Draw the structural formula of 4,5-diisopropylnonane.

Answers

Answer 1
Following the IUPAC rules, the longest carbon chain should consist of 9 carbons because of the word 'nonane'. From there, attach two isopropyl (3-carbon chains) to the 4th and 5th carbon starting either from the left or right of the parent carbon chain. The structural formula is shown in the picture attached.
Draw The Structural Formula Of 4,5-diisopropylnonane.
Answer 2
Final answer:

The structural formula of 4,5-diisopropylnonane is CH3-(CH2)3-C(CH3)2-C(CH3)2-(CH2)4-CH3. It represents a nine-carbon alkane with isopropyl groups on the fourth and fifth carbon.

Explanation:

The name 4,5-diisopropylnonane tells us that the compound is a nine-carbon alkane with isopropyl groups on the fourth and fifth carbon. The term 'nonane' represents a chain of nine carbon atoms. An isopropyl group is a carbon group with the formula -CH(CH3)2, which can be represented visually with one carbon connected to a carbon that is also connected to two other carbons with all remaining bonds with hydrogen. The fourth and fifth carbons in the chain of nonane have this type of structure attached. Therefore, the structural formula of 4,5-diisopropylnonane is as follows: CH3-(CH2)3-C(CH3)2-C(CH3)2-(CH2)4-CH3

Learn more about Structural formula of 4,5-diisopropylnonane here:

https://brainly.com/question/5819142

#SPJ3


Related Questions

Henry was having glass of water with some ice cubes in it and kept it near a window for some time. After some time, the water became warm. What is this process called? A.condensation B.freezing C.melting D.sublimation E.evaporation

Answers

it would be melting because it is the only one that would keep the water a liquid and not a solid or a gas.

The given process is known as melting.  

• The process in which a solid get transformed into liquid is known as melting.  

• This takes place because of the existence of heat in the surrounding environment.  

• The process in which a gas phase turns into a liquid phase is known as condensation.  

• The process in which liquid turns into a solid is known as freezing.  

• The process when there is a direct transformation of solid into the gas phase is known as sublimation.  

• The process in which the liquid molecules get transformed into a gas phase is known as evaporation, this takes place on the surfaces of liquid.  

Thus, when the glass of water containing ice cubes is kept outside it gets melt and becomes warm because of the transfer of heat. Therefore, the correct answer is option C, that is, melting.

To know more about:

https://brainly.com/question/4086394

For each solution below calculate the millimoles of solute.
a.1.90 l of 0.00657 m nacn
b.871 ml of a solution containing 8.49 ppm caco3

Answers

A
(1.62 L) x (0.00332 mol/L NaCN) = 0.00538 mol = 5.38 mmol NaCN

B
Supposing the solvent to be water, and supposing the density of the solution is near that of pure water:
(675 g) x (5.23 x 10^-6) / (100.0875 g CaCO3/mol) = 3.53 × 10^-5 mol = 0.0353 mmol CaCO3.

Otocz kółkiem symbole pierwiastków chemicznych

Na, H2O, KI, O, S, CO, MgO, Co, Si, Al, Fe2O3

Answers

This particular question is asking for the turker to circle the symbols of the chemical elements. The listed elements to be circled include the various choices: NA, S, O, Co, Si, and Al. The rest of the symbols are not chemical elements.

What is the formula mass of beryllium chloride , becl2? express your answer to four significant figures and include the appropriate units?

Answers

The formula mass of beryllium chloride (BeCl₂) is 79.92 u to four significant figures.

The formula mass of beryllium chloride, BeCl₂, is calculated by summing the atomic masses of beryllium and chlorine. The atomic mass of beryllium is approximately 9.012 u and that of chlorine is 35.453 u. Since there are two chlorine atoms in beryllium chloride, we need to take two times the atomic mass of chlorine and add it to the atomic mass of beryllium.

So the calculation for the formula mass of BeCl₂ is as follows:

Formula mass = Atomic mass of Be + (2 ˣ Atomic mass of Cl)
             = 9.012 u + (2 * 35.453 u)
             = 9.012 u + 70.906 u
             = 79.918 u

Expressed to four significant figures, the formula mass of BeCl₂ is 79.92 u (atomic mass units).

