FeCl2 Express your answers as ions separated by a comma.

Answers

Answer 1

The ionic compound formed from Fe3+ and Cl- is FeCl3, called iron(III) chloride. For dissociation in water, FeCl2 separates into Fe2+ and Cl-. The complete ionic equation for the reaction between FeCl2 and AgNO3 includes all ions present with AgCl precipitating out, and the net ionic equation shows just the ions involved in the formation of the precipitate.

Naming the Ionic Compound Formed from Fe3+ and Each Anion

To name the ionic compound formed from Fe3+ and an anion, you follow a set of rules. Firstly, you write the name of the cation including the charge in roman numerals enclosed in small brackets, followed by the name of the anion. For Fe3+, we use the name Iron(III), and for a chloride ion (Cl-), the name is chloride. The compound's formula is FeCl3, which is called iron(III) chloride. Remember that the subscript in the chemical formula indicates the number of anions needed to balance the charge of the cation.

Compound Dissociation in Water

To write a balanced equation for how an ionic compound like FeCl2 dissociates in water, you would represent it as follows:

FeCl2(s) -> Fe2+(aq) + 2 Cl-(aq)

This shows the separation of the ionic compound into its individual ions when dissolved in water.

Complete Ionic Equation for FeCl2 and AgNO3

The complete ionic equation for the reaction between FeCl2(aq) and AgNO3(aq), consulting solubility rules, would look like this:

Fe2+(aq) + 2 Cl-(aq) + 2 Ag+(aq) + 2 NO3-(aq) -> 2 AgCl(s) + Fe2+(aq) + 2 NO3-(aq)

Net Ionic Equation for FeCl2 and AgNO3

The net ionic equation, after removing the spectator ions, for the same reaction would be:

2 Cl-(aq) + 2 Ag+(aq) -> 2 AgCl(s)


Related Questions

Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.

Answers

Ans. : Volatile liquids with lower boiling points often gives better result than those with higher boiling points because for the liquid for the higher boiling might evaporate before it boils because of its volatility. For the one with higher boiling point it would take longer to boil than the one with a lower boiling point therefore it has a longer time for the liquid to evaporate before it boils.

At which stage does a gas form in a gas formation reaction?

the reactants stage
the product stage
the liquid stage
the solid stage

Answers

B, the product stage. I just took this test and got this answer right. Happy to help!

Answer: b

Explanation:

A gas mixture is made by combining 8.2 g each of ar, ne, and an unknown diatomic gas. at stp, the mixture occupies a volume of 19.44 l.what is the molar mass of the unknown gas

Answers

34 g/mol if using the post 1981 definition of STP 32 g/mol if using the pre 1982 definition of STP One minor complication is that the definition of STP changed in 1982 and some text books still use the old definition. So for this problem, I'll be giving two answers, but showing the work for only one of the results. Pre 1982, STP was defined as 273.15 K at exactly 1 atmosphere (101325. Pascals) Post 1981, STP was defined as 273.15 K at exactly 100 kPa (100000 Pascals) The result of this difference is that the volume of 1 mole of a gas at STP differs. Pre 1982, 1 mole of gas at STP has a volume of 22.414 liters. Post 1981, 1 mole of gas at STP has a volume of 22.71098 liters. First, determine the number of moles of gas molecules we have. 19.44 l / 22.71098 l/mol = 0.85597363 mol Now determine how many moles of Ar, and Ne we have. Look up the atomic weights. Atomic weight Argon = 39.948 Atomic weight Neon = 20.1797 Moles Argon = 8.2 / 39.948 = 0.205266847 mol Moles Neon = 8.2 / 20.1797 = 0.406348955 mol Calculate the number of moles of unknown gas by subtracting the number of moles of argon and neon we have from the number of moles of gas in total. So 0.85597363 mol - 0.205266847 mol - 0.406348955 mol = 0.244357829 mol Now that we know how many moles of the unknown gas we have, we can simply divide the mass by the number of moles, so 8.2 g / 0.244357829 mol = 33.55734514 g/mol Rounding to 2 significant figures gives a molar mass of 34 g/mol and since there isn't any element with a atomic weight of 17, I suspect that the textbook you're using is using the pre-1982 definition of STP. So repeating the calculations above with a volume of 22.414 liters per mole (pre-1982 definition of STP), the newly calculated molar mass becomes 32 g/mol which is a nice match for the unknown gas being oxygen. The differences using the older standard are: 19.44 l / 22.414 l/mol = 0.867315071 mol ; Number of moles in the volume of 19.44 l 0.867315071 mol - 0.205266847 mol - 0.406348955 mol = 0.255699269 mol ; moles of unknown gas. 8.2 g / 0.255699269 mol = 32.06892229 g/mol ; Molar mass of unknown gas.

Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.

Answers

The (s) in the chemical name of (s)-3-iodo-2-methylnonane indicates an S-configuration using the Cahn-Ingold-Prelog system of stereochemical nomenclature. The S-configuration means that an "imaginary" rotation from the highest priority substituent group to the lowest priority substituent group of the chiral center moves counterclockwise (to the left), provided that the lowest priority group is oriented "towards the back" (symbolized by dashed lines). 

The highest priority group (iodine in this case) is the one with the highest atomic number and the lowest priority (hydrogen in this case) is one with the lowest atomic number.

If the atoms directly beside the chiral center have the same atomic number (Carbon-2 and Carbon-4 in this case), the atoms next to them will be evaluated until a point of difference is found. Carbon-2 is connected to 2 other carbon atoms and 1 hydrogen atom, while Carbon-4 is connected to only 1 carbon atom and 2 hydrogen atoms. Thus, Carbon-2 has a higher priority, with the point of difference being the carbon atom of the methyl group attached to Carbon-2. Both Carbon-2 and Carbon-4 are connected to one carbon atom from the main nonane chain, but the other atoms connected to Carbon-4 are hydrogen atoms only. Carbon-2 has an extra carbon connected to it and carbon has a higher atomic number than hydrogen.

If there is no point of difference, the central atom is not chiral and cannot be named using the Cahn-Ingold-Prelog system. 

Thus, the structure of (s)-3-iodo-2-methylnonane is


Final answer:

The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.

Explanation:

The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.

Learn more about Organic Compound Structure here:

https://brainly.com/question/35316125

#SPJ3

Which of the following is the correct formula for barium (II) sulfate?

Answers

BaSO4 is the correct formula for barium (ll) sulfate
BaSO4 is the correct formula for barium (ll) sulfate

Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.

Answers

Co-product (rather than side product) of Horner-Emmons Wittig reaction is alpha-hydroxy phosphonate which by definition is hydrophilic as opposed to triphenylphosphine oxide. In addition, the side groups in Horner-Wittig reagents are typically Me or Et which are less bulky than phenyls are more compatible with hydrophilicity.

4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place

Answers

To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.

In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.

What role does the oxidation agent play in a redox reaction

Answers

The oxidizing agent receives electrons from the reducing agent.  Keep in mind that the reducing agent is the element in an oxidation-reduction reaction that gives an electron to another species. And since the reducing agent always loses its electrons, it is considered to call its condition 'oxidized'.

which state of matter undergoes changes in volume most easily?

Answers

The state of matter that undergoes changes in volume most easily is gas.
Final answer:

Gas is the state of matter that can most easily undergo changes in volume. The freely moving particles of gas adapt to take up the entire volume and shape of any container it is kept in.

Explanation:

The state of matter that undergoes changes in volume most easily is gas. This is because gaseous substances have the most dispersed particles among the three fundamental states of matter (solids, liquids, and gases). These particles move freely, occupying the complete shape and volume of the container in which they are kept. Thus, any change in the container's size will in-turn affect the volume of the gas. For instance, if we inflate a balloon with gas and then deflate it, the gas volume adjusts in line with the balloon's volume changes.

