A mechanical dart thrower throws darts independently each time, with probability 10% of hitting the bullseye in each attempt. The chance that the dart thrower hits the bullseye at least once in 6 attempts is:

Answers

Answer 1

Answer:

The probability of hitting the bullseye at least once in 6 attempts is 0.469.

Step-by-step explanation:

It is given that a mechanical dart thrower throws darts independently each time, with probability 10% of hitting the bullseye in each attempt.

The probability of hitting bullseye in each attempt, p = 0.10

The probability of not hitting bullseye in each attempt, q = 1-p = 1-0.10 = 0.90

Let x be the event of  hitting the bullseye.

We need to find the probability of hitting the bullseye at least once in 6 attempts.

[tex]P(x\geq 1)=1-P(x=0)[/tex]       .... (1)

According to binomial expression

[tex]P(x=r)=^nC_rp^rq^{n-r}[/tex]

where, n is total attempts, r is number of outcomes, p is probability of success and q is probability of failure.

The probability that the dart thrower not hits the bullseye in 6 attempts is

[tex]P(x=0)=^6C_0(0.10)^0(0.90)^{6-0}[/tex]

[tex]P(x=0)=0.531441[/tex]

Substitute the value of P(x=0) in (1).

[tex]P(x\geq 1)=1-0.531441[/tex]

[tex]P(x\geq 1)=0.468559[/tex]

[tex]P(x\geq 1)\approx 0.469[/tex]

Therefore the probability of hitting the bullseye at least once in 6 attempts is 0.469.


Related Questions

You have recorded your car mileage and gasoline use for 5 weeks. Estimate the number of miles you can drive on a full 15-gallon tank of gasoline.

Answers

Answer:

I think its 21.6 or 22 (Mostly 21.6 though) Sorry if its not right but i'm mostly sure of it like this!

Can someone please help me, I need to know the missing side length (x) using trigonometric ratios.

Answers

Answer:

x = 5.34

Step-by-step explanation:

The reference angle is 24 degrees.  I'm sure you are aware from the square at the other base angle that is a right triangle.  Right triangles have ratios by which we can determine missing side and angle measures.  The sin of a reference angle has a ratio that is side opposite/hypotenuse.  The cos of a reference angle has a ratio that is side adjacent/hypotenyse.  The tan of a reference angle has a ratio that is side opposite/side adjacent.

We need to decide which of these fits our needs according to the angle and sides we are given and need to find.  We have the reference angle as 24 degrees, we have the side adjacent to this angle as 12.  We are looking for x, which is the side opposite the reference angle.  Looking to what our definitions are for each ratio, the sides opposite and adjacent are defining the tan of the reference angle.  Setting up the ratio then looks like this:

[tex]tan(24)=\frac{x}{12}[/tex]

Multiply both sides by 12 to get

12 tan(24) = x

Do this on your calculator in DEGREE mode to get that

x = 5.342744224

Not sure what your teacher has you round to, but I usually have my students give me 2 decimal places



What is the volume of the following triangular prism?

288 ft3
480 ft3
96 ft3
576 ft3

Answers

The base is a right triangle with side lengths of 6 and 8 ft.

The area of a triangle is 1/2 x base x height = 1/2 x 6 x 8 = 24 square feet.

Now to find the volume, multiply the area by the height:

24 square ft x 12 ft = 288 ft^3

Answer:

i think it is 288 ft^3

Step-by-step explanation:


At the movie theatre, child admission is $5.20 and adult admission is $9.80
. On Tuesday, 147 tickets were sold for a total sales of $1054.20. How many child tickets were sold that day?

Answers

Answer:

  84 child tickets were sold

Step-by-step explanation:

Had they all been adult tickets, revenue would have been ...

  $9.80 × 147 = $1440.60

It was less by ...

  $1440.60 -1054.20 = $386.40

The child's ticket costs less by ...

  $9.80 -5.20 = $4.60

so there must have been $386.40/$4.60 = 84 child tickets sold.

__

Replacing an adult ticket with a child ticket reduces the revenue by $4.60 without changing the number of tickets sold.

_____

You can let c represent the number of child tickets sold. Then (147 -c) is the number of adult tickets sold, and total revenue is ...

  5.20c + 9.80(147 -c) = 1054.20

  -4.60c +1440.60 = 1054.20 . . . . simplify

  -4.60c = -386.40 . . . . . . . . . . . . . subtract 1440.60

  c = 386.40/4.60 = 84

Which products result in a perfect square trinomial? Check all that apply. (x + 9)(x 9) (xy + x)(xy + x) (2x 3)(3 + 2x) (16 x2)(x2 16) (4y2 + 25)(25 + 4y2)

Answers

Answer:

(xy + x)(xy + x)(16 x2)(x2 16) (4y2 + 25)(25 + 4y2)

Step-by-step explanation:

The product of two identical binomial factors will be a perfect square trinomial. The appropriate answer choices are those having both factors the same.