A metal M is converted to the metal sulfate M2(SO4)3. then a soultion of the metal sulfate was treated with calcium chloride to give calcium sulfate perciptate.If 1.2 g of the metal gave 5.451 g calcium sulfate what is the identity of metal M?
M2(SO4)3(aq)+3CaCl2(aq) ----->
2MCl3(aq)+3CaSO4(s)

Answers

1) From the chemical equation you obtaing the theoretical molar ratios:

2 mol of M : 3 mol of CaSO4

2) Convert 5.451 g of CaSO4 into number of moles

number of moles = mass in grams / molar mass

molar mass 0f CaSO4 = 136.14g/mol

=> number of moles of CaSO4 = 5.451 g / 136.14 g/mol = 0.0400 mol

3) Make a proportion with the unknown, 0.0400 mol and the theoretical molar ratio:

x / 0.0400 mol of CaSO4 = 2 mol of M / 3 mol of CaSO4

=> x = 0.400 * 2 / 3 mol of M = 0.02667 mol of M

4) Use the mass of 1.2 g and the number of moles to obtain the molar mass of M

molar mass = mass in grams / number of moles

=> molar mass = 1.2 g / 0.02667 moles = 45 g/mol

5) Use a periodic table to find the molar masses of different metals.

Scandium atomic mass is 45 g/mol, so the metal is Scandium.

Answer: Scandium

436 K = °C
163
709
-163
-709

Answers

436 Kelvin = 162.85 Celsius. To convert from Kelvin to Celsius you can use the folowing formula:

[°C] = [K] − 273.15.

Answer : The correct option is, [tex]163^oC[/tex]

Explanation :

The conversion used for the temperature from Kelvin to degree Celsius is:

[tex]K=273+^oC[/tex]

where,

K = temperature in Kelvin = 436 K

[tex]^oC[/tex] = temperature in degree Celsius = ?

Now put the value in the above conversion, we get the temperature in degree Celsius.

[tex]436=273+^oC[/tex]

[tex]^oC=436-273[/tex]

[tex]^oC=163[/tex]

Therefore, the temperature in degree Celsius is, [tex]163^oC[/tex]

Calculate the mass of butane needed to produce 96.7 g of carbon dioxide

Answers

31.9 grams butane needed to produce 96.7 grams CO2

A certain shade of blue has a frequency of 7.03 × 1014 Hz. What is the energy of exactly one photon of this light?

Answers

4.66 x 10^-19 Joules The energy of a photon is E=hf Where E = Energy h = Planck's constant (6.62607004Ă—10â’34 J s) f = frequency of photon. So plug in the known values E = 6.62607004Ă—10â’34 J s * 7.03 x 10^14 1/s E = 4.65812724x10^-19 J Since we only have 3 significant figures, the rounded result is E = 4.66x10^-19 J

The energy of one photon of light with a frequency of 7.03 × 1014 Hz is approximately 4.65618 × 10-19 Joules. This is obtained using Planck's equation, E = hf, where E is the energy, h is Planck's constant and f is the frequency of the light.

Explanation:

The subject of this question is Physics. The student wants to know the energy of exactly one photon of light that has a frequency of 7.03 × 1014 Hz. We can use Planck's equation which relates the energy of photon, its frequency and Planck's constant (h = 6.626 × 10-34 J.s).

So, the energy (E) of the photon is given by the formula E = hf. Substituting the frequency (f = 7.03 × 1014 Hz) and Planck's constant into the formula gives E = (6.626 × 10-34 J.s)(7.03 × 1014 Hz) which gives approximately 4.65618 × 10-19 Joules. This is the energy of one photon of light with a frequency of 7.03 × 1014 Hz.

Learn more about Photon here:

https://brainly.com/question/34240307

#SPJ12

How many fe(ii) ions are there in 15.0 g of feso4?

Answers

5.94 x 10^22 iron(II) ions

Answer : The number of Fe(II) ions present are [tex]5.94\times 10^{22}[/tex]

Explanation : Given,

Mass of [tex]FeSO_4[/tex] = 15.0 g

Molar mass of  [tex]FeSO_4[/tex] = 152 g/mole

First we have to calculate the moles of [tex]FeSO_4[/tex]

[tex]\text{Moles of }FeSO_4=\frac{\text{Mass of }FeSO_4}{\text{Molar mass of }FeSO_4}=\frac{15.0g}{152g/mole}=0.0987mole[/tex]

Now we have to calculate the number of Fe(II) ions.

