Cedric has $0.45 in his pocket which fraction of a dollar does Cedric have

Answers

Answer 1
Final answer:

Cedric has 9/20 of a dollar.

Explanation:

To find the fraction of a dollar that Cedric has, we need to convert $0.45 into a fraction with a denominator of 100, which represents cents. Since 1 dollar is equal to 100 cents, we can write $0.45 as 45 cents. So, Cedric has 45/100 of a dollar, which can be simplified to 9/20.


Related Questions

Last summer we took an auto trip of 3427 miles . After we had driven 1578 miles , how many are left ?

Answers

There wold be 1,849miles left.
There are 1849 miles left to go!! Good luck!

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

I need some help what 9 + 10?

Answers

9 + 10 will equal 19
19, because if let's say you took 9 blocks, added 10, and counted them all, 19 would be the answer

Miguel’s teacher asks him to color for 4/8 of his grid. He must use three colors: red blue and green. There must be more green sections then red sections. How can Miguel color the section service grid to follow all the rules?

Answers

2/8 can be green, 1/8 can be red, and 1/8 can be blue. The amount of green is greater then the red section and it all adds up to 4/8 or 1/2.

What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60

The system of equations 4x-y=4(x+1) , y = 6 has:
A. one solution
B. infinitely many solutions
C. no solution

Answers

The system of equations 4x-y=4(x+1) and y=6 has no solution.

To determine the solution(s) of the system of equations, let's analyze each equation:

Equation 1: 4x - y = 4(x + 1)

Equation 2: y = 6

To simplify Equation 1, we can distribute 4 on the right side:

4x - y = 4x + 4

By rearranging terms, we have:

- y = 4

Comparing Equation 2 with this result, we see that the two equations are contradictory. Equation 2 states that y = 6, while the modified Equation 1 states that y = -4. This means there is no value of y that can simultaneously satisfy both equations.

Thus, the system of equations has no solution.

Therefore, the correct answer is C. no solution.

To know more about system of equations, refer here:

https://brainly.com/question/30127282

#SPJ6

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

What is the completely factored form of x2y – 2xy – 24y?

Answers

Factoring the expression we proceed as follows:
x^2y-2xy-24y
this can be simplified to:
x^2y-xy-xy-24y
=xy(x-1)-y(x-24)

Answer:

C: y(x + 4)(x – 6)

Step-by-step explanation:

I took the test on Edge -2022

Sam is training for an upcoming wrestling match. He trains for 3.5 hours each day Monday through Wednesday. He trains 2.5 hours on Thursday and Friday. How many hours will he train if he trains for six weeks

Answers

3.5 * 3 = 10.5
2.5 * 2 = 5

10.5 + 5 = 15.5 hours for 1 week

15.5 * 6 = 93 hours in 6 weeks

Use Cavalieri’s Principle to calculate the exact volume of an oblique cylinder with a height of 10 meters and a circular base with a radius of 8 meters

Answers

I think it is 640 pi

Answer: Volume of an oblique cylinder is 2011.43 sq.m.

Step-by-step explanation:

Since we have given that

Radius of a cylinder = 8 meters

Height of a cylinder = 10 meters

Cavelieri's Principle states that volume of an oblique cylinder is same as the volume of right circular cylinder with equal radius and height.

As we know the formula for "Volume of cylinder":

[tex]Volume=\pi r^2h\\\\V=\frac{22}{7}\times 8\times 8\times10\\\\V=\frac{14080}{7}\\\\V=2011.43[/tex]

Hence, Volume of an oblique cylinder is 2011.43 sq.m.

Lorne subtracted 6x3 – 2x + 3 from –3x3 + 5x2 + 4x – 7. Use the drop-down menus to identify the steps Lorne used to find the difference. 1. (–3x3 + 5x2 + 4x – 7) + (–6x3 + 2x – 3) 2. (–3x3) + 5x2 + 4x + (–7) + (–6x3) + 2x + (–3) 3. [(–3x3) + (–6x3)] + [4x + 2x] + [(–7) + (–3)] + [5x2] 4. –9x3 + 6x + (–10) + 5x2 5. –9x3 + 5x2 + 6x – 10

Answers

To find the polynomial difference, Lorne transformed the subtraction into addition of the opposite, combined like terms, and simplified the expression to get the result of -9x³ + 5x² + 6x - 10.

To find the difference between the two polynomials, Lorne correctly followed the steps of subtraction by changing the subtraction to the addition of the opposite. The process is outlined below:

Add the opposite of the second polynomial to the first polynomial by changing the sign of each term in the second polynomial.

