression -2.5f+0.8f-13-5

Answers

To simplify we can collect like terms so we get -1.7f-18 :)

Round each number to the nearest... 100; 387,530

Answers

To round 387,530 to the nearest hundred, we leave the hundreds digit unchanged because the tens digit is 3, which is less than 5. The rounded number is therefore 387,500.

To round the number 387,530 to the nearest hundred, we look at the tens digit, which is 3.

The rounding rule states that if the digit to the right of the rounding place is less than 5, you do not change the rounding digit. If it is 5 or more, you round up. Since the tens digit is 3, it is less than 5, hence we do not round up.

The hundreds digit is 5, and because we do not round up, 387,530 rounded to the nearest hundred is 387,500.

Remember, rounding off to a certain place involves looking at the digit immediately to the right of the place you are rounding to.

Deciding whether to round up or keep the original number the same is based on whether this digit is less than or equal to 4, or 5 and above respectively.

How many ways can you choose 2 books from a shelf of 40 books

Answers

Answer:

Hence, the number of ways of doing so is:

                                780 ways.

Step-by-step explanation:

We know that if we have to choose r items out of a total of 'n' items then the number of ways of doing so is calculated by the formula of combination as:

                             [tex]n_C_r[/tex]

which is given by:

[tex]n_C_r=\dfrac{n!}{r!\times (n-r)!}[/tex]

Here we have to chose 2 books out of a shelf of 40 books.

i.e. we have: n=40 and r=2

Hence, the number of ways of doing so is:

[tex]{40}_C_{2}=\dfrac{40!}{2!\times (40-2)!}\\\\\\{40}_C_2=\dfrac{40!}{2!\times 38!}\\\\\\{40}_C_2=\dfrac{40\times 39\times 38!}{2!\times 38!}\\\\\\{40}_C_2=\dfrac{40\times 39}{2}\\\\\\{40}_C_2=780[/tex]

            Hence, the answer is:

                   780

Final answer:

In mathematics, the concept of combinations is used when selecting items from a larger group where order doesn't matter. Using the combination formula, we find that there are 780 ways to select 2 books from a shelf of 40 books.

Explanation:

The question pertains to the concept of combinations in mathematics. When you're selecting items, such as books, from a larger group and the order in which you select them doesn't matter, you are dealing with combinations. In this case, you are choosing 2 books from a selection of 40, and the order in which you select them doesn't matter.

To solve this, we use the combination formula nCr = n! / [(n-r)! r!], where 'n' represents the total number of items, 'r' is the number of items to choose, and '!' denotes factorial. In this scenario, n = 40 (total number of books) and r = 2 (number of books to select).

So, substituting these into the formula, we get 40C2 = 40! / [(40-2)! 2!] = (40*39) / (2*1)= 780.

Therefore, there are 780 ways to select 2 books from 40.

Learn more about Combinations here:

https://brainly.com/question/39347572

#SPJ3

17. Farimah and Helio are standing 15 ft. apart from each other and looking up at a kite that is with the flying between them. Farimah is flying the kite on a 57 ft. string at an angle of 68 ground. How far is Helio from the kite? 64.1 ft. 56.2 ft 60.0 ft. 53.2 ft.

Answers

Answer:

Helio is 53.2 feet from the kite ⇒ the last answer

Step-by-step explanation:

* Lets change this story problem to a trigonometry problem

- Assume that there is a triangle joining between the

 kite, Farimah and Helio

- The name of the triangle is KFH, where K position of the kite,

 F position of Farimah and H is the position of Helio

∵ Farimah and Helio are standing 15 feet apart from each other

∴ FH = 15 feet

∵ Farimah is flying the kite on a 57 feet string at an angle

 of 68 with the ground

∴ FK = 57 feet

∴ m∠KFH = 68°

∵ We need to know that Helio is how far from the kite

∴ We need to calculate the length of KH

* Now lets find the best way to find the length of KH

 using the trigonometry

- We have the length of two sides and the measure of the included

 angle between them , then the best way is the cosine Rule

* Lets explain the cosine rule:

- In ΔABC:

∵ a is the length of the side opposite to ∠A ⇒ a is BC

∵ b is the length of the side opposite to ∠B ⇒ b is AC

∵ c is the length of the side opposite to ∠C ⇒ c = AB

∴ a² = b² + c² -2bc × cos(A)

