". As an operator in a chemical plant, you tenda
separating machine. After you fill the tank, the
content settles for 14 hours before the liquid is
removed. You fill the tank at 1:45 A.m. When do
you remove the liquid?
A.
2:15 A.M.
B. 2:45 A.M.
C. 3:00 A.M.
D. 3:15 A.M.
E. 3:45 A.M.

Answers

Answer 1

Answer:

3:45 P.M.

Step-by-step explanation:

After I fill the tank, the content settles for 14 hours before the liquid is removed.

So, the liquid is removed after content settlement i.e. after 14 hours of filling up the tank.

If I fill the tank at 1:45 A.M. then after 14 hours i.e. at 3: 45 P.M I will remove the liquid.

If we separate the 14 hours into (12 hours + 2 hours), then by adding 12 hours the time will remain the same, only the A.M. will change to P.M i.e. 1: 45 P.M. and then by adding 2 hours more the time will be 3:45 P.M. (Answer)  


Related Questions

What is a non-example of unit rate

Answers

Answer:

60 calories per day

Step-by-step explanation:

example: 60 calories per serving so obviously the non example is the opposite

LiAnn works in the Olde Tyme Soda Shopee. The shop sells milkshakes, double milkshakes, and triple milkshakes. A shake uses 1/8 cup of syrup, a double shake uses 1/4 cup of syrup, and a triple shake uses 3/ 8 cup of syrup. How many shakes of each kind could she make with 3 cups of syrup?

Answers

Answer:

[tex]\large \boxed{24; 12; 8}[/tex]

Step-by-step explanation:

1. Calculate the number of milkshakes

[tex]\text{Number of milkshakes}= \dfrac{\text{Total volume}}{\text{Volume of each milkshake}} = 3 \div \dfrac{1}{8}[/tex]

Invert the denominator and change division to multiplication

[tex]3\div\frac{1}{8} = 3\times \dfrac{8}{1}  = \mathbf{24}\\\\\text{LiAnn can make $\large \boxed{\mathbf{24}}$ milkshakes}[/tex]

2. Calculate the number of double milkshakes

[tex]\text{Number of double milkshakes}= \dfrac{\text{Total volume}}{\text{Volume of each double milkshake}} = 3 \div \dfrac{1}{4}[/tex]

Invert the denominator and change division to multiplication

[tex]3\div\dfrac{1}{4} = 3\times \dfrac{4}{1}  = \mathbf{12}\\\\\text{LiAnn can make $\large \boxed{\mathbf{12}}$ milkshakes}[/tex]

3. Calculate the number of triple milkshakes

[tex]\text{Number of triple milkshakes}= \dfrac{\text{Total volume}}{\text{Volume of each triple milkshake}} = 3 \div \dfrac{3}{8}[/tex]

Invert the denominator and change division to multiplication

[tex]3\div\dfrac{3}{8} = 3\times \dfrac{8}{3}[/tex]  

Cancel the 3s

[tex]3\times \dfrac{8}{3} = \mathbf{8}\\\\\text{LiAnn can make $\boxed{\mathbf{8}}$ triple milkshakes}[/tex]

How do you determine the slope of a line

Answers

The slope of a line is the amount of units it goes across the x axis by how many units it goes up the y axis. A line with slope 3 goes 3 spaces up for every one space along.

Answer:

To calculate the slope of a line you need only two points from that line, (x1, y1) and (x2, y2). There are three steps in calculating the slope of a straight line when you are not given its equation.

Step-by-step explanation:

Step One: Identify two points on the line. Step Two: Select one to be (x1, y1) and the other to be (x2, y2).

Label each pair of triangles with the postulate or theorem that proves the triangles are congruent.

Answers

Answer:

We can conclude that Δ GHI ≅ Δ JKL by SAS postulate.

Step-by-step explanation:

Δ GHI and Δ JKL are congruents because:

1. Their sides GH and JK are equal (9 units = 9 units)

2. Their included angles ∠G and ∠J are equal (62° = 62°)

3. Their sides GI and JL are equal (17 units = 17 units)

Now, we can conclude that Δ GHI ≅ Δ JKL by SAS postulate.

