In 1990, Carl Woese introduced the three
domain system for classifying living things,
after the advancement of DNA analysis
allowed for a comparison of species genetic
code. Which of the following is the best
explanation for why domains were added to
the previous system of classification?
C. Domains have always been included, they
were just made official recently.
B. New species are evolving too quickly to
keep up with the old system of classification
D. Some organisms, which were previously
characterized together, were determined to
be genetically very different.
A. The old system of classification was wrong
and needed to be corrected.

Answers

Answer 1

Answer:

D. Some organisms, which were previously characterized together, were determined to be genetically very different.

Explanation:

Domains are the highest taxons within the biological classification of living beings. Like other taxons, domains are used to group living beings in a scientifically based classification.

They were added to the classification system after the other taxons were already established. The presence of domains was necessary to group individuals in relation to evolutionary factors. This was necessary because some organisms, previously characterized together, were determined to be genetically very different.

Answer 2

The correct explanation for why domains were added to the previous system of classification is: C. Domains have always been included, they were just made official recently.

The historical context and the implications of Carl Woese's work:

1. Prior to Woese's work, the classification system was primarily based on morphological and physiological characteristics, which led to the grouping of organisms into kingdoms. The five-kingdom system, proposed by R.H. Whittaker in 1969, included the Monera, Protista, Fungi, Plantae, and Animalia kingdoms.

2. With the advent of DNA sequencing and analysis techniques, particularly the sequencing of the 16S rRNA gene, scientists were able to compare genetic information across a wide variety of organisms. This allowed for a more detailed and accurate understanding of the evolutionary relationships between different species.

 3. Woese's research revealed that the prokaryotes, which were previously all classified within the Monera kingdom, actually comprised two distinct groups that were as different from each other as they were from eukaryotes. These two groups were the Bacteria and the Archaea.

 4. The recognition of these two distinct domains, along with the domain Eukarya (which includes the Protista, Fungi, Plantae, and Animalia kingdoms), led to the establishment of the three-domain system. This system reflects the major evolutionary divergences in the history of life.

5. The three-domain system does not imply that the previous systems were entirely wrong; rather, it represents a refinement of our understanding of the tree of life based on new genetic evidence. The domains were not newly created entities but were recognized and formalized as a result of advances in molecular biology.

6. The addition of domains to the classification system was a significant change that acknowledged the deep genetic differences between the Bacteria, Archaea, and Eukarya. It provided a more accurate framework for understanding the diversity of life and the relationships between different organisms.

In summary, domains were added to the classification system to reflect the profound genetic differences that had been discovered through DNA analysis, differences that were not apparent through morphological and physiological studies alone. The three-domain system, therefore, represents a more nuanced and genetically informed approach to classifying living organisms.


Related Questions

Actively dividing eukaryote cells pass through a series of stages known collectively as the cell cycle. Match each label to the correct location in the model

Answers

Answer:

Please provide a model/diagram.

I obviously cant directly answer the question but in mitotic cellular division and/or mitosis a cell goes through the following stages.

Interphase which consist of G1 phase S phase and G2 phase

Interphase is followed by mitosis/meiosis

MITOSIS consist of four main phases Prophase, Metaphase, Anaphase, and Telophase.

Cytokenisis would then follow MITOSIS resulting in divission down the cleavage furrow formed between Anaphase and Telophase.

Answer:

The euakaryotic cell is considered to be more adanced form of life on the planet, as the scientists believes that many unicellular cells(which are termed as the organelles inside the cell) made a specialized form of network with one another. And this network of cells was then attributed the name of a eukaryotic  cell, as many number of eukaryotic cells combined together to form a specialized system or form of a cellular body. But, the eukaryotic cells increased its number and was the entity with the most diverse functions and shapes. But, however the eukaryotic cell had a different way to replicate itself and for that reason the process of mitosis and meiosis takes place inside the system created by the eukaryotic cells.

Mitosis: During, the process of mitosis the different cells undergo the replication process in such a way that each cells are tend to be divided into the equal number of halves, as these new born cells contain the same number of chromosomes(genetic material) same as the parent cells have. While, the resemble the parent cells in there genotypes.

Meiosis: While, the meiosis is more concerned with the half number of chromosomes inside each daughter cells that are produced after the parents cells are gone through the process of meiosis. Having the half number of chromosomes does not mean that it would posses some sort of abnormalities but the genetic materials gets there level of stability after some time, and more over going through a process of growth and development.

Humans have had a pattern of _____________ growth.

