Given f(x)=x-1 and g(x)=-x+1, find (f•g)(x)

Answers

Answer 1

[tex](fog)(x) = -x[/tex]

Step-by-step explanation:

The composition is calculated by putting the other function in place of variable

Given

[tex]f(x) = x - 1\\g(x) = -x+1[/tex]

The composition will be:

[tex](fog)(x) = g(x) -1\\=(-x+1) -1\\=-x+1-1\\=-x[/tex]

Hence,

[tex](fog)(x) = -x[/tex]

Keywords: Composition, Functions

Learn more about composition at:

brainly.com/question/2977815brainly.com/question/3071107

#LearnwithBrainly


Related Questions

I need help on these three.

Answers

Step-by-step explanation:

I think it 1,180 yeah I think it is

√6(7+√2)

Please solve and list steps

Answers

√6(7+√2)

Use the distributive property:

√6 * 7 + √6 * √2

Move the 7 to the left:

7 * √6 + √6 * √2

Use the product rule for radicals on  √6 * √2

7 * √6 + √(6*2)

Simplify:

7√6 + √12

Rewrite 12 as 2^2*3

7√6 + √(2^2*3)

Pull terms out from under the radical for final answer:

7√6 + 2√3

It takes 60 minutes to make 2000 copies on an old copy machine. The newer copier works with the old copier to create 2000 sheets and it only takes 15 minutes. How many minutes would the new copier need to create the 2000 copies on its own?

Answers

The new copier can create 2000 copies in 20 minutes.

Step-by-step explanation:

Given,

It takes 60 minutes to make 2000 copies by old printer and 15 minutes to made x number of copies, therefore, using proportion

[tex]60:2000::15:x[/tex]

Product of mean = Product of extreme

[tex]2000*15=60*x\\30000=60x\\60x=30000[/tex]

Dividing both sides by 60

[tex]\frac{60x}{60}=\frac{30000}{60}\\x=500[/tex]

As the new copier is working with old copier, therefore,

Copies made by new printer = 2000 - 500 = 1500

New copier can make 1500 copies in 15 minutes and 2000 copies in x minutes, using proportion

[tex]1500:15::2000:x\\1500*x=15*2000\\1500x=30000[/tex]

Dividing both sides by 1500;

[tex]\frac{1500x}{1500}=\frac{30000}{1500}\\x=20[/tex]

The new copier can create 2000 copies in 20 minutes.

Keywords: ratio, proportion

Learn more about proportions at:

brainly.com/question/2860697brainly.com/question/2977815

#LearnwithBrainly

What is the eighth term of the geometric sequence whose first three terms are 3, 6, and
12?

Answers

Answer:

The answer is 384.

Step-by-step explanation:

It starts at 3 going up by three to 6 then from there it adds 6 equaling 12 then so forth so it would be 3, 6, 12, 24, 48, 96, 192, 384

meghan wants to go to prem. the dress she wants cost her 78.99, the shoes are 32.50 the tickets are $25 and the dinner will be $50 .meghan babysitdms and has put $52 in savings so far she earns $12/hour babysitting meghan would like to have some money left over in her savings after she pays for everything ​

Answers

Answer:

Meghan should babysit for 12 hours

Step-by-step explanation:

       Meghan is soon going to have to spend $78.99 on a dress, $32.50 on shoes, $25 for the ticket and $50 for dinner.

       Meghan already has $52 from her savings to spend. She earns money from babysitting at $12 each hour.

       Let the number of hours Meghan babysits be denoted by [tex]x[/tex].

From [tex]x[/tex] hours of babysitting, Meghan earns $([tex]x\times12[/tex]).

So, her total earnings sum up to [tex]12x+52[/tex]. This should be greater than total spendings.

       [tex]12x+52\geq 78.99+32.50+25+50\\12x\geq 134.49\\x\geq 11.208[/tex]

So, Meghan must work for 12 hours so she has something left after spendings.

∴ Meghan must babysit for 12 hours.

If 4x < 24, then x < 6

Answers

Answer:

x is less than 6 so that is correct because 24 divided by 4 is 6

The radius of Earth is 6378.1 km.
How long is the metal ring?