Learn more about State of Matter

https://brainly.com/question/31659891

#SPJ6

If 50% of radioactive element remains after 4000 years what what is the half life

Answers

4,000 years is the half life of that element. Nope 8,000 years, there will be 25% remaining

One radioactive isotope of calcium has an atomic mass number of 47. How many neutrons are in the calcium-47 nucleus?

Answers

isotope means having the same number of protons but different number of neutrons.
Thus, by looking at the periodic table the prton number is 20.
no. of neutrons in the isotope of Ca=47-20
Therefore the number of neutrons in calcium-47 is 27 neutrons.

Answer: The number of neutrons in the given isotope are 27.

Explanation:

Atomic number is defined as the number of electrons or number of protons that are present in a neutral atom. It is represented as Z.

Z = Atomic number = Number of electrons = Number of protons

Mass number is defined as the sum of number of protons and number of neutrons present in an atom. It is represented as A.

A = Mass number = Number of protons + Number of neutrons

Number of neutrons = Mass number - Atomic number

We are given an isotope having representation:  [tex]_{20}^{47}\textrm{Ca}[/tex]

Atomic number or number of protons = 20

Mass number = 47

So, number of neutrons = 47 - 20 = 27

Hence, the number of neutrons in the given isotope are 27.

How many dots would a lewis dot structure for neon have?

Answers

Eight, since it has eight valence electrons.

How many hydrogen atoms are in 2.80 mol of ammonium sulfide?

Answers

You can see each (NH4)2S has 
2 N atoms 
8 H atoms 
1 S atom 

So moles H atoms = 8 x moles (NH4)2S 
= 52.0 moles H 

1 mole anything = 6.022x10^23 units of that anything 

So number H atoms = moles H atoms x 6.022x10^23 atoms/mol 
= 52.0 x 6.022x10^23 atoms/mol 
= 3.13x10^25 atoms of H

Answer : The number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]

Explanation : Given,

Moles of hydrogen atoms = 2.80 mole

As we know that, the formula of ammonium sulfide is, [tex](NH_4)_2S[/tex]. In ammonium sulfide, there are 2 atoms of nitrogen, 8 atoms of hydrogen and 1 atom of sulfur.

Now we have to calculate the number of hydrogen atoms.

As, 1 mole of [tex](NH_4)_2S[/tex] contains [tex]8\times 6.022\times 10^{23}[/tex] number of hydrogen atoms.

So, 2.80 mole of [tex](NH_4)_2S[/tex] contains [tex]2.80\times 8\times \times 6.022\times 10^{23}=134.89\times 10^{23}[/tex] number of hydrogen atoms.

Therefore, the number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]

A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?

Answers

I need to know the answer of the above question.

moles of hydrogen in 9.15×10−2 mol C4H10

Answers

From the given formula, one mole of C4H10 contains 10 moles of hydrogen.

To know the number of moles of hydrogen in 9.15x10^-2, we will just do a cross multiplication as follows:
number of moles of hydrogen = (9.15 x 10^-2 x 10) / 1 = 0.915 moles

The ester below can be separated into phenol and an acetate salt, via saponification: heating the ester with a strong base, such as sodium hydroxide, will produce phenol and sodium acetate. the two chemicals can then be separated by heat and filtration.
a. calculate the unsaturation number of the ester above.
b. calculate the molecular weight of the ester above

Answers

I found a similar question online which will help me answer your incomplete question. To make it easier, show all the elements of the compound given. It is shown in the second picture attached.

a.) The formula for unsaturation number is shown in the 3rd picture attached. Following this, 
n = 8
m = 2(8) + 2 + 0 + 0 - 0 = 18
Thus,
x = Unsaturation number = (18 - 8)/2 = 5
The unsaturation number is 5.

b.) The molar mass of C is 12.01 g/mol; H is 1 g/mol; O is 16 g/mol. So, the molecular weight is:
Molecular weight = 12.01(8) + 8(1) + 2(16) = 136.08 g/mol
The molecular weight of the ester is 136.08 g/mol.

what is the definition of tributary

Answers

umm a tributary a stream of water that flows into another stream or a large body of water such as a river or lake 
Final answer:

A tributary is a smaller stream or river that flows into a larger one, contributing to its volume and influencing its navigability, ecosystem, and flooding potential.

