I need help!!!! Please if you get it right i will mark you brainliest!

I Need Help!!!! Please If You Get It Right I Will Mark You Brainliest!

Answers

Answer 1
if both are negative then it is located on the 3rd quadrant


hope this helps
Answer 2
An example of a point that has x < 0 and y < 0 is (-1,-1).
(-1,-1) would lie in Quadrant III (3).

So, if x < 0 and y < 0, the point (x,y) would be located in Quadrant III.
I Need Help!!!! Please If You Get It Right I Will Mark You Brainliest!

Related Questions

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 

16. Which of the following are the measures of a right isosceles triangle?

a. 36°, 60°, 90°
b. 40°, 40°, 90°
c. 60°, 60°, 60°
d. 45°, 90°, 45°

17. Of the following triangles, which one is impossible to construct?

a. acute scalene
b. acute equilateral
c. obtuse scalene
d. obtuse equilateral

Answers

16. 
The angles of right isosceles triangle are such that there is the right angle, 90 degrees, and there are two identical angles that add up to 90.

17. 
It is impossible to have an obtuse equilateral because and obtuse triangle has an angle that is more than 90 but less than 190. The equilateral triangle has all the angles equaling the same; 60 degrees. 60 degrees isn't obtuse so it is impossible to have an obtuse equilateral triangle. 

Hope this helps :)

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7

Anslee is designing a doll house shaped like a rectangular prism. The doll house is 8 feet long, 2 feet wide and 3 feet high. What is the surface area of the doll house?

Answers

we know that
L=8 ft
W=2 ft
H=3 ft
[surface area of the doll house]=2*[W*H]+2*[L*H]+2*[W*L]
[surface area of the doll house]=2*[2*3]+2*[8*3]+2*[2*8]
[surface area of the doll house]=2*[6]+2*[24]+2*[16]
[surface area of the doll house]=12+48+32--------> 92 ft²

the answer is 92 ft²

Sarah is shopping for groceries at the local supermarket. She paid for her groceries using a $100 bill recently issued by the US government. What type of money did Sarah use for this transaction? commodity money fiat money digital money representative money

Answers

It is not digital because that would something like applepay. It is also nt representative, since that would be something like food stamps. Commodity money is also a bad answer, since it is goods. You answer would be fiat money, which is paper tender issued by the government. Hope this helps.

Sarah draws a rectangle with an area of 4,875 square units and a length of 65 units. What is the width of the rectangle? 70 units 75 units 85 units 95 units

Answers

To calculate area of a rectangle you multiply the length and width together so to find the width you divide the area by the length: 4875÷65=75 so the width is 75 units.

First combined weight of three packages that weigh 5 1/2 pounds 4 7/16 pounds and 3 3/8 pounds

Answers

5 1/2 + 4 7/6= 9.9+3 3/8=13.37

How to find side of triangle if two sides and one angle is known?

Answers

The Law of Cosines can be used.

If the given angle is opposite one of the given sides, the Law of Sines can be used.

Law of Cosines:
.. c^2 = a^2 +b^2 -2ab*cos(C) . . . . . for any permutation of sides a, b, c, and opposite angle C

Law of Sines:
.. a/sin(A) = b/sin(B) = c/sin(C)

there are four brands of smartphones that are most popular in the united states . the number of people in the united states that have each brand is given.
brand A; 4.48x104;
brand b : 3.84 x107; brand c : 6.4x10^6; brand d: 1.50 x107
what is the order of these brands from most to least popular?

Answers

Brand B; brand D; Brand C; Brand A

For this case we must write the numbers from highest to lowest.

We observe that the numbers are written in exponential notation.

Therefore, by rewriting we have:

Brand A:

[tex] 4.48 * 10 ^ 4 = 44,800
[/tex]

Brand B:

[tex] 3.84 * 10 ^ 7 = 38,400,000
[/tex]

Brand C:

[tex] 6.4 * 10 ^ 6 = 6,400,000
[/tex]

Brand D:

[tex] 1.50 * 10 ^ 7 = 15,000,000
[/tex]

Ordering from highest to lowest we have:

[tex] 3.84 * 10 ^ 7 = 38,400,000

1.50 * 10 ^ 7 = 15,000,000

6.4 * 10 ^ 6 = 6,400,000

4.48 * 10 ^ 4 = 44,800
[/tex]

Answer:

The order of these brands from most to least popular is:

Brand B

Brand D

Brand C

Brand A

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

Singing "row, row, row your boat," in a round (each group starting at a different time) would be considered which texture? music appreciation

Answers

Yuh, ooh, brr, brr
Gucci gang, ooh
(That's it right there, Gnealz)
Yuh, Lil Pump, yuh
Gucci gang, ooh
(Ooh, Bi-Big Head on the beat)
Yuh, brr

Which of the following is the solution to the equation 25^(z + 2) = 125?

