help asap pls

there is a 90% chance that a person eats dinner, a 60% chance a person eats dessert, and 50% chance the person will eat dinner and dessert. which of the following is true

Help Asap Pls There Is A 90% Chance That A Person Eats Dinner, A 60% Chance A Person Eats Dessert, And

Answers

Answer 1

Answer:

Eating dinner and eating dessert are dependent events because

P(dinner) . P(dessert) = 0.9 × 0.6 = 0.54 which is not equal to

P(dinner and desert) = 0.5 ⇒ answer A

Step-by-step explanation:

* Lets study the meaning independent and dependent probability  

- Two events are independent if the result of the second event is not

  affected by the result of the first event

- If A and B are independent events, the probability of both events  

 is the product of the probabilities of the both events

- P (A and B) = P(A) · P(B)

* Lets solve the question  

∵ There is a 90% chance that a person eats dinner

∴ P(eating dinner) = 90/100 = 0.9

∵ There is a 60% chance a person eats dessert

∴ P(eating dessert) = 60/100 = 0.6

- If eating dinner and dating dessert are independent events, then

 probability of both events is the product of the probabilities of the

 both events

∵ P(eating dinner and dessert) = P(eating dinner) . P(eating dessert)

∴ P(eating dinner and dessert) = 0.9 × 0.6 = 0.54

∵ There is a 50% chance the person will eat dinner and dessert

∴ P(eating dinner and dessert) = 50/100 = 0.5

∵ P(eating dinner and dessert) ≠ P(eating dinner) . P(eating dessert)

∴ Eating dinner and eating dessert are dependent events because

  P(dinner) . P(dessert) = 0.9 × 0.6 = 0.54 which is not equal to

  P(dinner and desert) = 0.5


Related Questions

Point K is the midpoint of QZ. Point K is located at (-1,-11), and point Z is located at (7,-3). Where is point Q located?

Answers

[tex]\bf ~~~~~~~~~~~~\textit{middle point of 2 points } \\\\ Q(\stackrel{x_1}{x}~,~\stackrel{y_1}{y})\qquad Z(\stackrel{x_2}{7}~,~\stackrel{y_2}{-3}) \qquad \left(\cfrac{ x_2 + x_1}{2}~~~ ,~~~ \cfrac{ y_2 + y_1}{2} \right) \\\\\\ \left(\cfrac{7+x}{2}~~,~~\cfrac{-3+y}{2} \right)~~=~~\stackrel{\stackrel{midpoint}{K}}{(-1,-11)}\implies \begin{cases} \cfrac{7+x}{2}=-1\\[1em] 7+x=-2\\ \boxed{x=-9}\\ \cline{1-1} \cfrac{-3+y}{2}=-11\\[1em] -3+y=-22\\ \boxed{y=-19} \end{cases}[/tex]

Answer:

[tex](-9,-19)[/tex]

Step-by-step explanation:

Givens

[tex]K(-1,-11)\\Z(7,-3)\\Q(x_{1},y_{1})[/tex]

Now, the definition of midpoint is

[tex]K(\frac{x_{1}+x_{2} }{2} ,\frac{y_{1}+y_{2}}{2} )[/tex]

But, we know that [tex]K(-1,-11)[/tex], so we replace each vale, where [tex]x_{2} =7[/tex] and [tex]y_{1}=-3[/tex]

[tex]-1=\frac{x_{1}+7 }{2} \\-2=x_{1}+7\\-2-7=x_{1}\\x_{1}=-9\\[/tex]

[tex]\frac{y_{1}+y_{2}}{2}=-11\\y_{1}-3=-22\\y_{1}=-22+3\\y_{1}=-19[/tex]

Therefore, Q is located at [tex](-9,-19)[/tex]

what is the point-slope form of the equation for the line with a slope of -2 that passes through the point (4,-6)​

Answers

Answer: y+6=-2(x-4)

Step-by-step explanation:

Point slope form: Y-y1=m(x-x1)

Answer:

[tex]y+6=-2(x-4)[/tex]

Step-by-step explanation:

Point-slope form of a line is [tex]y-y_1=m(x-x_1)[/tex] where the slope is [tex]m[/tex] and [tex](x_1,y_1)[/tex] is a point on the line.