In a large city, the heights of 10-year-old children are approximately normally distributed with a mean of 53.7 inches and standard deviation of 7 inches.

(a) What is the probability that a randomly chosen 10-year-old child has a height that is less than than 38.2 inches? Round your answer to 3 decimal places.



(b) What is the probability that a randomly chosen 10-year-old child has a height that is more than 40.3 inches? Round your answer to 3 decimal places

Answers

Answer:

(A) 40.67

(B) 57.98

Step-by-step explanation:

I did it in my head

What is the value of x in the equation? 4 3/7 x − 3 1/2 = 12
A) 3 2/5
B) 3 1/2
C) 3 3/4
D) 3 6/7

Answers

Answer:

B) 3 1/2 or 7/2

Step-by-step explanation:

4 3/7=31/7

3 1/2=7/2

---------------

31/7x-7/2=12

31/7x=12+7/2

31/7x=24/2+7/2

31/7x=31/2

x=(31/2)/(31/7)

x=(31/2)(7/31)

x=7/2

Answer:

The answer is B.) 3 1/2

Step-by-step explanation:

4

3

7

x − 3

1

2

= 12

31

7

x −

7

2

= 12

31

7

x · 14 −

7

2

· 14 = 12 · 14

62x − 49 = 168

62x = 217

x =

217

62

=

7

2

= 3

1

2

John was born in 1980 for his grandmother was born in 1928 of the year is 2014 how old are both John and his grandmother

Answers

John is 34, Grandmother is 86.

2014 - 1980 = 34.

2014 - 1928 = 86.

:)

) What number makes the equation true?
-5+__=7 1/3

Answers

-5 + x = 7 1/3

X = 7 1/3 + 5

X = 12 1/3
2 1/3 because I learned this exact question at school it was onstly really easy

25. A company spends $34,000 annually on product payment costs. Its
total annual expenses are $296,000. About what percentage of the
total annual expenses is for product payment costs? Round to the
nearest hundredth of a percent.​

Answers

Answer:

The percentage of the total annual expenses for product payment costs is  11.49% .

Step-by-step explanation:

Given:

Annually costs on product company spends = $34000 and total annual expenses = $296000.

Now, to get the percentage of the total annual expenses for product payment costs. We will calculate the percentage, $34000 by $296000:

According to question:

[tex]\frac{34000}{296000} \times 100[/tex]

[tex]=0.11486\times 100[/tex]

[tex]=11.486[/tex]

Now, rounding to the nearest hundredth of a percent to 11.486 will be 11.49. As we see 6 in the thousandth place and 8 in hundredth place so rounding to decimal in hundredth place will change 8 into 9.

Therefore, the percentage of the total annual expenses for product payment costs is 11.49% .

add the following complex numbers (2-8)+(5-i)​

Answers

Answer:

-1-i

Step-by-step explanation:

(2-8)+(5-i)=-6+5-i=-1-i

Y''+Y'+Y=1
solve ordinary differential equation

Answers

Answer:

y(t) = c₁ e^(-1/2 t) cos(√3/2 t) + c₂ e^(-1/2 t) sin(√3/2 t) + 1

Step-by-step explanation:

y" + y' + y = 1

This is a second order nonhomogenous differential equation with constant coefficients.

First, find the roots of the complementary solution.

y" + y' + y = 0

r² + r + 1 = 0

r = [ -1 ± √(1² − 4(1)(1)) ] / 2(1)

r = [ -1 ± √(1 − 4) ] / 2

r = -1/2 ± i√3/2

These roots are complex, so the complementary solution is:

y = c₁ e^(-1/2 t) cos(√3/2 t) + c₂ e^(-1/2 t) sin(√3/2 t)

Next, assume the particular solution has the form of the right hand side of the differential equation.  In this case, a constant.

y = c

Plug this into the differential equation and use undetermined coefficients to solve:

y" + y' + y = 1

0 + 0 + c = 1

c = 1

So the total solution is:

y(t) = c₁ e^(-1/2 t) cos(√3/2 t) + c₂ e^(-1/2 t) sin(√3/2 t) + 1

To solve for c₁ and c₂, you need to be given initial conditions.