Answers

Answer:

z = -0.5

Step-by-step explanation:

Using exponent rule:

[tex]x^a = x^b[/tex] then a = b

Given the equation:

[tex]25^{z+2} = 125[/tex]

We can write 25 and 125 as:

[tex]25 = 5 \cdot 5 = 5^2[/tex]

[tex]125 = 5 \cdot 5 \cdot 5 = 5^3[/tex]

then;

[tex]5^{2(z+2)}= 5^3[/tex]

Apply the rule:

[tex]2(z+2) = 3[/tex]

using distributive property [tex]a \cdot (b+c) = a\cdot b+ a\cdot c[/tex]

[tex]2z+4 = 3[/tex]

Subtract 4 from both sides we have;

[tex]2z = -1[/tex]

Divide both sides by 2 we have;

z = -0.5

Therefore, the solution for the given equation is, z = -0.5

There are 6 speakers at a conference: Ms. Sally, Ms. Elaine, Ms. Boo-Koo, Mr. Adam, Mr. Jones, and Mr. Tall. In how many ways can we order the speakers so that Mr. Adam doesn’t speak first?

Answers

Problems such as this are called counting problems. They often ask "in how many way" something can occur. Here we have 6 speakers and need to arrange them in order. We can use the counting principle which tells us that the number of ways can be obtained by considering how many speakers could be chosen for each position (first, second, third, ...  sixth) and multiplying these.

Even though there are 6 speakers, Mr. Adam cannot go first so there are 5 choices for who goes first. That leaves 5 speakers who can go second. As we already picked two people, there are 4 speakers who can go third and 3 who can go fourth. That leaves 2 that can go fifth and 1 that is left for the last slot.

The total number of ways is given by (5)(5)(4)(3)(2)(1) = 600

Math help!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

6,023 
6,032
6,407
6,704
From least to greatest:

6,023; 6,032; 6,407; and 6,704.
From this list, the most accurate answer choice is the first one, A.

I hope this helps!

Answer for number 5?

Answers

you should try to divide 192 by the 4 sides on the rectangle.
The first thing you should know is that the perimeter of a rectangle is given by:
 P = 2L + 2W
 Where,
 L: side
 W: width
 On the other hand we have that the ratio is:
 L / W = 5/3
 Clearing L we have:
 L = (5/3) * (W)
 Substituting in the expression of the perimeter:
 P = 2 ((5/3) * (W)) + 2W
 Rewriting:
 P = (16/3) W
 The perimeter is 192:
 192 = (16/3) W
 We cleared W:
 W = (3/16) * (192)
 W = 36
 Finally we substitute W in the expression for L:
 L = (5/3) * (W)
 L = (5/3) * (36)
 L = 60
 Answer: 
 The width and length are: 
 W = 36 yards 
 L = 60 yards

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

Solve the following inequality. 2x < 8

Answers

2x < 8
2x / 2 < 8/2
  x < 4

hope it helps

The required solution of the given inequality 2x < 8 is x < 4.

What is inequality?

The relation between two expressions that are not equal, employing a sign such as ≠ ‘not equal to’, > ‘greater than’, or < ‘less than’.

Given:

The given  inequality is

2x < 8

According to given question we have

Write inequality

2x < 8

Divide both sides by 2 we get,

x < 4

Therefore, the required solution of the given inequality 2x < 8 is x < 4.

Learn more details about inequality here:

https://brainly.com/question/20383699

#SPJ2

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:



The graph shows the path of a rider on a ride at an amusement park.

What does the x-coordinate of the vertex represent?



The rider’s minimum height above the ground is 25 ft.
The rider travels a total distance of 25 ft.
The difference between the rider’s maximum and minimum’s height above the ground is 25 ft.
The rider is closest to the ground when he is 25 ft from the left side of the ride.

https://static.k12.com/nextgen_media/assets/8090397-NG_AL1_O_07_U12_Quiz_08.png

Answers

The rider is closest to the ground when he is 25 ft from the left side of the ride.

Answer:

D. The rider is closest to the ground when he is 25 ft from the left side of the ride.

Step-by-step explanation:

The vertex of x-coordinate represents the distance from the from the origin of the pendulum, which is the closest to the ground when he is 25 ft away from 0.

Hope this will helpful.

Thank you.

[100 POINTS]

Question 1)
The graph for the equation y = 2x - 2 is shown below.
If another equation is graphed so that the system has one solution, which equation could that be?
A) y = 2(x+1)
B) y = 2(x-1)
C) y = 2(x-2)
D) y = -2(x+1)

Question 2)
Solve the inequality and then graph its solution.
1/5(x-2) > -1

a) x > -7
b) x < -3
c) x > -3
d) x > 3

Answers

Question 1)

D

The answer is D because every other option has the same slope (2), and even if the intercepts are different, the lines would only be parallel, whereas in D, the slope is -2, which has one solution.

Question 2)

C

You would multiply everything by 5 to get rid of the fraction. Then, you can simplify and get the answer.

The first question is D, because when graphed, intercepts with the slope of 3, the only with the solution.

The second question is C, because u can multiple the LHS and RHS to get x-2 is greater than -5. Add 5 to get x is greater than -3

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2


Hint: Omars equation doesn't work!
Identify his error and correct it by showing the steps Omar should have taken and determine the correct value of x.