Explanation:

The definition of a tributary is a stream or river that flows into a larger stream, river, or lake. These smaller watercourses contribute to the flow of the larger one, which is often referred to as the mainstem or parent river. Tributaries do not flow directly into the sea. They provide additional water volume to their parent river, which can then affect the river's ability to navigate, its ecosystem, and potential for flooding. For example, the Missouri River is a tributary of the Mississippi River because it flows into it.

Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?

Answers

The Density will be 3.7 mL

Which of these statements about enzymes is true?
a.) enzymes increase the rate of a reaction by decreasing the gibbs free energy change of the reaction.
b.) enzymes decrease the rate of a reaction by increasing the gibbs free energy change of the reaction.
c.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction.
d.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction and the gibbs free energy change of the reaction.
e.) enzymes do not change the rate of a reaction?

Answers

enzymes are organic catalysts
and catalysts generally increase rate of reaction by lowering activation energy
C is the answer

Enzymes increase the rate of a reaction by decreasing the activation energy required for the reaction but do not change the Gibbs free energy change of the reaction. Option C is correct.

Among the statements about enzymes, the true one is that enzymes increase the rate of a reaction by decreasing the activation energy of the reaction. Enzymes are biological catalysts that specifically bind to substrates and help convert them to products more efficiently by lowering the energetic barrier, which is the activation energy required for the reaction to proceed.

However, it is important to note that while enzymes do lower the activation energy, they do not alter the Gibbs free energy change (AG) of the reaction. The Gibbs free energy change is a thermodynamic property that determines the spontaneity of a reaction and remains unchanged regardless of whether enzymes are present.

Hence, C. is the correct option.

A child goes to the kitchen sink to rinse the glass from which he just drank grape juice. as the water runs into the glass, the juice residue turns from ppurple to light blue what is happening

Answers

the moore water is run I the glass the color lightens up

There are three common functional groups in organic chemistry that are readily ionized by adjusting the ph of the aqueous solution during an extraction. name and write the chemical structure of these three functional groups and show each

Answers

The three functional groups are carboxylic acids, amines and phenols. These functional groups can be turn to ions by adjusting their pH during extraction.
Their chemical strictures are as follows:
Carboxylic acid: RCOOH
Amines: RNH2
Phenols: C6H6O.

How many grams of CO2 are used when 7.0 g of O2 are produced?

Answers

Final answer:

The question cannot be answered as posed because a specific chemical reaction and balanced equation are needed to relate the masses of O2 and CO2.

Explanation:

To answer how many grams of CO2 are used when 7.0 g of O2 are produced, we assume the process is a typical combustion or respiration reaction, where CO2 is generated from O2, or vice versa. The balanced chemical equation for the combustion of carbon would typically be C + O2 → CO2. However, since we are given the mass of O2 produced, and not the mass of a carbon-containing fuel that reacts, we cannot proceed to calculate the mass of CO2 without additional information on the specific reaction involved, including the stoichiometry that defines the mass relationship between O2 and CO2. Therefore, we must have a balanced equation or a known reaction to relate the masses of O2 and CO2 produced in order to provide a specific answer.

Learn more about Chemical Reaction Stoichiometry here:

https://brainly.com/question/30415532

#SPJ12

9.62 grams of [tex]\( \text{CO}_2 \)[/tex] are used when 7.0 grams of [tex]\( \text{O}_2 \)[/tex] are produced.

