Calculate the effective rate of interest (to the nearest hundredth percent) of the following Treasury bill. Given: $10,000 Treasury bill, 3.85% for 13 weeks.

Answers

Answer 1
A useful formula for finding the effective rate on discounted notes is
.. (effective rate) = r/(1 -rt)

If we assume a 52-week year, the t = (13 weeks)/(52 weeks) = 1/4.
.. (effective rate) = 0.0385/(1 -0.0385/4) ≈ 0.038874 ≈ 3.89%

Related Questions

Can you prove that def=hgf? Justify your answer.

Answers

We can prove that ΔDEF = ΔHGF as follows; A: Yes, the triangles are congruent by SAS.

How to prove the congruence

Side DE is congruent to GH as seen in the fact that both have two line marks. These are opposite angles (EFD and HFG) and these angles are congruent.

Note that the opposite sides of a triangle are congruent and corresponding angles are also congruent. This is true of angles DEF and HGF. So, we can conclude that the triangles are congruent by SAS.

Complete Question:

Can you prove that ADEF = AHGF? Justify your answer:

A: Yes, the triangles are congruent by SAS. B: Yes, the triangles are congruent by SSS. C: Yes, the triangles are congruent by SSA. D: No, not enough information is given

You have a $50 gift card to the same site. You want to buy an album with 16 tracks for $12.99 and then use the rest of the gift card for single tracks. How many songs can you buy with the gift card?

Answers

first you will subtract 12.99 from 50
50 - 12.99 = 37.01
now you need to divide 16 by 12.99 to find out how much it costs for a single song
16 divided by 12.99 = $1.23
now you will divide 37.01 divided by 1.23
37.01 divided by 1.23 = about 30 
this means youll get about 30 single tracks with your gift card.
let me know if you have any further questions
:)

Final answer:

After purchasing an album for $12.99 from the $50 gift card, the remaining balance is $37.01, which allows the purchase of 37 more single tracks, assuming each track costs $1.

Explanation:

To determine how many songs can be bought with a $50 gift card after purchasing an album for $12.99, we need to subtract the cost of the album from the total amount on the gift card. So, we have:

Total amount on gift card: $50Cost of album: $12.99

Subtracting the cost of the album from the gift card amount gives us:

$50 - $12.99 = $37.01

Assuming that each single track costs $1 as per the scenario provided, we can divide the remaining balance by the cost per single track:

$37.01 ÷ $1 per track = 37 tracks

This means that you can purchase 37 more single tracks with the remaining balance on the gift card.

Tim and Maria went on a cruise together, but agreed to divide their expenses. The cost of the room was R. The cost of the horseback riding excursion was $125 per person. The historic tour was $214 per couple. Tim and Maria equally split the cost of the room, but Tim also paid for both his and Maria's horseback riding excursion. Maria was to pay for the historic tour but only had to paid half price because the cruise line scratched their luggage, so they offered to pay the other half.

Answers

Tim paid more. $250 + 1/2R 
Maria only paid 107+ 1/2R
Hope that helps.

can someone help me with this

Answers

x is the supplement to 40°.
x is 140°.

What percent of 20 is 2?

Answers

2 is 10% of 20.

2/10 = 1/10 = 10%

Hope this helps!

I need some help what 9 + 10?

Answers

9 + 10 will equal 19
19, because if let's say you took 9 blocks, added 10, and counted them all, 19 would be the answer

the model below represents the equation 2x + 3 = 11. What is the first step in finding the value of x?

Answers

do 2 times a number(4), and see if when you add 3 you get 11. Hope i can help out!

Answer:

B

Step-by-step explanation:

picture:)

Oliver earns $93 per week mowing lawns in his neighborhood. Which expression can be used to show how much money he earns in 6 weeks?

Answers

1 week  = $93
6 weeks = $93 x 6 
6 weeks = $558

2. Quadrilateral ABCD is inscribed in a circle. Find the measure of each of the angles of the quadrilateral. Show your work.

Answers

A cyclic quadrilateral is a quadrilateral whose vertices all touch the circumference of a circle.

