Assume that the weights of all packages of a certain brand of cookies are normally distributed with a mean of 32 ounces and a standard deviation of 0.3 ounce. find the probability that the mean weight, x¯, of a random sample of 20 packages of this brand of cookies will be between 31.8 and 31.9 ounces.

Answers

Answer 1
That probability is about 6.7%.
Assume That The Weights Of All Packages Of A Certain Brand Of Cookies Are Normally Distributed With A

Related Questions

the area of this circle is 72π m^2 what is the area of a 45° sector of this circle

Answers

A 45° sector is 1/8 of the area of the circle, so is (72π m^2)/8 = 9π m^2.

Lorne subtracted 6x3 – 2x + 3 from –3x3 + 5x2 + 4x – 7. Use the drop-down menus to identify the steps Lorne used to find the difference. 1. (–3x3 + 5x2 + 4x – 7) + (–6x3 + 2x – 3) 2. (–3x3) + 5x2 + 4x + (–7) + (–6x3) + 2x + (–3) 3. [(–3x3) + (–6x3)] + [4x + 2x] + [(–7) + (–3)] + [5x2] 4. –9x3 + 6x + (–10) + 5x2 5. –9x3 + 5x2 + 6x – 10

Answers

To find the polynomial difference, Lorne transformed the subtraction into addition of the opposite, combined like terms, and simplified the expression to get the result of -9x³ + 5x² + 6x - 10.

To find the difference between the two polynomials, Lorne correctly followed the steps of subtraction by changing the subtraction to the addition of the opposite. The process is outlined below:

Add the opposite of the second polynomial to the first polynomial by changing the sign of each term in the second polynomial.

Combine like terms by adding the coefficients of terms with the same degree of x.

Rearrange the terms in descending order of their degrees.

Write down the final simplified form of the polynomial.

By following these steps, the result would be:

Step 1:

(-3x³ + 5x² + 4x - 7) + (-6x³ + 2x - 3)

Step 2:

(-3x³ + 5x² + 4x - 7) + (-6x³) + 2x + (-3)

Step 3:

[(-3x³) + (-6x³)] + [4x + 2x] + [(-7) + (-3)] + [5x²]

Step 4:

-9x³ + 6x + (-10) + 5x2

Step 5:

-9x³ + 5x² + 6x - 10

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

The steps Lorne used to find the difference between [tex]-3x^{3} +5x^{2} +4x-7[/tex] and [tex]6x^{3} -2x+3[/tex] are:

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

Lorne first added the two polynomials by combining like terms, then simplified the result by collecting like terms. The final expression represents the difference between the two polynomials after combining and simplifying.

COMPLETE QUESTION:

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. Use the drop-down menus to identify the steps Lorne used to find the difference.

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

I need some help what 9 + 10?

Answers

9 + 10 will equal 19
19, because if let's say you took 9 blocks, added 10, and counted them all, 19 would be the answer

Last summer we took an auto trip of 3427 miles . After we had driven 1578 miles , how many are left ?

Answers

There wold be 1,849miles left.
There are 1849 miles left to go!! Good luck!

2. Quadrilateral ABCD is inscribed in a circle. Find the measure of each of the angles of the quadrilateral. Show your work.

Answers

A cyclic quadrilateral is a quadrilateral whose vertices all touch the circumference of a circle.

Opposite angles in a cyclic quadrilateral add to 180 degrees. Quadrilateral ABCD is a cyclic quadrilateral.

< A+<C=180

Substituting <A and <B values given in figure:

x+2+x-2=180

Adding like terms:

2x=180

Dividing both sides by 2

x=90°

<A=x+2=90+2=92°

<C=x-2=90-2=88°

<D=x-10=90-10=80°

<B+<D=180

<B=180-80=100°

The angles of the quadrilateral ABCD are

<A=92°

<B=100°

<C=88°

<D=80°

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.

Philip is going on a 400040004000-kilometer road trip with three friends. The car consumes 666 liters of gas per 100100100 kilometers, and gas costs \$1.50$1.50dollar sign, 1, point, 50 per liter.