Answers

Answer:

12 756.2 kilometers

Step-by-step explanation:

12 756.2 kilometers

A metallurgist has one alloy containing 34% copper another containing 48% copper. How many pounds of each alloy must he use to make 46 pounds of the third alloy containing 37% copper

Answers

Answer:

36.14 pounds of 34% copper alloy and 9.86 pounds of 48% copper alloy

Step-by-step explanation:

        First alloy contains 34% copper and the second alloy contains 48% alloy.

We wish to make 46 pounds of a third alloy containing 37% copper.

       Let the weight of first alloy used be [tex]x[/tex] in pounds and the weight of second alloy used be [tex]y[/tex] in pounds.

       Total weight = [tex]46\text{ }pounds=x+y[/tex]        [tex]-(i)[/tex]

      Total weight of copper = [tex]37\%\text{ of 46 pounds = }34\%\text{ of }x\text{ pounds + }48\%\text{ of }y\text{ pounds }[/tex]

       [tex]\dfrac{37\times 46}{100}=\dfrac{34x}{100}+\dfrac{48y}{100}\\\\ 34x+48y=1702[/tex]        [tex]-(ii)[/tex]

       Subtracting 34 times first equation from second equation,

[tex]34x+48y-34x-34y=1702-34\times46\\14y=138\\y=9.857\text{ }pounds \\x=36.143\text{ }pounds[/tex]

36.14 pounds of first alloy and 9.86 pounds of second alloy were used.

Final answer:

The metallurgist must use around 36.14 pounds of the 34% copper alloy and approximately 9.86 pounds of the 48% copper alloy to make 46 pounds of a 37% copper alloy.

Explanation:

To solve the problem involving an alloy containing copper, we can use a system of equations based on the percentages provided and the total weight required for the new alloy.

Let's denote x as the number of pounds of the 34% copper alloy, and y as the number of pounds of the 48% copper alloy. We are aiming to create 46 pounds of a 37% copper alloy.

The first equation represents the total weight of the mixture:

x + y = 46

The second equation represents the total amount of copper in the new alloy:

0.34x + 0.48y = 0.37 * 46

Solving this system of equations, we get:

Multiply the second equation by 100 to remove decimals: 34x + 48y = 37 * 46

Substitute y from the first equation into the second: 34x + 48(46 - x) = 37 * 46

Simplify and solve for x: 34x + 2208 - 48x = 1702

This yields -14x = -506, so x = 506 / 14 = 36.14

Using x to solve for y gives us y = 46 - 36.14 = 9.86

Therefore, the metallurgist must use around 36.14 pounds of the 34% copper alloy and approximately 9.86 pounds of the 48% copper alloy to make 46 pounds of the third alloy containing 37% copper.

To save for the purchase of a new car, a deposit was made into an account that earns 8% annual simple interest. Another deposit, $1700 less than the first deposit, was placed in a certificate of deposit (CD) earning 12% annual simple interest. The total interest earned on both accounts for 1 year was $676. How much money was deposited in the CD?
$

Answers

The amount deposited in CD is $660

Solution:

Given that , To save for the purchase of a new car, a deposit was made into an account that earns 8% annual simple interest.  

Let the amount deposited in new car be $ n

Another deposit, $1700 less than the first deposit, was placed in a certificate of deposit (CD) earning 12% annual simple interest.  

Then, amount deposited in CD will be $ (n – 1700)

The total interest earned on both accounts for 1 year was $676

The simple interest is given as:

[tex]\text { Simple interest }=\frac{\text { principal } \times \text {rate} \times \text {time}}{100}[/tex]

Simple interest for purchase of new car:

[tex]\text { S. } \mathrm{I}=\frac{n \times 8 \times 1}{100}=\frac{8 n}{100}[/tex]

Simple interest for CD:

[tex]\text { S.I } =\frac{(n-1700) \times 12 \times 1}{100}=\frac{12(n-1700)}{100}[/tex]

Now, given that S.I for new car + S.I for CD = 676

[tex]\begin{array}{l}{\frac{8 n}{100}+\frac{12(n-1700)}{100}=676} \\\\ {\frac{8 n+12 n-12 \times 1700}{100}=676}\end{array}[/tex]

20n = 67600 – 20400

n = 2360

So money deposited in CD = n - 1700 = 2360 – 1700 = 660

Hence, the CD deposit amount is $660

Final answer:

To find the amount deposited in the CD, set up an equation using the given information. Solve for x to find the amount of the first deposit. Subtract $1700 from the first deposit to find the amount deposited in the CD.

