HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16​

HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16

Answers

Answer 1

Answer:

Step-by-step explanation:

Oof, all 6?  That's not fun.  

I'm going to show you one for the first bunch, (4-12) and hopefully you can get the rest.  If not let me know and I can more carefully work you through some others on here.

4)  So first we need the angle.  How do we find that?  Well, we know it's somewhere between 270 and 360 degrees (or 3pi/2 and 2pi radians) since it's in the fourth quadrant.    The method to finding the angle is ifferent for each quadrant, but it's nice to know around where you'll get.  Anyway,, if we take 360 and subtract that little space  that is unlabeled  we will know  the rest.    Hopefully that makes sense, but let me know if not, it's important to understand.  Maybe think of what happens if you add the two together, you get around the whole circle then.  

Anyway, to find that little sliver, we are going to construct a right triangle wherethe x axis is one side.  If you draw a line connecting point p and the x axis you have this right triangle.  I am going to call this sliver we don't know s.  ANyway, now we use trig here.  

s = arcsin(3/5) (you can find 5 pretty easily but let me know if you don't see it.)

You may think to use -3 instead of 3, and  it wouldn't be a huge mistake, it will just give you the negative version of what we want.  

Anyway, now we know theta is 360-s (or 2pi-s).  You can solve s or leave it as arcsin(3/5) so you don't have to round.

Now we can solve the trig functions.  If you don't know the sum and difference trig identities  you will have to round.  They are pretty simple formula though.  For instance, sin(2pi - arcsin(3/5)) = sin(2pi)cos(arcsin(3/5))-cos(2pi)sin(arcsin(3/5)) = 0 - 3/5 = -3/5  You will also want to know that s = arcsin(3/5) = arccos(4/5) = arctan(3/4).  ROunding will get you close but not exact.

Again, let me know ifyou need any more help, they should just be a lot of doing the same thing over and over and over again though.  

14)  For 14 and 16 you just need to know how the graphs of sin, cos and tan look.  Is this something you have trouble with?  Like could you draw the graphs at the intervals of increasing/ decrasing and all.  if not I can give a quick explanation.


Related Questions

2a - 14 - 7b + 10
Select ALL coefficients from the expression above. I NEED AN ANWSER ASAP​

Answers

its called be a smart kid and actually paying attention u downs syndrome idiot

Look at these equations.
11 = 5 + a
a + 4 = b + 3
Use both equations to work out the value of b.
Pls Help

Answers

Bonjour cheese gateou! je help tes maths!

11=5+a

11-5=a

6=a

a + 4 = b + 3

a - b = - 4 + 3

a-b=-1

Merci beaucoup...

11 = 5 + a
11 - 5 = a
6 = a

6 + 4 = b + 3
10 = b + 3
10 - 3 = b
7 = b

complement of angle Y. Y=(8x-20°)​

Answers

Answer:

Step-by-step explanation:

Complement = 90 - Angle

Complement = 90 - y

Complement = 90 - (8x - 20)

Complement = 90 - 8x + 20

Complement = -8x + 110

Final answer:

The complement of an angle Y denoted as (8x-20°), is found by subtracting the angle from 90°. After distribution and addition, the final formula for the complement of angle Y is 110° - 8x.

Explanation:

The complement of an angle is defined as the difference between 90 degrees and the angle. In this case, we need to find the complement of angle Y, represented as (8x-20°).

To find the complement, we subtract the angle from 90°. So, the complement of angle Y is given by the formula 90° - (8x - 20°).

When you distribute the negative sign into the parentheses, the formula becomes 90° - 8x + 20°. Adding 90° and 20° gives us 110°, making the final formula for the complement of angle Y as 110° - 8x.

Learn more about the Complement of an angle here:

https://brainly.com/question/29775107

#SPJ2

Grade 6,7, and 8 at a middle school each have 180 students. The student council is throwing a school dance and they want to know what Theme to have for the dance. Since the student council cannot ask everyone they will Survey a group of students. Which sample can best help the council to draw conclusions about the preferences of all the students in the school.

A. 6 students from each grade

B. 25 students from each grade

C. 6 students from the entire school

D. 25 students from the entire school

Answers

The answer is B. 25 students from each grade. This is because it will be the most accurate answer of what the school dance will be.
Your answer is B. 25 children a grade would have the most accurate data because you'd be taking 75 children's ideas.

