How would paying off the lowest outstanding balance credit card first be beneficial over paying off the one with the highest interest rate?

Answers

Answer 1
Final answer:

Paying off the lowest outstanding balance credit card first can be beneficial for motivation and momentum, even if it's not the most mathematically efficient approach.

Explanation:

When paying off credit card debt, it can be beneficial to start by paying off the credit card with the lowest outstanding balance. This approach is called the Snowball Method and is popularized by financial expert Dave Ramsey. The Snowball Method focuses on tackling the smallest debt first, regardless of the interest rate, as it provides a psychological boost and motivates individuals to continue paying off their debts.

By paying off the smallest debt first, you can quickly eliminate one of your credit card balances. This can give you a sense of accomplishment and momentum to continue paying off your other debts. It's important to note that while the Snowball Method may not be the most mathematically efficient approach in terms of saving on interest payments, it can be effective in helping individuals stay motivated and committed to paying off their debts.


Related Questions

There are 6 speakers at a conference: Ms. Sally, Ms. Elaine, Ms. Boo-Koo, Mr. Adam, Mr. Jones, and Mr. Tall. In how many ways can we order the speakers so that Mr. Adam doesn’t speak first?

Answers

Problems such as this are called counting problems. They often ask "in how many way" something can occur. Here we have 6 speakers and need to arrange them in order. We can use the counting principle which tells us that the number of ways can be obtained by considering how many speakers could be chosen for each position (first, second, third, ...  sixth) and multiplying these.

Even though there are 6 speakers, Mr. Adam cannot go first so there are 5 choices for who goes first. That leaves 5 speakers who can go second. As we already picked two people, there are 4 speakers who can go third and 3 who can go fourth. That leaves 2 that can go fifth and 1 that is left for the last slot.

The total number of ways is given by (5)(5)(4)(3)(2)(1) = 600

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

Help me ASAP!!! THANKS!




RANDOM ANSWERS WILL BE MODERATED!

Answers

It isn't clear to me whether you want a graph of that region, or you want a graph of a function that has those characteristics. Either way, ....

Mario bought a shirt priced at $ 24.99 and a pair of pants priced at $ 39.99. For these items, he paid a total of $ 69.53 , sales tax included. What was the sales tax rate?

Answers

24.99 + 39.99 = 64.98

69.53-64.98 = 4.55


4.55/69.53 = 0.0654 = 6.5% sales tax

Sarah draws a rectangle with an area of 4,875 square units and a length of 65 units. What is the width of the rectangle? 70 units 75 units 85 units 95 units

Answers

To calculate area of a rectangle you multiply the length and width together so to find the width you divide the area by the length: 4875÷65=75 so the width is 75 units.

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

Makhaya is required to spend more than 300 minutes to complete assignments, and he can use at most 20 paper sheets. Let W denote the number of writing assignments he completes and M the number of math assignments he completes.

Write an inequality that represents the condition based on the number of minutes.

Write an inequality that represents the condition based on the number of paper sheets.

Answers

The constraint on time is
.. 75W +15M ≥ 300 . . . . . . . minutes

The constraint on paper is
.. 3W +M ≤ 20 . . . . . . . . . . . sheets of paper

urgent help needed!

write y = (-5/8)x + 3 in standard form using integers.
a. 5x + 8y = -24
b. 5x + 8y = 24
c. 5x - 8y = 24
d. -5x + 8y = 24

Answers

To write this in standard form, you need to eliminate the fraction in the coefficient of variable x. You can do this by multiplying 8 to the two sides of the equation:

8(y) = 8[(-5/8)x + 3]

8y = -5x + 24

Transpose the variable x to the other side:

5x + 8y = 24        

 

 

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 

what is 1000x - 1x?

A) 101x
B) 1001x
C) 99x
D) 999x

Answers

Your answer is D) 999x
Hey there!

Let's think of what 1000x means.