Explanation:

To find the amount of money deposited in the CD, we can set up an equation using the given information.

Let the amount of the first deposit be x.

The second deposit is $1700 less than the first deposit, so it is x - $1700.

Using the formula for simple interest, the interest earned on the first deposit is x * 0.08.

The interest earned on the second deposit is (x - $1700) * 0.12.

According to the given information, the total interest earned is $676. Therefore, we can set up the equation: x * 0.08 + (x - $1700) * 0.12 = $676.

Simplifying and solving for x:

0.08x + 0.12x - $204 = $676

0.20x - $204 = $676

0.20x = $880

x = $4400

Therefore, the amount of money deposited in the CD is $4400 - $1700 = $2700.

Through: (-1,-5), slope=3

Answers

Answer:

y + 5 = 3(x + 1) → point-slope form

y = 3x - 2 → slope-intercept form

3x - y = 2 → standard form

Step-by-step explanation:

The point-slope form of an equation of a line:

y - y₁ = m(x - x₁)

m - a slope

(x₁, y₁) - a point on a line

We have

m = 3, (-1, -5) → x₁ = -1, y₁ = -5

Substitute:

y - (-5) = 3(x - (-1))

y + 5 = 3(x + 1) → point-slope form

convert to the slope-intercept form y = mx + b:

y + 5 = 3(x + 1)      use the distributive property: a(b + c) = ab + ac

y + 5 = 3x + 3     subtract 5 from both sides

y = 3x - 2 → slope-intercept form

convert to the standard form Ax + By = C:

y = 3x - 2            subtract 3x from both sides

-3x + y = -2         change the signs

3x - y = 2 → standard form

Long-Term Mehlum
The boiling point of water T
by the function T(a) = -0
water T (measured in degrees), at altitude a (measured in feet) is mod
-0.0018a + 212. In terms of altitude and temperature, which
nt describes the meaning of the slope?
A. The boiling point decreases by
B. The boiling point decrea
C. The boiling point decreases by 10
D. The boiling point decrea:
decreases by 18 degrees as the altitude Increases by 1,000 feet.
reases by 1.8 degrees as the altitude increases by 1,000 feet.
decreases by 18 degrees as the altitude Increases by 1,000 feet.
t decreases by 1.8 degrees as the altitude increases by 1,000 feet.

Answers

Answer:

a

Step-by-step explanation:

Answer:

A

Step-by-step explanation:

EDGE 2021

Data scored 42 points in 3 games. How many points would you expect him to make in an 11 game season?

Answers

Answer:

He would score 154 points because he averages 14 points per game and 11 times 14 is 154

Data scored 42 points in 3 games, then points scored in 11 games will be equal to 154 points.

What is an arithmetic operation?

The four basic mathematical operations are the addition, subtraction, multiplication, and division of two or even more integers. Among them is the examination of integers, particularly the order of actions, which is crucial for all other mathematical topics, including algebra, data organization, and geometry.

As per information obtained from the question,

Let x points will be obtained in 11 games.

Data scored,

42 points = 3 games

Points earned in 1 game = 42/3 = 14

Then,

Points obtained in 11 games = 14 × 11

x = 154 points.

To know more about arithmetic operations:

https://brainly.com/question/13585407

#SPJ2

Cousin Hector drove 1,851 miles to the reunion. He lives in Mexico and drove 747 miles through that country to the United States border. How many miles did he drive in the United States?