Answer:

2nd 3rd5th

Step-by-step explanation:

(xy + x)(xy + x)

(16 x2)(x2 16)

(4y2 + 25)(25 + 4y2)

URGENT PLEASE HELP WITH THIS MATH QUESTION ALSO IT WOULD BE GREAT IF SOMEONE CAN HELP ME WITH SOME OTHER QUESTIONS

Answers

Answer:

Area=14.22π

Step-by-step explanation:

Area=πr²(C/360)

C  is the central angle in degrees

r  is the radius of the circle of which the sector is part.

Area = π(8)²(80/360)

Area=π(64)(0.2222)

Area=π(14.22)

Area=14.22π....

Which statement wether Shannon is correct ?

Answers

Answer:

Option B A rectangular prism in which BA=30 and h=5 has a volume of 150 units³, therefore, Shannon is correct

Step-by-step explanation:

step 1

Find the area of the base of the rectangular pyramid

The volume of the rectangular pyramid is equal to

[tex]V=\frac{1}{3}BH[/tex]

where

B is the area of the base and H is the height of the pyramid

we have

[tex]V=50\ units^{3}[/tex]

[tex]H=5\ units[/tex]

substitute and solve for B

[tex]50=\frac{1}{3}B(5)[/tex]

[tex]B=30\ units^{2}[/tex]

step 2

Find the volume of the rectangular prism with the same base area and height than the rectangular pyramid

The volume of the rectangular prism is equal to

[tex]V=BH[/tex]

where

B is the area of the base and H is the height of the pyramid

we have

[tex]B=30\ units^{2}[/tex]

[tex]H=5\ units[/tex]

substitute

[tex]V=(30)(5)=150\ units^{3}[/tex]

step 3

Compare the volumes

Volume of the rectangular pyramid -------> [tex]50\ units^{3}[/tex]

Volume of the rectangular prism -------> [tex]150\ units^{3}[/tex]

therefore

The volume of the rectangular prism is three times the volume of the rectangular pyramid

Shannon is correct

A person died leaving property worth rs.4000.40. His widow get 0.125 of the property and his son got 0.4 of the remainder. What did his widow and his son get

Answers

Answer:

Widow's Share = Rs 500.05

Son's share = Rs 1400.14

Step-by-step explanation:

Property = 4000.40

Widow get share = 0.125

So, Share of Widow = 0.125 * 4000.40

Widow's Share = Rs 500.05

Remaining Property = 4000.40 - 500.05

Remaining Property = 3500.35

Son's share = 0.4 * 3500.35

Son's share = Rs 1400.14

To solve this problem, we will follow these steps:
1. Calculate the widow's share of the property.
2. Determine the remainder of the property after the widow has received her share.
3. Calculate the son's share of the remainder of the property.
Step 1: Calculate the widow's share.
The widow gets 0.125 (or 12.5%) of the total property. The total property is valued at 4000.40 units (where the unit could be in rupees, dollars, etc.).
Widow's share = Total property * Widow's share percentage
              = 4000.40 * 0.125
Let's calculate that:
Widow's share = 4000.40 * 0.125
              = 500.05
So, the widow gets 500.05 units.
Step 2: Determine the remainder of the property.
Now, subtract the widow's share from the total property to find out how much is left for the son to receive his share from.
Remainder of property = Total property - Widow's share
                      = 4000.40 - 500.05
Let's calculate that:
Remainder of property = 4000.40 - 500.05
                      = 3500.35
Now we have 3500.35 units remaining after the widow has received her share.
Step 3: Calculate the son's share.
The son gets 0.4 (or 40%) of the remainder of the property.
Son's share = Remainder of property * Son's share percentage
            = 3500.35 * 0.4
Let's calculate that:
Son's share = 3500.35 * 0.4
            = 1400.14
So, the son gets 1400.14 units.
To summarize, the widow receives 500.05 units of the property, and the son receives 1400.14 units of the property after the widow has received her share.

Determine the slope of the line that contains the given points T(4,6) a V(8,7)

A) -1/2
B) 4
C) 1/4
D) -4

Answers

The answer is C. 1/4

Finding the slope using two points:

The formula for slope is

[tex]\frac{y_{2}-y_{1}}{x_{2}-x_{1}}[/tex]

In this case...

[tex]y_{2} =7\\y_{1} =6\\x_{2} =8\\x_{1} =4[/tex]

^^^Plug these numbers into the formula for slope...

[tex]\frac{7 - 6}{8 - 4}[/tex]

C) [tex]\frac{1}{4}[/tex]

^^^This is your slope

Hope this helped!