20.
0/1 points
Previous Answers
GHColAlg12 5.1.094.MI.
An account now contains $11,680 and has been accumulating interest at a 8% annual rate, compounded continuously, for 5 years. Find the initi
$ 3,3839
Need Help? Read It Watch It
Master It
Talk to a Tutor
Viewing Saved Work Revert to Last Response

Answers

Answer:

The initial investment was $7945.58.

Step-by-step explanation:

Use the compound interest formula: A = P(1 + r)^t

A is the ending amount, in this case 11,680.

P is the starting amount, which is unknown.

r is the interest rate in decimal form, in that case 8% is 0.08.

t is the time in years, in this case 5.

Substitute known values into the equation

A = P(1 + r)^t

11,680 = P(1.08)^5

11,680 = 1.47P

P = 11,680/1.47

P = 7945.58

The initial investment was $7945.58.

6% of what number is 2.36

Answers

Answer:

39.3

Step-by-step explanation:

100 / 6 is about 16, 16.66667 to be exact:

2.36 * 16.66667 =  approx. 39.3

Final answer:

To determine 6% of what number is 2.36, divide 2.36 by 0.06, resulting in an answer of approximately 39.33.

Explanation:

To find 6% of what number equals 2.36, we set up an equation where 6% (or 0.06) multiplied by a number 'x' equals 2.36. The equation looks like this: 0.06x = 2.36. To solve for 'x', you divide both sides of the equation by 0.06, which yields x = 2.36 ÷ 0.06. After calculating, you get that x equals 39.33. Therefore, 6% of 39.33 is 2.36.

how do i write this inequality

You must be at least 42 inches tall to ride the bumper cars at an amusement park. Write an inequality that represents this situation. Let x represent the heights of people who are allowed to ride the bumper cars.

Answers

The inequality for the given condition is x ≥ 42 inches

Solution:

Given that, the condition is you must be at least 42 inches tall to ride the bumper cars at an amusement park.  

We have to write an inequality that represents this situation.

Equations and inequalities are both mathematical sentences formed by relating two expressions to each other. In an equation, the two expressions are deemed equal which is shown by the symbol =

Where as in an inequality, the two expressions are not necessarily equal which is indicated by the symbols: >, <, ≤ or ≥

Let "x" represent the heights of people who are allowed to ride the bumper cars

Height of people who are allowed to ride the bumper cars should be at least 42 inches

Height of people ≥ 42 inches [ since at least condition holds even at 42 value also ]

x ≥ 42 inches

Hence, the inequality for the given condition is x ≥ 42 inches

(5x)(-2x)(3x) is equal to?

Answers

-30x cubed
There are three x hence the cubes and then all you do is multiply (5)(-2)and(3) together to get -30
-75 is the answer bc you have to multiply it

Identify which is NOT a Pythagorean triple.

A)5, 12, 13B)7, 24, 25C)8, 15, 16D)11, 60, 61E)12, 35, 37

Answers

Answer:

C)  8, 15, 16 is NOT Pythagorean TRIPLET.

Step-by-step explanation:

There numbers  a, b and c are said to be a PYTHAGORAS TRIPLET if

[tex](a) ^2 + (b)^2 = (c) ^2[/tex]

Now, here in the given options:

A)5, 12, 13

[tex](5)^2 +   (12)^2 = 25 +  144 = 169 = (13)^2\\\implies (5) ^2 + (12)^2 = (13) ^2[/tex]

Hence, 5, 12, 13 is a Pythagorean TRIPLET.

B)7, 24, 25

[tex](7)^2 +   (24)^2 = 49 +  576=  625 = (25)^2\\\implies (7) ^2 + (24)^2 = (25) ^2[/tex]

Hence, 7, 24, 25 is a Pythagorean TRIPLET.

C)8, 15, 16

[tex](8)^2 +   (15)^2 = 64 +  225=  289 \neq (16)^2 = 256\\\implies (8) ^2 + (15)^2 \neq (16) ^2[/tex]

Hence, 8, 15, 16 is NOT Pythagorean TRIPLET.