We know both of those things so we have enough information without doing any math to do this problem.  You just got to plug in.

So replace [tex]m[/tex] with -2, [tex]x_1[/tex] with 4, and [tex]y_1[/tex] with -6.

Like so:

[tex]y-(-6)=-2(x-4)[/tex].

You can simplify a little:

[tex]y+6=-2(x-4)[/tex].

Determine, to the nearest tenth, the perimeter of the triangle shown in the accompanying diagram.
A. 29.7
B. 23.3
C. 24.9
D. 28.5

Answers

Answer: c) 24.9

Step-by-step explanation:

Use the distance formula then add and round to nearest tenth

The perimeter of the triangle ABC will be 24.9. Then the correct option is C.

What is the distance between two points?

Let one point be (x, y) and another point be (h, k).

Then the distance between the points will be

D² = (x – h)² + (y – k)²

The vertices of the triangle are A(1, 3), B(11, 4), and C(7, 9).

The distance between AB will be

AB² = (11 – 1)² + (4 – 3)²

AB² = 101

AB = 10.05

The distance between BC will be

BC² = (11 – 7)² + (4 – 9)²

BC² = 41

BC = 6.40

The distance between AC will be

AC² = (7 – 1)² + (9 – 3)²

AC² = 72

AC = 8.50

Then the perimeter of the triangle ABC will be

Perimeter = AB + BC + CA

Perimeter = 10.05 + 6.40 + 8.50

Perimeter = 24.95 ≈ 24.9

The perimeter of the triangle ABC will be 24.9.

Then the correct option is C.

Learn more about the distance between two points here:

https://brainly.com/question/18296211

#SPJ2

Sin(x) = 1/7
A.3.2
B.8.2
C.12.4
D.14.3

Answers

La correcta respuesta es número D porque solo tienes que dividir los dos numeros

Answer: B

Step-by-step explanation: If you use inverse sin, then you can take sin^-1(1/7) and get 8.2. To check this, do sin(8.2) and it comes out to 1/7

A customer is tiling a shower, the main, back wall of which is 6' by 4'.
The tile they want to use is 3" x 6", which comes 20 pieces to a box.
How many pieces of this tile do they need for this project? (No Waste)​

Answers

Answer:

a lot

Step-by-step explanation:

Answer:

192 pieces of tiles will be required.

Step-by-step explanation:

A customer is tiling a shower's back wall which is in the dimensions of 6' by 4'

This area of the wall is = 6 × 4 square feet = 24 feet²

Customer wants to cover this wall with the tiles measuring 3" by 6" or 3 inches by 6 inches.

Now we will convert these dimensions of the tiles in foot.

Since 12 inches = 1 foot

Therefore, 1 inch = [tex]\frac{1}{12}[/tex] foot

Dimensions of one tile in foot will be [tex]\frac{3}{12}[/tex] foot by [tex]\frac{6}{12}[/tex] foot.

In simplified form, dimensions of the tile is [tex]\frac{1}{4}[/tex] foot by [tex]\frac{1}{2}[/tex] foot.

Area of one tile = [tex]\frac{1}{4}\times \frac{1}{2}=\frac{1}{8}[/tex] square feet

Number of tiles = [tex]\frac{\text{Area of the wall}}{\text{Area of one tile}}[/tex]

                          = [tex]\frac{24}{\frac{1}{8}}[/tex]

                          = 24×8

                          = 192 tiles

Therefore, 192 pieces of tiles will be required.

Approximate area under the curve f(x) =-x^2+2x+4 from x=0 to x=3 by using summation notation with six rectangles and use the the right endpoint value for x to calculate the height​

Answers

Answer:

Summation notation:

[tex]\frac{1}{2}\sum_{k=1}^6f((.5k))[/tex]

or after using your function part:

[tex]\frac{1}{2}\sum_{k=1}^6(-(.5k)^2+2(.5k)+4)[/tex]

After evaluating you get 11.125 square units.

Step-by-step explanation:

The width of each rectangle is the same so we want to take the distance from x=0 to x=3 and divide by 6 since we want 6 equal base lengths for our rectangles.

The distance between x=0 and x=3 is (3-0)=3.

We want to divide that length of 3 units by 6 which gives a length of a half per each base length.

We are doing right endpoint value so I'm going to stat at x=3. The first rectangle will be drawn to the height of f(3).

