A motor bike gets $60 kilometers per gallon of gasoline how many gallons of gasoline would the bike need to travel 240 kilometers

Answers

Answer 1
Make a proportion:

60 km/ 1 g = 240 km/ x

Cross multiply to find x.

60x = 240

x = 4  The bike would need 4 gallons of gasoline.
Answer 2

To calculate the amount of gasoline needed, divide the distance to travel (240 kilometers) by the vehicle's fuel efficiency (60 kilometers per gallon), which results in 4 gallons.

To find out how many gallons of gasoline a motorbike would need to travel 240 kilometers, we can use the provided fuel efficiency of the bike, which is 60 kilometers per gallon. The calculation involves dividing the total distance by the fuel efficiency:

First, write down the given efficiency: 60 kilometers per gallon.

Next, divide the distance to be traveled (240 kilometers) by the fuel efficiency:

240 kilometers / 60 kilometers per gallon = 4 gallons.

Thus, the motorbike would require 4 gallons of gasoline to travel 240 kilometers.


Related Questions

Tim and Maria went on a cruise together, but agreed to divide their expenses. The cost of the room was R. The cost of the horseback riding excursion was $125 per person. The historic tour was $214 per couple. Tim and Maria equally split the cost of the room, but Tim also paid for both his and Maria's horseback riding excursion. Maria was to pay for the historic tour but only had to paid half price because the cruise line scratched their luggage, so they offered to pay the other half.

Answers

Tim paid more. $250 + 1/2R 
Maria only paid 107+ 1/2R
Hope that helps.

Can you prove that def=hgf? Justify your answer.

Answers

We can prove that ΔDEF = ΔHGF as follows; A: Yes, the triangles are congruent by SAS.

How to prove the congruence

Side DE is congruent to GH as seen in the fact that both have two line marks. These are opposite angles (EFD and HFG) and these angles are congruent.

Note that the opposite sides of a triangle are congruent and corresponding angles are also congruent. This is true of angles DEF and HGF. So, we can conclude that the triangles are congruent by SAS.

Complete Question:

Can you prove that ADEF = AHGF? Justify your answer:

A: Yes, the triangles are congruent by SAS. B: Yes, the triangles are congruent by SSS. C: Yes, the triangles are congruent by SSA. D: No, not enough information is given

7b divided by 12=4.2 what is b

Answers

Final answer:

To solve for b in the equation 7b divided by 12 equals 4.2, multiply both sides by 12 and then divide by 7, resulting in b being equal to 7.2.

Explanation:

To solve the equation 7b ÷ 12 = 4.2 for b, we must isolate b on one side of the equation. We can begin by multiplying both sides of the equation by 12 to cancel out the division by 12 on the left side. This results in the equation 7b = 4.2 × 12. To find the value of b, we then divide both sides of the equation by 7:

Multiply both sides by 12: 7b ÷ 12 × 12 = 4.2 × 12Simplify: 7b = 50.4Divide both sides by 7: 7b ÷ 7 = 50.4 ÷ 7b = 7.2

Therefore, the value of b is 7.2.

Final answer:

To find the value of b in the equation 7b/12 = 4.2, multiply both sides by 12 and then divide by 7 to get b = 7.2. The value of b is 7.2.

Explanation:

The student is asking how to find the value of b in the equation 7b divided by 12 equals 4.2. To solve for b, you can follow these steps:

Write down the original equation: 7b / 12 = 4.2.Multiply both sides of the equation by 12 to eliminate the denominator: 12 * (7b / 12) = 12 * 4.2, which simplifies to 7b = 50.4.Divide both sides by 7 to solve for b: 7b / 7 = 50.4 / 7, which gives b = 7.2.

Therefore, the value of b is 7.2.

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

Can some explain this to me do i need to covert something or can someone explain it to me how in gonna get the answer i try to do it and i got 60 and i think it is wrong

Answers

cross multiply:

2.5 ft x 16.5 ft = 41.25 ft

now divide:

41.25 / 8.25 = 5

L = 5 feet 

What is the area of the figure?

Express your answer as a mixed number in simplest form.

? m2

Answers

The area of this would be 1.69 or 1 69/100 in mixed number form.

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

Last summer we took an auto trip of 3427 miles . After we had driven 1578 miles , how many are left ?

Answers

There wold be 1,849miles left.
There are 1849 miles left to go!! Good luck!

The left and right page numbers of an open book are two consecutive integers whose sum is 423.

Answers

211 and 212. this is bc x+1 and x+2 is equal to 2x+3=423 and if you solve for  it equals 210 so 210 +1 =211 and 210+2=213

A Bird Is flying 5 m/s. How far will it travel if it flies for 3minutes

A. 15m
B. 5m
C. 900m
D. 36m

Answers

The bird is flying at 5m/s, so
1 sec = 5 m

It flies for 3 mins
3 mins = 3 x 6sec
3 mins = 180 sec
The bird flies for 180 seconds

1 sec = 5 m
180sec = 5 x 180 = 900m

The bird flew 900m in 3 mins (Answer C)

Philip is going on a 400040004000-kilometer road trip with three friends. The car consumes 666 liters of gas per 100100100 kilometers, and gas costs \$1.50$1.50dollar sign, 1, point, 50 per liter.