~Just a girl in love with Shawn Mendes

Helppppppp please quickly

Answers

Answer:

For [tex]3,604\ books[/tex] the cost for both methods will be the same

Step-by-step explanation:

Let

y ------> the production cost

x ------> the number of books

we know that

First production Method

[tex]y=19.25x+22,427[/tex] -------> equation A

Second production Method

[tex]y=10.50x+53,962[/tex] -------> equation B

Solve the system of equations

Equate equation A and equation B and solve for x

[tex]19.25x+22,427=10.50x+53,962[/tex]

[tex]19.25x-10.50x=53,962-22,427[/tex]

[tex]8.75x=31,535[/tex]

[tex]x=3,604\ books[/tex]

The Greek mathematician Eratosthenes (ca. 276-195 BC) measured the circumference of the earthfrom the following observations. He noticed that on a certain day the sun shone directly down a deep wellin Syene (modern Aswan). At the same time in Alexandrea, 500 miles north (on the same meridian), therays of the sun shone at an angle of 7.2° to the zenith. Use this information to find theradius and circumference of the earth.

Answers

Answer:

Radius of the Earth is 3978.8 Miles

Circumference of the Earth is 25000 Miles

Step-by-step explanation:

The angle of the sun shone at an angle of 7.2° to the zenith

This means that the angle of the sector of the circle is 7.2° (θ)

S = Length of the sector of the circle = 500 miles

r = radius of earth

Converting 7.2° to radians

[tex]\theta =7.2\frac{\pi}{180}[/tex]

[tex]S=r\theta\\\Rightarrow r=\frac{S}{\theta}\\\Rightarrow r=\frac{500}{7.2\frac{\pi}{180}}\\\Rightarrow r=3978.8\ Miles[/tex]

∴ Radius of the Earth is 3978.8 Miles

[tex]C=2\pi r\\\Rightarrow C=2\times \pi \frac{500}{7.2\frac{\pi}{180}}\\\Rightarrow C=25000\ Miles[/tex]

∴ Circumference of the Earth is 25000 Miles

The radius and circumference are respectively; r = 3978.86 miles and C = 25000 miles

What is the radius and circumference?

We are told that the angle of the sun shone at an angle of 7.2° to the zenith. Thus, we can liken this to the angle of a sector and so;

Angle of the sector of the circle; θ = 7.2° = 0.125664 rad

Length of the sector of the circle; S = 500 miles

Formula for length of arc is;

S = rθ

where;

S is length of arc

r is radius

θ is angle of sector in radians

Thus;

r = S/θ = 500/0.125664

r = 3978.86 miles

Formula for circumference is;

C = 2πr

C = 2 * π * 3978.86

C = 25000 miles

Read more about Circumference at; https://brainly.com/question/14283575

Find the longer leg of the triangle.


A. 3

B. [tex]\sqrt{3}[/tex]

C. 9

D. [tex]\sqrt{6}[/tex]

Answers

Answer:

Choice A. 3.

Step-by-step explanation:

The triangle in question is a right triangle.

The length of the hypotenuse (the side opposite to the right angle) is given. The measure of one of the acute angle is also given.

As a result, the length of both legs can be found directly using the sine function and the cosine function.

Let [tex]\text{Opposite}[/tex] denotes the length of the side opposite to the [tex]30^{\circ}[/tex] acute angle, and [tex]\text{Adjacent}[/tex] be the length of the side next to this [tex]30^{\circ}[/tex] acute angle.

[tex]\displaystyle \begin{aligned}\text{Opposite} &= \text{Hypotenuse} \times \sin{30^{\circ}}\\ &=2\sqrt{3}\times \frac{1}{2} \\&= \sqrt{3}\end{aligned}[/tex].

Similarly,

[tex]\displaystyle \begin{aligned}\text{Adjacent} &= \text{Hypotenuse} \times \cos{30^{\circ}}\\ &=2\sqrt{3}\times \frac{\sqrt{3}}{2} \\&= 3\end{aligned}[/tex].

The longer leg in this case is the one adjacent to the [tex]30^{\circ}[/tex] acute angle. The answer will be [tex]3[/tex].

There's a shortcut to the answer. Notice that [tex]\sin{30^{\circ}} < \cos{30^{\circ}}[/tex]. The cosine of an acute angle is directly related to the adjacent leg. In other words, the leg adjacent to the [tex]30^{\circ}[/tex] angle will be the longer leg. There will be no need to find the length of the opposite leg.

Does this relationship [tex]\sin{\theta} < \cos{\theta}[/tex] holds for all acute angles? (That is, [tex]0^{\circ} < \theta <90^{\circ}[/tex]?) It turns out that:

[tex]\sin{\theta} < \cos{\theta}[/tex] if [tex]0^{\circ} < \theta <45^{\circ}[/tex];[tex]\sin{\theta} > \cos{\theta}[/tex] if [tex]45^{\circ} < \theta <90^{\circ}[/tex];[tex]\sin{\theta} = \cos{\theta}[/tex] if [tex]\theta = 45^{\circ}[/tex].