Answers

 If Philip and his friends want to split the cost of gas evenly, how much should they each pay?
the amount of gas it consumes per 100 km = 6 l
the cost per litre = $1.50
the total distance of the trip = 4000 km
If 100 km consumes - 6 l
Then 1 km consumes - 6/100 l/km
therefore amount of gas for the whole trip of 4000 km = 6/100 l/km * 4000 km
the gas consumed = 240 l
cost of 1 l = $1.5
then the cost of gas for the whole ride = 240 l * $ 1.5
  cost = $ 360
there are 4 friends , cost of each friend = $ 360/4 = $ 90
cost each friend has to pay = $ 90

Sam is training for an upcoming wrestling match. He trains for 3.5 hours each day Monday through Wednesday. He trains 2.5 hours on Thursday and Friday. How many hours will he train if he trains for six weeks

Answers

3.5 * 3 = 10.5
2.5 * 2 = 5

10.5 + 5 = 15.5 hours for 1 week

15.5 * 6 = 93 hours in 6 weeks

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

The system of equations 4x-y=4(x+1) , y = 6 has:
A. one solution
B. infinitely many solutions
C. no solution

Answers

The system of equations 4x-y=4(x+1) and y=6 has no solution.

To determine the solution(s) of the system of equations, let's analyze each equation:

Equation 1: 4x - y = 4(x + 1)

Equation 2: y = 6

To simplify Equation 1, we can distribute 4 on the right side:

4x - y = 4x + 4

By rearranging terms, we have:

- y = 4

Comparing Equation 2 with this result, we see that the two equations are contradictory. Equation 2 states that y = 6, while the modified Equation 1 states that y = -4. This means there is no value of y that can simultaneously satisfy both equations.

Thus, the system of equations has no solution.

Therefore, the correct answer is C. no solution.

To know more about system of equations, refer here:

https://brainly.com/question/30127282

#SPJ6

can someone help me with this

Answers

x is the supplement to 40°.
x is 140°.

7b divided by 12=4.2 what is b

Answers

Final answer:

To solve for b in the equation 7b divided by 12 equals 4.2, multiply both sides by 12 and then divide by 7, resulting in b being equal to 7.2.

Explanation:

To solve the equation 7b ÷ 12 = 4.2 for b, we must isolate b on one side of the equation. We can begin by multiplying both sides of the equation by 12 to cancel out the division by 12 on the left side. This results in the equation 7b = 4.2 × 12. To find the value of b, we then divide both sides of the equation by 7:

Multiply both sides by 12: 7b ÷ 12 × 12 = 4.2 × 12Simplify: 7b = 50.4Divide both sides by 7: 7b ÷ 7 = 50.4 ÷ 7b = 7.2

Therefore, the value of b is 7.2.

Final answer:

To find the value of b in the equation 7b/12 = 4.2, multiply both sides by 12 and then divide by 7 to get b = 7.2. The value of b is 7.2.

Explanation:

The student is asking how to find the value of b in the equation 7b divided by 12 equals 4.2. To solve for b, you can follow these steps:

Write down the original equation: 7b / 12 = 4.2.Multiply both sides of the equation by 12 to eliminate the denominator: 12 * (7b / 12) = 12 * 4.2, which simplifies to 7b = 50.4.Divide both sides by 7 to solve for b: 7b / 7 = 50.4 / 7, which gives b = 7.2.

Therefore, the value of b is 7.2.

What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

You have a $50 gift card to the same site. You want to buy an album with 16 tracks for $12.99 and then use the rest of the gift card for single tracks. How many songs can you buy with the gift card?

Answers

first you will subtract 12.99 from 50
50 - 12.99 = 37.01
now you need to divide 16 by 12.99 to find out how much it costs for a single song
16 divided by 12.99 = $1.23
now you will divide 37.01 divided by 1.23
37.01 divided by 1.23 = about 30 
this means youll get about 30 single tracks with your gift card.
let me know if you have any further questions
:)

Final answer:

After purchasing an album for $12.99 from the $50 gift card, the remaining balance is $37.01, which allows the purchase of 37 more single tracks, assuming each track costs $1.