Answers

 If Philip and his friends want to split the cost of gas evenly, how much should they each pay?
the amount of gas it consumes per 100 km = 6 l
the cost per litre = $1.50
the total distance of the trip = 4000 km
If 100 km consumes - 6 l
Then 1 km consumes - 6/100 l/km
therefore amount of gas for the whole trip of 4000 km = 6/100 l/km * 4000 km
the gas consumed = 240 l
cost of 1 l = $1.5
then the cost of gas for the whole ride = 240 l * $ 1.5
  cost = $ 360
there are 4 friends , cost of each friend = $ 360/4 = $ 90
cost each friend has to pay = $ 90

Find a rational number that is between 9.5 and 9.7

Answers

9.5000032 is one such number

9.5000032 i think i'm not sure

You have a $50 gift card to the same site. You want to buy an album with 16 tracks for $12.99 and then use the rest of the gift card for single tracks. How many songs can you buy with the gift card?

Answers

first you will subtract 12.99 from 50
50 - 12.99 = 37.01
now you need to divide 16 by 12.99 to find out how much it costs for a single song
16 divided by 12.99 = $1.23
now you will divide 37.01 divided by 1.23
37.01 divided by 1.23 = about 30 
this means youll get about 30 single tracks with your gift card.
let me know if you have any further questions
:)

Final answer:

After purchasing an album for $12.99 from the $50 gift card, the remaining balance is $37.01, which allows the purchase of 37 more single tracks, assuming each track costs $1.

Explanation:

To determine how many songs can be bought with a $50 gift card after purchasing an album for $12.99, we need to subtract the cost of the album from the total amount on the gift card. So, we have:

Total amount on gift card: $50Cost of album: $12.99

Subtracting the cost of the album from the gift card amount gives us:

$50 - $12.99 = $37.01

Assuming that each single track costs $1 as per the scenario provided, we can divide the remaining balance by the cost per single track:

$37.01 ÷ $1 per track = 37 tracks

This means that you can purchase 37 more single tracks with the remaining balance on the gift card.

can someone help me with this

Answers

x is the supplement to 40°.
x is 140°.

I need some help what 9 + 10?

Answers

9 + 10 will equal 19
19, because if let's say you took 9 blocks, added 10, and counted them all, 19 would be the answer

Use Cavalieri’s Principle to calculate the exact volume of an oblique cylinder with a height of 10 meters and a circular base with a radius of 8 meters

Answers

I think it is 640 pi

Answer: Volume of an oblique cylinder is 2011.43 sq.m.

Step-by-step explanation:

Since we have given that

Radius of a cylinder = 8 meters

Height of a cylinder = 10 meters

Cavelieri's Principle states that volume of an oblique cylinder is same as the volume of right circular cylinder with equal radius and height.

As we know the formula for "Volume of cylinder":

[tex]Volume=\pi r^2h\\\\V=\frac{22}{7}\times 8\times 8\times10\\\\V=\frac{14080}{7}\\\\V=2011.43[/tex]

Hence, Volume of an oblique cylinder is 2011.43 sq.m.

What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



Oliver earns $93 per week mowing lawns in his neighborhood. Which expression can be used to show how much money he earns in 6 weeks?

Answers

1 week  = $93
6 weeks = $93 x 6 
6 weeks = $558

The system of equations 4x-y=4(x+1) , y = 6 has:
A. one solution
B. infinitely many solutions
C. no solution

Answers

The system of equations 4x-y=4(x+1) and y=6 has no solution.

To determine the solution(s) of the system of equations, let's analyze each equation:

Equation 1: 4x - y = 4(x + 1)

Equation 2: y = 6

To simplify Equation 1, we can distribute 4 on the right side:

4x - y = 4x + 4

By rearranging terms, we have:

- y = 4

Comparing Equation 2 with this result, we see that the two equations are contradictory. Equation 2 states that y = 6, while the modified Equation 1 states that y = -4. This means there is no value of y that can simultaneously satisfy both equations.

Thus, the system of equations has no solution.

Therefore, the correct answer is C. no solution.

To know more about system of equations, refer here:

https://brainly.com/question/30127282

#SPJ6

Sam is training for an upcoming wrestling match. He trains for 3.5 hours each day Monday through Wednesday. He trains 2.5 hours on Thursday and Friday. How many hours will he train if he trains for six weeks

Answers

3.5 * 3 = 10.5
2.5 * 2 = 5

10.5 + 5 = 15.5 hours for 1 week

15.5 * 6 = 93 hours in 6 weeks

three friends are in the same algebra class. Their scores on a recent test are three consecutive odd intergers whose sum is 279. find each score

Answers

x= 1st integer
x+2= 2nd integer
x+4= 3rd integer

Add the integers together

x + (x + 2) + (x + 4)= 279
combine like terms
3x + 6= 279
subtract 6 from both sides
3x= 273
divide both sides by 3
x= 91 first integer

Substitute x=91 to find 2nd & 3rd integers

2nd Integer
=x+2
=91+2
=93

3rd Integer
=x+4
=91+4
=95

ANSWER: The three test scores are 91, 93 and 95.