The next right endpoint is x=3-1/2=5/2=2.5, and the second rectangle will have a height of f(2.5).

The next will be at x=2.5-.5=2, and the third rectangle will have  a height of f(2).

The fourth rectangle will have a height of f(2-.5)=f(1.5).

The fifth one will have a height of f(1.5-.5)=f(1).

The last one because it is the sixth one will have a height of f(1-.5)=f(.5).

So to find the area of a rectangle you do base*time.

So we just need to evaluate:

[tex]\frac{1}{2}f(3)+\frac{1}{2}f(2.5)+\frac{1}{2}f(2)+\frac{1}{2}f(1.5)+\frac{1}{2}f(1)+\frac{1}{2}f(.5)[/tex]

or by factoring out the 1/2 part:

[tex]\frac{1}{2}(f(3)+f(2.5)+f(2)+f(1.5)+f(1)+f(.5))[/tex]

To find f(3) replace x in -x^2+2x+4 with 3:

-3^2+2(3)+4

-9+6+4

1

To find f(2.5) replace x in -x^2+2x+4 with 2.5:

-2.5^2+2(2.5)+4

-6.25+5+4

2.75

To find f(2) replace x in -x^2+2x+4 with 2:

-2^2+2(2)+4

-4+4+4

4

To find (1.5) replace x in -x^2+2x+4 with 1.5:

-1.5^2+2(1.5)+4

-2.25+3+4

4.75

To find f(1) replace x in -x^2+2x+4 with 1:

-1^2+2(1)+4

-1+2+4

5

To find f(.5) replace x in -x^2+2x+4 with .5:

-.5^2+2(.5)+4

-.25+1+4

4.75

Now let's add those heights.  After we obtain this sum we multiply by 1/2 and we have our approximate area:

[tex]\frac{1}{2}(f(3)+f(2.5)+f(2)+f(1.5)+f(1)+f(.5))[/tex]

[tex]\frac{1}{2}(1+2.75+4+4.75+5+4.75)[/tex]

[tex]\frac{1}{2}(22.25)[/tex]

[tex]11.125[/tex]

Okay now if you wanted the summation notation for:

[tex]\frac{1}{2}(f(3)+f(2.5)+f(2)+f(1.5)+f(1)+f(.5))[/tex]

is it

[tex]\frac{1}{2}\sum_{k=1}^{6}(f(.5+.5(k-1)))[/tex]

or after simplifying a bit:

[tex]\frac{1}{2}\sum_{k=1}^6 f((.5+.5k-.5))[/tex]

[tex]\frac{1}{2}\sum_{k=1}^6f((.5k))[/tex]

If you are wondering how I obtain the .5+.5(k-1):

I realize that 3,2.5,2,1.5,1,.5 is an arithmetic sequence with first term .5 if you the sequence from right to left (instead of left to right) and it is going up by .5 (reading from right to left.)

Find the value of x rounded to the nearest degree

Answers

Answer:

b 44 degrees

Step-by-step explanation:

cos x = adjacent side / hypotenuse

cos x = 15/21

cos x = 5/7

Take the inverse cos of each side

cos ^-1 (cos (x) )= cos ^-1 (5/7)

x =44.4153086

To the nearest degree

x = 44 degrees

Answer:

The correct answer is option(b).  44°

Step-by-step explanation:

From the figure we can see a right angled triangle with one angle is x° and two sides are given.

To find the value of x

From the given figure we get the adjacent side of angle is given

Therefore we can write,

Cos x = Adjacent side/Hypotenuse

 = 15/21

 = 0.7142

x = Cos ⁻¹ (0.7142)

 = 44°

Therefore the value of x = 44°

The correct answer is option(b).  44°

If f(x) = [tex]x^{2} -2^x,[/tex] what is the value of f(3) ?

PLEASE HELP! WILL PUT BRAINLIESTT!

Answers

Answer:

f(3) = 1

Step-by-step explanation:

f(x) = x² - 2ˣ

You are solving for f(3). Plug in 3 for x in the equation:

f(3) = (3)² - (2)³

Simplify. First, simplify each number by solving the powers, then subtract:

f(3) = (3 * 3) - (2 * 2 * 2)

f(3) = (9) - (8)

f(3) = 9 - 8

f(3) = 1

f(3) = 1 is your answer.