Answers

Answer:

change in body proportions throughout development from birth to adult

Explanation:

Answer:

Increase in size and weight

Explanation:

Which of the components in blood helps the blood to recognise and destroy microorganisms?

Answers

Answer:

white blood cells or WBCs

Explanation:

White blood cells are the cells that fight off infection and anyother thing that enters your blood stream

What role do enzymes play in chemical reaction that occur in your body

Answers

Answer AND Explanation:

There is a large number of biochemical reactions taking place in a cell at any given time. Enzymes being biological catalysts control these reactions and regulate them so that they proceed at a pace that is suitable for sustaining life. Thus enzymes regulate cellular activities. Enzymes also ensure that only the required reactions take place and progress to their appropriate extent.

What ecological pyramid is "The rule of 10" associated with?​

Answers

Answer:

'The rule of 10' is associated with the pyramids of quantifying energy flow.

Only a small amount of energy is transferred from one trophic level to another. Most of the energy is lost in the form of heat. Hence, we quantify that about 10% of energy travels from one trophic level to another.

Let's say the producers have 100% energy. The primary consumers will only receive 10% of this energy. The secondary consumers will receive 1% energy from the primary consumers. The tertiary consumers will receive 0.1% energy. This is known as the rule of 10.

How does increasing and decreasing heart rate impact blood delivery, oxygen need, blood pressure, body temperature and glucose level?

Answers

Answer:

Homeostasis regulates heart rate by increasing heart rate when cells need more oxygen and decreasing heart rate when they need less oxygen.

Explanation:

How many reactants and products are present in a double-replacement reaction?


one reactant and two products

one reactant and one product

two reactants and two products

two reactants and one product

Answers

Answer:

2 reactants and 2 products. All are compounds

Explanation:

Answer : The correct option is, two reactants and two products.

Explanation :

Double replacement reaction : It is a type of chemical reaction in which a positive cation and a negative anion of two reactants exchange their places to form two new products.

It is represented as,

[tex]XY+AB\rightarrow XB+AY[/tex]

(X and A are the cations, Y and B are the anions)

For example : Barium chloride react with magnesium sulfate to give barium sulfate and magnesium chloride as a product.

The balanced chemical reaction will be:

[tex]BaCl_2+MgSO_4\rightarrow MgCl_2+BaSO_4[/tex]

From this we conclude that, there are two reactants and two products are present in a double-replacement reaction.

Hence, the correct option is, two reactants and two products.

Which cellular structure would be the most likely location for synthesis of these enzymes

Answers

Final answer:

The rough endoplasmic reticulum, with its surface-bound ribosomes, is the site for synthesis of enzymes intended for export in eukaryotic cells. Post-synthesis, these proteins are modified in the Golgi apparatus before being transported to their final destinations.

Explanation:

The cellular structure most likely involved in the synthesis of enzymes for export is the endoplasmic reticulum (ER), specifically the rough ER due to the presence of ribosomes on its surface. Enzymes, which are proteins necessary for catalyzing various biological processes, are synthesized by ribosomes that are found either floating freely in the cytoplasm or attached to the rough ER. When enzymes are meant for export or for use in lysosomes, the rough ER becomes the primary site of synthesis. After synthesis, these proteins are usually sent to the Golgi apparatus for further modification and sorting, before being shipped to their final destinations.

Cells that are highly active in protein synthesis, such as those in the pancreas that produce digestive enzymes, have a large number of ribosomes. Moreover, certain enzymes are compartmentalized within specific organelles, like mitochondria, which house enzymes involved in cellular respiration; or lysosomes, which contain enzymes that break down cellular debris. This compartmentalization provides efficient and regulated chemical reactions within the cell.

What must be done to ensure DNA made is a laboratory is radioactive

Answers

A) Incorporating radioactive nucleotides.

An inorganic mineral is not composed of anything that was once _____.

A.oxidized

B.alive

C.used

D.crystallized

E.reduced

Answers

B

An inorganic mineral is not composed of anything that was once alive

Explanation:

Organic minerals made from life. They mainly make up the biosphere and examples are minerals in plants and animals. Even after the death and decomposition of the living organisms, the minerals from the decomposition are considered organic. Organism matter is mainly made up of carbon and hydrogen.

Inorganic material, on the hand, are not derived from life and include substances like metal elements and inorganic salts.

