If total Revenue is $3000, Cost of Goods is $1500, and total Selling Expense is $500; what is the Profit for the business?

Answers

Answer 1
I would like to see the multiple questions, but i'll try to help.Total Revenue $3000. Cost of goods is $1500. And total selling is $500. What is the profit. $3000 + $ 1500 =$4,500 - $500 = $4,000 Profit. I hope this is correct.
Answer 2
Profit= Total Revenue- Cost of goods- operating expense so the total Profit is $1,000

Related Questions


If x = a + bi and y = –a – bi, x + y = 0

Answers

That would be the inverse property of addition. When you add the opposite of a number to that number, your sum will be zero. -a is the opposite of a and -bi is the opposite of bi. When you add x + y (aka the opposites) your total is absolutely nothing!  

Answer:

inverse property

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

Laura was making a recipe that said the ingredients were for 6 people, but she needed to make it for 8 people. the recipe called for 2 2/3 cups of milk and 1/4 cup oil. how many of these liquid ingredients did she need for 8 people?

Answers

3 cups of milk and 2/4 cups of oil

Answer:

[tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

Step-by-step explanation:

Cups of milk for 6 people = [tex]2 \frac{2}{3} =\frac{8}{3}[/tex]

Cups of milk for 1 people = [tex]\frac{\frac{8}{3}}{6}=\frac{4}{9}[/tex]

Cups of milk for 8 people = [tex]\frac{4}{9} \times 8= \frac{32}{9}[/tex]

Cups of oil for 6 people = [tex]\frac{1}{4}[/tex]

Cups of oil for 1 people = [tex]\frac{\frac{1}{4}}{6}= \frac{1}{24}[/tex]

Cups of oil for 8 people = [tex]\frac{8}{24}=\frac{1}{3}[/tex]

Hence [tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3

Use substitution to solve the system
5x+4y=12
Y=2x-10

Answers

ok so do you know the steps for substitution

Substitute the 2x-10 in for I in the first equation:
5x+4(2x-10) =12

Distribute the 4:
5x+8x-40=12

Add 40 to both sides and combine the x terms:
13x=52

Divide by 13:
x=4

Plug the 4 into either equation for the x value:
y=2(4)-10
y=8-10
y=-2

Answer:
X=4
Y=-2

To check you can plug them into either one of the equations.

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

Suppose f(π/3) = 3 and f '(π/3) = −7,
and let
g(x) = f(x) sin x
and
h(x) = (cos x)/f(x).
Find the h'(x)

Answers

Final answer:

To find h'(x), differentiate the function h(x) = (cos x)/f(x) using the product rule.

Explanation:

To find h'(x), we need to differentiate the function h(x) = (cos x)/f(x).

First, let's find the derivative of cos x, which is -sin x.

Next, we need to find the derivative of f(x). Since f(π/3) = 3 and f '(π/3) = −7, we know the slope of the tangent line at x = π/3 is -7.

Using the product rule, we can now differentiate h(x) = (cos x)/f(x) as follows:

h'(x) = [f(x)(-sin x) - cos x(f '(x))]/[f(x)]^2

Is 89 prime or composite

Answers

it is a prime number. 89=1×89 hope it helps

Answer:

Prime

Step-by-step explanation:

A prime number is a number that has only one factor. A composite number is a number that has more than one factor.

-kiniwih426

Solve the equation.

6 = 2(x + 8) - 5x

A. 2/3
B. 3 1/3
C. - 2/3
D. -3 1/3

Answers

I hope this helps you
6=2x+16-5x
6=(2x-5x)+16
6-16=2x-5x
-10=-3x
X=10/3

Paul plans to put concrete on a rectangular portion of his driveway. The portion is 12 feet long and 6 inches high. The price of concrete is $98 per cubic yard. The total cost of the concrete Paul needs is $108.89. Which of the following is closest to the width of the portion of the driveway on which Paul plans to put concrete?

[1 foot = 12inches; 1 yard = 3 feet]

3 feet

5 feet

8 feet

10 feet

Answers

The width needed is 5 feet.

Answer:

The answer is b. 5 feet

Step-by-step explanation:


108/250 in simplest form in a whole number.