What is the least common multiple (LCM) of 10 and 12?

Answers

The LCM of 10 and 12 = 60.

Hope this helped!

Answer:

60

Step-by-step explanation:

Some people think this concept is confusing. Let's break it down. First, let's ask, what is a multiple?

We get a multiple of a number when we multiply it by another number other than zero. For example:

Multiples of 10: [tex]10, 20, 30, 40, 50, 60, 70, 80, 90, 100...[/tex]

Multiples of 12: [tex]12,24,36,48,60,72,84,96,108...[/tex]

The Least Common Multiple is the smallest multiple of the two numbers. The smallest multiple we see 10 and 12 have is 60.



HELP will mark brainilest
The original price of a sound system is $1250. For one day only, the store is offering a frequent shopper discount of 35% on all merchandise. Which expressions can be used to find the discounted price of the sound system? Check all that apply.

0.35($1250)
$1250 + 0.35($1250)
0.65($1250)
$1250 – 0.35($1250)

Answers

Answer:

The answer to your question is $1250 - 0.35($1250)

Step-by-step explanation:

You need 35 black tiles and 28 white tiles to tile a patio. How many
tiles will you need in all? Use the Distributive Property to help you
find the sum.

Answers

In a simple addition problem like this, just directly add the number of black tiles (35) and white tiles (28). So, 35 + 28 equals 63. You will need 63 tiles in all to tile the patio.

The question asks you to find the total number of black and white tiles needed to tile a patio, using the Distributive Property to do the math.

However, the Distributive Property is used for multiplying a number by a group of numbers added together, not for a simple addition problem like this. For this question, you directly add the number of black tiles (35) and white tiles (28).

So, 35 (number of black tiles) + 28 (number of white tiles) equals 63. Therefore, you will need 63 tiles in all to tile the patio.

For more such questions on addition, click on:

https://brainly.com/question/35006189

#SPJ2

what is the answer to 1/8÷1/4​

Answers

1/8÷1/4​

Flip over the second fraction

1/4=4/1

1/8 *4/1

Cross out 8 and 4 ,divide by 4

8/4=2

4/4=1

1/2 *1/1=1/2

Answer: 1/2

Answer:

1/2

Step-by-step explanation:

1/8 divided by 1/4 becomes

1/8 multiplied by 4/1

(When we divide fractions the second fraction flips and we multiply instead of division)

So the answer is 1/2

2x+y=8

What is the work for it?

Answers

Answer:

y= -2x+8

Step-by-step explanation:

2x+y=8

-2x     -2x

__________

y= -2x+8

I think this is what you're asking for. The question is kind of confusing.

300 students were surveyed. 240 completed the survey. What is the percentage of students surveyed

Answers

240 divided by 300 would be 0.8 multiply by 100 giving you 80. 80 percent.

Final answer:

To calculate the percentage of students who completed the survey, divide the number who completed it (240) by the total number surveyed (300) and then multiply by 100, yielding 80%.

Explanation:

To find the percentage of students who completed the survey, we use the formula for calculating a percentage: (Number of Students Who Completed the Survey ÷ Total Number of Students Surveyed) × 100. In this case, it's (240 ÷ 300) × 100, which equals 80%. Therefore, 80% of the students surveyed completed the survey. This is a common type of problem in statistics that involves dealing with portions and percentages of a whole.

. In this case, 240 students completed the survey out of 300 students surveyed. So, the percentage of students surveyed is:

Percentage = (240 / 300) * 100 = 80%

3w - (7w + 12) = 2(w – 3)

how do u do this step by step​

Answers

Answer:

w=-1

Step-by-step explanation:

3w-7w-12=2(w-3)

1) Combine alike terms:

-4w-12=2(w-3)

2) Use the Distributive property on the left side of the equation:

-4w+12=2w-6

3) Add a 6 to both sides:

-4w-6=2w

4) Add a 4w to both sides:

-6=6w

5) Divide both sides by 6:

w=-6/6

6) Simplify the fraction:

w=-1

The solution to the equation 3w - (7w + 12) = 2(w - 3) is w = -1.

The given equation is 3w - (7w + 12) = 2(w – 3).