Learn More:

For more on organic vs inorganic minerals check out;

https://brainly.com/question/11232288

https://brainly.com/question/10801059

#LearnWithBrainly

Final answer:

An inorganic mineral is not composed of anything that was once alive, emphasizing the distinction between organic and inorganic substances and highlighting the characteristics that define inorganic minerals, such as their crystalline structure and definite chemical composition.

Explanation:

An inorganic mineral is not composed of anything that was once alive. This distinction is crucial in understanding what constitutes an inorganic mineral versus organic matter. Minerals are defined as naturally occurring, inorganic solids with a definite chemical composition and a characteristic crystalline structure. Organically derived compounds, which include elements such as carbon (C), hydrogen (H), oxygen (O), and nitrogen (N) derived from living organisms, do not fall under the definition of an inorganic mineral. The presence of a crystalline structure indicates that the atoms within minerals are arranged in an orderly manner, reflecting the internal atomic arrangement. It is this precise arrangement and chemical composition that differentiate minerals from other substances.

Watch the following Changing with the Times: Variations within Ecosystems tutorial. Write a summary paragraph (4-6 sentences) describing what you learned from the tutorial.

Answers

Answer:

  Variations Within Ecosystems

Ecosystem diversity can be described as a term which is used o describe the changes within an ecosystem and the impact these changes have on the environment and humans.

Variations within an ecosystem can cause genetic drifts. Variations will cause those organisms to survive which are better adapted to survive to the changes which occur in an ecosystem. And the organisms which are not better suited become extinct over a period of time. Hence, this will lead to a wide rise in biodiversity.

list of 50 non living things ​

Answers

book
Bat
Hat
Chair
Tape
Water
Temperature
Soil
Sun
Door

Answer:

Hot air balloon

Trench coat

Sofa

Coloring book

The Leaning Tower of Pisa

Kitchen sink

Hydro flask

Lay's chips

Blue Castle Coffee

My reading assignment

French fry

Laptop charger

The laptop itself

Cruise ship

Bow

Arrow

Closet door

Bowling ball

The X that marks the spot

Tissue box

Mirror

Mozzarella sticks

Ammonium Lactate lotion

Barcode scanner

Chimney

Kilt

Erhu

Battery

Message

Lip piercing

Submarine

Nail polish

Caboose

Combat boots

Bathtub

Car radio

Pacifier

Reese's Peanut Butter Cups

Bluetooth speakers

Punching bag

Sidewalk

Sweater

Contact lenses

Police uniform

Artificial plant decor

Fedora

Whip

Pendulum clock

Microphone

Me in a thousand years

what will each newly formed cell form around the chromosomes

Answers

A nuclear envelope forms around each set of chromosomes, and a nucleolus forms in each of the newly forming cells. Copied DNA coils into chromosomes. ... Kinetochore fibers move chromosomes to the cell's center.

Answer:

it will form a Telophase

Explanation:

During telophase, the newly separated chromosomes reach the mitotic spindle and a nuclear membrane forms around each set of chromosomes, thus creating two separate nuclei inside the same cell. As Figure 4 illustrates, the cytoplasm then divides to produce two identical cells.

Which of these landforms is created due to deposition?
A. Cirque
B. Fjord
C. Horn
D. Sandbars

Answers

Sandbars is created due to deposition.

Explanation:

Sandbars are long, fine deposit below the surface of water. Also they are termed as the offshore bar, they are sometimes inundated, sometimes exposed ridges of sand, which is made by waves offshore from beach. Creation of the swirling turbulence of the waves which breaks the beach and digs a through in the sandy bottom. The top portion of the bar remains in water level by the plunge by the waves breaking over it.

Fill in the blank.
1. Increasing temperatures in the atmosphere have caused the temperature of the oceans to _____,leading to more powerful tropical storms.
2. Approximately 25% of carbon dioxide emitted into the atmosphere is absorbed in the________
3. _____treatment is critical to removing pollutants from contaminated water by using
physical, chemical, or biological processes.
4. Water pollution can come from the ____ of dead organic matter or animal waste in
waterways.
5. Water pollution increases the amount of salinity and slows down major ocean______that are
responsible for regulating Earth's climate.
Respond to the following based on your reading.
6. Describe steps that can be taken to improve water quality through water conservation ​

Answers

Answer:

increase

oceans

wastewater

decomposition

currents

Individuals can control their use of water. Governments can help conserve water by encouraging farmers to plant climate-resistant crops that require less water. Switching to newer alternative energy technologies can reduce water used in fossil fuel and nuclear power plants for cooling.

Explanation:

The branch of science which deals with a living being is called biology.