Answers

Answer:

1104 miles

Step-by-step explanation:

Given

Hector drove 1851 miles totallyHector drove 747 miles from mexico till US border

Let x be the miles he drove in the United States

The total distance traveled by him= distance traveled in mexico + distance traveled in US

1851=747+x

x=1104 miles

⇒distance traveled in US= 1104 miles

if the area of a parallelogram is 86cm and the height is 12cm write an equation that relates the height,base and area of the parallelogram

Answers

Answer:

The relation to find base is, [tex]base=\frac{area\ of\ the \ parallelogram}{height}=\frac{86}{12}=7.16\ cm[/tex]

Step-by-step explanation:

Given

Area of the parallelogram [tex]=86\ cm^2[/tex]

Height of the parallelogram [tex]=12\ cm[/tex]

We know that the area of the parallelogram [tex]=base\times height[/tex]

So

To find base we have to divide the height on both sides of the equation.

[tex]base=\frac{area\ of\ the \ parallelogram}{height}[/tex]

Plugging the values.

[tex]base=\frac{86}{12} =7.1\ cm[/tex]

So the base in terms of area of the parallelogram and its height is [tex]b=\frac{area}{height} =\frac{86}{12}=7.16\ cm[/tex]

A lawn has a perimeter of 300 ft and width of 60ft and a bag of grass seeds cover 270ft how many seeds are needed for the new lawn

Answers

Answer:

Multiply the length by the width to find the area in square metres and then multiply that figure by 0.03 Kg to find out how much seed you'll need.

Step-by-step explanation:

Answer:

20 bags of seed is needed for the new lawn

Step-by-step explanation:

To answer this question, first find the area of the lawn and divide the area calculated by the number of square feet per bag of seed.

A  lawn is assumed to have a rectangular shape, the area (A) of the lawn  therefore is

               A = L x W

Where:    A = Area of lawn

                L = Length of lawn

               W =  Width of lawn

                A = L x W

                 L = ?

                W = 60 ft

To find the length, use the formula for the perimeter of a rectangle since the lawn is assumed to a rectangular shape

Perimeter (P) = 2(L+W)

                  P = 300 ft

            300  = 2(L + 60) ft

            300  = 2L + 120

Subtract 120 from both sides

   300 - 120  = 2L + 120 - 120

              180 = 2L

Divide both sides of the equation by the coefficient of L which is 2

         180/2 = 2L/2

             90 = L

              L  =  90 ft

That is, the length of the lawn is 90 ft

To calculate the area of the lawn

              A  = L x W

              L   =  90 ft

              W  = 60 ft

               A  = 90 ft x 60 ft

               A  = 5400 square feet

This means that the area of the lawn is 5,400 square feet

To get the number of bags of seed that will cover the lawn, divide the area of the lawn by the number square feet that a bag will cover.

Number of bags of seed  = Total Area of lawn/Number square feet per bag.

Total Area                          = 5400 square feet

Number square

feet per bag                      = 270

Number of bags               = 5400/270

                                          = 20 bags of grass seed

20 bags of seed is needed for the new lawn

6 people voted, and it ended up 84% to 16%. How many people voted for each option?​

Answers

Answer:

see the explanation

Step-by-step explanation:

we know that

To find out how many people voted for each option multiply the percentage in decimal form of each option by the total number of people

so

[tex]84\%=84/100=0.84[/tex] ---> [tex]0.84(6)=5.04=5\ people[/tex]

[tex]16\%=16/100=0.16[/tex] ---> [tex]0.16(6)=0.96=1\ people[/tex]

HELP I NEED YOUR HELP MATH ONE PROBLEM 10 POINTS HELP

Answers

Answer:

The Value of x is 40.

Step-by-step explanation:

Given:

∠SRT ≅ ∠STR

∠SRT = 20

m∠SRT = 4x

To find: Value of x

Solution:

From the given data,

m ∠SRT = 20

Also ∠SRT ≅ ∠STR

Hence from congruence and equality property we can say that;

m∠STR= 20

m∠STU= 4x

Now by straight angle property which states that sum of two angles which are created by a straight line is always 180.

Hence,

∠STR +∠STU =180

Now Substituting the given values we get;

[tex]20+4x=180\\4x=180-20\\4x=160\\\\x=\frac{160}{4} =40[/tex]

Hence m∠STU = 4x =4 ×40 = 160°

Hence the value of x = 40.