Distribute the negative sign (-) to the terms inside the parentheses on the left side and distribute the 2 to the terms inside the parentheses on the right side:

3w - 7w - 12 = 2w - 6

-4w - 12 = 2w - 6

Move all the terms involving w to one side of the equation by adding 4w to both sides:

-4w + 4w - 12 = 2w + 4w - 6

-12 = 6w - 6

Add 6 to both sides of the equation to isolate the term with 6w:

-12 + 6 = 6w - 6 + 6

-6 = 6w

Divide both sides of the equation by 6 to solve for w:

(-6) / 6 = 6w / 6

-1 = w

Therefore, the solution to the equation 3w - (7w + 12) = 2(w - 3) is w = -1.

To learn more on Equation:

https://brainly.com/question/10413253

#SPJ6

Two angles are complementary. The measure of the larger angle is 10 more than 4 times the measure of the smaller angle. Find the measures of both angles.


Can someone please help me?

Answers

Answer:

16 = small

74 = big

Step-by-step explanation:

4x+10 = big angle

x = small angle

4x+10+x = 90

5x+10 = 90

5x = 80

x = 16

4 x 16 + 10 = 74

Avocado out!!!!!!!!!

Answer:

[tex]y=16^{\circ},x=74^{\circ}[/tex]

Step-by-step explanation:

Let complementary angles are x and y.

Let x is larger angle between x and y.

We have to find the measure of both angles x and y.

According to question

[tex]x=4y+10[/tex]

We know that complementary angles :Two angles whose sum is 90 degrees.

[tex]x+y=90^{\circ}[/tex]

[tex]4y+10+y=90[/tex]

[tex]5y=90-10=80[/tex]

[tex]y=\frac{80}{5}=16^{\circ}[/tex]

Substitute the value then we get

[tex]x=4(16)+10=74^{\circ}[/tex]

'Find the highest common factor of 32, 48 and 72. show your working'

please please help asap <3

Answers

Answer:

HCF(32,48,72) = 8

Step-by-step explanation:

We have ,

32 = 2×2×2×2×2 =

48 = 2×2×2×2×3 = 2⁴×3¹

72 = 2×2×2×3×3 = 2³×3²

Now,

HCF(32,48,72) = 2³ = 8

/* Product of the smallest power of each common prime factors of the numbers */

Suppose that each quarter at a particular community college Jared has to pay $785 in tuition and $23 in fees. If Jared has 2 quarters remaining find the total amount he will need for tuition and fees

Answers

Answer:

he will need exactly $808.75

Final answer:

Jared's total expense for the remaining 2 quarters would amount to $1616, which is the sum of tuition ($785) and fees ($23) per quarter, multiplied by the total remaining quarters (2).

Explanation:

To determine the amount Jared will need for tuition and fees, we first have to calculate the total cost for each quarter. For every quarter, the total cost comprises of $785 in tuition and $23 in fees. Consequently, the overall cost per quarter will be 785 (for tuition) + 23 (fees), which amounts to $808.

Given that Jared still has 2 quarters remaining, the net amount he would require will be the product of the amount needed per quarter and the number of remaining quarters i.e., 808 * 2, therefore equally to $1616.

Learn more about tuition and fees calculation here:

https://brainly.com/question/32938164

#SPJ2

Solve the equation c2 = 4.​

Answers

Answer:

C = 2

Step-by-step explanation:

[tex]2*2=4[/tex]

The required solution for the given equation c² = 4 is  c = 2.​​

What is an equation?

In mathematics, an equation is a formula that expresses the equality of two expressions by connecting them with the equal sign = .

Now the given equation is,

c² = 4

Since factor 4 = 2 x 2

Therefore, 4 = 2 x 2 = 2²

So the given equation becomes,

c² = 2²

Taking square root both the side we get,

√c² = √2²

Therefore,

c = 2

which is the required solution of the given equation.

Thus, The required solution for the given equation c² = 4 is  c = 2.​​

To learn more about equations:

brainly.com/question/2273153

#SPJ2

Convert 45°C to Fahrenheit using the formula F = 5 C + 32.
081°F
O 113°F
O 57°F
138.6°F
Question #25MultipleChoice

Answers

Answer:113

here you go

Answer:

113

Step-by-step explanation:

Here you go

1. Classify the equation 7x + 3 = 7x - 4
as having one solution, no solution, or
infinitely many solutions.​

Answers

Answer:

No solution

Step-by-step explanation:

There are no values of x  that make the equation true.

If A= (-1,-3) and B = (11,-8), what is the length of Ad?