The current question is fill in the blanks. The correct answer is as follows:-

Increasing temperatures in the atmosphere have caused the temperature of the oceans to increase , leading to more powerful tropical storms. Approximately 25% of carbon dioxide emitted into the atmosphere is absorbed in the oceans

Water waste treatment is critical to removing pollutants from contaminated water by using Water pollution can come from the physical and biological waste of dead organic matter or animal waste in waterways.Water pollution increases the amount of salinity and slows down major ocean decomposition  that are  responsible for regulating Earth's climate

The amount of drinking water is limited on the earth. As the population increases the water will be deficient for every species.

The only way to resolve this issue is to conserve the water in all possible ways out. Water conservation help in increasing the water amount use for daily chores and the extra water is can be used by the deficient person.

Hence, these are the answer to the following.

For more information, refer to the link:-

https://brainly.com/question/17338790

How does recycling runoff reduce agricultural pollution?

Answers

Answer:

Agricultural runoff can be described as the waste such as fertilizers, pesticides, herbicides, soil waste etc which gets drained off into rivers with water. Agricultural runoff might occur due to irrigation, abundant rain etc.

If the agricultural run-off is recycled, then water will be less polluted. The water will therefore be not harmful for usage by the plants. The run-off can be diagnosed and essential minerals required by the plants can be recycled.

The recycling of the agricultural run off will make the drained water less contaminated for the animals living in the lakes or ponds.

Answer:

It keeps chemicals from entering the water shed.

Explanation:

Watershed are connected to water basins, rivers and ponds and therefore if its protected from being polluted through recycling runoff, it reduces polluting the waters and therefore agricultural pollution is reduces.

As pressure on a gas is increased the volume of the gas decreases. Is that theory, law, or hypothesis?

Answers

Answer:

Is a theory. See the explanation below, please.

Explanation:

This phenomenon is explained by the Boyle-Mariotte Law, where as the pressure of a gas increases, the volume decreases and vice versa, all at a constant temperature (they are inversely proportional magnitudes). This law is explained by the following formula:

Initial P x Initial V = P Final x Final V

what do the similarities between the skeletal structures of these three species most likely indicate about their evolutionary history​

Answers

These three species are distantly related and share a common ancestor

Final answer:

Skeletal similarities among species indicate a common evolutionary past, and these are called homologous structures. Complex anatomical structures are unlikely to evolve independently in the exact same way, just as it's improbable for people to invent identical complex machines separately.

Explanation:

The similarities between the skeletal structures of different species suggest a common evolutionary history. For example, the similar bone arrangements in a bat's wings, a dolphin's flippers, and a horse's legs are not random; they are indicative of a shared ancestry. These structures are known as homologous structures, which are anatomical similarities due to descent from a common ancestor.

Homologous structures provide evidence for evolution because it is highly improbable that complex features, like a mammalian limb with all its specific bones and muscle attachments, would independently evolve in the exact same way. Just as it would be improbable for two people from different countries to independently invent a car with the same design without prior knowledge or influence, it is unlikely for the complex structures of different species to have arisen separately rather than from a common ancestor.

what is the volume of an object that is 12 cm long, 100 mm wide and 0.001 m high

Answers

The volume of an object that is 12 cm long, 100 mm wide and 0.001 m high is 0.00012 cubic meters.

To calculate volume of an object:

Height = 0.001 m

Length = 12 cm = 0.12 m

Width = 100 mm = 0.1 m

Volume refers to amount of space that an object occupies.

The units for volume will depend upon the units of the dimensions of the object. For example if the length, width, and height are all in meters, then the volume will be in cubic meters.

Multiply the length, width, and height to get the volume:

Volume = Length × width × height

= 0.12 m x 0.1 m x 0.001 m

= 0.00012 cubic meters

Therefore, the volume of the object is 0.000212 cubic meters.

To learn more about Volume:

https://brainly.com/question/31622596

#SPJ4

(Urgent) DNA is the primary source of heritable information in cells. Explain how the
chemical structure of DNA makes this possible.

Answers

Answer:

The DNA is made up of two strands which are joined through the hydrogen bonds present in the nucleotides. There are 4 nucleotides which make up the DNA. Adenine of one strand pairs with thymine of the other strand. Cytosine of one strand pairs with guanine of the other strand. These bonds keep the DNA double helix intact. Information stored in the DNA is unique due to the sequence of pairing of these nucleotides.

The DNA encodes information through the proper sequencing of the nucleotides. These DNA messages encode for certain types of proteins.