In [tex]FeSO_4[/tex], there 1 atom of iron ion and 1 atom of sulfate ion.

As we know that,

1 mole of substance always contains [tex]6.022\times 10^{23}[/tex] number of atoms or ions.

As, 1 mole of [tex]FeSO_4[/tex] contains [tex]6.022\times 10^{23}[/tex] number of Fe(II) ions.

So, 0.0987 mole of [tex]FeSO_4[/tex] contains [tex]0.0987\times 6.022\times 10^{23}=5.94\times 10^{22}[/tex] number of Fe(II) ions.

Therefore, the number of Fe(II) ions present are [tex]5.94\times 10^{22}[/tex]

Which of the following statements describes a solid?
A.) It is easily compressed
B.) Its particles are packed together tightly
C.) It takes the volume of its container
D.) It takes the shape of its container

Answers

B.) Its particles are packed together tightly. 

Answer: Option (B) is the correct answer.

Explanation:

In solids, molecules are held together by strong intermolecular forces of attraction. Hence, the molecules are much more closer to each other.

As a result, they are unable to move from their initial position and can only vibrate at their mean position.

Hence, a solid has definite shape and volume. Solids cannot be compressed.

Whereas in a liquid, particles are held by less strong intermolecular forces of attraction as compared to solids. Therefore, in a liquid molecules are able to slide past each other and thus, they can be slightly compressed.

Liquids do not have a fixed shape but they do have a fixed volume.

In gases, molecules are widely spread out as they are held by weak Vander waal forces. Hence, they do not have a fixed shape but they acquire the volume of container in which they are placed.

Thus, we can conclude that the statement its particles are packed together tightly, is correct.

if the waste you have contains 100.0 grams of silver nitrate, how many mols of silver nitrate is this

Answers

Final answer:

To find the number of moles of silver nitrate, divide the mass by the molar mass.

Explanation:

To determine the number of moles of silver nitrate in a given mass, we need to use the molar mass of silver nitrate. The molar mass of silver nitrate (AgNO3) is 169.88 g/mol.

Given that the waste contains 100.0 grams of silver nitrate, we divide the mass by the molar mass to find the number of moles:

Number of moles = Mass (g) / Molar mass (g/mol)

Number of moles = 100.0 g / 169.88 g/mol = 0.589 mol

Learn more about moles of silver nitrate here:

https://brainly.com/question/22031122

#SPJ3

1. Given 100.0 grams of silver nitrate, we calculate it to be approximately 0.588 moles of silver nitrate.

2. According to the balanced chemical equation with copper, 0.294 moles of copper are needed to completely react with the silver nitrate. This ensures the reaction proceeds to completion.

To determine the number of moles of silver nitrate (AgNO₃) from the given mass, we use its molar mass:

Determine the molar mass of AgNO₃: 169.88 g/mol.Calculate the moles of silver nitrate:
Moles of AgNO₃ = mass / molar mass = 100.0 g / 169.88 g/mol ≈ 0.588 mol.

Next, we need to determine how many moles of copper (Cu) are needed to react completely with the silver nitrate.

The balanced chemical reaction between these two substances is:

2AgNO₃(aq) + Cu(s) → Cu(NO₃)₂ (aq) + 2Ag(s)

From the balanced equation, we see that 1 mole of Cu reacts with 2 moles of AgNO₃. Therefore, we use the stoichiometric ratio to find the required moles of copper:

Moles of Cu = 0.588 mol AgNO₃ * (1 mole Cu / 2 moles AgNO3) = 0.294 mol Cu

Correct question is: Answer the following :

1. If the waste you have contains 100.0 grams of silver nitrate, how many moles of silver nitrate is this? (Use the molar mass of the silver nitrate from above)
2. If you found that the waste contains 100.0 grams of silver nitrate, how many moles of copper would you need to completely react with all of the silver nitrate?

What kind of crystals halite crystal (rock salt)?

Answers

Halite crystals are isometric crystals.
Hope this helps!

Answer:

isometric crystal

Explanation:

At the county fair, Carrie and Sam climbed up on the carousel horses. Around and around they went; the horses also bobbed up and down. When they got off of the carousel, Carrie told Sam they had been accelerating during their ride. Sam disagreed; they had been moving at a constant speed. Whose response is fully correct, and why?