~

A class used cars and vans to go on a field trip because of the buses were already in use the use 12 vehicles to go on the trip each car holds for students in each van holds 11 students if 83 students went on the trip and how many of each type of vehicle did the class use
Please answer

Answers

Answer:5 vans   7 cars

Step-by-step explanation:

c=cars         v=vans

c+v= 12

c =( 12-v)

11v + 4(12-v) = 83

11v + 48-4v = 83

7v = 35

v= 5

c = 12-5         c = 7

7 cars x 4 students = 28 students

5 vans x 11 students = 55 students

55+28 = 83 students

solve the equation below x
cx -4=7

A x=11/C

B x=3/C

C x= c/3

D x= c/11​

Answers

Answer:

A

Step-by-step explanation:

Given

cx - 4 = 7 ( isolate the term in x by adding 4 to both sides )

cx = 11 ( divide both sides by c )

x = [tex]\frac{11}{c}[/tex] → A

Explain why the two sets are equivalent.
A={The letters in the word SEAT}
B={The letters in the word TASTE}

A. The two sets are not equivalent because set A has 4 letters and set B has 5.
B. Both sets contain the same elements.
C. Both sets contain objects.
D. Both sets contain letters.

Answers

Answer:

B. Both sets contain the same elements.

Step-by-step explanation:

Given:

A={The letters in the word SEAT}  

B={The letters in the word TASTE}

Writing the sets in elements form

A = {S,E,A,T}

B={A,S,T,E} => the letter T appears two times but the repeating elements are written only once.

Hence, both sets contain the same letters.

Therefore, the correct answer is:

B. Both sets contain the same elements ..

What is the area of a sector with a central angle of 4π/5 radians and a radius of 11 cm?

Answers

Answer:

the area of a sector is 151.976 cm²....

Step-by-step explanation:

Area of sector(A)is given by:

A=πr².θ/360°

where,

r is the radius and θ is the angle in degree.

As per the statement:

A central angle of 4π/5 radians and a radius of 11 cm.

r=11cm

Use conversion:

1 radian=180/π

then:

4π/5 radians=180/π * 4π/5

=144°

θ=144°

Substitute these given values and use 3.14 for π we have;

A=3.14*(11)²*144/360

A=3.14(121)*144/360

A=379.94*0.4

A=151.976 cm²

Therefore the area of a sector is 151.976 cm²....

The area of a sector with a central angle of 4π/5 radians and a radius of 11 cm is approximately 96.8 cm², calculated using the formula A = (θ/2π) * πr² and rounded to two significant figures.

To find the area of a sector of a circle with a given central angle in radians and a specific radius, you can use the formula:

A = (θ/2π) * πr²

where A is the area of the sector, θ is the central angle in radians, and r is the radius of the circle.

In this case, the central angle is 4π/5 radians and the radius is 11 cm. Substituting the given values into the formula:

A = (4π/5/2π) * π * (11 cm)²
= (2/5) * π * 121 cm²
= (2/5) * 3.1415927 * 121 cm²
= 96.76 cm² to two significant figures, since the radius is given to two significant figures.

Hence, the area of the sector is approximately 96.8 cm².

Choose the inverse of y=X2-2

Answers

Answer:

26

Step-by-step explanation:

For this case we must find the inverse of the following function:

[tex]y = x ^ 2-2[/tex]

We exchange the variables:

[tex]x = y ^ 2-2[/tex]

We clear the variable "y":

Adding 2 to both sides we have:

[tex]x + 2 = y ^ 2[/tex]

Applying square root on both sides of the equation:

[tex]y = \pm \sqrt {x + 2}[/tex]

We change y by [tex]f ^ {- 1} (x)[/tex]:[tex]f ^ {- 1} (x) =\pm \sqrt {x + 2}[/tex]

Answer:

[tex]f ^ {- 1} (x) = \pm\sqrt {x + 2}[/tex]

Subtract the sum of _36/11 and 49/22 from the sum of 33/8 and _19/4.

Answers

Answer:37/88

Step-by-step explanation:

Sum of -36/11&49/22=- 1,1/22

Sum of 33/8&-19/4=- 5/8

-5/8-(-1,1/22)=37/88

What is the value of x in the equation 3/4(1/4x+8)-(1/2x+2)=3/8(4-x)-1/4x ?