Combine like terms by adding the coefficients of terms with the same degree of x.

Rearrange the terms in descending order of their degrees.

Write down the final simplified form of the polynomial.

By following these steps, the result would be:

Step 1:

(-3x³ + 5x² + 4x - 7) + (-6x³ + 2x - 3)

Step 2:

(-3x³ + 5x² + 4x - 7) + (-6x³) + 2x + (-3)

Step 3:

[(-3x³) + (-6x³)] + [4x + 2x] + [(-7) + (-3)] + [5x²]

Step 4:

-9x³ + 6x + (-10) + 5x2

Step 5:

-9x³ + 5x² + 6x - 10

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

The steps Lorne used to find the difference between [tex]-3x^{3} +5x^{2} +4x-7[/tex] and [tex]6x^{3} -2x+3[/tex] are:

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

Lorne first added the two polynomials by combining like terms, then simplified the result by collecting like terms. The final expression represents the difference between the two polynomials after combining and simplifying.

COMPLETE QUESTION:

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. Use the drop-down menus to identify the steps Lorne used to find the difference.

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

can someone help me with this

Answers

x is the supplement to 40°.
x is 140°.

What is the area of the figure?

Express your answer as a mixed number in simplest form.

? m2

Answers

The area of this would be 1.69 or 1 69/100 in mixed number form.

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

the area of this circle is 72π m^2 what is the area of a 45° sector of this circle

Answers

A 45° sector is 1/8 of the area of the circle, so is (72π m^2)/8 = 9π m^2.

three friends are in the same algebra class. Their scores on a recent test are three consecutive odd intergers whose sum is 279. find each score

Answers

x= 1st integer
x+2= 2nd integer
x+4= 3rd integer

Add the integers together

x + (x + 2) + (x + 4)= 279
combine like terms
3x + 6= 279
subtract 6 from both sides
3x= 273
divide both sides by 3
x= 91 first integer

Substitute x=91 to find 2nd & 3rd integers

2nd Integer
=x+2
=91+2
=93

3rd Integer
=x+4
=91+4
=95

ANSWER: The three test scores are 91, 93 and 95.

Hope this helps! :)

Tim and Maria went on a cruise together, but agreed to divide their expenses. The cost of the room was R. The cost of the horseback riding excursion was $125 per person. The historic tour was $214 per couple. Tim and Maria equally split the cost of the room, but Tim also paid for both his and Maria's horseback riding excursion. Maria was to pay for the historic tour but only had to paid half price because the cruise line scratched their luggage, so they offered to pay the other half.

Answers

Tim paid more. $250 + 1/2R 
Maria only paid 107+ 1/2R
Hope that helps.

2. Quadrilateral ABCD is inscribed in a circle. Find the measure of each of the angles of the quadrilateral. Show your work.

Answers

A cyclic quadrilateral is a quadrilateral whose vertices all touch the circumference of a circle.

Opposite angles in a cyclic quadrilateral add to 180 degrees. Quadrilateral ABCD is a cyclic quadrilateral.

< A+<C=180

Substituting <A and <B values given in figure:

x+2+x-2=180

Adding like terms:

2x=180

Dividing both sides by 2

x=90°

<A=x+2=90+2=92°

<C=x-2=90-2=88°

<D=x-10=90-10=80°

<B+<D=180

<B=180-80=100°

The angles of the quadrilateral ABCD are

<A=92°

<B=100°

<C=88°

<D=80°

You have a $50 gift card to the same site. You want to buy an album with 16 tracks for $12.99 and then use the rest of the gift card for single tracks. How many songs can you buy with the gift card?

Answers

first you will subtract 12.99 from 50
50 - 12.99 = 37.01
now you need to divide 16 by 12.99 to find out how much it costs for a single song
16 divided by 12.99 = $1.23
now you will divide 37.01 divided by 1.23
37.01 divided by 1.23 = about 30 
this means youll get about 30 single tracks with your gift card.
let me know if you have any further questions
:)

Final answer:

After purchasing an album for $12.99 from the $50 gift card, the remaining balance is $37.01, which allows the purchase of 37 more single tracks, assuming each track costs $1.

Explanation:

To determine how many songs can be bought with a $50 gift card after purchasing an album for $12.99, we need to subtract the cost of the album from the total amount on the gift card. So, we have:

Total amount on gift card: $50Cost of album: $12.99

Subtracting the cost of the album from the gift card amount gives us:

$50 - $12.99 = $37.01

Assuming that each single track costs $1 as per the scenario provided, we can divide the remaining balance by the cost per single track:

$37.01 ÷ $1 per track = 37 tracks

This means that you can purchase 37 more single tracks with the remaining balance on the gift card.