∴ b² = a² + c² -2ac × cos(B)

∴ c² = a² + b² -2ab × cos(C)

* We will use the rule in our problem to find HK

∵ FH is k , HK is f , KF is h

∴ f² = h² + k² - 2hk × cos(F)

∵ h = 57 feet , k = 15 feet , m∠F = 68°

∴ f² = (57)² + (15)² - 2(57)(15) × cos(68) = 2833.4227

∴ f = √2833.4227 = 53.2 feet

* Helio is 53.2 feet from the kite

 

Write your answer in simplest form. −1.6⋅(0.5)⋅(−20)

Answers

Answer:

16

Step-by-step explanation:

-1.6*.5*-20

=-.8*-20

=-4/5*-20

=16

Answer:

16

Step-by-step explanation:

Solve the equation.

y + 3 = –y + 9

y = 1
y = 3
y = 6
y = 9

(please provide an explanation) thank you :)

Answers

Answer:

3

Step-by-step explanation:

Let's get the variable y on the left side only and the constants on the right side only.  To do this, add y to both sides.  

This results in 2y = 6, and so y = 3.

Answer:

B

Step-by-step explanation:

The student body at a high school was surveyed about sports participation. The table below shows the data by grade level.
The number of students who are in 9th grade and play two or more sports is a
'marginal frequency'
'Joint frequency'
The number of students who are in the 11th grade is a
'marginal frequency'
'joint frequency'
The percentage of the student body that plays one sport is a
'marginal relative frequency'
'joint relative frequency'
The percentage of the student body that are in 12th grade and do not play a sport is a
'marginal relative frequency'
'joint relative frequency'

Answers

Marginal frequency:

The number in the end column or row - "Total".

Joint frequency:

The ratio of the frequency in a particular category and the total number of data values.

Basically, the values that aren't in the final row or column - "Total".

The number of students who are in 9th grade and play two or more sports is a  joint frequency.

This is only asking for the students in 9th grade who play two or more sports.

The number of students who are in the 11th grade is a  marginal frequency.

This is asking for the total number of students in 11th grade.

The percentage of the student body that plays one sport is a  marginal relative frequency'.

This is asking for the total number of students who play 1 sport.

The percentage of the student body that are in 12th grade and do not play a sport is a  joint relative frequency.

This is only asking for the students in 12th grade and don't play sports.

Answer:

The answer is D on edge

The cross-section of a ramp is a triangle with side lengths of 9 inches, 40 inches, and 41 inches. Is this a right triangle?

Answers

Answer: True.

Step-by-step explanation: For this to be true, then:

[tex]9^2+40^2(=?)41^2[/tex]

[tex]81+1600 (=?) 1681[/tex]

[tex]1681=1681[/tex]

Yes, the ramp is indeed a right triangle.

Final answer:

The triangle with sides of 9 inches, 40 inches, and 41 inches is a right triangle, as it satisfies the Pythagorean theorem (9² + 40² = 41²).

Explanation:

A student asked if a ramp with a triangular cross-section and side lengths of 9 inches, 40 inches, and 41 inches is a right triangle. To determine this, we can use the Pythagorean theorem, which states that in a right triangle, the square of the length of the hypotenuse (the side opposite the right angle) is equal to the sum of the squares of the lengths of the other two sides.

For the triangle in question, if we square each of the side lengths and add the squares of the shorter sides, we should get the square of the longest side if it is indeed a right triangle:

9² = 8140² = 160041² = 1681

Then add the squares of the two shorter sides:

81 + 1600 = 1681

Since 1681 equals 41², the triangle with sides of 9 inches, 40 inches, and 41 inches satisfies the Pythagorean theorem, confirming it is a right triangle.

What number is the same as 10^-5

Answers

Answer:

0.00001

Step-by-step explanation:

   1

______

100000

hope this helps

In an acute scalene triangle, one angle is 20 degrees larger than another angle and the third angle is half the sum of the other two angles. What is the measure, in degrees, of each of the three angles of the triangle?

Answers

Answer:

it could be 20 30 and 25

Step-by-step explanation:

Question 3 options:
Now simplify each piece. Fill in the blanks:

(1.__) ±(2.___√(3.__)
1.__

2.__
3.__
Question 4 (3 points)

Answers

Hi, sorry i couldn't understand the format of the question, could you post a picture of the question please?

