In 25 hour, Matt can type 45 page.
What is Matt's rate in pages per hour?

Answers

Answer 1

Answer: Matt's rate is 2 pages per hour.

Step-by-step explanation:

25 hours = 45 pages

1. First, let's divide 45 by 25 to find how much it takes for one page to be done: [tex]\frac{45}{25}[/tex] = 1.8

2. This answer means it takes 1.8 hours to do one page.

3. Now, we can choose to round 1.8, which is 2.


Related Questions

MaryAnn is printing pictures from her recent trip to Europe. An online print shop charges $0.15 per
4x6 inch print, along with a flat rate shipping charge of $3.00. If MaryAnn has $35 to spend, how
many prints can she order?

Answers

Answer:

213

Step-by-step explanation:

Let

x = number of picturesy = total price

The relationship between x and y can be represented through a linear equation.

y = a . x + b

where,

a is the slope

b is the y-intercept

The slope refers to the price per print, that is, a = $0.15/p.

Then,

y = $0.15/p . x + b

Even if x = 0, there is a fixed cost of $3.00 (y = $3.00). We can replace these values in the expression above.

$3.00 = $0.15/p . 0 + b

b = $3.00

The final equation is:

y = $0.15/p . x + $3.00

If MaryAnn has $35,

$35 = $0.15/p . x + $3.00

$32 = $0.15/p . x

x = 213 p

She can order 213 prints.

Find midpoint of xy
X(7,-5) and y (9,-1)

Answers

Answer:

(8,-3)

Step-by-step explanation:

(x1+x2/2), (y1+y2/2)

7+9/2=16/2=8           x=8

-5-1/2=-6/2=-3          y=-3

Answer:

(8, -3)

Step-by-step explanation:

The formula of a midpoint of AB

[tex]A(x_A,\ y_A),\ B(x_B,\ y_B)\\\\M_{AB}\left(\dfrac{x_A+x_B}{2};\ \dfrac{y_A+y_B}{2}\right)[/tex]

We have the points X(7, -5) and Y(9, -1).

Substitute:

[tex]M_{XY}\left(\dfrac{7+9}{2};\ \dfrac{-5+(-1)}{2}\right)\\\\M_{XY}\left(\dfrac{16}{2};\ \dfrac{-6}{2}\right)\\\\M_{XY}(8,\ -3)[/tex]

8 lb 1 oz − 3 lb 6 oz

Answers

Answer:

4.6875 is the answer

Step-by-step explanation:

First, lets put both into just ounces. (1lb = 16oz.)

8lb. 1oz. = 129oz.

3lb. 6oz. = 54oz.

Second, subtract.

129 - 54 = 75

Third, put into pounds and ounces.

75oz. = 4lb. 11oz.

_______

Best Regards,

Wolfyy :)

What is y+x=5 in function notation? The dependent variable is y.​

Answers

Answer:

f(x)=5-x

Step-by-step explanation:

Final answer:

The equation y + x = 5 in function notation is f(x) = 5 - x, done by isolating the dependent variable, y, and expressing it as a function of x.

Explanation:

The equation y + x = 5 can be rewritten in function notation by isolating the dependent variable, y, which is standard procedure in function notation. To isolate y, we need to subtract x from both sides of the equation. Thus, the equation y + x = 5 becomes y = 5 - x. In function notation, where y is typically written as f(x), this would become f(x) = 5 - x.

Learn more about Function Notation here:

https://brainly.com/question/36493719

#SPJ2

What is .001 as a fraction with a negative exponent.

Answers

Answer:

1/1000 or 1x10^(-3)

Step-by-step explanation:

0.001=1/1000 as a fraction

With a negative exponent?

You can write it into standard notation.

It's 1x10^(-3).

0.001 as a fraction with a negative exponent is 10⁻³.

To express the decimal 0.001 as a fraction with a negative exponent, we need to understand how negative exponents work with powers of ten. The decimal 0.001 is equivalent to the fraction [tex]\frac{1}{1000}[/tex], which can be written as [tex]\frac{1}{103}[/tex].

Using the concept of negative exponents, [tex]\frac{1}{103}[/tex] can be rewritten as 10⁻³. This is because a negative exponent indicates the inverse of the corresponding positive exponent. So, 0.001 = 10⁻³.