Answer:

A

Step-by-step explanation:

Since the triangle is right use the cosine ratio

cos30° = [tex]\frac{adjacent }{hypotenuse}[/tex] = [tex]\frac{adj}{2\sqrt{3} }[/tex], so

[tex]\frac{\sqrt{3} }{2}[/tex] = [tex]\frac{adj}{2\sqrt{3} }[/tex]

Multiply both sides by 2[tex]\sqrt{3}[/tex]

adj = [tex]\frac{\sqrt{3} }{2}[/tex] × 2[tex]\sqrt{3}[/tex] = 3

In? 2008, a country used ?twenty-five percent or 100 million tons of all the grain grown that year to produce ethanol. How much grain was grown in the country in? 2008?

Answers

Answer:

400,000,000 tons

Step-by-step explanation:

You could reword this sentence to ask the question, "100,000,000 is 25% of how much?"

The word "is" means equals, the percent will be .25 in decimal form, the word "of" means to multiply, and "how much" is x, our unknown.  In equation form, then, this looks like

100,000,000 = .25 × x

We will divide both sides by .25 to get that

x = 400,000,000

That's how much grain was grown in 2008

Answer: 400 million tons

Step-by-step explanation:

100 millions is 1/4 of 400 million

Of what numbers does the binary system consist of

Answers

Answer:

0 and 1

Step-by-step explanation:

binary

0 and 1


Binary numbers

Use the discriminant to determine how many and what kind of solutions the quadratic equation x^2−x=−1/4 has


Select one:

a. two real solutions

b. no real or complex solutions

c. one real solution

d. two complex (nonreal) solutions

its c

Answers

A=1
B= -1
C= 1/4

B^2-4ac
(-1)^2 -4(1)(1/4)
1 -1
0 = 1 solution

Using the discriminant to know about the nature of the solution of the quadratic equation x² -x = -1/4 tells us the fact as given by: Option c. one real solution

How to use discriminant to find the property of solutions of given quadratic equation?

Let the quadratic equation given be of the form [tex]ax^2 + bx + c = 0[/tex], then

The quantity [tex]b^2 - 4ac[/tex] is called its discriminant.

The solution contains the term [tex]\sqrt{b^2 - 4ac}[/tex] which will be:

Real and distinct if the discriminant is positiveReal and equal if the discriminant is 0Non-real and distinct roots if the discriminant is negative

There are two roots of a quadratic equations always(assuming existence of complex numbers). We say that the considered quadratic equation has 2 solution if roots are distinct, and have 1 solutions when both roots are same.

For this case, the given equation is:

[tex]x^2 - x = -1/4[/tex]

Converting this to the form [tex]ax^2 + bx + c = 0[/tex], we get:

[tex]x^2 - x + 1/4= 0\\or\\4x^2 -4x + 1 = 0[/tex]

Thus, we get:

a = 4, b = -4, c = 1

Putting these values in the expression for discriminant, we get:

[tex]D = b^2 - 4ac =(-4)^2 - 4(4)(1) = 16 - 16 = 0[/tex]

The discriminant is 0, so the considered quadratic equation is going to have both roots real and equal. Or in terms of distinct solutions, it is going to have one real solution (distinct).

Thus, using the discriminant to know about the nature of the solution of the quadratic equation x² -x = -1/4 tells us the fact as given by: Option c. one real solution

Learn more about discriminant of a quadratic equation here:

https://brainly.com/question/18659539

#SPJ2

What is the volume of the oblique cone? Round to the nearest tenth. 142.4 cubic units 142.4 square units 196.0 cubic units 196.0 square units

Answers

Answer:

142.4 cubic units

Step-by-step explanation:

Formula: π * r²

Radius = 4

Height = 8.5

Volume = 1/3 x 3.14 x (4)^2 x 8.5 =

142.4 cubic units

Final answer:

The volume of an oblique cone is given in cubic units. The two options presented as cubic units are 142.4 and 196.0. Without additional measurements, we cannot calculate the exact volume, but we know that the volume must be one of these two options.

Explanation:

The question is asking to determine which of the provided values represents the volume of an oblique cone. Volume is the measure of space occupied by a three-dimensional object and is expressed in cubic units. In general, the volume of a cone can be calculated using the formula V = (1/3)πr²h, where 'r' is the radius of the base, 'h' is the height, and π is Pi, approximately 3.14159. Since an oblique cone has a circular base but is tilted, the formula for its volume is the same as that of a right cone.

Looking at the options provided, we need to determine which value most likely represents the volume of a cone. Since volume is expressed in cubic units, the correct answer will be in cubic units, not square units. Therefore, we can immediately eliminate the options with 'square units' as they represent an area measure instead of volume.