Explanation:

To determine how many songs can be bought with a $50 gift card after purchasing an album for $12.99, we need to subtract the cost of the album from the total amount on the gift card. So, we have:

Total amount on gift card: $50Cost of album: $12.99

Subtracting the cost of the album from the gift card amount gives us:

$50 - $12.99 = $37.01

Assuming that each single track costs $1 as per the scenario provided, we can divide the remaining balance by the cost per single track:

$37.01 ÷ $1 per track = 37 tracks

This means that you can purchase 37 more single tracks with the remaining balance on the gift card.

Help with this question

Answers

Since there is one real root and one complex root, there must be one additional real root and another complex root that is the conjugate of the one given.

The conjugate complex roots give rise to the factor
.. (x -2 -5i)*(x -2 +5i)
.. = (x -2)^2 +25
.. = (x^2 -4x +29)

The given real root gives rise to the factor 
.. (x +2)

The remaining factor can be written as
.. (ax -3)
since we know the product of the constant terms in these factors must be -174.

The product of these factors is
.. (x +2)(x^2 -4x +29)(ax -3)
.. = ax^4 -(2a +3)x^3 +(21a +6)x^2 +(58a -63)x -174

Matching x-coefficients, we have
.. 53 = 58a -63
.. 116 = 58a
.. 2 = a


(a) The factored function is
.. f(x) = (x +2)(x^2 -4x +29)(2x -3)


(b) The values of a, b, c are ...
.. a = 2
.. b = -(2a +3) = -7
.. c = 21a +6 = 48

(a, b, c) = (2, -7, 48)

What is the area of the figure?

Express your answer as a mixed number in simplest form.

? m2

Answers

The area of this would be 1.69 or 1 69/100 in mixed number form.

What is the completely factored form of x2y – 2xy – 24y?

Answers

Factoring the expression we proceed as follows:
x^2y-2xy-24y
this can be simplified to:
x^2y-xy-xy-24y
=xy(x-1)-y(x-24)

Answer:

C: y(x + 4)(x – 6)

Step-by-step explanation:

I took the test on Edge -2022

what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

Tim and Maria went on a cruise together, but agreed to divide their expenses. The cost of the room was R. The cost of the horseback riding excursion was $125 per person. The historic tour was $214 per couple. Tim and Maria equally split the cost of the room, but Tim also paid for both his and Maria's horseback riding excursion. Maria was to pay for the historic tour but only had to paid half price because the cruise line scratched their luggage, so they offered to pay the other half.

Answers

Tim paid more. $250 + 1/2R 
Maria only paid 107+ 1/2R
Hope that helps.

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60

Miguel’s teacher asks him to color for 4/8 of his grid. He must use three colors: red blue and green. There must be more green sections then red sections. How can Miguel color the section service grid to follow all the rules?

Answers

2/8 can be green, 1/8 can be red, and 1/8 can be blue. The amount of green is greater then the red section and it all adds up to 4/8 or 1/2.

three friends are in the same algebra class. Their scores on a recent test are three consecutive odd intergers whose sum is 279. find each score

Answers

x= 1st integer
x+2= 2nd integer
x+4= 3rd integer

Add the integers together

x + (x + 2) + (x + 4)= 279
combine like terms
3x + 6= 279
subtract 6 from both sides
3x= 273
divide both sides by 3
x= 91 first integer

Substitute x=91 to find 2nd & 3rd integers

2nd Integer
=x+2
=91+2
=93

3rd Integer
=x+4
=91+4
=95

ANSWER: The three test scores are 91, 93 and 95.

Hope this helps! :)

A Bird Is flying 5 m/s. How far will it travel if it flies for 3minutes

A. 15m
B. 5m
C. 900m
D. 36m

Answers

The bird is flying at 5m/s, so
1 sec = 5 m

It flies for 3 mins
3 mins = 3 x 6sec
3 mins = 180 sec
The bird flies for 180 seconds

1 sec = 5 m
180sec = 5 x 180 = 900m

The bird flew 900m in 3 mins (Answer C)

Use Cavalieri’s Principle to calculate the exact volume of an oblique cylinder with a height of 10 meters and a circular base with a radius of 8 meters

Answers

I think it is 640 pi

Answer: Volume of an oblique cylinder is 2011.43 sq.m.