Find the area and circumference of a circle with radius 2 cm use 3.14 for pie do not round answers

Answers

Answer:

The area is 12.56, and the circumference is 12.56.

Step-by-step explanation:

For the area,

We need to use the formula A=3.14*radius*radius

So we plug it in, and we get 3.14*2*2, which is 12.56 centimeters squared.

For circumference, we need to do,

C = 3.14*diameter

To find the diameter we need to do 2 (radius) x 2 which is 4

Plugging it in that would be 3.14 * 4 which is 12.56

So, in this case, the area is 12.56, and the circumference is also 12.56.

Final answer:

The area of a circle with a radius of 2 cm is 12.56 cm², and the circumference is 12.56 cm, using 3.14 for pi.

Explanation:

To find the area and circumference of a circle with a radius of 2 cm, we can use the formulas A = πr² for the area and C = 2πr for the circumference, where π (pi) is approximately 3.14.

Area of the Circle

The area of the circle is calculated using the formula A = πr². Plugging in the radius:

A = 3.14 × (2 cm)²


A = 3.14 × 4 cm²


A = 12.56 cm²

Circumference of the Circle

The circumference of the circle is calculated using the formula C = 2πr. Plugging in the radius:

C = 2 × 3.14 × 2 cm


C = 12.56 cm

5/6 is equivalent to a percent that is larger than 100%.

True or False

13 pts.

Answers

I think it's false.... 5/6 is 83.33% as a percent so I don't think it's true.

6/6 ......... 100%

5/6 ..............x%

x = 5/6*100/6/6 = 500/6 = 83,(3)%

A textile factory in the United States plays 300 workers a total of $9 million each year to produce 4.5 million shirts. A foreign factory employs 225 workers at a total cost of $1,050,000 to produce 2,500,00 shirts. How do the labor costs per shirt of the American and foreign factory compare

Answers

Answer:

The labor cost per shirt of the American factory is 0.36 times the labor cost per shirt of the foreign company.

Step-by-step explanation:

A textile factory in the United States plays 300 workers a total of $9 million each year to produce 4.5 million shirts.

Therefore, the labor cost per shirt will be

[tex]\frac{9 \times 10^{6}}{300 \times 4.5 \times 10^{6}} = 0.0067[/tex]

Again, a foreign factory employs 225 workers at a total cost of $1,050,000 to produce 2,500,00 shirts.

Therefore, the labor cost per shirt will be

[tex]\frac{1050000}{250000 \times 225} = 0.01867[/tex]

Therefore, the labor cost per shirt of the American factory is 0.36 times (Approximate) the labor cost per shirt of the foreign company. (Answer)

Which does not show a direct variation between x and y ?

A) y = 5x
B) y = 6/x
C) y - 0.7x
D) y = x/9

Answers

Answer:

B

Step-by-step explanation:

in B, the expression can be writting in variation form as

y∝1/x

this indicate an inverse variation

Answer:

B) y=6/x

Step-by-step explanation:

I took the test.

8. You are a computer technician for Data Control. You earn a regular hourly
rate of $15.40. You earn time and a half for overtime work on Saturdays and
double time on Sundays. This week you worked 38 hours from Monday
through Friday, 8 hours on Saturday, and 5 hours on Sunday. What is your
total pay for the week?

Answers

Answer:

Total pay for the week is $924.

Step-by-step explanation:

The per hour rate of weekdays from Monday to Friday =  $15.40

The rate for Saturday = One and Half ( $15.40)

Now,  [tex]1\frac{1}{2}  \times (15.40)  = \frac{3}{2} (15.40) = 23.1[/tex]

So, the per hourly rate for work on Saturday  = $23.1

The rate for Sunday  = 2 x ( $15.40)  = $30.80

So, the per hourly rate for work on Sunday  = $30.80

Now, total hours worked in weekday = 38

So, the rate of 38 hours = 38 x ( Per hour rate) = 38 x ($15.40)  

                                        = $585.2

Now, total hours worked on Saturday  = 8

So, the rate of 8 hours = 8 x ( Per hour rate) = 8 x ($23.1)    = $184.8

Now, total hours worked on Sunday  = 5

So, the rate of 5 hours = 5 x ( Per hour rate) = 5 x ($30.80)    = $154

Hence the total pay = Payment of ( weekday  + Saturday +Sunday)

= $585.2 +  $184.8 +  $154  =  $924

Hence, total pay for the week is $924.