Answers

Answer: x = 24

Step-by-step explanation:

3/4 (x/4 + 8) - x/2 +2 = 3/8 (4-x) - x/4

3x/16 + 6 - x = 3/2 - 3x/8 - x/4

collect like term

3x/16 - x+ 3x/8 +x/4 = 3/2 -6

3x-16x+6x +4x / 16 = 3-12 / 2

-3x/16 = -9/2

cross multiply

-6x = -144

Divide bothside by -6

-6x/-6 = -144/6

x = 24

Sure, let's solve the equation:
\[ \frac{3}{4}\left(\frac{1}{4}x + 8\right) - \left(\frac{1}{2}x + 2\right) = \frac{3}{8}(4 - x) - \frac{1}{4}x \]
First, distribute the fractions across the terms inside the parentheses:
\[ \frac{3}{4} \cdot \frac{1}{4}x + \frac{3}{4} \cdot 8 - \frac{1}{2}x - 2 = \frac{3}{8} \cdot 4 - \frac{3}{8} \cdot x - \frac{1}{4}x \]
[Simplify the terms]:
\[ \frac{3}{16}x + 6 - \frac{1}{2}x - 2 = \frac{3}{2} - \left(\frac{3}{8} + \frac{1}{4}\right)x \]
Now, combine like terms:
\[ \frac{3}{16}x - \frac{8}{16}x + 4 = \frac{3}{2} - \frac{3}{8}x - \frac{2}{8}x \]
\[ -\frac{5}{16}x + 4 = \frac{3}{2} - \frac{5}{8}x \]
Next, we want to solve for \( x \), so we'll move all the \( x \)-terms to one side and the constants to the other side:
\[ -\frac{5}{16}x + \frac{5}{8}x = \frac{3}{2} - 4 \]
Convert \( \frac{5}{8} \) to a fraction with a denominator of 16:
\[ -\frac{5}{16}x + \frac{10}{16}x = \frac{6}{4} - \frac{16}{4} \]
Combine like terms again:
\[ \frac{5}{16}x  = -\frac{10}{4} \]
\[ \frac{5}{16}x = -2.5 \]
Finally, solve for \( x \):
\[ x = \frac{-2.5}{\frac{5}{16}} \]
\[ x = -2.5 \cdot \frac{16}{5} \]
\[ x = -2.5 \cdot 3.2 \]
\[ x = -8 \]
So the solution for \( x \) in the given equation is \( x = -8 \).

two lines intersecting at a right angle

Answers

Answer:

are perpendicular

Step-by-step explanation:

Two lines that intersect and make a right angles are by definition perpendicular

Answer:

C) are perpendicular

Step-by-step explanation:

Perpendicular: a straight line at an angle of 90° to a given line, plane, or surface.

How many points of intersection are there between line A and line B if they contain the points listed? Line A: (2, 8) and (–2, –4) Line B: (4, 10) and (–3, –11)

Answers

Answer:

No intersection

Zero intersections

Step-by-step explanation:

Let's determine the slope first.

If the slopes are different, then there is one solution.

If the slopes are the same, there are 2 possibilities.  The first possibility is that there is no solutions because the lines are parallel.  The second possibility is that there is infinitely many solutions because they are the same line. When I say solution, I'm also referring to intersection.

So I'm going to find the slope by lining up the points and subtracting vertically then putting 2nd difference over 1st difference.

Let's do that for line A:

 (  2  ,   8)

- (  -2 , -4)

---------------

  4        12

So the slope is 12/4 or just 3.

Let's do this for line B now:

  (  4  ,  10)

-  ( -3  ,  -11)

-------------------

    7     21

So the slope is 21/7 or just 3.

So we have more work now. The lines either are the same or parallel.

We are going to use this to determine if they same or parallel, we are going to find the slope-intercept form of the equation for both lines.

That is y=mx+b where m is slope and b is y-intercept.

Let's look at line A:

y=mx+b with m=3 and a point (x,y)=(2,8)

8=3(2)+b

8=6+b

2=b

So the line is y=3x+2

Let's look at line B.

y=mx+b with m=3 and a point (x,y)=(4,10)

10=3(4)+b

10=12+b

-2=b

The equation of this line is y=3x-2

So the lines y=3x+2 and y=3x-2 are not the same, they are parallel which means they intersect zero times.