Step-by-step explanation:

Since we have given that

Radius of a cylinder = 8 meters

Height of a cylinder = 10 meters

Cavelieri's Principle states that volume of an oblique cylinder is same as the volume of right circular cylinder with equal radius and height.

As we know the formula for "Volume of cylinder":

[tex]Volume=\pi r^2h\\\\V=\frac{22}{7}\times 8\times 8\times10\\\\V=\frac{14080}{7}\\\\V=2011.43[/tex]

Hence, Volume of an oblique cylinder is 2011.43 sq.m.

The left and right page numbers of an open book are two consecutive integers whose sum is 423.

Answers

211 and 212. this is bc x+1 and x+2 is equal to 2x+3=423 and if you solve for  it equals 210 so 210 +1 =211 and 210+2=213

Write 4/10 as a fraction with a denominator of 100. Then write 4/10 as a decimal.
Would it be 4/100 or 40/100? The decimal would be 0.4 ?

Answers

4/10 = (4x10)/(10x10) = 40/100

4/10 = 0.4

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

Other Questions
Two sides of a right triangle measure 7 units and 3 units. What is the area of the square that shares a side with the third side of the triangle? The total amount of ticket sales for an event is called the ______________. What happened to the men who were accused of shooting Emmett Till? A.They were found guilty and executed. B.They were found guilty, but did not go to jail. C.They were found not guilty. D.They went to prison. What best describes the use of visual codes to memorize informationodes to memorize? Which two energy sources can help a star maintain its internal thermal pressure? which two energy sources can help a star maintain its internal thermal pressure? nuclear fission and gravitational contraction nuclear fusion and chemical reactions chemical reactions and gravitational contraction nuclear fusion and gravitational contraction nuclear fusion and nuclear fission? Which of the following sentences best summarizes the purpose of the excerpt? It tells the audience exactly what will happen at the end of the play. It reveals the conflicting feelings Romeo has for Juliet and his family. It foreshadows the death of the lovers in the next section of the play. It explains that Romeo and Juliet will face many obstacles because of their families hatred. NextReset Which group formed the anti-defamation league One root of f(x)=x^3-9x^2+26x-24 is x = 2. What are all the roots of the function? How did political rebellions affect the political structures and ideologies around the world? Read the following passage:I try to select nutritious food choices in the school cafeteria to help me do well in school, but sometimes the French fries and chocolate fudge cake just look so delicious.Based on the clues, what is the most likely definition of the word nutritious?boringblandhealthyyummy A runner ran 2/3 of a 5 kilometer race in 21 minutes. They ran the entire race at a constant speed.a. How long did it take to run the entire race?b. How many minutes did it take to run 1 kilometer? Mikes current restaurant measures 60 feet by 30 feet. Due to increase in the number of customers, he wants to rent a bigger restaurant. The dimensions of the bigger restaurant will be related by a scale factor of 2. What is the difference in area between Mike's new restaurant and his current restaurant, in square feet? Older Orchards need more hives per acre Caleb has decided to place 6 hives for every 2 acres on an older peach orchard Zeke one of Caleb workers delivery 10 hives to a 30 acre peach orchard did Zeke follow Calebs decision.how does the table prove your answer. Don't do a table How do social institutions affect health? A. By building hospitals B. By collecting garbage C. By building sewers D. All of the above A home lending library should include all of the following except A. a list of consequences for returning a book late. . B. sign-out pockets in books and sheets to track lending. C. read-a-long CDs for each book. D. duplicates of books used in the classroom. the initial vertical velocity of a rocket shot straight up is 42 meters per second. How long does it take for the rocket to return to earth? round your answer to the nearest tenth of a second. show all your work. What material is rare in the atmosphere of earth, but common in the atmospheres of mars and venus? The concept of voting rights is based on Type the term that best completes the sentence. the internet, by enabling us to obtain everything from music to vintage toys without leaving our home, sometimes without paying, is forcing us as a society to reconsider the meaning of ________. Suppose your club is selling candles to raise money. It cost $100 to rent a booth from which to sell the candles. If the candles cost your club $1 and are sold for $5 each, how many candles must be sold to equal your expenses?