Answers

Answer:

AB = 13

Step-by-step explanation:

The formula of a distance between two points

[tex]A(x_1,\ y_1),\ B(x_2,\ y_2)\\\\d=\sqrt{(x_2-x_1)^2+(y_2-y_1)^2}[/tex]

We have the points A(-1, -3) and B(11, -8).

Substitute:

[tex]AB=\sqrt{(-8-(-3))^2+(11-(-1))^2}=\sqrt{(-8+3)^2+(11+1)^2}\\\\=\sqrt{(-5)^2+12^2}=\sqrt{25+144}=\sqrt{169}=13\\\\\sqrt{169}=13\ \text{because}\ 13^2=169[/tex]

f (x) = (x + 1)(x - 3)(x-4)
Factored form number of roots

Answers

There are 3 factors.

One root per factor.

Set each factor to 0 and solve for x individually.

The PSU charges $2 for a package weighing up to 3 lbs, plus an additional fee of $0.15 per lb over 3lbs . what is the most a package can weigh that you plan to mail if you have 3 dollars ? (the nearest whole lb)

Answers

The correct answer is 9lbs!

You will start by subtracting the initial $2 which leaves you with $1 left. after that you count how many times $0.15 goes into your $1 left. That answer should be 6 time which is $0.90. Now you add the 6 to the original 3 to get 9lbs!

Find the difference. –12 – (–21) = _____ –33 –9 33 9

Answers

Answer:

9

Step-by-step explanation:

(-)(-) = (+)

(-)(+) = (-)

(+)(-) = (-)

(+)(+) = (+)

-(-21) = (-)(-21) = (+)21 = 21

-12 - (-21) = -12 + 21           use commutative property: a + b = b + a

= 21 + (-12) = 21 - 12 = 9

Pleassseee help, and show steps

Answers

Answer:

(p +5)²  = 26

Step-by-step explanation:

p²+10p = 1

try to arrange them like a²+2ab+b² ;

     

here,

a² = p²  →      ∴a=p

and,

2ab = 10p

⇒2ab = 10a    [∵a=p]

∴ b=5            [dividing both sides by 2a]

∴b²=5²

hence,

⇒ p² + 2 .p.5 + 5² = 1+5²   [add  5² on both sides ]

⇒ (p +5)²  =1+25

∴  (p +5)²  = 26

             

What is the slope of the line represented by the equation y = -x-3?

Answers

Answer:

(C) 1/3

Step-by-step explanation:

The slope intercept form: y = mx + b.

Note:

m = slope

b = y-intercept

x & y = (x , y) for the points.

You are trying to get the y-intercept of the following function given:

f(x) or y = (-2/9)x + (1/3)

1/3 is your answer, or (C), for 1/3 replaces the b inside the equation.

If you really need the slope, the slope of the following equation is (-2/9), which replaces the m inside the equation.

~

What is the image point of (9,8) after a translation right 4 units and up 2 units?​

Answers

Answer:

(13,10)

Step-by-step explanation:

On the graph, all the points going right starting from 0, would be positive, and all points going up starting from 0 would be positive.

You should also know that going right would mean the x (which is 9 here) would get bigger; and the y (which is 4) going up would get bigger too.

So if you move (9,8) right 4 times 9 + 4 = 13, so now you have (13,8).

Then, you move (13,8) up 2 units, so 8+2 more units = 10, so then your final answer would be (13,10).

Hope this helped, sorry if its confusing I wasn't born to teach lol

The image point of (9, 8) is (13, 10), after the translation.

What is the required image point ?

In graphs, we know that the horizontal line is the x-axis, more we go right in that line, more positive values of x we get & in similar manner, more we go left, we get more negative values of x.

So, if we translate (9, 8), 4 units in the right, then we get larger value of x, i.e. 9+4=13 and the point becomes (13,8)

Also, the vertical line on a graph defined the y-axis, more we go up in that line, more we get positive values of y and more we go down that line, more we get negative values of y.

So, if we up the value of y 2 units, then the co-ordinate of y is 8+2 = 10

And the point becomes (13,10)

So, the required image point is (13,10)

Learn more about image point here :

https://brainly.com/question/2418777

#SPJ2

which whole number is closest to the value of square root of 54?
[tex] \sqrt{54} [/tex]
1. 6
2. 7
3. 8
4. 9​

Answers

The answer for this problem is 7
The answer is 7 because 7 • 7 is 49 which is the to the value of the square root of 54.
Hope this helps!