Answers

You cannot express 108/250 in a whole number but it can be simplified to 54/125

Over the past year, your friend Maura has been saving up for an epic road trip to travel across the country this summer. Her goal is to squeeze in as many sights as she can with her available budget of $2000.
Give an example of a sound financial decision Maura might make to support this goal. Why is it sound? Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Answers

"Give an example of a sound financial decision Maura might make to support this goal. Why is it sound?"

She could choose to carefully budget her trip and avoid overspending at all costs. This prevents going into debt. She should also save up extra money in the event of an emergency.

Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Not having a plan would be a poor decision on her part. She could end up spending too much and not realize how much money she has left.


I hope I helped!

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

Josephine started a business selling cosmetics. She spent $4500 to obtain her merchandise, and it costs her $200 per week for general expenses. She earned $550 per week in sales. What is the minimum number of weeks it will take for Josephine to make a profit? Write an inequality to model the problem.

A.)550w > 4500 + 200w

b.)200w > 4500 + 550w

c.) 550w < 4500 + 200w

d.)200w 4500 + 550w
...?

Answers

Answer:

a

Step-by-step explanation:

Final answer:

Josephine will need at least 13 full weeks to start making a profit. The correct inequality that models this economic scenario is 550w > 4500 + 200w.

Explanation:

The minimum number of weeks it will take for Josephine to make a profit in her cosmetics business can be determined by setting up an inequality where the total earnings must be greater than the sum of the initial investment and the running costs. We define w as the number of weeks. Josephine earns $550 per week, so her earnings after w weeks are 550w. The initial investment is $4500 and the weekly expense is $200, so the total expenses after w weeks are 4500 + 200w. To make a profit, the earnings must be greater than the expenses:

550w > 4500 + 200w

To solve for w, we need to collect like terms:

550w - 200w > 4500

350w > 4500

Dividing both sides by 350:

w > 4500 / 350

w > 12.86

This means Josephine will need to work for at least 13 full weeks to make a profit.

Given the equation Square root of 2x plus 1 = 3, solve for x and identify if it is an extraneous solution.

^ I really don't understand this topic, whatsoever. Could someone help?

Answers

The answer is 4.

Square root of 2x plus 1 = 3:
[tex] \sqrt{2x+1} =3[/tex]

Square both sides:
[tex]( \sqrt{2x+1} )^{2} =3^{2} \\ \\ 2x+1=9 \\ 2x = 9 - 1 \\ 2x =8 \\ x = 8:2 \\ x =4 [/tex]

By squaring both sides and solving for [tex]\(x\),[/tex] we find [tex]\(x = 4\)[/tex] as the solution, which is not extraneous upon substitution into the original equation.

To solve the equation [tex]\(\sqrt{2x + 1} = 3\),[/tex] we need to isolate[tex]\(x\).[/tex] Here's how:

1. Square both sides of the equation to eliminate the square root:

[tex]\[ (\sqrt{2x + 1})^2 = 3^2 \][/tex]

[tex]\[ 2x + 1 = 9 \][/tex]

2. Subtract 1 from both sides to isolate [tex]\(2x\)[/tex]:

[tex]\[ 2x = 9 - 1 \][/tex]

[tex]\[ 2x = 8 \][/tex]

3. Divide both sides by 2 to solve for [tex]\(x\)[/tex]:

[tex]\[ x = \frac{8}{2} \][/tex]

[tex]\[ x = 4 \][/tex]

Now, we have [tex]\(x = 4\)[/tex]. To determine if it's an extraneous solution, we need to check if it satisfies the original equation.

Substitute [tex]\(x = 4\)[/tex] into the original equation:

[tex]\[ \sqrt{2(4) + 1} = 3 \][/tex]

[tex]\[ \sqrt{9} = 3 \][/tex]

[tex]\[ 3 = 3 \][/tex]

Since the equation holds true, [tex]\(x = 4\)[/tex]is a valid solution, not an extraneous one.