One common reaction where [tex]\( \text{O}_2 \)[/tex] is produced and [tex]\( \text{CO}_2 \)[/tex] is consumed is photosynthesis:

[tex]\[ 6 \text{CO}_2 + 6 \text{H}_2\text{O} \rightarrow \text{C}_6\text{H}_{12}\text{O}_6 + 6 \text{O}_2 \][/tex]

From this balanced equation, we see that 6 moles of [tex]\( \text{CO}_2 \)[/tex] produce 6 moles of [tex]\( \text{O}_2 \)[/tex]. This means that 1 mole of [tex]\( \text{CO}_2 \)[/tex] produces 1 mole of[tex]\( \text{O}_2 \).[/tex]

Step-by-Step Solution:

1. Determine the molar mass of [tex]\( \text{O}_2 \)[/tex]:

[tex]\[ \text{Molar mass of O}_2 = 2 \times 16.00 \text{ g/mol} = 32.00 \text{ g/mol} \][/tex]

2. Calculate the moles of \( \text{O}_2 \) produced:

[tex]\[ \text{Moles of O}_2 = \frac{7.0 \text{ g}}{32.00 \text{ g/mol}} = 0.21875 \text{ moles} \][/tex]

3. Use the stoichiometry from the balanced equation:

  From the balanced equation, the mole ratio between[tex]\( \text{CO}_2 \) and \( \text{O}_2 \) is 1:1.[/tex]

 Therefore, the moles of [tex]\( \text{CO}_2 \)[/tex] used is the same as the moles of [tex]\( \text{O}_2 \)[/tex]produced:

[tex]\[ \text{Moles of CO}_2 = 0.21875 \text{ moles} \][/tex]

4. Determine the molar mass of [tex]\( \text{CO}_2 \)[/tex] :

[tex]\[ \text{Molar mass of CO}_2 = 12.01 \text{ g/mol} + 2 \times 16.00 \text{ g/mol} = 44.01 \text{ g/mol} \][/tex]

5. Calculate the grams of \( \text{CO}_2 \) used:

[tex]\[ \text{Grams of CO}_2 = \text{Moles of CO}_2 \times \text{Molar mass of CO}_2 \][/tex]

[tex]\[ \text{Grams of CO}_2 = 0.21875 \text{ moles} \times 44.01 \text{ g/mol} = 9.62 \text{ g} \][/tex]

If a feather and an iron bar is released from a same height in a room without any air resistance, which one(s) will impact the ground first.
A) neither one, because without air resistance gravity is absent
B) iron bar
C) both
D) feather

Answers

Final answer:

Both a feather and an iron bar will impact the ground at the same time if released from the same height in a room without air resistance, demonstrating that gravity causes all objects to fall with the same acceleration, disregarding their mass.

Explanation:

If a feather and an iron bar are released from the same height in a room without any air resistance, both the feather and the iron bar will impact the ground at the same time. The correct answer is C) both. This outcome occurs because in the absence of air resistance, all objects fall at the same rate due to gravity. This phenomenon was famously demonstrated on the Moon by astronaut David R. Scott in 1971, where, despite the Moon's lower gravitational acceleration of 1.67 m/s² compared to Earth's 9.81 m/s², both a hammer and a feather were shown to fall at the same rate when dropped from the same height. This validates that acceleration due to gravity is constant and does not depend on the mass of the objects involved.

Learn more about Free-fall in a vacuum here:

https://brainly.com/question/28228808

#SPJ3

How many liters of water are required to dissolve 1.00 g of barium sulfate?

Answers

Final answer:

To dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Explanation:

In order to calculate the amount of water needed to dissolve 1.00 g of barium sulfate, we need to use the molar mass of barium sulfate and the concept of molarity.

The molar mass of barium sulfate (BaSO4) is 233.43 g/mol. We can use this to convert the mass of barium sulfate to moles.