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

7b divided by 12=4.2 what is b

Answers

Final answer:

To solve for b in the equation 7b divided by 12 equals 4.2, multiply both sides by 12 and then divide by 7, resulting in b being equal to 7.2.

Explanation:

To solve the equation 7b ÷ 12 = 4.2 for b, we must isolate b on one side of the equation. We can begin by multiplying both sides of the equation by 12 to cancel out the division by 12 on the left side. This results in the equation 7b = 4.2 × 12. To find the value of b, we then divide both sides of the equation by 7:

Multiply both sides by 12: 7b ÷ 12 × 12 = 4.2 × 12Simplify: 7b = 50.4Divide both sides by 7: 7b ÷ 7 = 50.4 ÷ 7b = 7.2

Therefore, the value of b is 7.2.

Final answer:

To find the value of b in the equation 7b/12 = 4.2, multiply both sides by 12 and then divide by 7 to get b = 7.2. The value of b is 7.2.

Explanation:

The student is asking how to find the value of b in the equation 7b divided by 12 equals 4.2. To solve for b, you can follow these steps:

Write down the original equation: 7b / 12 = 4.2.Multiply both sides of the equation by 12 to eliminate the denominator: 12 * (7b / 12) = 12 * 4.2, which simplifies to 7b = 50.4.Divide both sides by 7 to solve for b: 7b / 7 = 50.4 / 7, which gives b = 7.2.

Therefore, the value of b is 7.2.

Write 4/10 as a fraction with a denominator of 100. Then write 4/10 as a decimal.
Would it be 4/100 or 40/100? The decimal would be 0.4 ?

Answers

4/10 = (4x10)/(10x10) = 40/100

4/10 = 0.4

The left and right page numbers of an open book are two consecutive integers whose sum is 423.

Answers

211 and 212. this is bc x+1 and x+2 is equal to 2x+3=423 and if you solve for  it equals 210 so 210 +1 =211 and 210+2=213

A Bird Is flying 5 m/s. How far will it travel if it flies for 3minutes

A. 15m
B. 5m
C. 900m
D. 36m

Answers

The bird is flying at 5m/s, so
1 sec = 5 m

It flies for 3 mins
3 mins = 3 x 6sec
3 mins = 180 sec
The bird flies for 180 seconds

1 sec = 5 m
180sec = 5 x 180 = 900m

The bird flew 900m in 3 mins (Answer C)

Philip is going on a 400040004000-kilometer road trip with three friends. The car consumes 666 liters of gas per 100100100 kilometers, and gas costs \$1.50$1.50dollar sign, 1, point, 50 per liter.

Answers

 If Philip and his friends want to split the cost of gas evenly, how much should they each pay?
the amount of gas it consumes per 100 km = 6 l
the cost per litre = $1.50
the total distance of the trip = 4000 km
If 100 km consumes - 6 l
Then 1 km consumes - 6/100 l/km
therefore amount of gas for the whole trip of 4000 km = 6/100 l/km * 4000 km
the gas consumed = 240 l
cost of 1 l = $1.5
then the cost of gas for the whole ride = 240 l * $ 1.5
  cost = $ 360
there are 4 friends , cost of each friend = $ 360/4 = $ 90
cost each friend has to pay = $ 90

Help with this question

Answers

Since there is one real root and one complex root, there must be one additional real root and another complex root that is the conjugate of the one given.

The conjugate complex roots give rise to the factor
.. (x -2 -5i)*(x -2 +5i)
.. = (x -2)^2 +25
.. = (x^2 -4x +29)

The given real root gives rise to the factor 
.. (x +2)

The remaining factor can be written as
.. (ax -3)
since we know the product of the constant terms in these factors must be -174.