Therefore, the solution to the equation [tex]\(\sqrt{2x + 1} = 3\) is \(x = 4\),[/tex]and it is not an extraneous solution.

how is a tangent different from a chord

Answers

Answer:

A tangent is a line, ray, or line segment that intersects a circle at exactly one point (called the point of tangency) and contains no points inside the circle. A chord is a segment with both endpoints on a circle. Tangents intersect the circle at one point, while a chord intersects at two.

I've checked this answer, E counted it as correct. Hope this helped!!!

A tangent touches a circle at one point, while a chord connects any two points on the circle's circumference.

A tangent and a chord are both important concepts in geometry, but they have distinct characteristics.

A tangent is a line that intersects a circle at exactly one point, touching the circle's circumference at that point.

It never crosses the circle. Tangents are perpendicular to the radius that intersects the point of tangency.

On the other hand, a chord is a line segment connecting any two points on a circle's circumference. Unlike tangents, chords can intersect the circle at multiple points.

The diameter is a special case of a chord that passes through the center of the circle.

Hence,

Tangents touch a circle at one point, while chords connect two points on a circle's circumference.

To learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ6

Which of the following statements is true of chords?

A chord is a line segments.A chord connects two points on a circle.A chord can be a radius of a circle.A chord can be a diameter of a circle.A chord divides a circle into two regions

Answers

All of those are true, except the one about the radius.  Because alternate definition of diameter uses the idea of chord. So, both ends of a chord have to be on the circle, but one end of a radius is at the center, so a radius can't be a chord.

1. Miguel tosses a coin three times. which diagram represents the sample space of the three tosses?

Answers

The only diagram that has the possibility that each coin toss could come up H or T is answer "c."

Tree diagram can be used to represent the sample space. The correct option is option C.

What is a tree diagram?

In probability, a tree diagram can be used to represent the sample space. Tree diagrams represent a series of independent events or conditional probabilities.

As it is given that the coin is tossed three times, therefore, the number of stages in the tree diagram will be three, where each time the coin is tossed will result in either heads or tails.

Now, the tree diagram of the coins can be drawn as shown below.

Further, comparing it with our diagram, the only possible option is option c where the number of levels in the tree is three and each toss result in either heads or tails.

Hence, the correct option is option C.


Learn more about Tree Diagram:

https://brainly.com/question/3269330

Factor -9x^2-36x-36 please.

Answers

Tricky Trinomial
-9x^2-36x-36
(-9x^2-18x)(-18x-36)
-9x(x+2)-18(x+2)
=(-9x-18)(x+2)
factor out -9
-9(x^2+4x+4)
what 2 numbers multiply to 4 and add to 4
 2 and 2

-9(x+2)(x+2)

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

Tyrone’s hourly wage is $18 and his net pay is 72% of his earnings. Tyrone spends about $1,800 on his monthly expenses. If Tyrone works 40 hours per week and has no other sources of income, what is his total monthly cash inflow? (Hint: Assume that there are 4 pay periods per month.)

Answers

$2073.60 per month

===================

To calculate Tyrone's total monthly cash inflow, we need to determine his weekly and then monthly earnings.

Calculate weekly gross income:

$18/hour * 40 hours/week = $720/week

Calculate net pay per week:

$720/week * 72% = $518.40/week

Calculate monthly cash inflow:

$518.40/week * 4 weeks/month = $2073.60/month

Tyrone's total monthly cash inflow is $2073.60.

The area of a rectangle is 70 square inches and the length of the rectangle is 3 inches longer than the width.

The area of a rectangle is found by multiplying the length times the width.

Which equation models this situation?

w(w+3)=70w(w+3)=70

w + 3 = 70

3w = 70

w + 3w = 70

Answers

Final answer:

The correct equation to model the rectangle's area where the length is 3 inches more than the width and the area is 70 square inches is W(W + 3) = 70, which simplifies to W^2 + 3W = 70.

Explanation:

The student is asking for the correct equation to model a rectangle's area where the length (L) is 3 inches more than the width (W), and the area is 70 square inches. To find an equation that models the situation, we need to express L in terms of W. Since L is 3 inches more than W, we can write L as W + 3. The area (A) of a rectangle is found by multiplying the length by the width, so A = L x W.