When do you need to rationalize the denominator? My physics teacher says that you don't have to if you are isolating a variable.

Answers

Answer:

When the denominator is an irrational number in order to make the denominator a rational number we rationalize the denominator.

Step-by-step explanation:

For example,

[tex]\frac{1}{1+\sqrt{2} }[/tex] (here the denominator is an irrational number)

Multiply the numerator and denominator by [tex]1-\sqrt{2}[/tex]

We get [tex]\frac{1-\sqrt{2} }{(1+\sqrt{2})(1-\sqrt{2}) }[/tex]

Here (1+\sqrt{2})(1-\sqrt{2}) = -1

Thus we get [tex]\sqrt{2} -1[/tex]

Here the denominator has become a rational number.

When we are isolating a variable we are only taking the required variables to one side thus it doesn't require rationalization.

[tex]a = \frac{x}{1+\sqrt{2} }[/tex]

Then we can say,

[tex]x = a(1+\sqrt{2})[/tex]

No rationalisation required

A car originally priced at $8,900 is on sale at 15% off. If the sales tax rate is 8.25%, what is the sale price of the car?

Answers

Answer:

8189.11

Step-by-step explanation:

If 8900 is 100% and we need to find 15%  we would multiply 8900 and 15 then divide by 100 and that equal 1335 so we would then subtract 1335 from 8900 because it is 15% off, which equals 7565, so now 7565 is 100% and we need to add the 8.25% tax, so we multiply 7565 and 8.25 then divide by 100 which equals 625.11 then we add 7565 and 625.11 which equals 8189.11

The sale price of the car is $8,188.36.

What is Percentage?

To determine the quantity or percentage of something in terms of 100, use the percentage formula. Per cent simply means one in a hundred. Using the percentage formula, a number between 0 and 1 can be expressed.

We have,

A car originally priced at $8,900 is on sale at 15% off.

If the sales tax rate is 8.25%.

So, Discount

= 15% of $8,900

= 0.15 x $8,900

= $1,335

Now, Price after discount

= $8,900 - $1,335

= $7,565

and, Sales tax

= 8.25% of $7,565

= 0.0825 x $7,565

= $623.36

So, Sale price of the car

= $7,565 + $623.36

= $8,188.36

Therefore, the sale price of the car is $8,188.36.

Learn more about Percentage here:

https://brainly.com/question/29306119

#SPJ3

What is the equation of the line that all inverses reflect across?

Answers

So if you're asked to graph a function and its inverse, all you have to do is graph the function and then switch all x and y values in each point to graph the inverse. Just look at all those values switching places from the f(x) function to its inverse g(x) (and back again), reflected over the line y = x.

The equation of the line across which all inverses reflect is y = x. This reflection principle applies to linear functions, hyperbolas, and other mathematical relations where inverses can be found by interchanging the roles of x and y.

The equation of the line that all inverses reflect across is y = x. This is because when you are finding the inverse of a function, you swap the x and y variables, thus mirroring the original function across the line y = x. If you have a linear function in the slope-intercept form (y = mx + b), and you find its inverse, assuming the function is one-to-one and therefore has an inverse, you would essentially swap the x and y coordinates, resulting in the equation of its inverse. This process reflects each point of the original function across the line y = x.

As an example, for a line with an equation y = -x + 1, the inverse when reflected across the line y = x would result in swapping x and y to get x = -y + 1, which when solved for y, gives the inverse function's equation. Conversely, for a function expressed in another form, such as a hyperbola or a set of simultaneous linear equations, the principle is the same: to find the inverse, interchange the roles of the dependent and independent variables. For instance, a hyperbola described by y = a - b/x could have its inverse derived by interchanging x and y, leading to the inverse relation x = a - b/y.

Without using a calculator, fill in the blanks with two consecutive integers to complete the following inequality
_____<√74 <____

Answers

Answer:

8<74 square root<9

Step-by-step explanation:

The first thing we have to do is to find the lowest number that can be squared to 74. 1,4,9,16,25,36,49,64,81,100.