Summary in Steps:

Convert 0.001 to a fraction: [tex]\frac{1}{1000}[/tex].Express 1/1000 as 10⁻³ using the rule of negative exponents.

Therefore, 0.001 equals 10⁻³ as a fraction with a negative exponent.

8. Find the value of k, if (1-1) is a solution of the equation 3x-ky =8. Also, find the coordinates of
another point lying on its graph.​

Answers

Answer:

k = 5 and (6,2).

Step-by-step explanation:

Since (1,-1) is a solution of the equation 3x - ky = 8, so the point (1,-1) will satisfy the equation above.

Hence, putting x = 1 and y = -1 in the equation will give left-hand side = right-hand side.

So, 3(1) - k(-1) = 8

⇒ 3 + k = 8

k = 5 (Answer)

Therefore, the equation of the straight line is 3x - 5y = 8 ....... (1)

Now, putting x = 6 , then from equation (1) we get y = 2

Therefore, (6,2) is also a point on the graph of equation (1). (Answer)

The temperature rises 15 degrees Fahrenheit (゚F) and then drops by 8゚F. If the temperature started at -11゚F, what temperature change would be required to bring the temperature to 0゚F?

A) an Incase of 4゚F
B) a decreased of 4゚F
C) a decreased of 19゚F
D) an increase of 19゚F

Answers

Answer:

the answer is A)

Step-by-step explanation:

-11 + 15 = 4

4 - 8 = -4

-4 + 4 = 0

Answer:

Step-by-step explanation:

Hello

The temperature rises 15 degrees Fahrenheit (゚F) and then drops by 8゚F. If the temperature started at -11゚F, what temperature change would be required to bring the temperature to 0゚F?

A) an Incase of 4゚F

B) a decreased of 4゚F

C) a decreased of 19゚F

D) an increase of 19゚F

-11 + 15 - 8 = -19 + 15 = -4° F

A) An increase of 4° F

What is the following following product 4 square 7 • 4 square root 7• 4 square root 7 •4 square root 7

Answers

Answer:

The value of product is 7.

Step-by-step explanation:

Since we have given that

4 square 7x4 square root 7x4 square root 7x4 square root 7

We need to find the product of the following terms:

We will apply the "law of exponents":

i.e.

(a^m)^n=a^{mn}

4 square 7x4 square root 7x4 square root 7x4 square root 7

=7 ^(1/4)4=7

Hence, the value of product is 7.

The value of product is 7.

What is product?

The term "product" refers to the result of one or more multiplications. For example, the mathematical statement would be read " times equals ," where is called the multiplier, the multiplicand and is their product.

Given is an expression, 4 square 7 • 4 square root 7• 4 square root 7 •4 square root 7

Converting into mathematical notation,

= [tex]\sqrt[4]{7} . \sqrt[4]{7} . \sqrt[4]{7} . \sqrt[4]{7} .[/tex]

We need to find the product of the following terms:

We will apply the "law of exponents":

(xᵃ)ᵇ = xᵃᵇ

[tex](\sqrt[4]{7})^4\\\\= (7^\frac{1}{4})^4\\\\= 7[/tex]

Hence, the value of product is 7.

Learn more about products, click;

https://brainly.com/question/22852400

#SPJ2

Which function has the same graph as x + y = 11? A. f(x) = -y + 11 B. f(x) = -x + 11 C. f(x) = x − 11 D. f(x) = y − 11

Answers

The real is B.) f(x) = -x + 11

A.) f(x) = -y + 11 is the wrong answer.

I have pictures to prove that they are the same in the graph as x + y = 11.

Hope this will help a lot more than the other answer.

Answer:

B.) f(x) = -x + 11

Step-by-step explanation:

Helen uses 0.12
kilogram of nuts in each batch of granola
that she makes. If she makes 2.5 batches,
how many kilograms of nuts will she use?

Answers

The answer is .30 kilograms of nuts

Helen uses 0.3 kg of nuts for 2.5 kg of granola.

What is multiplication?

Multiplication is an operation that represents the basic idea of repeated addition of the same number.