We know that multiplication is repeated addition. For example, 5(5) = 5+5+5+5+5. It's 5 added five times.

It's no different here. That means we have x 1000 times. If we look at a simpler situation:

5x - 3x, we have (x + x + x + x + x) - (x + x + x)

That means we're getting rid of 3 x's, which means we have 2x. If we have different coefficients but the same variable, we can just subtract or add the coefficients but keep the variable. That means:

4x - 2x = 2x and 10x - 5x = 5x

Now, we can do this problem. We want:

(1000-1)x = 999x

Your answer is D.

Hope this helps!

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

the area of a rectangle is 20x^2-27x-8.the length is 4x+1. What is the width?

Answers

w= (5x - 8) this is your answer
⇒w=(5x−8)
Explanation:
Let width be w
Then w(4x+1)=20x2−27x−8
So
(?x+?)(4x+1)=20x2−27x−8
Note that
5×4=20 and (−8)×(+1)=−8
⇒w(4x+1)
=(5x-8)(4x+1)=20x2+5x−32x−8
⇒w(5x−8)

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

Need help asap please.

Answers

y intercept  replace x with 0 and solve = -3

axis of symmetry =  x = 3/2

coordinates of the vertex = (2,-9)

vertex form =  y = (x-7)^2-19

solution set = no real solution
 

Y varies directly as x and inversely as the square root of w; write the sentence as an equation.

Answers

Y varies directly as x
y = kx

Y varies inversely as the square root of w
y = [tex] \frac{k}{ \sqrt{w} } [/tex]
Final answer:

The relationship where y varies directly as x and inversely as the square root of w can be represented by the equation y = k * (x / sqrt(w)). Here, k is a constant of proportionality.

Explanation:

From the statement given, we can deduce an equation representing a direct proportionality to x and an inverse proportionality to the square root of w.

In mathematics, direct and inverse proportionality relationships are commonly depicted as y = kx and y = k/x respectively, where k is a constant. For direct proportionality, as x increases, y also increases. Contrastingly, for inverse proportionality, as x increases, y decreases.

Given the statement, we can represent the relationship as follows: y = k * (x / sqrt(w)).

Here, y varies directly as x and inversely as the square root of w. The constant k is the constant of proportionality which can be determined based on specific values of x, y and w.

Learn more about Proportionality here:

https://brainly.com/question/32437705

#SPJ3

How to find side of triangle if two sides and one angle is known?

Answers

The Law of Cosines can be used.

If the given angle is opposite one of the given sides, the Law of Sines can be used.

Law of Cosines:
.. c^2 = a^2 +b^2 -2ab*cos(C) . . . . . for any permutation of sides a, b, c, and opposite angle C

Law of Sines:
.. a/sin(A) = b/sin(B) = c/sin(C)

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

there are four brands of smartphones that are most popular in the united states . the number of people in the united states that have each brand is given.
brand A; 4.48x104;
brand b : 3.84 x107; brand c : 6.4x10^6; brand d: 1.50 x107
what is the order of these brands from most to least popular?

Answers

Brand B; brand D; Brand C; Brand A

For this case we must write the numbers from highest to lowest.

We observe that the numbers are written in exponential notation.

Therefore, by rewriting we have:

Brand A:

[tex] 4.48 * 10 ^ 4 = 44,800
[/tex]

Brand B:

[tex] 3.84 * 10 ^ 7 = 38,400,000
[/tex]

Brand C:

[tex] 6.4 * 10 ^ 6 = 6,400,000
[/tex]

Brand D:

[tex] 1.50 * 10 ^ 7 = 15,000,000
[/tex]

Ordering from highest to lowest we have:

[tex] 3.84 * 10 ^ 7 = 38,400,000

1.50 * 10 ^ 7 = 15,000,000

6.4 * 10 ^ 6 = 6,400,000

4.48 * 10 ^ 4 = 44,800
[/tex]

Answer:

The order of these brands from most to least popular is:

Brand B

Brand D

Brand C

Brand A

Solve the following inequality. 2x < 8

Answers

2x < 8
2x / 2 < 8/2
  x < 4

hope it helps

The required solution of the given inequality 2x < 8 is x < 4.