Final answer:

The chemical structure of DNA, with its double-helix shape and specific base pairing properties, allows it to store and transmit heritable information in cells.

Explanation:

The chemical structure of DNA makes it possible to be the primary source of heritable information in cells. DNA is composed of two strands that are connected by nucleotides, which are made up of a sugar, a phosphate group, and a nitrogenous base. The sequence of these nitrogenous bases along the DNA molecule carries the genetic information that is passed on to offspring.

The complementary pairing of nitrogenous bases allows DNA to replicate itself during cell division, ensuring that the heritable information is faithfully passed on. For example, adenine on one strand always pairs with thymine on the other strand, while guanine always pairs with cytosine. This base pairing rules ensures the accuracy of DNA replication.

Overall, the double-helix structure of DNA and its specific base pairing properties allow it to store and transmit heritable information, making it the primary source of genetic material in cells.

Learn more about DNA as the primary source of heritable information here:

https://brainly.com/question/36956747

#SPJ3

Which ecosystems do NOT have
symbiotic relationships?
A. deserts
B. All ecosystems contain symbiotic relationships.
C tropical rainforests

Answers

Answer:

The correct option is B. All ecosystems contain symbiotic relationships.

Explanation:

Symbiotic relationship can be described as a relationship between the organisms of two species. It might be harmful for both the species, beneficial for both the species or just beneficial to one of the species. All ecosystems will have some kind of symbiotic relationships. Hence, option B is correct.

Other options like Option A is false because the desert ecosystem does has symbiotic relationships. For example, the Gobi woodpecker lives on a cactus in a desert. In return it eats the insects and other parasites which harm the cactus.

 

The correct answer is A. deserts.

Symbiotic relationships are interactions between two or more organisms from different species that live in close physical association with each other. These relationships can be beneficial to one or both organisms (mutualism), beneficial to one while having no effect on the other (commensalism), or beneficial to one while being harmful to the other (parasitism).

In ecosystems, symbiotic relationships are widespread and can be found in virtually all environments where life exists. This includes deserts, tropical rainforests, coral reefs, tundras, and even human bodies, where millions of bacteria form symbiotic relationships with their host.

Option B states that all ecosystems contain symbiotic relationships, which is generally true. However, the question asks for an option that does NOT have symbiotic relationships, which means we are looking for an exception to this general rule.

Deserts (option A) are often characterized by harsh conditions, including extreme temperatures, low precipitation, and limited resources. While it is true that deserts can have fewer visible examples of symbiotic relationships due to the sparse distribution of organisms, symbiotic relationships do still exist in desert ecosystems. For example, cacti may have mutualistic relationships with certain species of birds or insects that nest in them or help with pollination.

Tropical rainforests (option C) are known for their high biodiversity and complex web of interactions, including a multitude of symbiotic relationships.

Therefore, the most accurate answer to the question is that all ecosystems, including deserts, contain symbiotic relationships to some extent. However, if we were to identify an ecosystem with fewer symbiotic relationships compared to others, deserts might be considered due to their extreme conditions and lower organism density. It's important to note that the question's premise is somewhat flawed because symbiotic relationships, even if less visible or less diverse, are present in all ecosystems.

2 Points
A protein channel in a hydrogen ion pump is shown below.
What would happen if there were no Htion concentration difference when the
channel opened?

Answers

Explanation:

H+ pumps use energy to move H+ across membranes...

the H+ ion gradient must favor the flow of electrons into the cellthere must be a concentration gradient

With no concentration difference, a gradient cannot be established. Thus, there is no movement of H+

Further Explanation:

For example, for H pumps in the inner membrane of the mitochondria like ATPase...

Hydrogen atoms contain 1 proton and 1 electron while being devoid of neutrons. When they lose their electron they form an ion or H+, a particle carrying a unit of positive charge. At the mitochondrial membrane, the outer membrane freely allows for the passage of H+ while the inner membrane does not. Mitochondria require H+ concentration gradients to produce ATP; i.e. high concentrations of of H+ in the intermembrane space and low H+ within the mitochondrial matrix.

The H+ being pumped outside the mitochondrial matrix leads to increased H+ within the intermembrane space, due to its high permeability. This forms a gradient where there is a differential in the number of protons on either side of the membrane the protons flow or re-enter the matrix through the enzyme ATP synthase, which makes the energy storage molecules of ATP from the reduction of ADP and inorganic phosphate, Pi.