Answers

I believe sam's response is correct.
When human is riding a moving target with constant speed over a period of time, we tend to have  a visual acceleration perception due to our optical movement.
This make people such as Carrie believes that the carousel horses are accelerating while it actually stayed at constant pace.

Carrie is correct because acceleration involves a change in direction, not just speed. On the carousel, there is centripetal acceleration due to the constant change in direction of the horses on the carousel.

Carrie's understanding of the situation is fully correct. When they were on the carousel, Carrie and Sam were indeed accelerating despite moving at what seemed to be a constant speed. This is because acceleration is not just a change in speed, but a change in velocity, which includes both speed and direction. In the case of the carousel, although the horses were moving at a constant speed in a circular path, their direction was continually changing, which means they were undergoing centripetal acceleration. The fact that the horses also bobbed up and down adds vertical acceleration to the motion.

Observing other scenarios where objects are in motion, such as on gravity-driven amusement park rides or objects released from moving vehicles, it can be noted that acceleration and perceived motion can vary greatly depending on the observer's frame of reference. For instance, an object dropped by someone who is at rest with respect to the object will observe a different motion compared to someone who is not moving with the object.

In the case of an amusement park ride where a chair is hoisted up at a constant speed, if a rider drops a corndog without giving it any additional speed, it will initially move upwards with the same velocity as the rider, and then slow down due to gravity until it begins to fall towards the ground. The corndog's perceived acceleration from the rider's perspective is negative as it decelerates, but from the ground perspective, the corndog has a positive acceleration downwards (due to gravity) after release.

How would you test a colorless crystalline compound to determine if it was a hydrate?

Answers

A hydrate is a substance where in it contains water and other constituent elements. To know whether if that compound was a hydrate,you should record its mass, then put it in a test tube and heat it with a Bunsen burner. If the compound is a hydrate, the water in the compound will discharge in the form of water vapor. At the next 5-10 minutes, remove it in the test tube and weigh it up again. If the mass is now fewer, that means that there was water existing that has now evaporated, and the compound was a hydrate.

Final answer:

To test a colorless crystalline compound for being a hydrate, you can compare its solubility in water with known hydrates or use infrared spectroscopy to detect the presence of water molecules in the compound.

Explanation:

To test if a colorless crystalline compound is a hydrate, you can use several methods.

One way is to compare the compound's solubility in water with known hydrates. If the compound dissolves in water and the resulting solution has a higher mass than expected, it could indicate the presence of water molecules.

Another method is to perform an infrared spectroscopy analysis on the compound and compare it with known hydrates. Hydrates have characteristic absorption peaks in the infrared spectrum due to the presence of water molecules.

Learn more about Testing for hydrates here:

https://brainly.com/question/29792483

#SPJ11

Why should a new splint be used for each compound?

Answers

So that the injury wont come straight back if it is bumped.

The concentration of a dilute aspirin solution is 0.000529 m. standard solutions of this compound were used to prepare a beer\'s law plot which gives a slope of 1550.7 m-1. what is the expected absorbance value for the aspirin solution?

Answers

The expected absorbance for the dilute aspirin solution with a concentration of 0.000529 M and a Beer's Law plot slope of 1550.7 m-1 is 0.81967, according to the Beer's Law equation [tex]A = \epsilon b \times c[/tex].

The student has been tasked with determining the expected absorbance value of a dilute aspirin solution using Beer's Law. Beer's Law states that absorbance (A) is equal to the molar absorptivity (ε) times the path length (b) times the concentration (c).

In this case, the slope of the Beer's Law plot represents the product of the molar absorptivity and the path length (εb).

The given slope is 1550.7 m-1 and the concentration of the solution is 0.000529 M. Therefore, the expected absorbance (A) is calculated by multiplying these two:

[tex]A = \epsilon b \times c[/tex]

[tex]A = 1550.7 m^{-1} \times 0.000529 M = 0.81967[/tex]

This value represents the expected absorbance for the aspirin solution, assuming a path length of 1 cm.

What type of technology would you want to use to study gas giant planets?

Answers

Final answer:

To study gas giant planets, direct imaging and infrared observations using telescopes like JWST and Hubble are effective. Missions similar to Juno would provide close examination. Pre-mission, understand the solar system's characteristics, the planet's orbit, gravity, atmosphere, and magnetism.