Once we know the number of moles of barium sulfate, we can use the molar ratio between barium sulfate and water to calculate the volume of water needed. The balanced equation for the dissolution of barium sulfate in water is:

BaSO4 (s) + H2O (l) → Ba2+ (aq) + SO42- (aq)

Based on this equation, 1 mole of barium sulfate dissolves to give 1 mole of water. Therefore, to dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Learn more about dissolving barium sulfate in water here:

https://brainly.com/question/5383482

#SPJ12

A chemist dissolves of pure barium hydroxide in enough water to make up of solution. calculate the ph of the solution. (the temperature of the solution is .) be sure your answer has the correct number of significant digits.

Answers

Barium Hydroxide is a strong base, so it would completely dissociate to Ba²⁺ and OH⁻. But it is crucial to know the concentration of the Ba(OH)₂ solution. For example, if you dissolve 1 g in 1 L of solution, then the concentration would be:

C = (1 g)(1 mol Ba(OH)₂/171.34 g)/ 1 L = 5.84×10⁻³ M
So, the concentration of [OH⁻] is
[OH⁻] = 5.84×10⁻³*2 = 0.0117 M

pH = 14 - -log(0.0117)
pH = 12.07
Final answer:

The pH of a 4.5 × 10^-4 M Ba(OH)2 solution is calculated by first determining the hydroxide ion concentration, which is doubled due to the two hydroxide ions provided by Ba(OH)2, and then calculating the pOH followed by subtracting from 14 to get the pH value of approximately 10.95.

Explanation:

Calculating the pH of Barium Hydroxide Solution

For the calculation of the pH of a 4.5 × 10-4 M barium hydroxide (Ba(OH)2) solution, it is crucial to consider that barium hydroxide is a strong base which dissociates fully in water. As Ba(OH)2 provides two moles of hydroxide ions for each mole of the substance dissolved, the hydroxide ion concentration will be twice the concentration of Ba(OH)2, which is 9 × 10-4 M (2 × 4.5 × 10-4 M).

To find the pOH of the solution, we take the negative logarithm of the hydroxide ion concentration: pOH = -log (9 × 10-4) = 3.045757491. To find the pH, subtract the pOH from 14: pH = 14 - 3.045757491, which simplifies to approximately pH = 10.95. This is a basic solution, as expected from barium hydroxide.

In laboratory settings, remember to use proper safety precautions, the correct form of chemicals, accurate measuring tools, and the appropriate methods to adjust the pH of solutions, such as adding acid or base. Moreover, for precise results, correctly label solutions and calibrate equipment such as pH meters as necessary.

The oceanic crust is made primarily from this type of rock.

Answers

Im pretty sure its basalt

Answer:

Igneous rock basalt.

Explanation:

The ocean crust is made mostly of igneous rock basalt, which comes from lava and the movement of tectonic plates.

what location on earth experiences the least change in the number of daylight hours throughout the year?

Answers

The areas around the equator. The equator is an invisible line going around the middle of the earth. Because of our tilted axis we get more light in some parts of the year, and less in others. But because the equator is right in the middle, the sun goes from east to west in the middle of the sky every day, meaning they get the same amount of daylight all year.

If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.

Answers

Ethanoic (Acetic) acid is a weak acid and do not dissociate fully. Therefore its equilibrium state has to be considered here.