Opposite angles in a cyclic quadrilateral add to 180 degrees. Quadrilateral ABCD is a cyclic quadrilateral.

< A+<C=180

Substituting <A and <B values given in figure:

x+2+x-2=180

Adding like terms:

2x=180

Dividing both sides by 2

x=90°

<A=x+2=90+2=92°

<C=x-2=90-2=88°

<D=x-10=90-10=80°

<B+<D=180

<B=180-80=100°

The angles of the quadrilateral ABCD are

<A=92°

<B=100°

<C=88°

<D=80°

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.

What is the area of the figure?

Express your answer as a mixed number in simplest form.

? m2

Answers

The area of this would be 1.69 or 1 69/100 in mixed number form.

7b divided by 12=4.2 what is b

Answers

Final answer:

To solve for b in the equation 7b divided by 12 equals 4.2, multiply both sides by 12 and then divide by 7, resulting in b being equal to 7.2.

Explanation:

To solve the equation 7b ÷ 12 = 4.2 for b, we must isolate b on one side of the equation. We can begin by multiplying both sides of the equation by 12 to cancel out the division by 12 on the left side. This results in the equation 7b = 4.2 × 12. To find the value of b, we then divide both sides of the equation by 7:

Multiply both sides by 12: 7b ÷ 12 × 12 = 4.2 × 12Simplify: 7b = 50.4Divide both sides by 7: 7b ÷ 7 = 50.4 ÷ 7b = 7.2

Therefore, the value of b is 7.2.

Final answer:

To find the value of b in the equation 7b/12 = 4.2, multiply both sides by 12 and then divide by 7 to get b = 7.2. The value of b is 7.2.

Explanation:

The student is asking how to find the value of b in the equation 7b divided by 12 equals 4.2. To solve for b, you can follow these steps:

Write down the original equation: 7b / 12 = 4.2.Multiply both sides of the equation by 12 to eliminate the denominator: 12 * (7b / 12) = 12 * 4.2, which simplifies to 7b = 50.4.Divide both sides by 7 to solve for b: 7b / 7 = 50.4 / 7, which gives b = 7.2.

Therefore, the value of b is 7.2.

A Bird Is flying 5 m/s. How far will it travel if it flies for 3minutes

A. 15m
B. 5m
C. 900m
D. 36m

Answers

The bird is flying at 5m/s, so
1 sec = 5 m

It flies for 3 mins
3 mins = 3 x 6sec
3 mins = 180 sec
The bird flies for 180 seconds

1 sec = 5 m
180sec = 5 x 180 = 900m

The bird flew 900m in 3 mins (Answer C)

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

holly is making a stir fry holly measures 5/8 cup of chicken and then adds 1/9 cup more how much chicken did holly use altogether?

Answers

Final answer:

Holly used a total of 53/72 cup of chicken for her stir fry, by adding 5/8 cup and 1/9 cup together after converting them to have a common denominator.

Explanation:

Holly is making a stir fry and needs to calculate the total amount of chicken she has used.

Initially, she measures 5/8 cup of chicken and then adds 1/9 cup of chicken.

To find the total amount of chicken used, we need to add these two fractions together.

This is a simple arithmetic operation called fraction addition.

First, we find a common denominator for the two fractions, which in this case is 72 (the least common multiple of 8 and 9).

Next, we convert each fraction to an equivalent fraction with the common denominator.

The fraction 5/8 converts to (5×72)/(8×72) = 45/72, and 1/9 converts to (1×72)/(9×72) = 8/72.

Now that the fractions share a common denominator, we can add them:

45/72 + 8/72 = 53/72

The sum of the two fractions gives us the total amount of chicken used by Holly, which is 53/72 cup.

Final answer:

To find out how much chicken Holly used altogether, we need to add the two fractions together. First, we find a common denominator, then convert the fractions to have that denominator. Finally, we add the numerators and keep the denominator the same. Holly used a total of 53/72 cup of chicken for her stir fry.