Therefore, the equation that models this situation is W(W + 3) = 70. To see why, let's insert the expression for L into the area formula:

A = L x W = (W + 3) x W

This simplifies to:

A = W^2 + 3W

Since we know the area A is 70 square inches, we substitute and get the equation:

W^2 + 3W = 70

Which is the correct model for the given situation.

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

Are the graphs of −5y=2x+3 and y=25x+4 parallel, perpendicular, or neither?

Answers

parallel graphs have the same slope. perpendicular has opposite reciprocal slopes. These equations have slopes of -2/5 and 25 so they are neither.

The graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

What is a linear equation?

It is defined as the relation between two variables, if we plot the graph of the linear equation we will get a straight line.

If in the linear equation, one variable is present, then the equation is known as the linear equation in one variable.

It is given that:

The system of equations is:

 −5y=2x+3 and y=25x+4

The slope of parallel graphs is the same. The reciprocal slopes of a perpendicular are opposite.

These equations are neither because they have slopes of 25 and -2/5.

Thus, the graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

Learn more about the linear equation here:

brainly.com/question/11897796

#SPJ3

A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B
Other Questions
who were the aztecas Roscoe is trying to take notes in class, but he finds that he can't keep up with what his instructor is saying. After class, he discovers that he has a lot of blanks in his notes. What is the most plausible reason for this? (1.8 * 10^2) * (5 * 10^2) The main objective of sherman's march to the sea was What aspect of chaparral shrubs is both a part of their natural defenses and the reason many are popular in cooking?a. aromatic oils b. small evergreen leaves c. ability to thrive in nutrient-poor soil d. seed germination after fires Expressionists alter the shape of forms, and they use color as an independent expressive element. Which of these artists served as an inspiration for early expressionist?Jackson PollockMark RothkoVincent van Gogh Most of todays environmental problems began during which period(s) in human history? will upvote please help !!why is choosing strong nouns and verbs important when writing poetry ?A strong nouns and verbs create specific imagery B strong nouns and verbs create difficult imagery C strong nouns and verbs create strong adjectives D strong nouns and verbs create challenging metaphors how to turn 5x+10y=15 in to slope intercept form (y=mx+b) Grey 2.4 times as many miles as Emory. If Emery ran 2.08 miles, how many miles did grey run. Let's Check InWhich excerpt illustrates Achebes use of dialect? A.My friend,. . . I hear what you say and I thank you.B.Literature, whether handed down by word of mouth or in print . . . . C.Awrighto. Now make we talk business. We no be bad tief.D.Then he made the journey to Enugu and found another miracle. Renna pushed the button for the elevator to go up, but it would not move. The weight limit for the elevator is 450 kilograms, but the current group of passengers weighs a total of 750 kilograms. Renna wants to determine how many 70-kilogram passengers need to get off the elevator.Let p represent the number of excess passengers. Write an inequality to determine the number of passengers who need to get off the elevator to meet the weight requirement. What did the battle of Yorktown led to? The decimal number 0.66 is an example of a repeating decimal.TrueorFalsepls answer quick HELP!! What is the solution of the system?Use the substitution method.{y+7=3x6x2y=12(a.) (14, 12)(b.) (12, 14)(c.) There is no solution.(d.) There are an infinite number of solutions. Solve the following word problems by writing an equation and then solving algebraically:During the 2007 baseball season, Wade was up to bat 10 more times than his teammate Dwight. Dwight batted 17 fewer times than another teammate, Ellis. The three players were up to bat a total of 1650 times. How many times did Ellis come to bat?I only really need help making an equation because the ones I tried making didn't work. What is 117.28 rounded to the nearest 10 cents? Deirdre doubled her savings account balance of $100 . Then she withdrew $30 to buy some new clothes. Represent this situation with a numerical expression. Use your knowledge of affixes to complete the sentence below. In a business, if a person is a subordinate, then he or she works A. without other people. B. under another person. C. against another person. D. before other people. For the fruit punch, keira needed 2 gallons of grape juice. she already had 2 quarts of grape juice. grape juice comes in bottles of 1 pint. how many bottles of grape juice does she need to buy? bottles