Learn more about cellular life at brainly.com/question/11259903

Learn more about cellular respiration at brainly.com/question/11203046

#LearnWithBrainly

Final answer:

In the absence of a hydrogen ion concentration difference, the ATP synthase mechanism would not operate, as there is no gradient to drive protons through it, leading to a halt in ATP production.

Explanation:

If there were no hydrogen ion concentration difference when the protein channel in a hydrogen ion pump opened, the driving force for the movement of hydrogen ions (protons) through the channel would be absent. In the mitochondria, an integral membrane protein known as ATP synthase harnesses the potential energy of the hydrogen ion gradient to produce ATP. ATP synthase acts like a generator, where the movement of hydrogen ions through it, down their electrochemical gradient, turns part of the molecular machine facilitating the phosphorylation of ADP to form ATP.

Without a concentration difference, there would be no gradient to drive this process, and as a result, the production of ATP by chemiosmosis would halt. The normal flow of hydrogen ions from higher to lower concentration through the ATP synthase is crucial for this energy conversion process.

Which of the Following is an Example of Parasitism?


A.Tree frogs using a tree to hide from predators

B. Fleas living on a dog, making the dog ill

C. Algae living on a sloth, giving it camouflage

D.Two fish protecting each other from preditors

Answers

B!

Parasitism is when one organism benefits and harms the organism it is living off of, while the organism it is living off of will only be harmed and does not benefit.

Fleas on a dog represent parasitism because the fleas benefit by obtaining nutrients at the dog's expense, potentially causing illness to the dog. The example of parasitism among the options provided is B.

Parasitism is a type of symbiotic relationship where one organism, the parasite, benefits at the expense of another organism, the host. The flea acts as a parasite by living on the dog and deriving nutrients from it, while the dog suffers harm, often in the form of illness or discomfort. This detrimental effect on the host is a hallmark of parasitism.

When you’re wearing a big sweater, what kind of energy is keeping you warm?
A
chemical energy

B
thermal energy

C
sound energy

D
kinetic energy

Answers

Answer:

b. thermal

Explanation:

When you’re wearing a big sweater, thermal energy is the kind of energy that keeping you warm. Thus, option B is correct.

What is kinetic energy?

The energy of the body by the virtue of its motion is known as the kinetic energy of the body. It is defined as the product of half of mass and square of the velocity.

The passage of vibrations through matter is characterized as sound energy. When an item vibrates, sound energy is created, resulting in noise. Sound vibrations induce pressure waves to flow through a material like air, water, wood, or metal.

Each magnetic field, also known as magnetic energy, includes energy. Electric currents create magnetic fields, magnetic energy is a kind of energy for transporting charge carriers.

Therefore, When you’re wearing a big sweater, thermal energy is the kind of energy that keeping you warm. Thus, option B is correct.

Learn more about energy on:

https://brainly.com/question/1932868

#SPJ6


How would this disease most likely impact the grassland ecosystem?

Answers

Answer:

Explanation:

Characterized by their flat, open pastures and abundance of nutrient-rich soil, more than a quarter of the world’s land—and about 70 percent of its agricultural land—is covered by grasslands.

This biome is home to a range of flora and fauna, which add to its resilience against natural disasters such as droughts or wildfires. In fact, native grassland plants have adapted to extreme weather conditions to such an extent that savannas, a subset of grasslands found in Africa, Australia, South America, and India, require seasonal droughts and wildfires to maintain biodiversity

But this resiliency does not equate to immunity.

Grasslands are threatened by habitat loss, which can be caused by human actions, such as unsustainable agricultural practices, overgrazing, and crop clearing. Almost half of all temperate grasslands and 16 percent of tropical grasslands have been converted to agricultural or industrial uses and only one percent of the original tallgrass prairie exists today.

In dogs, gum coloration is co-dominant, with black coloration,
black & pink spotted and pink.
You have a lovely spotted gummed Labrador retriever who has
just had 8 pups. Four of the pups have spotted like your dog.
and 4 have pink gums.
What is the likely phenotype of the sneaky neighbor dog? Show
your work.

Answers

Answer:

The phenotype of the sneaky neighbor dog will be pink. Let's consider the phenotype of our spotted gummed Labrador to be CPCB and neighbors dog to be CPCP

          CP          CB

CP     CPCP       CPCB

CP     CPCP      CPCB

The results of this cross show that there will be a probability of having pink dogs as well as spotted dogs. Hence, this proves that the neighbors dog had pink gums.