Answer:

Zero

Step-by-step explanation:

How many points of intersection are there between line A and line B if they contain the points listed?

Line A: (2, 8) and (–2, –4)

Line B: (4, 10) and (–3, –11)

A pizza restaurant recently advertised two specials. The first special was a 14-inch pizza for $12. The second special was two 4-inch pizzas for $8. Determine the
better buy. (Hint: First compare the areas of the two specials and then find a price per square inch for both specials.)
Choose the correct answer below.
14-inch diameter pizza
two 4-inch diameter pizzas​

Answers

Answer:

14-inch pizza

Step-by-step explanation:

The area of a circle (or a pizza) is πr^2, if r is the radius.

For a 14-inch pizza, the radius is 14/2=7 and therefore the area is π*7^2 which is approximately 154 square inches. Therefore, the price per square inch is 12/154, or approximately 0.078 dollars per inch.

Similarly, the area of a 4-inch pizza is π*2^2 which is approximately 12.5 square inches, two 4-inch pizzas are 25, and so the price per square inch is 8/25 which is approximately 0.32 dollars per inch.

So the 14-inch pizza is the better deal.

Assume red and green are equally likely occurrences. Using Pascal’s triangle, what is the probability that you will get one green light in a row of five lights? a. 3/16 b. 1/32 c. 5/16 d. 5/32

Answers

Answer:

5/32.

Step-by-step explanation:

                     1

                  1      1

              1       2      1

           1       3      3       1

      1       4       6      4       1

  1      5      10      10     5       1

As there are 5 lights we need the last row in the above Pascals triangle.

And  there is 1 red and 4 green  ( = 5) and it can happen in 5 ways, so that gives us the second term in the last row . The total  in that last row = 1+5+10+10+5+1 = 32.

so the probability is 5/32.

Any line with a slope of zero is parallel to the
O y-axis
O x-axis
O line y = x

Answers

Answer:

  x-axis

Step-by-step explanation:

A line with a slope of zero has the same y-value everywhere, so is parallel to the line y=0, the x-axis.

Answer:

x- axis

Step-by-step explanation:

We  are given that any line whose slope is zero.

We have to find the line with a slope  of zero is parallel to which axis.

We know that when any line is parallel to x- axis

It means y does not change with

Therefore, [tex]\frac{dy}{dx}=0[/tex]

Slope of a line which is parallel to x- axis is zero because y does not vary with x.

But when a line parallel to y - axis then slope of that line is undefined.

When line y=x

Then , [tex]\frac{dy}{dx}=1\neq 0[/tex]

Hence, any line with slope of zero is parallel to the x- axis.

Answer:x- axis.

Y=-3x+4. What is the y intercept?

Answers

Answer:

4

Step-by-step explanation:

The equation is in the form

y= mx+b

where m is the slope and b is the y intercept

y = -3x +4

-3 is the slope and 4 is the y intercept

Answer:

y intercept is 4

Step-by-step explanation:

When you are finding the Y intercept, you need to pretend that x=0. Cover up the x and you would find the y-intercept which is 4

if it is wrong, let me know and I will fix it

hope this helps!

Can someone please explain how this answer was produced?

Answers

Answer:

Step-by-step explanation:

First, we know that the sin function is odd which means:

sin(-x) = -sin(x).

Secondly evaluating an inverse trigonometric function with a normal trigonometric function as the argument can be rewritten as an algebraic expression.

Let [tex]t = \sin(-\frac{11\pi}{4}) = - \sin(\frac{11\pi}{4})[/tex]

We know the certain identity.

[tex]\sin(\theta) = \sin(2\pi + \theta)[/tex]

We use it to evaluate sin(11 pi / 4).

[tex]\sin(\frac{11 \pi}{4}) = \sin({\frac{8\pi}{4} + \frac{3 \pi}{4}}) = \sin(2\pi + \frac{3 \pi}{4}) = \sin(\frac{3\pi}{4})[/tex]

Another helping identity is the following:

[tex]\sin(\theta) = \sin(\pi - \theta)[/tex]

[tex]\sin(\frac{3\pi}{4}) = \sin(\pi - \frac{3\pi}{4}) = \sin(\frac{\pi}{4}) = \frac{\sqrt{2}}{2}[/tex]

But let's not forget that t = -sin(11 pi/4) = - sqrt(2) / 2

Now we end up with the following equation.