D)11, 60, 61

[tex](11)^2 +   (60)^2 = 121 +  3600 =  3721 =  (61)^2\\\implies (11) ^2 + (60)^2 = (61) ^2[/tex]

Hence, 11, 60, 61 is a Pythagorean TRIPLET.

E)12, 35, 37

[tex](12)^2 +   (35)^2 = 144 +  1225 =  3721 =  (37)^2\\\implies (12) ^2 + (35)^2 = (37) ^2[/tex]

Hence, 12,35 , 37 is a Pythagorean TRIPLET.

there are two green Skittles out of every five what percent are green​

Answers

Answer:

40%

Step-by-step explanation:

2 green of every 5:

[tex]\dfrac{2}{5}[/tex]

Convert to the percent:

[tex]\dfrac{2}{5}\cdot100\%=\dfrac{200}{5}\%=40\%[/tex]

g(x) = x - 6
If the opposite of g(x) is-g(x),
then--g(x) =

Answers

Answer:

  --g(x) = g(x) = x - 6

Step-by-step explanation:

The opposite of the opposite is the original.

the answer is 0

Step-by-step explanation:

on edge

What is the median of this set of data values? 11, 13, 14, 15, 18, 20, 23, 26

Answers

Step-by-step explanation:

= (11+13+14+15+18+20+23+26)/8

= 140/8

= 17.5

Answer:

16.5

Step-by-step explanation:

what is the slope for (12,5) (9,8)

Answers

We can use the points (12, 5) and (9, 8) to solve.

Slope formula: y2-y1/x2-x1

= 8-5/9-12

= 3/-3

= -1

______

Best Regards,

Wolfyy :)

Cara is 14 years old . This is twice as old as her brother . How old is her brother

Answers

Cara's brother is 7 years old.

14 is twice as much as 7 (7 * 2 = 14).

Answer:

7

Step-by-step explanation:

If Cara is twice the age of her brother,

divide 14/2

7, her brother is 7

What is the solution to the equation

1+1

Answers

Answer:

2

Step-by-step explanation:

but I would personally say FISH

Answer: Like I really told you what I just had said, "The answer to this basic math question with the given basic math expression is [tex]1+1=2.[/tex]"

Step-by-step explanation: Seriously, like I really told you what I just had said, "This seems extremely too simple and easy for me and the users of The Brainly in order to answer to this basic math question with your own given the basic math expression, there is just only 1 of the basic step-by-step explanation for the basic math question with the given basic math expression for me and the users of The Brainly in order to solve it that looks in the equation form like this: [tex]1+1=2.[/tex]"

So, anyway, I hoped that my own given quoted with my own given quoted basic answer and my own given quoted basic step-by-step explanation is being very helpful to your own basic math question with the given basic math expression what I've been just said and have a great rest of the weekend! :D

Sincerely,

Jason Ta,

The Ambitious of Brainly And The Role of The TDSB And WHCI Student of The High School.

Jacob has a 20 gallon fish tank. He could only find a quart size pitcher to fill his tank. How many times will Jacob have to fill the pitcher to get 19 gallons of water in his tank?
A
38

B
76

C
80

D
152

Answers

Answer:

B.76

Step-by-step explanation:

4 quarts = 1 gallon

so 4 * 19=76

In the box, type in the number that will correctly complete the sentence.

Jane has a debt of $63. She owes equal amounts to seven different people. Her debt to each person can be expressed as Answer
dollars.

Answers

Answer:

$9 to each person

Step-by-step explanation:

63/7=9

Answer: 9

Step-by-step explanation:

$63 divided by 7 people = $9 debt per person

Write the quadratic equation whose roots are -5 -4 and whose leading coefficient is 4

Answers

Answer:

y = 4x² + 36x + 80

Step-by-step explanation:

Since the roots are x = - 5 and x = - 4 then the factors are

(x + 5) and (x + 4)

The equation is the product of the factors

y = (x + 5)(x + 4) and with leading coefficient of 4 is

y = 4(x + 5)(x + 4) ← expand factors

  = 4(x² + 9x + 20)

  = 4x² + 36x + 80

A manufacturer of tennis rackets makes a profit of $15 on each oversized racket and $8 on each standard racket. To meet dealer demand, daily production of standard rackets should be between 30 and 80, and production of oversized rackets should be between 10 and 30. To maintain high quality, the total number of rackets produced should not exceed 80 per day. How many of each type should be manufactured daily to maximize profit?