As we see, 64 is the lowest closest number to 74 and the square root of 64 is 8. So right now, is 8<square root of 74<___.

Now, we have to find the highest number closest to 74. As we look back at our square roots, 81 is the closest number to 74 in the square roots and the square root is 9 and voila. 8<sqrt74<9

The inequality is -

8 < √74  < 9.

We have the following inequality -

_____<√74 <____.

We have to fill in the blanks with two consecutive integers to complete the above inequality.

What is inequality ?

In mathematics, an inequality is a relation which makes a non-equal comparison between two numbers or other mathematical expressions.

According to the question -

Let A = √74

Then -   A² = 74

The nearest integers, square of between which lies is between 8 and 9. So -

8² < A² < 9²

Therefore, the two consecutive integers will be - 8 and 9.

Hence, the inequality is -

8 < √74  < 9

To solve more questions on comparing numbers, visit the link below-

https://brainly.com/question/13763555

#SPJ2

Kiera is buying the items shown at the right
for her kitchen. Will $35 be enough to purchase all three items?
Explain your reasoning.
mixing bowl
14.95
spatula
8.49
measuring cups
10.75

Answers

Answer:

Yes

Step-by-step explanation:

Total Price of all 3 items - $34.19

35 > 34.19

Yes, Kiera will have enough to purchase all three items.

No, $35 will not be enough to purchase all three items.

To determine if $35 is enough to purchase all three items, we need to calculate the total cost of the items and compare it to the amount of money Kiera has.

The cost of each item is as follows:

- Mixing bowl: $14.95

- Spatula: $8.49

- Measuring cups: $10.75

Now, let's add up the costs of these items to find the total cost:

Total cost = Cost of mixing bowl + Cost of spatula + Cost of measuring cups

Total cost = $14.95 + $8.49 + $10.75

To make the calculation easier, we can round each price to the nearest whole number:

- Mixing bowl: $14.95 ≈ $15.00

- Spatula: $8.49 ≈ $8.50

- Measuring cups: $10.75 ≈ $10.75 (already a whole number)

Now, let's calculate the total cost with these rounded numbers:

Total cost ≈ $15.00 + $8.50 + $10.75

Total cost ≈ $34.25

However, even with rounding, the total cost is $34.25, which is still less than $35. Therefore, we need to calculate the exact total cost without rounding:

Total cost = $14.95 + $8.49 + $10.75

Total cost = $34.19

Since the total cost of $34.19 is less than $35, it appears that Kiera has enough money to purchase all three items. However, we must also consider sales tax, which is not included in the given prices. Sales tax rates vary by location, but let's assume a standard rate of 7%.

To calculate the total cost including sales tax:

Total cost with tax = Total cost before tax + (Total cost before tax × Sales tax rate)

Total cost with tax = $34.19 + ($34.19 × 0.07)

Total cost with tax = $34.19 + $2.3933

Total cost with tax ≈ $34.19 + $2.40 (rounded to the nearest cent)

Total cost with tax ≈ $36.59

After including the sales tax, the total cost is approximately $36.59, which is more than the $35 Kiera has. Therefore, $35 will not be enough to purchase all three items once sales tax is included.

what is the greatest common factor of 12, 40 and 68

Answers

Answer:

4 is the greatest

Step-by-step explanation:

How do I find the coordinates of the point P that lies along the directed segment from C(-3,-2) to D(6,1) and partitions the segment in the ratio 2 to 1?

Answers

[tex]\bf \textit{internal division of a line segment using ratios} \\\\\\ C(-3,-2)\qquad D(6,1)\qquad \qquad \stackrel{\textit{ratio from C to D}}{2:1} \\\\\\ \cfrac{C\underline{P}}{\underline{P} D} = \cfrac{2}{1}\implies \cfrac{C}{D} = \cfrac{2}{1}\implies 1C=2D\implies 1(-3,-2)=2(6,1)\\\\[-0.35em] ~\dotfill\\\\ P=\left(\frac{\textit{sum of "x" values}}{\textit{sum of ratios}}\quad ,\quad \frac{\textit{sum of "y" values}}{\textit{sum of ratios}}\right)\\\\[-0.35em] ~\dotfill[/tex]