Final answer:

The genotype of the sneaky neighbor dog is likely pp, resulting in a pink gum phenotype, because when this dog mated with a Bp (black and pink spotted gums) Labrador, half of the puppies had pink gums.

Explanation:

The observation that half of the Labrador retriever puppies have spotted gums while the other half have pink gums suggests that gum coloration in dogs displays a pattern of co-dominance. In this case, the phenotype of the puppies informs us about the possible genotype of the parents.

Since the Labrador mother has spotted gums, her genotype for gum color must be one allele for black and one for pink, expressed as Bp. The appearance of some puppies with pink gums indicates they must be pp, receiving a pink allele from both parents. Thus, the father (the sneaky neighbor dog) must have a pp genotype to produce pups with pink gums when mated with a Bp Labrador.

To conclude, the phenotype of the sneaky neighbor dog is likely to be pink gums.

Which of the following is NOT TRUE concerning enzymes?
A. Enzymes have optimal environmental conditions
B. Enzymes are consumed by the reactions they catalyze
C. Enzymes can catalyze only one or a very few different reactions
D. All enzymes are proteins
E. Enzymes can only catalyze spontaneous reactions

Answers

Answer:

It should be B.)

Explanation:

Enzymes are catalysts, which means they are not consumed by the chemical reactions they catalyze.

Final answer:

The correct answer is D. All enzymes are proteins.

Explanation:

D. All enzymes are proteins is the correct answer as it is NOT TRUE concerning enzymes. While the majority of enzymes are proteins, there are a few exceptions. Ribozymes, for example, are enzymes that are composed of RNA molecules rather than proteins.

Enzymes have optimal environmental conditions, which refers to specific pH and temperature ranges where the enzyme operates most efficiently. They are not consumed by the reactions they catalyze, meaning that they can be reused. Enzymes can catalyze only one or a very few different reactions, and they can catalyze both spontaneous and non-spontaneous reactions.

Learn more about Enzymes here:

https://brainly.com/question/31385011

#SPJ6



Select the correct answer.
Which combination of gases dominates Earth’s atmosphere?
A.
argon (78.50%), oxygen (20.90%)
B.
nitrogen (78.10%), oxygen (20.90%)
C.
carbon dioxide (78.15%), oxygen (20.90%)
D.
methane (50.10%), oxygen (49.9%)
E.
nitrogen (20.9%), oxygen (78.10%)

Answers

Answer:

Answer is B.

nitrogen (78.10%), oxygen (20.90%) - this combination of gases dominate the Earth’s atmosphere.

Explanation:

The atmosphere of earth is a gaseous layer which surrounds the earth. It  protects the life on earth by absorbing harmful ultraviolet radiation, reducing temperature extremes, maintaining the existence of  liquid water on the earth's surface and warming the surface. The atmosphere consists of many gases including some pollutants and greenhouse gases. Nitrogen is the gas present in the atmosphere most abundantly while Oxygen and Argon take the second and third place. Atmosphere contains approximately 78% of nitrogen , 21% of oxygen and 0.9% of argon. Gases like carbon dioxide, nitrous oxides, methane, ozone and the water vapor constitutes the rest of the atmosphere. Many small particles called aerosols are also there which include dust, spores, pollen, volcanic ash, smoke etc. There are five layers of atmosphere. Troposphere (0 to 12 km) where we live is the lowest layer of earth's atmosphere ,which is closest to the earth's surface contains half of the atmosphere. Here most clouds are found and almost all weather occurs. Stratosphere (12 to 50 km) is the second layer where jet aircraft and weather balloons fly. It contains the ozone layer that absorbs harmful radiation from the sun.  Mesosphere (50 to 80 km) is the third highest layer and the coldest part of the atmosphere where most meteors burn up upon entering in to the atmosphere. The fourth layer is thermosphere (80 to 700 km) where the International Space Station orbits earth and the space shuttles flew. Exosphere (700 to 10,000 km) is the outermost layer where the atmosphere merges into outer space. Most of the satellites orbiting earth are found here.

Anser as soon as possible! Worth 50 points! And make sure to EXPLAIN. Please and thank you!
-Airee (not real name just my online name)

Antigens can trigger an immune response. Is this a specific or a nonspecific defense? Explain.

Answers

The immune system protects the body from possibly harmful substances by recognizing and responding to antigens. Antigens are substances (usually proteins) on the surface of cells, viruses, fungi, or bacteria. Nonliving substances such as toxins, chemicals, drugs, and foreign particles (such as a splinter) can also be antigens. The immune system recognizes and destroys, or tries to destroy, substances that contain antigens.  Your body's cells have proteins that are antigens. These include a group of antigens called HLA antigens. Your immune system learns to see these antigens as normal and usually does not react against them.