Thus the potential answers could either be 142.4 cubic units or 196.0 cubic units. Without additional information, such as the dimensions of the base and the height, we cannot perform the calculation to further refine the answer. However, the question might be simplifying the process by providing the answer directly, and it is up to the student to choose between the given cubic unit options based on an understanding of volumes rounding procedures, if applicable.

A lopsided coin has a probability of 1/3 for coming up heads and 2/3 for coming up tails. On average, how many flips of this coin are needed to have both heads and tails appear at least once? Give your answer as a reduced fraction.

Answers

Answer with explanation:

For a Lopsided coin ,probability of getting Head is equal to [tex]\frac{1}{3}[/tex] For a Lopsided coin ,probability of getting Tail  is equal to [tex]\frac{1}{3}[/tex].

Probability of getting Tail > Probability of getting Head

→Coin is heavier from tail side and lighter from Head side.

→→We have to Calculate number of flips of coin that is needed to have both heads and tails appear at least once.

[tex]\rightarrow P(\text{Head})=\frac{1}{3}\\\\ \frac{1}{3} \times x=1\\\\x=3\\\\\rightarrow P(\text{Tail})=\frac{2}{3}\\\\ \frac{2}{3} \times y=1\\\\y=\frac{3}{2}[/tex]

→We need to find common multiple of 3 and [tex]\frac{3}{2}[/tex].

Least common multiple of 3 and [tex]\frac{3}{2}[/tex] is 6.

→So,on Average number of flips of this coin are needed to have both heads and tails appear at least once=6 tosses

                                                                             

Solve the system of equations. 4x - 4y = 10 3x + 2y = 5
ANSWER CHOICES
(2, -1/2)
(1, 1)
(3, -2)
(3,1/2 )

Answers

Answer:

A) (2, -1/2)

Step-by-step explanation:

Start with one equation and isolate a variable:

4x - 4y = 10

4x - 4x - 4y = 10 - 4x

-4y = 10 - 4x

-4y/-4 = 10/-4 - 4x/-4

y = -2 1/2 + x

Now plug this in for y in the other equation:

3x + 2(-2 1/2 + x) = 5

3x - 5 + 2x = 5

5x - 5 = 5

5x - 5 + 5 = 5 + 5

5x = 10

5x/5 = 10/5

x = 2

Right here we can tell your answer is A since it is the only one with 2 as the x-value

A wholesaler requires a minimum of 4 items in each order from its retail customers. The manager of one retail store is considering ordering a certain number of sofas, x, and a certain number of pillows that come in pairs, y. Which graph represents the possible combinations of sofa and pillow orders the manager can have?

Answers

Answer:

It is the last graph: solid line, shaded area over the line x = 2 - x/2

Explanation:

1) Set the algebraigic expression that represents the combinations of sofa and pillow orders:

Number of sofas: x (given)Number of pillows: 2y (given, since they come in pairs)Number of items = number of sofas + number of pillows = x + 2yMinimum of 4 items in each order (given) ⇒ x + 2y ≥ 4

2) Predict the graph of the inequality x + 2y ≥ 4

The border line is the equation x + 2y = 4You can choose two points to draw a lineChoose the axis-intercepst:

        x = 0 ⇒ 2y = 4 ⇒ y =4/2 ⇒ y = 2 ⇒ point (0,2)

        y = 0 ⇒ x = 4 ⇒ point (4,0)

        Then the lines goes through (0,2) and (4,0) ... [the four graphs meet this]

The shading area is above the line because when you solve for y you get y ≥   2 - x/2, and the line is included because the "equal to" part of the symbol (≥ means greater than or equal to).

 To state that the line is included the graph uses a continous line instead of a dotted one.

3) Conclusion:

That means that the correct graph is the last one: solid line, shaded area over the line y = 2 - x/2.

Note: a more detailed graph would include the fact that the items cannot be negative, i.e. x ≥ 0 and y ≥ 0, which would result in that the shaded area would be on the first quadrant.

   

Answer: D

Step-by-step explanation:

Dirt cut 2 ft deep from a section of land 33 ft by 65 ft is used to fill a section 23 ft by 22ft to a depth of 4 how many cubic yards of dirt are left after the fill

Answers

Answer:

  83 25/27 yd³

Step-by-step explanation:

Assuming a 4 ft depth of fill, the cut volume is ...

  (2 ft)(33 ft)(65 ft) = 4290 ft³

The fill volume is ...

  (23 ft)(22 ft)(4 ft) = 2024 ft³

The left over dirt occupies a volume of ...

  4290 ft³ -2024 ft³ = 2266 ft³ = (2266 ft³)(1 yd³)/(27 ft³) = 83 25/27 yd³

HELP ME!!!
Select the correct answer from the drop-down menu.

The value of x that satisfies the equation is °.

Answers

Answer:

210 is the only choice I see listed that works.

Step-by-step explanation:

I don't know if you know this but you can apply a co-function identity here giving you the equation:

[tex]cos(x)=-\frac{\sqrt{3}}{2}[/tex].