Answers

Answer:

30 oversized rackets and 50 standard rackets

Step-by-step explanation:

To maximize profit, it is very essential she strikes a balance between the two type of rackets. It is important to note that the profit on oversized racket is twice that of standard racket. Hence, she must make as many oversized rackets as possible.

The highest number of oversized racket she can make is 30. Subtracting 30 from the total number of rackets give 50 standard racket

Final answer:

To maximize profit, represent the constraints as a system of inequalities, graph these to find a feasible region, and evaluate the profit function at each vertex of this region.

Explanation:Maximizing Profit with Production Constraints

To determine how many of each type of tennis racket a manufacturer should produce daily to maximize profit, we can set up a system of inequalities based on the given constraints and then use linear programming. The constraints are that the daily production of standard rackets (S) should be between 30 and 80, and production of oversized rackets (O) should be between 10 and 30. Additionally, the total number of rackets produced (S + O) should not exceed 80 per day.

The profit function to be maximized is P = 15O + 8S. The optimization process involves graphing the inequalities to form a feasible region, then evaluating the profit function at each vertex of this region to find the maximum profit point.

The constraints can be written as:

30 ≤ S ≤ 80 (constraint for standard rackets)10 ≤ O ≤ 30 (constraint for oversized rackets)S + O ≤ 80 (constraint for total production)


We look for the corner points of the feasible region that satisfies all the constraints and calculate the profit at each of these points. The highest profit among these calculated values will give us the optimal number of each type of racket to produce.

By systematically evaluating the profit P at the corner points of the feasible region, the manufacturer can identify the production levels of standard and oversized rackets that will maximize profit within the given constraints.

This approach ensures that the manufacturer can meet dealer demand, maintain high quality through production limits, and optimize profit based on the profit margins of each racket type.

14.
-2(y – 4) + 8y +2 < 16

Answers

Answer:

y<1

Step-by-step explanation:

-2(y-4)+8y+2<16

-2y+8+8y+2<16

6y+10<16

6y<16-10

6y<6

y<6/6

y<1

If t stands for the number of years since 2000 write an equation for the deer population p as a function of t

Answers

Final answer:

To write an equation for the deer population p as a function of t, we can assume a constant growth rate and use the equation p = 80 + rt, where r is the growth rate per year.

Explanation:

To write an equation for the deer population p as a function of t, we can use the information given. Let's assume that the population grows at a constant rate. If t represents the number of years since 2000, then we can write the equation as:

p = 80 + rt

where r is the growth rate per year. This equation assumes that there were 80 deer in the population in 2000, and the population has been growing at a constant rate since then.

Learn more about Deer population growth here:

https://brainly.com/question/36688505

#SPJ12

A scale has a percent error of 5%. The actual mass of a rock is 258 g.

Select from the drop-down menus to correctly complete the statement.

The scale is likely to show the mass is either [Choose...] g or [Choose...] g.

Please help, I have an F in math and the semesters almost over. Im doing over due so I can try to bring my grade up to a C. Please help, Ill give brainlyest.