Find the vertex of the function given below.
y = 3x2 + 6x +1

Answers

Answer: The coordinates of the vertex are : (-1,-2)

Step-by-step explanation: To find the x coordinate, we use the formula:

Xv = -b/2a = -6/(2.3) = -6/6 = -1

Replacing x by -1, we write:

y = 3. (-1)^2 + 6. (-1) +1 = 3 - 6 + 1 = -2

The vertex of the function will be (-1, -2)

What is Function?

A relation between a set of inputs having one output each is called a function.

Given that;

The function is,

⇒ y = 3x² + 6x + 1

Now,

Since, The function is,

⇒ y = 3x² + 6x + 1

By comparing with the standard form of a quadratic equation ax²+bx+ c , we get;

⇒  a = 3, b = 6 c = 1

Since, The x- coordinate of the vertex is,

⇒ x = - b/2a

Substitute all the values, we get;

⇒ x = - 6/2×3

⇒ x = - 6/6

⇒ x = - 1

And, Put x =- 1 in the function, we get;

⇒ y = 3x² + 6x + 1

⇒ y = 3(-1)² + 6(-1) + 1

⇒ y = 3 - 6 + 1

⇒ y = - 2

Thus, The value of vertex = (- 1, - 2)

Learn more about the function visit:

https://brainly.com/question/17043948

#SPJ2

What is the range of the function in this table?
|
|
24
3 | 3
4 | 2

Answers

recall that in a function, the output or f(x) or namely the dependent variable set is the range.

[tex]\bf \begin{array}{ccll} \stackrel{domain}{x}&\stackrel{range}{y}\\ \cline{1-2} 2&4\\ 3&3\\ 4&2 \end{array}\qquad \qquad \stackrel{\mathbb{RANGE}}{\{4,3,2\}}[/tex]

I need help solving this equation does anybody know what x is? 5+x+(-2)=-8

Answers

Answer: x=5

Step-by-step explanation:

5+x+(−2)=−8

Simplify

5 + x - 2 = -8

x + 3 = -8

Subtract 3 to both sides

x + 3 - 3 = -8 +3

Simplify

x = -5

Answer:

x=-11

Step-by-step explanation:

5+x+(-2)=-8

x+(-2)=-13

x=-11


What is the surface area of a sphere with a diameter of 8 mm?
Use 3.14 for π .

Answers

Answer:

Step-by-step explanation:

804.25mm

Match the property of equality with the example that models the property.
multiplication property of equality
55/11 = 11x/11
addition property of equality
3x - 4 + 4 = 12 + 4
subtraction property of equality
(4x)(1/4) = (3)(1/4)
division property of equality
(1/2) + 5x -(1/2)=8-(1/2)

Answers

Answer:

Each property is about an operation. Specifically, each property indicates that an equality is like a balance, if we operate one side, we must also operate the other side with the same operation and number.

So, the example that shows a division, that is representing the division property, and so on.

Division property of equality: this property states that if we divide one side of the equation, we must divide the other side by the same number.

[tex]\frac{55}{11}=\frac{11x}{11}[/tex]

Multiplication property of equality: this property states that if we multiply one side of the equation, we must multiply the other side by the same number

[tex](4x)(\frac{1}{4} )=(3)(\frac{1}{4} )[/tex]

Adition property of equality.

[tex]3x-4+4=12+4[/tex]

Subtraction property of equality.

[tex]\frac{1}{2}+5x-\frac{1}{2}=8-\frac{1}{2}[/tex]

The corret match is as follows:

Multiplication property of equality: (4x)(1/4) = (3)(1/4)

Addition property of equality : 3x - 4 + 4 = 12 + 4

Subtraction property of equality: (1/2) + 5x -(1/2)=8-(1/2)

Division property of equality: 55/11 = 11x/11.

For multiplication property of equality:

Consider an equation:

4x = 3

Multiply by (1/4) on both sides by this property we get,

(4x)(1/4) = (3)(1/4)

For addition property of equality:

Consider an equation:

3x - 4  = 12
Add 4 both sides we get,

3x - 4 + 4 = 12 + 4

For subtraction property of equality:

Consider an equation:

(1/2) + 5x=8

Subtract both sides by (1/2)

(1/2) + 5x -(1/2)=8-(1/2)

For division property of equality:

Consider an equation:

55= 11x

Divide both sides by 11 we get,

55/11 = 11x/11.