If you are unsure of the identity sin(90-x)=cos(x) then I can show you another identity that leads to this one.

The difference identity for sine is sin(a-b)=sin(a)cos(b)-sin(b)cos(a).

Applying this to sin(90-x) gives you sin(90)cos(x)-sin(x)cos(90).

Let's simplify that using that sin(90)=1 while cos(90)=0:

sin(90-x)=sin(90)cos(x)-sin(x)cos(90)

sin(90-x)=1cos(x)-sin(x)(0)

sin(90-x)=cos(x)

You can also prove this identity using a right triangle like the one in this picture:  

That missing angle is 90-x since we need the angles in this triangle to add up to 180 which it does:

(x)+(90)+(90-x)

x+90+90-x

x-x+90+90

0+180

180

Anyways you should see that sin(90-x)=b/c while cos(x)=b/c.

Since they are equal to the same ratio, then you can say sin(90-x)=cos(x).

There are other co-function identities you can get from using this idea.

Anyways back to the problem.

We are solving:

[tex]cos(x)=-\frac{\sqrt{3}}{2}[/tex].

It looks like you have a drop-down menu with answers ranging from 0 to 360.

So I'm going to answer in degrees using the unit circle.

cosine value refers to the x-coordinate.

We are looking for when the x-coordinate is [tex]-\frac{\sqrt{3}}{2}[/tex] which is at [tex]\theta=150^\circ , 210^\circ[/tex].

Paul and Tom both commute to work. Paul's commute on the train takes 15 minutes more than one third as many minutes as Tom's commute by car. It takes Paul 45 minutes to get to work. Write an equation to determine how many minutes it takes Tom to get to work.

45 = one thirdx − 15
45 = one thirdx + 15
45 = 3x − 15
45 = 3x + 15

Answers

Answer:

  45 = (one third)x + 15

Step-by-step explanation:

If x represents the number of minutes Tom commutes, then (1/3)x is "one-third as many minutes as Tom's commute." 15 minutes more than that is ...

  (1/3)x + 15

We are told this is the length of Paul's commute, and that it is 45 minutes. So, the appropriate equation is ...

  45 = (1/3)x +15

Answer: 45 = (one third)x + 15

Step-by-step explanation:

Zoe has $3.25 worth of dimes and quarters. She has 6 more quarters than dimes. Determine the number of dimes and the number of quarters that Zoe has.

Answers

Answer:

quarters = 6+x

dimes = x

Total value = 325

Dime value = 10

Quarter value = 25

Step-by-step explanation:

25x+150+10x=325 (simplify)

35x=175

x=5  

6+5 = 11  

Hence Zoe has 5 dimes and 11 quarters.

Hope this helps!!❤

What is the radius of the following circle?

Answers

Answer:

r = +2√3

Step-by-step explanation:

The equation of a circle with center at (0, 0) and radius r is

x^2 + y^2 = r^2.

Here we have

x^2 + y^2 = 12,

and so we can deduce that r^2 = 12.  Then r = +2√3.

Answer:

The radius is: [tex]2\sqrt{3}[/tex]

Step-by-step explanation:

The equation of a circle in center-radius form is:

[tex](x - h)^2 + (y - k)^2 = r^2[/tex]

Where the center is at the point (h, k) and the radius is "r".

So, given the equation of the circle:

[tex]x^2+y^2=12[/tex]

You can identify that:

[tex]r^2=12[/tex]

Then, solving for "r", you get that the radius of this circle is:

[tex]r=\sqrt{12}\\\\r=2\sqrt{3}[/tex]

Milford Company uses the​ percent-of-sales method to estimate uncollectibles. Net credit sales for the current year amount to $ 140 comma 000​, and management estimates 2​% will be uncollectible. The Allowance for Uncollectible Accounts prior to adjustment has a credit balance of $ 3 comma 000. The amount of expense to report on the income statement will be?

Answers

Amount of expenditure to be shown on the income statement = 0 and Income from the reversal of additional balance = $200

What are Arithmetic operations?

Arithmetic operations can also be specified by subtracting, dividing, and multiplying built-in functions.

Given that the Allowance for Uncollected Accounts is at 2% based on the percentage of sales method, the closing amount for the current year must be 2% of credit sales.

Current year credit sales = $140,000

Allowance for Uncollected Accounts = $140,000 × 2% = $2,800

the current amount of Allowance for Uncollected Accounts is $3,000, it is already $200 in excess of the threshold ($3000 - $2800), hence it must be reversed by $200.

Amount of expenditure to be shown on the income statement = 0.

Income from the reversal of additional balance = $200

Learn more about Arithmetic operations here:

brainly.com/question/25834626

#SPJ2

Final answer:

To calculate the expense for uncollectibles using the percent-of-sales method, multiply the net credit sales by the estimated percentage of uncollectibles. For Millford Company, this calculation is $140,000 * 2%, resulting in an expense of $2,800, ignoring the existing allowance balance.