Explanation:

To find out how much chicken Holly used altogether, we need to add the two fractions together.

First, we need to find a common denominator for these fractions. The smallest number that both 8 and 9 can divide into is 72.

Next, we need to convert both fractions to have a denominator of 72. To do this, we multiply the numerator and denominator of each fraction by the same number.

For the first fraction, we multiply both the numerator and denominator by 9, obtaining 45/72. For the second fraction, we multiply both the numerator and denominator by 8, obtaining 8/72.

Now that we have both fractions with a denominator of 72, we can add them together. 45/72 + 8/72 = 53/72.

Therefore, Holly used a total of 53/72 cup of chicken for her stir fry.

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

Subtract -7a^2 + 3a -9 from 5a^2 - 6a -4

Answer should be polynomial in standard form

Answers

5a^2 - 6a -4 - (-7a^2 + 3a -9)
=5a^2 - 6a -4 + 7a^2 -  3a + 9
=12a^2 - 9a + 5

answer
12a^2 - 9a + 5

The polynomial in standard form after subtraction will be 12a² - 9a + 5.

What is polynomial?

A polynomial expression is an algebraic expression with variables and coefficients. Unknown variables are what they're termed. We can use addition, subtraction, and other mathematical operations. However, a variable is not divisible.

It simply implies subtracting something from an entity, group, location, etc. Subtracting from a collection or a list of ways is known as subtraction.

The polynomial is given below.

-7a² + 3a - 9 and 5a² - 6a - 4

Subtract -7a² + 3a - 9 from 5a² - 6a - 4, then we have

(5a² - 6a - 4) - (-7a² + 3a - 9)

Simplify the equation, then we have

(5a² - 6a - 4) - (-7a² + 3a - 9)

5a² - 6a - 4 +  7a² - 3a + 9

12a² - 9a + 5

The polynomial in standard form after subtraction will be 12a² - 9a + 5.

More about the polynomial link is given below.

https://brainly.com/question/17822016

#SPJ5

Can some explain this to me do i need to covert something or can someone explain it to me how in gonna get the answer i try to do it and i got 60 and i think it is wrong

Answers

cross multiply:

2.5 ft x 16.5 ft = 41.25 ft

now divide:

41.25 / 8.25 = 5

L = 5 feet 

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



Miguel’s teacher asks him to color for 4/8 of his grid. He must use three colors: red blue and green. There must be more green sections then red sections. How can Miguel color the section service grid to follow all the rules?

Answers

2/8 can be green, 1/8 can be red, and 1/8 can be blue. The amount of green is greater then the red section and it all adds up to 4/8 or 1/2.

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

Suppose you borrow 13,000 for four years at 7% toward the purchase of a car.

Answers

Amount borrowed, P = 13000
Interest, i = 0.07/12 per month
number of periods (months),  n = 4*12 = 48

Monthly payment, 
[tex]A=\frac{P(i*(1+i)^n)}{(1+i)^n-1}[/tex]
[tex]=\frac{13000(.07/12*(1+.07/12)^{48}}{(1+.07/12)^{48}-1}[/tex]
=311.30   (to the nearest cent)

three friends are in the same algebra class. Their scores on a recent test are three consecutive odd intergers whose sum is 279. find each score

Answers

x= 1st integer
x+2= 2nd integer
x+4= 3rd integer

Add the integers together

x + (x + 2) + (x + 4)= 279
combine like terms
3x + 6= 279
subtract 6 from both sides
3x= 273
divide both sides by 3
x= 91 first integer

Substitute x=91 to find 2nd & 3rd integers

2nd Integer
=x+2
=91+2
=93

3rd Integer
=x+4
=91+4
=95

ANSWER: The three test scores are 91, 93 and 95.

Hope this helps! :)

The left and right page numbers of an open book are two consecutive integers whose sum is 423.