Neither do I understand the format, what is the numbers involved? or a picture please

help subtract (xsquared +43x10)-(10xsquared-5x+10 express the answer in standard form

Answers

Answer:

[tex]\large\boxed{(x^2+43x+10)-(10x^2-5x+10)=-9x^2+48x}[/tex]

Step-by-step explanation:

[tex](x^2+43x+10)-(10x^2-5x+10)\\\\=x^2+43x+10-10x^2-(-5x)-10\\\\=x^2+43x+10-10x^2+5x-10\qquad\text{combine like terms}\\\\=(x^2-10x^2)+(43x+5x)+(10-10)\\\\=-9x^2+48x[/tex]

Help! 20 points. Show step-by-step solution.

Answers

use the quadratic formula and plug in the coefficients

[tex]3x - 9 {x}^{2} = - 10 \\ - 9 {x}^{2} + 3x + 10 = 0 \\ b = 3 \\ a = - 9 \\ c = 10 \\ - \frac{3 + \sqrt{ {3}^{2} - 4( - 9)(10) } }{2( - 9)} \\ \frac{ - 3 + \sqrt{9 + 360} }{ - 18} \\ \frac{ - 3 + 3 \sqrt{41} }{{ - 18} } \\ \frac{ - 1 + \sqrt{41} }{ - 6} [/tex]

I wasn't able to the plus or minus sign in so I just used the plus sign you can look up the quadratic formula online

how to solve 4.5×-7=20​

Answers

Simplifying

4.5x + -7 = 20

Reorder the terms:

-7 + 4.5x = 20

Solving

-7 + 4.5x = 20

Solving for variable 'x'.

Move all terms containing x to the left, all other terms to the right.

Add '7' to each side of the equation.

-7 + 7 + 4.5x = 20 + 7

Combine like terms: -7 + 7 = 0

0 + 4.5x = 20 + 7

4.5x = 20 + 7

Combine like terms: 20 + 7 = 27

4.5x = 27

Divide each side by '4.5'.

x = 6

Simplifying

x = 6

whoops my mistake next time please explain more...

Write the polynomial as a product: p2q+r2–pqr–pr

Answers

[tex] {p}^{2} q + {r}^{2} - pqr - pr \\ = pq(p - r) - r(p - r) \\ = (pq - r)(p - r)[/tex]

Answer:

(p - r)(pq - r)

Step-by-step explanation:

P = p²q + r² – pqr – pr  

Rewrite the equation in descending orders of p and increasing orders of r.

P = p²q - pqr - pr + r²

Factor the first two and the last two terms

P = pq(p - r) - r(p - r)

Remove the common factor

P = (p - r)(pq - r)

I don’t know how to do this XD plzzzz help meh

Answers

Answer:

D) 5/2 divided by 8/6

Step-by-step explanation:

Factor 1/7 out of 1/7x+46/7. 1/7x+46/7=

Answers

Final answer:

To factor 1/7 out of 1/7x+46/7, you can factor it out of each term separately and then combine like terms.

Explanation:

To factor 1/7 out of 1/7x+46/7, you can factor it out of each term separately. So you would have:

1/7(1/7x) + 1/7(46/7)

Simplifying each term gives us:

1/49x + 1/49(46)

Finally, you can combine like terms to get the answer:

1/49x + 46/49

Find the value of X rounded to the nearest tenth
A)5.1
B)9.2
C)5.8
D)5.2

Answers

Answer:

B

Step-by-step explanation:

Chords which intersect have segments whose products are equal. This means the chord with lengths 5 and x has a product 5x. It is equal to the the other chords lengths 5.1 and 9 as a product 5.1*9.

5x = (5.1)(9)

5x = 45.9

x = 9.18

9.18 rounds to the tenth place as 9.2

The teacher passed out math books.The length is 10 inches and the width is 8 inches.What is the perimeter of each book?

Answers

Answer:  The perimeter of each book is:  " 36 in. " .

__________________________________________________

Step-by-step explanation:

__________________________________________________

Note that the given units are all in "inches (in.)" .

Use the formula for the "perimeter of a rectangle" ;

{which happens to work for a "square" as well;

          since a "square" is a rectangle.}.

__________________________________________________

This is based on the assumption that the book is shaped like a

"rectangle"  (or "square" —which is a rectangle).