Hope this helps! :)

what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

What percent of 20 is 2?

Answers

2 is 10% of 20.

2/10 = 1/10 = 10%

Hope this helps!

2. Quadrilateral ABCD is inscribed in a circle. Find the measure of each of the angles of the quadrilateral. Show your work.

Answers

A cyclic quadrilateral is a quadrilateral whose vertices all touch the circumference of a circle.

Opposite angles in a cyclic quadrilateral add to 180 degrees. Quadrilateral ABCD is a cyclic quadrilateral.

< A+<C=180

Substituting <A and <B values given in figure:

x+2+x-2=180

Adding like terms:

2x=180

Dividing both sides by 2

x=90°

<A=x+2=90+2=92°

<C=x-2=90-2=88°

<D=x-10=90-10=80°

<B+<D=180

<B=180-80=100°

The angles of the quadrilateral ABCD are

<A=92°

<B=100°

<C=88°

<D=80°

Miguel’s teacher asks him to color for 4/8 of his grid. He must use three colors: red blue and green. There must be more green sections then red sections. How can Miguel color the section service grid to follow all the rules?

Answers

2/8 can be green, 1/8 can be red, and 1/8 can be blue. The amount of green is greater then the red section and it all adds up to 4/8 or 1/2.

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

Other Questions
The diprotic acid h2co3 can produce two buffers depending on the ph of the solution. identify the conjugate acid/base pair from carbonic acid that would form the most basic buffer. NEED HELP ASAP!!!!! PLEASE!!!!!How does Cry, the Beloved Country, by Alan Paton, reflect the cultural experiences of South Africans in the late 1940s? Through its depiction of Absaloms and Gertrudes fall from grace into sin, the novel describes the way in which many rural families failed to protect their children from the dangers of the city. By describing the brutal murder of Arthur Jarvis, the novel reflects the deep hatred that nonwhite South Africans felt toward white South Africans in Johannesburg. By depicting the unbreakable bond between Kumalo and John, the novel captures the unique importance of brotherhood within South African culture. Through its descriptions of the shantytowns around Johannesburg, Cry, the Beloved Country accurately presents the poverty, crime, and injustices that nonwhite South Africans experienced at this time. What gives Mary Shelley the idea for her story?A. a discussion between her husband and her about Darwins experimentsB. a discussion between Lord Byron and her husband about writing ghost storiesC. a discussion between Lord Byron and her husband about the nature of lifeD. a discussion between Lord Byron and her about his writing Childe Harold Brody calculated the area of a square to be16/36 square foot. Which shows the side length of the square? According to the author of the passage, the story of George Dantzig's first discovery has lived on because A contest on a game show receives -25 points for each wrong answer what integer represents the change in periods after three wrong answers The first agricultural species to be altered by genetic modification was the __________. A. watermelon B. squash C. soybean D. tomato Identify some of the side effects of negative energy balance. Which part of the brain signals when to start and stop eating? How do hunger and appetite differ? How can you approximate the number of calories required to keep you in energy balance? About _______ percent of the calories you take in are used for physiological functions like breathing, blood circulation, and digestion. A farmer wants to build a rectangular garden 10ft long and 6ft wide. How many feet of fencing should he buy? Which subatomic particle contains the energy stored in chemical bonds? isotope , neutron , electron , proton A loose union of independent states is a? The sales tax in mike's state is 6%. mike bought a jetta having a sales tax of $820. what was the cost of the vehicle? round to the nearest dollar. what single positive effect did the great depression have on latin America? Apple was a pioneer in user interface development, introducing the _____, complete with mouse and screen icons, in the early 1980s. a. binary line interface b. command line interface c. character user interface d. graphical user interface Why is implicit memory so difficult to study?a. it does not operate on a conscious levelb. it is a more recently identified type of memoryc. it is concerned with the identification of only certain words and objectsd. it is more susceptible to confabulation? Tickets for a concert sold for $8 for floor seats and $6 for balcony seats. For one performance, 400 tickets were sold, bringing in $2,888. How many of each ticket were sold? Convert the angle \theta=\dfrac{23\pi}{20}= 20 23 theta, equals, start fraction, 23, pi, divided by, 20, end fraction radians to degrees A. 41 Cu in B. 83 Cu in C. 124 Cu in D. 166 Cu in 540 seconds how many minutes Which option gives the correct chronological order of the milestones in the history of photo sharing? a. launch of photo-finishing website - photo CDs were used to store and distribute photos - launch of Photobucket - launch of Webshot b. photo CDs were used to store and distribute photos launch of photo-finishing websites launch of Webshots - launch of Photobucket c. launch of photo-finishing website - photo CDs were used to store and distribute photos - launch of Webshot - launch of Photobucket d. photo CDs were used to store and distribute photos launch of photo-finishing websites launch of Photobucket - launch of Webshots The correct answer is "B"