Answers

211 and 212. this is bc x+1 and x+2 is equal to 2x+3=423 and if you solve for  it equals 210 so 210 +1 =211 and 210+2=213

Find a rational number that is between 9.5 and 9.7

Answers

9.5000032 is one such number

9.5000032 i think i'm not sure

Sam is training for an upcoming wrestling match. He trains for 3.5 hours each day Monday through Wednesday. He trains 2.5 hours on Thursday and Friday. How many hours will he train if he trains for six weeks

Answers

3.5 * 3 = 10.5
2.5 * 2 = 5

10.5 + 5 = 15.5 hours for 1 week

15.5 * 6 = 93 hours in 6 weeks

What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60
Other Questions
What is the best way to combine this information into a grammatically correct sentence The activation energy for the reaction no2(g)+co(g)no(g)+co2(g) is ea = 175 kj/mol and the change in enthalpy for the reaction is h = -200 kj/mol . what is the activation energy for the reverse reaction? The white-tailed deer, Odocoileus virginianus, is common in the Eastern United States. Most deer have reddish brown fur, but occasionally a deer may be born with a genetic condition known as albinism which results in white fur. Albinism is caused by the inheritance of two recessive alleles for the production of coloration pigments. If an albino deer is born to two parents who each have normal fur coloration, what conclusion may be drawn about the genotypes of the parent deer? A)Both parents must be homozygous for the coloration gene. B)Both parents must be heterozygous for the coloration gene. C)The female parent must have two recessive alleles for the coloration gene. D)No conclusion may be drawn about the parental genotypes based on the information given. The labels button is found under the a) mailings tab b) view lab c) page layout tab d) file tab The main source of phosphorous is in: rocks water plants the atmosphe You are at home in your air conditioned garage. You are planning a family road trip from New York to Florida. You are lnfating the tires of your suv. You fill each car-tire with about 10 Liters of air. The temperature inside your air conditioned garage is about 10 degrees Celsius. Your family packs the car, and you begin your trip to Florida. The temperature in New York is about 21 degrees Celsius, and the happen temperature in Florida is 32 degrees Celsius. Assuming the pressure stays constant from the garage all the way to Florida, what could to your car tires during your road trip.Write a paragraph that makes a claim about what happen to the car tires Which area in the United States had the highest average number of thunderstorms per year?A. NorthwesternB. SouthwesternC. Mid-AtlanticD. Southeastern which identifies the intent of the media and explains its relationship to the factual content PLEASE HELP FAST What is the area of the triangle in the coordinate plane? 26 units 33 units 36 units 66 units What was an immediate cause of the 1789 French Revolution the perimeter of a rectangle is p units. iF ITS LENGTH AND WIDTH ARE TRIPLED WHAT IS THE PERIMETER OF THE NEW RECTANGLE Hi there! Can you help me?I am struggling with an assignment and I feel if I have examples of the same assignment I can have an easier time with this.Assignment:Write an 8 lined poem about any topic of your choice.Include at least 3 of the following1. Onomatopoeia2. Alliteration3. Meter (rhythm)4. Rhyme scheme5. Assonance6. Consonance why did president kennedy maintain his official schedule Sonar stands for sound navigation and ranging. What assumption was proved wrong after the invention of sonar? The age of the ocean floor is variable. The ocean floor is featureless. The ocean floor is changing. The ocean floor is denser than continental crust. 9. How did Velazquez learn to paint?A)By apprenticing with a master painterB)By going to art school C)By studying with his father D)By teaching himself The difference of two numbers is 44 1/2 . If the smaller of the two numbers increases 7 times then the difference will be 10 3/14 . Find the numbers.The numbers are: ___ ,___ or ____,___ There is no place for the role of thinking process and attitudes in contemporary behavior therapy. question 2 options: a. True b. False sodium bicarbonate reacts with sulfuric acid to form sodium sulfate, carbon dioxide, and water. calculate the mass od sodium bicarbonate necessary to produce 1.75 g of carbon dioxide gas.How would i even go about doing this?, What is the difference between valid arguments and fallacious arguments?A.) true and falseB.) sound and unsound reasoningC.) bad and good reasoningD.) negative and positive incentives What characteristic do the settlements located at letters B, D, and E on the map share?