Innate, or nonspecific, immunity is the defense system with which you were born. It protects you against all antigens. Innate immunity involves barriers that keep harmful materials from entering your body. These barriers form the first line of defense in the immune response. Examples of innate immunity include:

Cough reflex

Enzymes in tears and skin oils

Mucus, which traps bacteria and small particles

Skin

Stomach acid

Innate immunity also comes in a protein chemical form, called innate humoral immunity. Examples include the body's complement system and substances called interferon and interleukin-1 (which causes fever).  If an antigen gets past these barriers, it is attacked and destroyed by other parts of the immune system.  Acquired immunity is immunity that develops with exposure to various antigens. Your immune system builds a defense against that specific antigen.  Passive immunity is due to antibodies that are produced in a body other than your own. Infants have passive immunity because they are born with antibodies that are transferred through the placenta from their mother. These antibodies disappear between ages 6 and 12 months.  Passive immunization may also be due to injection of antiserum, which contains antibodies that are formed by another person or animal. It provides immediate protection against an antigen, but does not provide long-lasting protection. Immune serum globulin (given for hepatitis exposure) and tetanus antitoxin are examples of passive immunization.

Antigens are substances (usually proteins) on the surface of cells, viruses, fungi, or bacteria. ... Your immune system learns to see these antigens as normal and usually does not react against them. INNATE IMMUNITY. Innate, or nonspecific, immunity is the defense system with which you were born

Answer:

Specific Defense

Explanation:

Specific immune system gets activated when the pathogens (foreign elements) enter the body and are able enough to bypass the innate immune defenses thereby activating the adaptive immune system  

Specific defense is triggered by elements found on the surface of pathogens. These surface elements are called antigens. Antigens responds to these pathogens by producing antibodies specific to pathogen surface type.

Soil is made of _____.


Answers

Answer:

easy

Explanation:

Soil is made up of a mixture of organic material and minerals.

Because the plants grow on top of the soil and the rocks are found underground, soil is made up of layers.

Other Questions
Which of the following is NOT a political right? what is the slope for (12,5) (9,8) I need help putting these sentences in present progressive form. pleeeease help me1. Nosotros / practicar deportes2. Carmen / comer en casa3. Nuestro equipo / ganar el partido4. Yo / leer el peridico5. l / pensar comprar una bicicleta roja6. Ustedes / jugar a las cartas7. Jos y Francisco / dormir8. Marisa / leer el correo electrnico9. Yo / preparar sndwiches10. Carlos / tomar fotos11. dormir / t? A product modification differs from a line extension in that _______. The U.S. Congress enacted the CAN-SPAM Act in 2003. This act: a. limits advertisers from sending more than one ad per month per email address. b. does not view sending multiple spam emails with the use of a hijacked computer as an offense. c. prohibits the use of false or misleading subject lines on emails used for advertising. d. requires spammers to register with the Federal Trade Commission. All of the following statements are consistent with the kinetic molecular theory of gases EXCEPT: A. The gas molecules collide with each other and with the surfaces around them.B. Strong attractive forces hold the gas molecules together. C. The average kinetic energy of the molecules of a gas is proportional to the temperature of the gas in kelvins. D. The size of the gas molecules is negligible compared to the total volume of the gas. E. none of the above. What is a non-example of unit rate 14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line Linda says she values education. Over the years she has had several employees who worked for her and earned their degrees at the same time. To support them, Linda allowed them to flex their daily work hours. In this example, Linda demonstrates_____________. A 1.00-L gas sample at 100.C and 500. torr contains 52.0% helium and 48.0% xenon by mass. What are the partial pressures of the individual gases? Consider this simplified balance sheet for Geomorph Trading: Current assets $ 275 Current liabilities $ 210 Long-term assets 650 Long-term debt 205 Other liabilities 120 Equity 390 $ 925 $ 925 a. What is the companys debt-equity ratio? 6% of what number is 2.36 GEICO has decided that everyone will work in units with people who perform similar jobs. All of the procurement employees work in one department. All of the human resource employees work in one department and all of the printing employees work in the print shop. This type of structure is called_________. Consider the reaction 2Na(s) + 2H2O(l)2NaOH(aq) + H2(g) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 1.74 moles of Na(s) react at standard conditions. Ssurroundings = J/K g