[tex]\cos^{-1}(-\frac{\sqrt{2}}{2}) = x\\\cos(x) = -\frac{\sqrt{2}}{2} => x = \frac{3\pi}{4}[/tex]

What is the length of the unknown leg in the right triangle?
6 mm
8 mm
78 mm
134 mm

Answers

Answer:

6 mm

Step-by-step explanation:

Use the Pythagorean theorem:

[tex]leg^2+leg^2=hypotenuse^2[/tex]

We have:

[tex]leg=7\ mm,\ leg=a,\ hypotenuse=\sqrt{85}\ mm[/tex]

Substiute:

[tex]7^2+a^2=(\sqrt{85})^2[/tex]       use (√a)² = a for a ≥ 0

[tex]49+a^2=85[/tex]           subtract 49 from both sides

[tex]a^2=36\to a=\sqrt{36}\\\\a=6\ mm[/tex]

Answer:

A. 6mm

Step-by-step explanation:

Using the Pythagorean Theorem, which is a^2 + b^2 = c^2, the c is always the hypotenuse so the problem would be: a^2 + 7^2 = square root of 85 squared. square root of 85 squared is just 85. 7^2 is 49. 85 - 49=36. square root of 36 is 6... If you liked this answer then mark me as brainliest.



Find the value of m<3-m<1.
A. 20°
B. 50°
C. 90
D. 120°

Answers

Answer:

B. 50°

Step-by-step explanation:

70° and m<1 are Complementary Angles, meaning they add up to 90°, so, m<1 is 20°. Now, m<3 is also 70° because they are Alternative Angles, meaning that they are reflexive. Now you can perform your deduction:

70 - 20 = 50

I am joyous to assist you anytime.

Which inequality statement best represents the graph?

Answers

Answer:

Step-by-step explanation:

If you have choices, you really should list them.

Here is the graph for y = (x  + 0.25)(x - 1.75) which will look like yours. There are all sorts of variations that are possible, but at least I could reproduce a similar looking graph.

Need Help Answer Plz!!

Answers

Answer:

[tex]\large\boxed{\overline{AC}\ and\ \overline{DF}}[/tex]

Step-by-step explanation:

[tex]\triangle ABC\cong\triangle DE F\\\\\text{Corresponding angles:}\\\\\angle A\to\angle D\\\angle B\to\angle E\\\angle C\to\angle F\\\\\text{Corresponding sides:}\\\\AB\to DA\\AC\to}DF\\BC\to EF[/tex]

What is the area, in square units, of the parallelogram shown below? A parallelogram ABCD is shown with a height of 6 units and base 4 units.
12 square units 18 square units 24 square units 36 square units

Answers

Answer:

The correct option is 24 square units.

Step-by-step explanation:

Given data:

Base= 4units

height = 6 units

Area = ?

Now substitute the values in the formula:

Area= base * height

Area= 4*6

Area= 24 square units

Thus the correct option is 24 square units....

Answer:

I am a little late but its 24

Step-by-step explanation:

4*6 = 24

REALLY EASY NEED ANSWER BY 10:00 P. M. AND WILL GIVE BRAINLEIST. PLS HURRY IF YOU HAVE TIME PLEASE ANSWER OTHER QUESTIONS PLS THANK YOU.

Answers

Answer:

no

Step-by-step explanation:

it asks if the given value is a solution of the inequality, but I'm pretty sure it's not

Twenty one-slips of paper are each marked with a different letter of the alphabet and placed in a basket. A slip is pulled out, it’s letter recorded and the slip is replaced. This is done 6 times. Find the probability that the word riddle is formed. Assume that each letter in the word is also in the basket

Answers

Answer:

0.095

Step-by-step explanation:

the probability of getting the word riddle is 0.095.