Answers

His Error: He set the expressions 10x-1 and 59 equal to each other. Those two angles are not congruent. 

He should have added the two expressions to get 180
(10x-1) + (59) = 180
10x+(-1+59) = 180
10x+58 = 180
10x+58-58 = 180-58
10x = 122
10x/10 = 122/10
x = 12.2

urgent help needed!

write y = (-5/8)x + 3 in standard form using integers.
a. 5x + 8y = -24
b. 5x + 8y = 24
c. 5x - 8y = 24
d. -5x + 8y = 24

Answers

To write this in standard form, you need to eliminate the fraction in the coefficient of variable x. You can do this by multiplying 8 to the two sides of the equation:

8(y) = 8[(-5/8)x + 3]

8y = -5x + 24

Transpose the variable x to the other side:

5x + 8y = 24        

 

 

Other Questions
If radioactive deoxythymidine triphosphate (dttp) is added to a culture of rapidly growing bacterial cells, where in the cell would you expect to find the greatest concentration of radioactivity? be mindful of what type of macromolecule dttp is incorporated into in living, growing cells. Why do writers need to revise sentences containing dangling modifiers? The observation that chloroplasts and mitochondria each contain their own dna and synthesize some of the proteins that function in these organelles suggests that chloroplasts and mitochondria __________. must divide each time the cell containing them divides are produced by the nucleus of the cell contain three sets of membranes are part of the endomembrane system What was Christian art like before the Edict of Milan? Please answer in at least 3 sentences. 3. If the price currently prevailing on the market is $0.20 per greebe, buyers would want to buy_______ million greebes and sellers would want to sell _______ million greebes. Under theseconditions, competitive market forces would tend to cause the price to (increase / decrease) to aprice of $ _______ per greebe.And, at this new price, buyers would now want to buy _______ million greebes, and sellers wouldwant to sell _______ million greebes. Due to this change in (price / underlying conditions), the(demand / quantity demanded) changed by _______ million greebes, and the (supply / quantitysupplied) changed by _______ million greebes. Read the excerpt from "The Lady Maid's Bell." But that wasnt the only queer thing in the house. The very next day I found out that Mrs. Brympton had no nurse; and then I asked Agnes about the woman I had seen in the passage the afternoon before. Agnes said she had seen no one, and I saw that she thought I was dreaming. To be sure, it was dusk when we went down the passage, and she had excused herself for not bringing a light; but I had seen the woman plain enough to know her again if we should meet. I decided that she must have been a friend of the cooks, or of one of the other women servants: perhaps she had come down from town for a nights visit, and the servants wanted it kept secret. Some ladies are very stiff about having their servants friends in the house overnight. At any rate, I made up my mind to ask no more questions. Which statement describes a gothic element in this excerpt that reflects a social attitude of Whartons time? The narrator feels inadequate when she reports seeing a supernatural being and nobody believes her. The narrator feels like she lacks control of her own fate when her superiors refuse to answer her questions. The narrator is dismissed by her superiors when she asks questions about an occurrence that may have been supernatural. The narrator fears that she may be doomed when she witnesses a strange woman walking around the home. Who led the first attempt to create a canal through central america to connect the atlantic and pacific oceans and what country was he from? Find the fifth term of an=2(-1) n What mood has the writer attempted to create in this paragraph?Oh! No mortal could support the horror of that countenance. A mummy again endued with animation could not be so hideous as that wretch. I had gazed on him while unfinished; he was ugly then, but when those muscles and joints were rendered capable of motion, it became a thing such as even Dante could not have conceived.(from Frankenstein by Mary Shelley)A.empathyB.disgustC.angerD.anxiety Which term does NOT apply to sodium chloride? Question 1 options: A: molecule B: crystal C: compound D: ionic bonding Less than 40 percent of teens have used marijuana within the past year Which conclusion accurately explains Africa's economic and government problems after independence. Africa's economic problems were solved, but they continued to struggle with an organized government. Africa's economic and political problems became an even larger problem after independence. Africa's political problems were solved, but they continued to struggle economically. Africa's economic and political problems were solved by independence. Rachel has 60 scones. She sells them to Robbie , Cameron , Lous , Tom and Charlie in that order. Each customer buys more scones than the last and the increase is the same number in each case . Robbie and Camerons combined total number of scones is three sevenths of the total of Louis , Tom and Charlie . How many scones does each boy buy ? There are 203 apples in a basket. How many children can share these apples equally? How many apples would each child get? Question#1: All possible numbers of children in ascending order are:Question#2: All possible numbers of apples in descending order are:please help!!!!!!!!! If it takes a ball dropped from rest 2.069 s to fall to the ground, from what height h was it released? Which term, meaning "successor" in Arabic, refers to a political and religious leader of Islam after Muhammed's death?A. CaliphB.JihadC. MuslimD.Shi'ite The bake sale raised $90. If each cupcake sold for $ 0.75, how many cupcakes were sold? What is a hemisphere? Sampson and laub's research indicates that building __________ and strong social bonds reduces the likelihood of long-term deviance. The green party and libertarian party are both examples of what?