Answers

Multiply the weight by 5%, then subtract that from the weight for the lower value and add it for the higher value:

258 x 0.05 = 12.9g

Lower value: 258 - 12.9 = 245.1g

Higher value: 258 + 12.9 = 270.9g

Solve for k
7k+2m = kr + 4m + 3

Answers

Answer:

[tex]\large\boxed{k=\dfrac{2m+3}{7-r}\ \text{for}\ r\neq7}[/tex]

Step-by-step explanation:

[tex]7k+2m=kr+4m+3\qquad\text{subtract}\ 2m\ \text{from both sides}\\\\7k+2m-2m=kr+4m-2m+3\\\\7k=kr+2m+3\qquad\text{subtract}\ kr\ \text{from both sides}\\\\7k-kr=kr-kr+2m+3\\\\7k-kr=2m+3\qquad\text{distribute}\\\\k(7-r)=2m+3\qquad\text{divide both sides by}\ (7-r)\neq0\\\\k=\dfrac{2m+3}{7-r}[/tex]

Other Questions
The nine basic training principles are specificity, overload, progression, recovery, variation, transfer, balance, individualization, and reversibility. How can the basic training principles influence the type of location that you choose? Select at least three of nine training principles to write about. On January 1, Innovative Solutions, Inc. issued $220,000 in bonds at face value. The bonds have a stated interest rate of 5 percent. The bonds mature in 10 years and pay interest once per year on December 31.Required:1, 2 & 3. Complete the required journal entries to record the bond issuance, interest payment on December 31, early retirement of the bonds. Assume the bonds were retired immediately after the first interest payment at a quoted price of 103. (If no entry is required for a transaction/event, select "No Journal Entry Required" in the first account field.) Mark Welsch deposits $8,000 in an account that earns interest at an annual rate of 8%, compounded quarterly. The $8,000 plus earned interest must remain in the account 4 years before it can be withdrawn. How much money will be in the account at the end of 4 years? Cousin Hector drove 1,851 miles to the reunion. He lives in Mexico and drove 747 miles through that country to the United States border. How many miles did he drive in the United States? 3.Mitosis and meiosis are similar processes, but they have some very important differences. Explain how mitosis and meiosis are alike and how they are different. Provide at least two similarities and three differences. The height of your success is equal to the depth of your gratitude. Explain this quote A total of $150000 is invested in two funds paying 6.25% and 6% simple interest. If the total interest for the year is $9212.50, how much is invested at each rate? I need help on these three. A car originally priced at $8,900 is on sale at 15% off. If the sales tax rate is 8.25%, what is the sale price of the car? alculate the enthalpy of the reaction 4B(s)+3O2(g)2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)3O2(g)+B2H6(g), HA=+2035 kJ 2B(s)+3H2(g)B2H6(g), HB=+36 kJ H2(g)+12O2(g)H2O(l), HC=285 kJ H2O(l)H2O(g), HD=+4 HELP I NEED YOUR HELP MATH ONE PROBLEM 10 POINTS HELP When you drink cold water, your body must expend metabolic energy in order to maintain normal body temperature (37 C) by warming up the water in your stomach. Could drinking ice water, then, substitute for exercise as a way to "burn calories?" Suppose you expend 286 kilocalories during a brisk hour-long walk. How many liters of ice water (0 C) would you have to drink in order to use up 286 kilocalories of metabolic energy? For comparison, the stomach can hold about 1 liter. Find the area and circumference of a circle with radius 2 cm use 3.14 for pie do not round answers Theodore Roosevelt is often called a "Progressive" President. Which of these would BEST be an example of this label? Which choice could be the equation of a line perpendicular to the line represented by this equation?y = 5x 2A.B.y = 5x +2C.D.y = 5x + 5 1. In dialogue, periods, commas, question marks, and exclamation points gomarks2. List the ways to make your writing sound more natural.3. List three ways to vary your sentences.4. Why is it important to use a personal touch?5. One way to add humor to your writing is by using 0.812In to a fraction The layout of an envelope can be adjusted using the ____ tab Surf City's ad Manager, Dan, calls the billboard company to buy the billboard. He speaks with Jim, a salesperson. Jim asks how long Dan intends to run the campaign. Dan replies he expects to keep an outdoor message up along the interstate for 10 years or more. Jim responds that while a 30-sheet poster is a good choice, more permanence and impact can be achieved with a(n)A. junior poster.B. painted bulletin.C. spectacular.D. inflatable panel.E. inside bus. When you go to vote at your local library, you notice your neighbor walking around keeping a watchful eye on voters and officials. What role is your neighbor filling at the polling place?