Explanation:

The student has asked how to calculate the expense to report on the income statement for uncollectibles using the percent-of-sales method. Millford Company estimates that 2% of their net credit sales of $140,000 will be uncollectible. To find the uncollectible expense, you multiply the total net credit sales by the estimated percentage, which is $140,000 * 2% = $2,800. Since the Allowance for Uncollectible Accounts has a prior credit balance of $3,000, the current period's expense recognized in the income statement is calculated by adjusting for this existing balance. However, if the question simply asks for the expense amount based on current sales, it ignores the pre-adjustment balance and focuses solely on the estimated uncollectibles from current sales, which is $2,800.

How many positive integers are there whose digits strictly increase from left to right?

Answers

infinitely many, I am like 97.3% sure

There are 511 positive integers whose digits strictly increase from left to right.

To determine how many positive integers have digits that strictly increase from left to right, we need to consider combinations of digits. Since the digits must strictly increase, we cannot repeat any digit, and we can only use digits from 1 to 9.

Each number can be considered a unique combination of these digits, where the order of digits matters. For example, the digits {1, 2, 3} can only form the number 123. The total number of such combinations is given by the binomial coefficient C(9, k), where k is the number of digits.

For 1-digit numbers, the count is :C(9, 1) = 9For 2-digit numbers :C(9, 2) = 36For 3-digit numbers :C(9, 3) = 84And so on, up to 9-digit numbers which is :C(9, 9) = 1Summing these values, we get the total number of positive integers with strictly increasing digits :9 + 36 + 84 + 126 + 126 + 84 + 36 + 9 + 1 = 511Therefore, there are 511 positive integers whose digits strictly increase from left to right.

Suppose that a single card is selected from a standard​ 52-card deck. What is the probability that the card drawn is a clubclub​?

Now suppose that a single card is drawn from a standard​ 52-card deck, but it is told that the card is blackblack. What is the probability that the card drawn is a clubclub​?

Answers

Answer:

The probability that the card drawn is a club is 0.25.

The probability that card drawn is a club, when it is given that the card is black is 0.5.

Step-by-step explanation:

In a standard​ deck of cards:

Total number of cards = 52

Total number of cards of each suit (club, spade,heart, diamond) = 13

The probability that the card drawn is a club is

[tex]P=\frac{\text{Favorable outcomes}}{\text{Total outcomes}}[/tex]

[tex]P=\frac{^{13}C_1}{^{52}C_1}=\frac{13}{52}=0.25[/tex]

Therefore the probability that the card drawn is a club is 0.25.

Let A and B represents the following events:

A : Card is black

B : Card is a club

Total number of black cards = 26

[tex]P(A)=\frac{26}{52}=\frac{1}{2}=0.5[/tex]

From the above parts

[tex]P(B)=0.25[/tex]

Total number of black club cards = 13

[tex]P(A\cap B)=\frac{13}{52}=\frac{1}{4}=0.25[/tex]

We need to find the probability that card drawn is a club, when it is given that the card is black.

[tex]P(\frac{B}{A})=\frac{P(A\cap B)}{P(A)}[/tex]

[tex]P(\frac{B}{A})=\frac{0.25}{0.5}=0.5[/tex]

Therefore the probability that card drawn is a club, when it is given that the card is black is 0.5.

Please help me with this problem.

Answers

Answer:

b. 9/5

Step-by-step explanation:

Cotangent is the inverse of tangent.

tan θ = y/x

cot θ = x/y

cot θ = (-9)/(-5)

cot θ = 9/5

just to add to that great reply by @MathPhys above

[tex]\bf (\stackrel{adjacent}{-9},\stackrel{opposite}{-5})~\hfill cot(\theta )=\cfrac{\stackrel{adjacent}{-9}}{\stackrel{opposite}{-5}}\implies cot(\theta )=\cfrac{9}{5}[/tex]

bear in mind that, the value coordinate pairs we get is the (x,y) coordinates, and x = adjacent side of the triangle whilst y = opposite side of it.

If a baseball player hits a baseball from 4 feet off the ground with an initial velocity of 64 feet per second, how long will it take the baseball to hit the ground? Use the equation h = −16t2 + 4t + 4. Round your answer to the nearest hundredth.
please answer asap

Answers

Answer:

t = 4.06 sec

Step-by-step explanation:

First of all, if the initial velocity is 64 feet per second, then the parabola should actually look like this:

[tex]h(t)=-16t^2+64t+4[/tex]

The initial velocity is in the place of our linear term, so it should be 64 not just 4.