[tex]\bf P=\left(\cfrac{(1\cdot -3)+(2\cdot 6)}{2+1}\quad ,\quad \cfrac{(1\cdot -2)+(2\cdot 1)}{2+1}\right) \\\\\\ P=\left( \cfrac{-3+12}{3}~~,~~\cfrac{-2+2}{3} \right)\implies P=\left( \cfrac{9}{3}~~,~~\cfrac{0}{3} \right)\implies P=(3~~,~~0)[/tex]

Describe the pattern 0.13, 0.65, 3.25, 16.25

Answers

Answer:

multiply by 5

Step-by-step explanation:

Note the ratio between consecutive terms is constant, that is

[tex]\frac{0.65}{0.13}[/tex] = [tex]\frac{3.25}{0.65}[/tex] = [tex]\frac{16.25}{3.25}[/tex] = 5

Thus the pattern is multiply by 5

Answer:Multiply by 5

Step-by-step explanation:

Other Questions
Cousin Hector drove 1,851 miles to the reunion. He lives in Mexico and drove 747 miles through that country to the United States border. How many miles did he drive in the United States? 3.Mitosis and meiosis are similar processes, but they have some very important differences. Explain how mitosis and meiosis are alike and how they are different. Provide at least two similarities and three differences. The height of your success is equal to the depth of your gratitude. Explain this quote A total of $150000 is invested in two funds paying 6.25% and 6% simple interest. If the total interest for the year is $9212.50, how much is invested at each rate? I need help on these three. A car originally priced at $8,900 is on sale at 15% off. If the sales tax rate is 8.25%, what is the sale price of the car? alculate the enthalpy of the reaction 4B(s)+3O2(g)2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)3O2(g)+B2H6(g), HA=+2035 kJ 2B(s)+3H2(g)B2H6(g), HB=+36 kJ H2(g)+12O2(g)H2O(l), HC=285 kJ H2O(l)H2O(g), HD=+4 HELP I NEED YOUR HELP MATH ONE PROBLEM 10 POINTS HELP When you drink cold water, your body must expend metabolic energy in order to maintain normal body temperature (37 C) by warming up the water in your stomach. Could drinking ice water, then, substitute for exercise as a way to "burn calories?" Suppose you expend 286 kilocalories during a brisk hour-long walk. How many liters of ice water (0 C) would you have to drink in order to use up 286 kilocalories of metabolic energy? For comparison, the stomach can hold about 1 liter. Find the area and circumference of a circle with radius 2 cm use 3.14 for pie do not round answers Theodore Roosevelt is often called a "Progressive" President. Which of these would BEST be an example of this label? Which choice could be the equation of a line perpendicular to the line represented by this equation?y = 5x 2A.B.y = 5x +2C.D.y = 5x + 5 1. In dialogue, periods, commas, question marks, and exclamation points gomarks2. List the ways to make your writing sound more natural.3. List three ways to vary your sentences.4. Why is it important to use a personal touch?5. One way to add humor to your writing is by using 0.812In to a fraction The layout of an envelope can be adjusted using the ____ tab Surf City's ad Manager, Dan, calls the billboard company to buy the billboard. He speaks with Jim, a salesperson. Jim asks how long Dan intends to run the campaign. Dan replies he expects to keep an outdoor message up along the interstate for 10 years or more. Jim responds that while a 30-sheet poster is a good choice, more permanence and impact can be achieved with a(n)A. junior poster.B. painted bulletin.C. spectacular.D. inflatable panel.E. inside bus. When you go to vote at your local library, you notice your neighbor walking around keeping a watchful eye on voters and officials. What role is your neighbor filling at the polling place? A 8.00 L tank at 26.9 C is filled with 5.53 g of dinitrogen difluoride gas and 17.3 g of sulfur hexafluoride gas. You can assume both gases behave as ideal gases under these conditions. Calculate the mole fraction and partial pressure of each gas, and the total pressure in the tank What is an enzyme? Explain some characteristics of enzymes. Describe each type of primary election and its uses.