I'm sorry if the answer is wrong.... I'm not that good at maths either but I wanted to help :)

Ms. Ramos buys a rare painting for m dollars. She sells it for 5 times the amount she paid for it, or 5m. Her profit is
5m-m
She purchases another painting using half of the profit from the sale. Which expression represents how much MS
Ramos paid for the second painting?
•4m+2. •5m+2. •5m/2. •4m/2

Answers

I’m pretty sure the answer is 4m/2

Answer:

(D) 4m/2

Step-by-step explanation:

took test

Other Questions
Why did President Jefferson want the Louisiana territoryexplored? In his study of pea plants, Gregor Mendel used which method to produce offspring?O cross-pollination, by using parents that had identical traitsO cross-pollination, by using parents that had different traitsO self-pollination, by using one parentO random pollination, by using both identical- and different-trait matings If you are asked to provide a set of two or more numeric answers, separate them with commas. For example, to provide the year that Sputnik (the first satellite to be sent into orbit around the Earth) was launched and the year humans first walked on the Moon, you would enter 1957,1969 in the answer box.A rectangle has a length of 5.50 m and a width of 12.0 m. What are the perimeter and area of this rectangle?Enter the perimeter and area numerically separated by a comma. The perimeter should be given in meters and the area in square meters. Do not enter the units; they are provided to the right of the answer box. In circle C, r= 32 units.What is the area of circle C?32tt units6411 units?O256T1 units?1024T units? Determine the value of the equilibrium constant, Kgoal, for the reaction CO2(g)C(s)+O2(g), Kgoal=? by making use of the following information: 1. 2CO2(g)+2H2O(l)CH3COOH(l)+2O2(g), K1 = 5.401016 2. 2H2(g)+O2(g)2H2O(l), K2 = 1.061010 3. CH3COOH(l)2C(s)+2H2(g)+O2(g), K3 = 2.68109 Please answer this correctly Writeas a percentage. Which of the following ions: K, Cl, or Mg is most similar to the ion trigger for muscles based on its position on the periodic table? In the late 1800s, Cecil Rhodes took the money he made from renting water pumps to miners and used it to buy up the claims of small mining operations. In time, and with the help of funding from the Rothschild family, he formed De Beers, which would become the largest diamond mining company in the world. Which of the following best describes the role Cecil Rhodes played for De Beers?A. CapitalB. LandC. Entrepreneurial abilityD. Labor Select all the correct answers.What are the purposes of a prologue in a play?-to provide information about the inner thoughts and feelings of a character-to set the mood and tone of the play and provide background information-to provide information about how the stage should be set and what props are needed-to give some insight into the relationships among different characters-to provide a hint to the audience about what will happen later in the play What is the length of BC in the right triangle below? A golf ball is at rest on the grass when a golfer walks up and applies 10 N of force to it. There is 2 N of friction, resulting in 8 N of net force. What will happen to the ball? (4 points)It will remain at rest.It will move in the direction opposite the net force.It will move slowly at first, then speed up.It will move in the direction of the net force. what are the physiological reactions to stress in the alarm stage Select the correct answer.In chapter 3 of Franz Kafkas The Metamorphosis, Gregor is confined to his room after an injury inhibits his movement. However, he finds solace in being able to hear his familys conversations through his open bedroom door. What does this detail show about Gregors state of mind?A. He still feels the need for human company.B. He feels trapped in his house with his family.C. He misses interacting with his kind, loving mother.D. Hes bored and wants to go back to work. Which kind of event takes place in a character-versus-society conflict? A. A supernatural force affects a character's life. B. A character faces a tough time dealing with a natural disaster. C. A character confronts a cultural tradition, a custom, or a law. D. A character struggles with his inner thoughts and feelings. E. A character opposes and defeats another character. Mexico experienced a series of liberal reforms in the 1860s instituted by Some people in the Indus River Valley did not like Hinduism. Why? can a country with a diverse population create a sense of national unity in which step of the water cycle does most of earths water enter the atmosphere? Use the quadratic expression 15x2+14x16 to answer the questions. A: Which statement describes the correct method to factor the quadratic expression? B: What are the factors of the quadratic expression? Select one answer for question A, and select two answers for question B. A: This quadratic expression can be factored by using the difference of squares pattern. A: This quadratic expression can be factored by finding the correct pair of binomial factors. A: This quadratic expression can be factored by using the perfect square trinomial pattern. B: (3x+4) B: (3x2) B: (5x+8) B: (5x+4) B: (5x4) B: (3x+4)