What is inequality?

The relation between two expressions that are not equal, employing a sign such as ≠ ‘not equal to’, > ‘greater than’, or < ‘less than’.

Given:

The given  inequality is

2x < 8

According to given question we have

Write inequality

2x < 8

Divide both sides by 2 we get,

x < 4

Therefore, the required solution of the given inequality 2x < 8 is x < 4.

Learn more details about inequality here:

https://brainly.com/question/20383699

#SPJ2

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

[100 POINTS]

Question 1)
The graph for the equation y = 2x - 2 is shown below.
If another equation is graphed so that the system has one solution, which equation could that be?
A) y = 2(x+1)
B) y = 2(x-1)
C) y = 2(x-2)
D) y = -2(x+1)

Question 2)
Solve the inequality and then graph its solution.
1/5(x-2) > -1

a) x > -7
b) x < -3
c) x > -3
d) x > 3

Answers

Question 1)

D

The answer is D because every other option has the same slope (2), and even if the intercepts are different, the lines would only be parallel, whereas in D, the slope is -2, which has one solution.

Question 2)

C

You would multiply everything by 5 to get rid of the fraction. Then, you can simplify and get the answer.

The first question is D, because when graphed, intercepts with the slope of 3, the only with the solution.

The second question is C, because u can multiple the LHS and RHS to get x-2 is greater than -5. Add 5 to get x is greater than -3

A waterfall has a height of 900 feet. A pebble is thrown upward from the top of the falls with an initial velocity of 12 feet per second. The​ height, h, of the pebble after t seconds is given by the equation h equals negative 16 t squared plus 12 t plus 900. How long after the pebble is thrown will it hit the​ ground?

Answers

A graphing calculator shows the time to be 7.884 seconds.

_____
The quadratic formula tells you the time is
.. t = (-12 -√(12^2 +4*16*900))/(-32) = (3/8)*(1 +√401) . . . seconds

Final answer:

To find when the pebble hits the ground, solve for time using the quadratic equation from the given height function, resulting in around 6 seconds.

Explanation:

To find how long the pebble takes to hit the ground, we need to find the time t when its height h becomes 0. This means we need to solve the equation for t when h = 0:

-16t² + 12t + 900 = 0

This is a quadratic equation, and we can solve it using various methods like factoring, the quadratic formula, or completing the square. Here, we'll use the quadratic formula:

t = (-b ± √(b² - 4ac)) / 2a

where a = -16, b = 12, and c = 900:

t = (-12 ± √(12² - 4 × -16 × 900)) / (2 × -16)

t = (-12 ± √(614400)) / -32

t ≈ (-12 ± 247.88) / -32

There are two possible solutions:

t1 ≈ 25.50 seconds

t2 ≈ -5.50 seconds (we can discard this since time cannot be negative)

The pebble will hit the ground approximately 6 seconds after it is thrown.

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

16. Which of the following are the measures of a right isosceles triangle?

a. 36°, 60°, 90°
b. 40°, 40°, 90°
c. 60°, 60°, 60°
d. 45°, 90°, 45°

17. Of the following triangles, which one is impossible to construct?

a. acute scalene
b. acute equilateral
c. obtuse scalene
d. obtuse equilateral

Answers

16. 
The angles of right isosceles triangle are such that there is the right angle, 90 degrees, and there are two identical angles that add up to 90.

17. 
It is impossible to have an obtuse equilateral because and obtuse triangle has an angle that is more than 90 but less than 190. The equilateral triangle has all the angles equaling the same; 60 degrees. 60 degrees isn't obtuse so it is impossible to have an obtuse equilateral triangle. 