__________________________________________________

The formula for the Perimeter of a rectangle is:

  P = 2 L  + 2 w  ;

in which:

P =  the perimeter of the rectangle;

for which we shall solve;   [in "inches (in.)" ] ;

L =  the length of the rectangle = 10 in. (given) ;

w = the width of the rectangle = 8 in. (given) .

___________________________________________________

Now, plug the given values for the "length (L)" and the "width (w)" ;

 as follows:

___________________________________________________

    P = (2 * 10 in.)  +  (2 * 8 in.)  ;

    P = (20 in.)  +  (16 in.)  ;

   P = 36 in.

___________________________________________________

Answer:  The perimeter of each book is:  " 36 in. " .

___________________________________________________

Hope this helps!

    Best wishes in your academic pursuits

            — and within the "Brainly" community!

___________________________________________________

h + 6.9=11.4 what dose h= worth a lot of points please help will give brainlist

Answers

Answer: 4.5

Step-by-step explanation:

11.4-6.9=4.5

Answer:

h = 4.5

Step-by-step explanation:

You would do 11.4 - 6.9, which would equal 4.5.

solve the equation -7+2q=4​

Answers

Regroup terms

2q - 7 = 4

Add 7 to both sides

2q = 4 + 7

Simplify 4 + 7 to 11

2q = 11

Divide both sides by 2

q = 11/2

Other Questions
According to the federal regulations, which of the following studies meets the definition of research with human subjects?A. A researcher conducts a comparison of the comments made in a publicly available blog and the blogger's comments on a similar topic in a weekly magazine.B. A researcher sets up a meeting with the superintendent of a large and diverse public school system to get data about the ethnic composition of the school system and the number of students receiving free lunches.C. A cognitive psychologist enrolls undergraduate students for a computer-based study about the effect of mood on problem solving behaviors.D. Undergraduate students in a field methods class are assigned a research question and asked to interview another classmate, to be followed by a class discussion on interview techniques. Solve the triangle that has a=4.6, B=19, A=92 (picture provided) Consider the following balanced equation: SiO2(s)+3C(s)SiC(s)+2CO(g) Complete the following table showing the appropriate number of moles of reactants and products. If the number of moles of a reactant is provided, fill in the required amount of the other reactant, as well as the moles of each product formed. If the number of moles of a product is provided, fill in the required amount of each reactant to make that amount of product, as well as the amount of the other product that is made.Mol SiO2 Mol C Mol SiC Mol CORow 1: 3 _____ _____ _____Row 2: _____ 6 _____ _____Row 3: _____ _____ _____ 16Row 4: 2.8 _____ _____ _____Row 5: _____ 2.45 _____ _____A. complete the first row. Express your answers using one significant figure separated by commas. Mol C, Mol SiC, Mol CO =B. Complete the second row. Express your answers using one significant figure separated by commas. Mol SiO2, Mol SiC, Mol CO =C. Complete the third row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =D. Complete the fourth row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =E. Complite the fifth row. Express your answers using three significant figures separated by commas. Mol SiO2, Mol SiC, Mol CO = The emergence of__________ led people to question the role of religion in government. what is -4,5 reflected across the x axis 3(14-5x) = 72what is x A(n) __________ consists of independent firms at different levels of production and distribution joining together through contracts. Suppose there are ten five- and six-year-olds attending a birthday party. when a 30-year-old mother walks into the room with an infant in her arms, what happens to the mean age in the room? what happens to the standard deviation of ages in the room? remmi wrote the equation of the line y=1/3(x+2). He solved for x and got x=3y-2. which following is an equivalent equation for x? The belief that some races are innately superior to others is called _____ sidaanth kept a chart of his savings .which point represents this relationship? One of the functions of the respiratory system is to rid the body of co2. Where does the co2 come from? A rectangle has a perimeter of 48 inches. Each side is a whole number of inches. What is the difference between the greatest and least areas that the rectangle can have Organizations can be small or large groups. Please select the best answer from the choices provided T F What is the term for heat transfer because of the movement of electromagnetic The abdominal wall muscle that forms the inguinal ligament is the _______________. How can you identify the geography of the Mesoamerican Civilizations? There are THREE of them. Explain what you know about EACH one. What is the value of x? Show all of your work.Round your answer to the nearest tenth. What are the x and y intercepts of y=x^2+3x-10 (show all steps please) What type of molecule speeds up chemical reactions in living things? A. Lipid B. Nucleic acid C. Protein D. Water