The product of these factors is
.. (x +2)(x^2 -4x +29)(ax -3)
.. = ax^4 -(2a +3)x^3 +(21a +6)x^2 +(58a -63)x -174

Matching x-coefficients, we have
.. 53 = 58a -63
.. 116 = 58a
.. 2 = a


(a) The factored function is
.. f(x) = (x +2)(x^2 -4x +29)(2x -3)


(b) The values of a, b, c are ...
.. a = 2
.. b = -(2a +3) = -7
.. c = 21a +6 = 48

(a, b, c) = (2, -7, 48)

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.
Other Questions
In addition to replacing the president if Neccessary its the duty of the vice president to What is the value of h? "Asymmetrical balance" best describes a work that A. has a central axis that divides the composition in half and each half reflects the other half exactly. B. has two sides that don't match, but the visual weight on each side is similar. C. uses only three-dimensional forms. D. appears to have a sense of depth and distance by using parallel lines. Nerve roots in the spine are the key component of intervertebral disks. a. True b. False Need help with this, thanks. if blockages of this type occur,the most likely result would be that should candy and pop come with school lunch pros and cons Question 2 (1 point) Question 2 UnsavedThe groundlings in Shakespearean theatersQuestion 2 options:stood and watched the play for a pennywere hung like banners around the stageilluminated the stagesecured the stage to the floorQuestion 3 (1 point) Question 3 UnsavedWhen Romeo calls Juliet "the sun" in the "Balcony Scene," it is one of many references to his belief that she brightens every environment she appears in. How do Romeo's comparisons shape his and readers' view of Juliet?Question 3 options:They make Juliet seem ordinary, someone Romeo can easily win.They make Juliet seem heavenly and wonderful, someone who is like the sun and stars.They make Juliet seem friendly and kind, someone to whom Romeo can tell his troubles.Romeo is a Montague and Juliet is a CapuletQuestion 4 (1 point) Question 4 UnsavedIn the balcony love scene, several of Juliet's speeches convey a sense of foreboding. Which one of the following fears is not mentioned?Question 4 options:This love will result in her death.Romeo could prove faithlessTheir love is moving too swiftly.Romeo will be discovered.Question 5 (1 point) Question 5 UnsavedIn this excerpt, Romeo and Juliet have "discovered" and voiced their feelings for one another. How can something so great be so dangerous for them?Question 5 Juliet is underage, and if Romeo is caught, the police will arrest him.Their families are fueding and usually fight each other to the death.Benvolio is engaged to Juliet and is Romeo's good friend.Tybalt forbade Juliet from seeing Romeo because Tybalt lost a bet to him. TIME SENSITIVEThe range of [tex]y= \frac{4}{5} sinx[/tex] for [tex] \pi \leq x \leq \frac{3 \pi }{2} [/tex] is _____. Marco wants to investigate the chemical properties of sodium bicarbonate, or baking soda. He plans to carry out the tests below.Test 1: Mix a teaspoon of sodium bicarbonate into a cup of warm water to see if it dissolves.Test 2: Mix a teaspoon of sodium bicarbonate into a cup of vinegar to see if it fizzes.Test 3: Heat a teaspoon of sodium bicarbonate in the oven to see if its melting point is less than 400 degrees Fahrenheit.Which statement provides the best assessment of his tests?Only Test 3 will indicate a chemical property of sodium bicarbonate. Tests 1 and 2 will show a physical property of the substance.Only tests 1 and 2 will indicate chemical properties of sodium bicarbonate. Test 3 will show a physical property of the substance.Only Test 2 will indicate a chemical property of sodium bicarbonate. Tests 1 and 3 will show a physical property of the substance.Only tests 1 and 3 will indicate chemical properties of sodium bicarbonate. Test 2 will show a physical property of the substance. Marie decides to work all summer rather than going on vacation. She will be able to earn money and learn new skills but will not be able to spend much time with her friends. What is the opportunity cost in this scenario? In a scale drawing of an apartment 1 centimeter represents 2 3/4 feet. If the length of the kitchen is 4 1/2 centimeters on the scale drawing, what is the actual length in feet of the kitchen The sentence that defines what a persuasive essay will prove is called what? Plot the data for the functions f(x) and g(x) on a grid How conditions in the biome affect the plant and animal life in contains How is ozone produced?A. One molecule of oxygen is split into two atoms.B. Two molecules of oxygen are split simultaneously into four atoms. C. One atom of oxygen collides with one molecule of oxygen. D. Two atoms of oxygen combine to form one oxygen molecule. In the graph below, find the coordinate of the image point, P(3, 0). O is the origin and O,90 is a rotation of 90 degrees about the origin. Rx and Ry are reflections around the x- and y-axes.Rx O,90: (3,0)(0, 3)(-3, 0)(0, -3) What article of the Constitution states laws of Congress and all treaties are the laws of the land A _________ is generally considered an appreciating asset because it may _________ in value over time./10951950/21eda85b?utm_source=registration a recipe calls for 4 tsp of baking soda and 1 fl oz of vanilla which measurment is greater?