Hope this helps :)

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

Anslee is designing a doll house shaped like a rectangular prism. The doll house is 8 feet long, 2 feet wide and 3 feet high. What is the surface area of the doll house?

Answers

we know that
L=8 ft
W=2 ft
H=3 ft
[surface area of the doll house]=2*[W*H]+2*[L*H]+2*[W*L]
[surface area of the doll house]=2*[2*3]+2*[8*3]+2*[2*8]
[surface area of the doll house]=2*[6]+2*[24]+2*[16]
[surface area of the doll house]=12+48+32--------> 92 ft²

the answer is 92 ft²
Other Questions
During the _____ stage of psychosexual development, conflict may surround _____. Find the GCF of the following literal terms. m^7 n^4 p^3 and mn^12 p^5m[]n[]p[] Why do many industrialized nations fail to address the human rights violations occurring in Burma?a) Due to secrecy, it is unclear if there are any human rights being violated.b) The government of Burma has pledged to improve its human rights record.c) Due to the rich resources in Burma, such as oil, timber, and natural gas many countries ignore the problem.d) The human rights abuses are being addressed and remedied. Find the cost of the following item. A table marked up $45.00, selling for $189.95 4.22 144.95 234.95 8,357.80 What are some things that your friends did this week? Write 5 complete Spanish sentences describing what they did. Don't forget to conjugate your verbs in the preterite tense! (Use only -er verbs)Pay attention to (a) use of correct preterite form of the verb, (b) appropriate vocabulary usage, and (c) overall quality of each response. (02.04 HC)List an example of how an ecosystem can be affected by weather patterns. Explain how ocean temperatures affect weather patterns. Paula is writing a paper about bats, but she needs a more focused topic. Which of these graphic organizers would BEST help Paula narrow the information for her assignment? The authority of a state to govern matters within its own borders free from external interference is known as why is rosa parks called the first lady of civil rights? The bubonic plague killed approximately one third of the population of europe.a. trueb. false Johnny is 12 years old and has been aggressive toward his siblings and peers, hitting, kicking, and calling them names. johnny's parents are worried about these new aggressive behaviors and consult with a psychologist, who suggests that this behavior could be a result of watching too many violent movies and playing too many violent videogames. the psychologist's explanation for the aggression is consistent with Explain how knowing your learning style can help to improve your academic success. The most important criteria of a good tracking method is that it is ______. a. Comfortable b. Computer compatible c. Portable d. Expensive the chapter in lost in outer space in 8 pages Long.Mrs.Ross read1/4 of the chapter to the class . Then Mrs.M read three pages to the class. How many pages have they read so far In Paradise Lost by John Milton, how is Satan like other larger-than-life figures who, though villainous, rivet our attention?1) Satan does evil deeds to the wealthy to benefit the poor.2) Satan is described as attractive and debonair.3) Satan is vivid and dark at the same time.4) Satan uses violence to attract our attention. two jewlery stores buy silver chains from a manufacturer for c dollars each and then sell the chains at a 57% markup.store a has a sale and marks down all chains by 20% off retail.In addition customers can use a coupon worth 15% off the price of any item including sale items.Store b offers a coupon worth 35% off any one item.At store a Aurelie used a 15% off coupon to buy a chain already marked down by 20%.write an expression for the price of this chain. At store b Tuckers used a 35% off coupon to buy a chain.write an expression for the price of this chain. Which store offers a better price on chains? what is the constant of variation for the quadratic variation of x |2|3|4|5|6| fx |28|63|112|175|252| A chemist mixes oxygen gas and hydrogen gas to form water, which is composed of one oxygen and two hydrogen atoms per molecule. What has occurred? A physical change B chemical change C combustion D precipitation If a germ cell with 38 chromosomes undergoes meiosis, how many chromosomes will the resulting cells have? Juanita keeps 25% of the profit from her ice cream shop. If the shop makes $750 per month, how much money will Juanita keep?