Hence,

The corret match is:

Multiplication property of equality: (4x)(1/4) = (3)(1/4)

Addition property of equality : 3x - 4 + 4 = 12 + 4

Subtraction property of equality: (1/2) + 5x -(1/2)=8-(1/2)

Division property of equality: 55/11 = 11x/11.

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ3

Other Questions
Which is greater, 9 x 10-2 or 3 x 10-4? How many timesgreater is the number you chose than the other number?Explain your reasoning. Denson, Inc. has 10,000 shares of 7%, $100 par value, non-cumulative preferred stock and 40,000 shares of $1 par value common stock outstanding at December 31, 2014. There were no dividends declared in 2013. The board of directors declares and pays a $120,000 dividend in 2014. What is the amount of dividends received by the common stockholders in 2014?a. $0.b. $70,000.c. $120,000.d. $50,000. What is the best definition of "oxidation state"? The number of electrons an atom has The number of neutrons an atom has The number of electrons an atom has relative to a neutral atom of the same element The number of neutrons an atom has The number of electrons and protons an atom has Jessica's home town is a mid-sized city experiencing a decline in population. The following graph models the estimated population if the decline continues at the same rate. Select the most appropriate unit for the measure of time that the graph represents. A. hours B. years C. weeks D. days i need help with a math problem right now it says A car rental agency advertised renting a car for $23.95 per day and $0.25 per mile. If Trevor rents this car for 3 days, how many whole miles can he drive on a $100 budget? The pressure and temperature at the beginning of compression of a cold air-standard Diesel cycle are 100 kPa and 300K, respectively. At the end of the heat addition, the pressure is 7.2 MPa and the temperature is 2250 K. Assume constant specific heats evaluated at 300 K. Determine the cut-off ratio. There is a +/- 5% tolerance. - When a person does work on an object, the object gains energy. As a bicycle rider rides from the bottom to the top of a hill, theenergy from the work can become which combination of types of energy.The riders work becomes kinetic energy onlyThe riders work becomes a combination of kinetic energy and heatThe riders work becomes a combination of gravitational potential and heatThe riders work becomes a combination of gravitational potential,energy and heat Sex steroids are secreted by the __________ cells of the ovary and the ___________ cells of the testes. Whats an example of ecumene?? An inflatable raft (unoccupied) floats down a river at an approximately constant speed of 5.6 m/s. A child on a bridge, 71 m above the river, sees the raft in the river below and attempts to drop a small stone onto the raft. The child releases the stone from rest. In order for the stone to hit the raft, what must be the horizontal distance between the raft and the bridge when the child releases the stone? Discuss the evolutionary significance of increasing complexity from unicellular to multicellular organisation? A functional group on an amino acid that is polar and can become positively charged: ___________ An architect draws a blueprint of a house. He draws the living room on the blueprint as 4.5 in. long by 6 in. wide with a scale of 1 in. for every 4ft. He draws a second copy of the blueprint with a scale of 1 in. for every 3 ft. How many inches long should the living room be in this secondblueprint? Testing for information would be most likely to occur in which type of engineering?MarineChemicalStructuralComputer Assume you are given a variable x below:int x = 10;Create a pointer and save the memory address the variable x to the pointer:Answer:4.) You are given a class below, create a accessor and mutator function for field age.class Student{public: string name;private: int age;} The distance remaining for a road trip over several hours is shown in the table. Use information to find the constant rate of change in miles per hour. A nonconducting container filled with 25 kg of water at 23C is fitted with a stirrer, which is made to turn by gravity acting on a weight of mass 32 kg. The weight falls slowly through a distance of 5 m in driving the stirrer. Assume that all work done on the weight is transferred to the water and that the local acceleration of gravity is 9.8 ms2, determine:(a) The amount of work done on the water.(b) The internal-energy change of the water.(c) The final temperature of the water, for which Cp =4.18 kJ/kgC.(d) The amount of heat that must be removed from the water to return it to it initial temperature. solve each14 is 38% of what? 92% of what is 110please explain how to do i wanna understand Is the question is it ethical to eat meat testable? ou drag your feet on a carpeted floor on a dry day and the carpet acquires a net positive charge. a. Will you have an electron deficiency or an excess of electrons?b. If the load acquired has a magnitude of 2.15 nC, how many elecrtrons were transferred?