Explanation:

To study gas giant planets, various techniques and technologies can be utilized depending on the attributes of the planet and what information is sought. For instance, to explore young gas giant planets that emit infrared light and are located at considerable distances from their stars, direct imaging is one of the effective methods. It leverages the fact that these planets retain significant internal heat from their formation, thus emitting substantial infrared radiation.

When using a large modern telescope for such studies, one might consider the James Webb Space Telescope (JWST) or the Hubble Space Telescope for their ability to capture high-resolution images and detect faint infrared signals, respectively. An alternative approach could involve sending a dedicated mission, such as a space probe, to examine the gas giants more closely. For example, a mission akin to the Juno spacecraft could yield significant insights into these vast worlds, prioritizing those with the most intriguing or least understood characteristics based on preliminary observations.

In preparation for sending a probe to a distant planet such as Jupiter, one must know the characteristics of the solar system, including the target planet's orbit, gravitational field, atmospheric composition, and magnetic environment. This information is crucial to design a spacecraft that can survive and navigate such extreme conditions.

Other Questions
a quantity of gas in a cylinder received 1600j of hear from a hot plate at the same time 800j of work are done on the gas what is the change in the internal energy? If a parabolas focus is at (1,1) and directrix is at y = 7, what is the standard form of the equation representing this parabola What is the slope of the line that passes through th epoints (26, 7) and (-39, 12)? Josh has eight pairs of white socks, two pairs of black socks, and one pair of blue socks. Write a fraction to represent the part of his socks that are white. Use / for the fraction line. thankyou so much for helping please do it correctly and dont just guess which of the following characteristics must be present for a substance to be called a mineral?a. have a crystal structure b. has an unpredictable chemical structure c. can be liquid or solid d. can be organic or inorganic The study of the characteristics of human population (growth, distribution, density, movement, and other visual statistics) is called: Javier used the equivalent ratios to find the number of millimeters in 8 inches. How many millimeters are in 8 inches?127 mm163.2 mm167 mm203.2 mm Can you be fluid overload and dehydrated at the same time Which of the following sentences uses parentheses correctly?A.The Anasazi left their cliff dwellings (possibly because of drought) and disappeared before Europeans arrived.B.The Anasazi left their cliff dwellings (possibly because of drought), and disappeared before Europeans arrived.C.The Anasazi left their cliff dwellingslong dashpossibly because of droughtlong dashand disappeared before Europeans arrived.D.The Anasazi left their cliff dwellings, (possibly because of drought), and disappeared before Europeans arrived. The gyri and sulci on the brain greatly increase the brain's surface area. how do you think this increase in surface area relates to improved brain function? 2. can you think of another organ in the human body that is shaped specifically to increase surface area? how does this organ's structure relate to its function in the body? (hint: think about those few bites of pancakes you ate in the opening paragraph.) 3. why do you think you created the frontal lobe of the cerebrum in the same color clay you used to create the three muscles of the face? 4. from the names alone, what do you think are the specific functions of the motor cortex and the sensory cortex of the brain? 5. what do you think the up and down arrows you carved into the spinal cord are meant to represent? 6. how do the central nervous system and the peripheral nervous system work together to control the body? In the diagram below bd is parallel to xy what is the value of y? Gali found that she can drive 140 miles in 3 hours, including rest stops, or interstate highways. How long would it take her to drive the interstates from Cleveland, Ohio to Washington, D.C. which is 350 miles? A certain shade of blue has a frequency of 7.07 1014 Hz. What is the energy of exactly one photon of this light? A pitcher's arm rotates at a speed of 7 degrees per millisecond (degrees/ms)At what speed does the pitcher's arm rotate in degrees/s? a certain medicine is given an amount proportional to a patient's body weight. suppose a patient weight 132 pounds requires 143 milligrams of medicine. what is the amount of medicine required by a patient weighing 156 pounds? Tia cut a 4 meter 8 centimeter wire into 10 equal pieces. Marta cut a 540 centimeter wire into 9 equal pieces. how much longer is one of Marta's wires than one of Tia's? Using only the values given in the table for the function, f(x), what is the interval of x-values over which the function is increasing?(6, 3)(3, 1)(3, 0)(6, 5) The Epic of _____ tells the story of a mythological king and a worldwide flood.GilmondGilliandGilgameshGilthen Which element leaves yellow deposits where it's found in the landscape, and is called "brimstone" in the bible? The glycolysis of glucose occurs in which cellular component?