Anyways, the h(t) value represents the height of the object after a certain number of seconds, t, it was launched from the initial height. We are looking for the length of time it takes the object to hit the ground.  The height of something on the ground is 0.  So we replace h(t) with a 0 and factor to solve for the values of t:

[tex]0=-16t^2+64t+4[/tex]

If you plug that into the quadratic formula to factor it, you will get that the values of t are

t = -.06 seconds and

t = 4.06 seconds

We all know that the 2 things in math that will never EVER be negative are time and distance/measures, so we can safely disregard the negative value of time.  

It takes the ball 4.06 seconds to hit the ground when it is launched from an initial height of 4 feet.

The solution generated by the calculator is 5.779E–8. Describe how to interpret the solution.

Answers

Answer:

5.779 x 10^-8 =0.00000005779

Step-by-step explanation:

The E-8 at the end means the number is multiplied by 10^-8.

So 5.779E-8=5.779 x 10^-8

A negative power means move the decimal place that many places to the left

So 5.779 x 10^-8 =0.00000005779

Answer:

Sample response: The E indicates scientific notation. The first number is the coefficient of the number in scientific notation. This number is multiplied by a power of 10. The number following the E, which is –8, is the exponent, and the base is 10.

Step-by-step explanation:

2020

Other Questions
A ____ is a group of words that work together to express an idea and can function as a noun, adjective, verb, or adverb. In formulating hypotheses for a statistical test of significance, the null hypothesis is often A) A statement of no effect or no difference. B) The probability of observing the data you actually obtained. C) A statement that the data are all D) 0. 0.05. An object of weight 8N is moving along a horizontal plane. If the coefficient of kinetic friction is 0.25 find the friction force acting on the object. Pretend you're playing a carnival game and you've won the lottery, sort of. You have the opportunity to select five bills from a money bag, while blindfolded. The bill values are $1, $2, $5, $10, $20, $50, and $100. How many different possible ways can you choose the five bills? (Order doesn't matter, and there are at least five of each type of bill.) A. 56 B. 120 C. 288 D. 462 The original price of a skateboard was reduced by $15. The new price is $49. Solve the equation over the interval [0,2pi) 4cscx + 6= -2 How does drug effect the behavior of chromosomes during mitosis The number N(t) of people in a community who are exposed to a particular advertisement is governed by the logistic equation. Initially, N(0) = 500, and it is observed that N(1) = 1000. Solve for N(t) if it is predicted that the limiting number of people in the community who will see the advertisement is 50,000. Affirmations and strokes relate to the power of adult Cul de las siguientes funciones es una funcin constante? a. Y=x+1 b. Y=x+2 c. X=y+3 d. Y=3 Could someone check that I did this correctly? It's about complex numbers. Thank you! Evaluate the sum or explain why it diverges: Sigma^infinity_k = 3(-3/2)^k what do victor and walton have in common in frankenstein?A) they both want to impress the women they loveB) they both fail to achieve their scientific desiresC) they both suffer failure instead of fameD) they both pursue science for the benefit of society Redgreen color blindness is an X-linked recessive trait in humans. Polydactyly (extra fingers and toes) is an autosomal dominant trait. Martha has normal fingers and toes and normal color vision. Her mother is normal in all respects, but her father is color blind and polydactylous. Bill is color blind and polydactylous. His mother has normal color vision and normal fingers and toes. If Bill and Martha marry, what proportions of children with specific phenotypes would they be expected to produce? The answers only include the proportions of some of the possible phenotypes; other phenotypes are also expected to occur but are not included. An ideal gas in a sealed container has an initial volume of 2.50 L. At constant pressure, it is cooled to 21.00 C, where its final volume is 1.75 L. What was the initial temperature? High-density lipoproteins (HDLs) transport cholesterol from cells to the liver, where it becomes part of bile. HDLs are ____________ lipoproteins because they are used in cell repair and growth and do not tend to accumulate in body spaces where they are not needed. Give the structure of the expected organic product in the reaction of 3phenylpropanal with sodium hydroxide in ethanol at 70C. If your structure contains an aldehyde do NOT use the condensed formula (CHO), draw it out. Which of the following would be the most logical first step to solving thisquadratic equation?2x2-x+ 2 = -11OA. Divide both sides by x.OB. Take the square root of both sides.OC. Set up smaller equations using the zero product rule.OD. Add 11 to both sides. Which of the following fat-soluble vitamins is an antioxidant necessary for synthesizing visual pigments, can be found in butter and leafy green vegetables, and can lead to blindness when a person's diet is deficient in it?a. Vitamin Db. Vitamin Ac. Vitamin Kd. Vitamin E To help plan its nursing staff schedule, a large hospital uses simple exponential smoothing to forecast the daily number of hospital beds that will be occupied on each of the next few days. Using a smoothing parameter of 0.56 , the forecast for today's number of occupied beds was 385, although at day's end the actual number of occupied beds was reported to be 386. Using this information, calculate a forecast of the daily bed count for each of the next few days. Round your answer to the nearest integer.