[tex]CH_{3}COOH \ \textless \ ---\ \textgreater \ H^{+} + CH_{3}COO^{-} [/tex]

In this case pH value of the solution is necessary to calculate the concentration but it's not given here so pH = 2.88 (looked it up)

pH = 2.88 ==> [tex][H^{+}][/tex]  = [tex]10^{-2.88}[/tex] =  0.001 [tex]moldm^{-3}[/tex]

The change in Concentration Δ [tex][CH_{3}COOH][/tex]= 0.001 [tex]moldm^{-3}[/tex]


                                  CH3COOH          H+           CH3COOH    
Initial  [tex]moldm^{-3}[/tex]                      [tex]x[/tex]           0                     0
                                                                                                                       
Change [tex]moldm^{-3}[/tex]        -0.001            +0.001           +0.001
                                                                                                       
Equilibrium [tex]moldm^{-3}[/tex]      [tex]x[/tex]- 0.001      0.001             0.001
                                                                              

Since the [tex] k_{a} [/tex] value is so small, the assumption 
[tex][CH_{3}COOH]_{initial} = [CH_{3}COOH]_{equilibrium}[/tex] can be made.

[tex] k_{a} = [tex]= 1.8*10^{-5} = \frac{[H^{+}][CH_{3}COO^{-}]}{[CH_{3}COOH]} = \frac{0.001^{2}}{x} [/tex]

Solve for x to get the required concentration.

note: 1.)Since you need the answer in 2SF don&t round up values in the middle of the calculation like I've done here.

         2.) The ICE (Initial, Change, Equilibrium) table may come in handy if you are new to problems of this kind

Hope this helps! 



Why does ferrocene undergo the acylation reaction more readily than benzene?

Answers

A combination of Pd-catalyzed arene–alkynyl couplings and Cu(OAc)2-promoted internal alkyne dimerization furnishes novel ferrocene-based dehydroannulenes in high yield.

What is the angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ( SCN− ) ion?

Answers

Answer:

Angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ion[tex]SCN^-[/tex] is 180°.

Explanation:

The hybridization of carbon atom is sp hybridized. The shape of the sp hybridized carbon is linear which means that angle between sulfur carbon a bond and carbon nitrogen bond is 180 °.

Where as [tex]sp^3[/tex] hybridized carbon has tetrahedral shape with an angle of 109.5°.

Where as [tex]sp^2[/tex] hybridized carbon has trigonal planar with an angle of 120°.

Other Questions
Write a linear model for the cost of tickets based on the number of tickets a fan buys. what domus likely mean? for the immigrants to the united states the statue of liberty represents the hope for freedom and opportunity select true or false Use the Distributive Property to show that x+x=2x Solve the inequality and graph it... 9x -9 greater than or equal to 2(8x-15) Is the following sentence true or false?A refrain at the end of a stanza must repeat the same exact words each time. What are some things that people can do to prepare for parenthood? HOMEWORK HELP!!!!!!! 50 POINTS What is the theme of Taking the Plunge? How does the theme emerge and develop over the course of the passage? This president brought his slave, hercules, with him to philadelphia as his cook, despite pennsylvania's emancipation laws, which freed slaves who resided in the state for six months Which of these was not included as a piece of the American System?Question 1 options:internal (industrial and transportation) improvementsprotective tariff (to keep foreign goods more expensive than American made goods to help American businesses)universal manhood suffragerestoring a National Bank to the United States The poet uses metaphors mostly to emphasize the idea that the poem is meaningful because the speaker is poor. valuable because it provides many things. nourishing like a pot of food. a fashion piece or accessory, like a scarf. Simplify (x3+ 8x + 5) (2x2 3x 12). x2+ 11x + 17 x3 2x2+ 11x + 17 x2+ 5x 7 x3 2x2+ 5x 7 Wind moving in two directions over a prairie makes air in the middle spin. This is the beginning of a Piaget believe that the ___ fit entirely in a single stage of cognitive development called the ____ stage what is beach nourishment Hank's pickup can travel 42 miles on 3 gallons of gas. How many gallons will Hank's pickup need to travel 28 miles? DUE TOMORROW HELP PLEASE!! Two different ways to find the difference for 12-3 Which set of integers is a pythagorean triple?a. 2, 3, 6b. 3, 4, 5c. 4, 5, 9d. 5, 7, 12? what is f(-5) if f(x) equals |2x-1|+10?