Given that, Helen uses 0.12 kilogram of nuts in each batch of granola

that she makes, and she makes 2.5 batches,

For 1 batch she uses .12 kg of nuts, so for 2.5 kg she will use = 2.5*0.12 = 0.3 kg

Hence, Helen uses 0.3 kg of nuts for 2.5 kg of granola.

For more references on Multiplication, click;

https://brainly.com/question/5992872

#SPJ2

what is the equation of the line that passes through point (4, 12) and has a intercept of -2​

Answers

Answer:

[tex]\large\boxed{y=\dfrac{7}{2}x-2}[/tex]

Step-by-step explanation:

The slope-intercept form of an equation of a line:

[tex]y=mx+b[/tex]

m - slope

b - y-intercept → (0, b)

The formula of a slope:

[tex]m=\dfrac{y_2-y_1}{x_2-x_1}[/tex]

We have the point (4, 12), and y-intercept b = -2 → (0, -2).

Substitute:

[tex]m=\dfrac{-2-12}{0-4}=\dfrac{-14}{-4}=\dfrac{14:2}{4:2}=\dfrac{7}{2}[/tex]

Finally:

[tex]y=\dfrac{7}{2}x-2[/tex]

Divide 13 by v. Then, subtract 7.

Which of the following expressions matches the statement above?

A. 13 ÷ (v - 7)
B. 13 ÷ (7 - v)
C. 13 ÷ v - 7
D. v ÷ 13 - 7

Answers

Correct answer is C, you would do the order of operation 13\v then take that and subtract 7

find the values of x and y that satisfy the equation.
-10x+12i=20+3yi​

Answers

Answer:

x = -2

y = 4

Step-by-step explanation:

Given

[tex]-10x+12i=20+3yi[/tex]

Two complex numbers are equal when they have equal real and imaginary parts.

Equate real parts:

[tex]-10x=20\\ \\x=-\dfrac{20}{10}=-2[/tex]

Equate imaginary parts:

[tex]12=3y\\ \\y=\dfrac{12}{3}=4[/tex]

Final answer:

The values of x and y that satisfy the given complex equation are x = -2 and y = 4, found by equating the real and imaginary parts respectively.

Explanation:

To find the values of x and y that satisfy the equation -10x + 12i = 20 + 3yi, we need to equate the real parts and the imaginary parts of the complex numbers on both sides of the equation.

For the real parts, we have:
-10x = 20
=> x = -2

For the imaginary parts, we have:
12 = 3y
=> y = 4

So the solution for the equation is x = -2 and y = 4.

A cylinder has a diameter of 6 ft and height of 9 ft. What is the volume of this cylinder?
work plsss

Answers

The answer is 254.47 ft

Step-by-step explanation:

V=pi×r^2×h

pi=3.14

r=d/2

r=6/2=3

v=(3.14)×3^2×9

=254.47 ft

Answer:

54ft

Step-by-step explanation:

The formula for volume is base *height

joe bought g: gallons of gasoline for $2.85 per gallon and c: cans for oil for 3.15 dollars.

Part A:what expression can be used go determine the total amount joe spent on gasoline and oil?

part B:if he bought 8.4 gallons of gasoline and 6 cans of oil, how much will he have spent in all?


please help! thank you :D​

Answers

A) 2.85g+3.15c
B)2.85(8.4)+3.15(6)=$42.84
Final answer:

The expression to determine the total amount Joe spent on gasoline and oil is 2.85 * g + 3.15 * c. If Joe bought 8.4 gallons of gasoline and 6 cans of oil, he will have spent 42.84 dollars in total.

Explanation:

Part A: To determine the total amount Joe spent on gasoline and oil, we need to calculate the cost of gasoline and the cost of oil separately, and then add them together.

The expression to calculate the cost of gasoline is: 2.85 * g, where 'g' represents the number of gallons of gasoline Joe bought.

The expression to calculate the cost of oil is: 3.15 * c, where 'c' represents the number of cans of oil Joe bought.

Therefore, the expression to determine the total amount Joe spent is: 2.85 * g + 3.15 * c.

Part B: If Joe bought 8.4 gallons of gasoline and 6 cans of oil, we can substitute these values into the expression we derived in Part A.

The total amount Joe spent can be calculated as follows:

Total amount spent = 2.85 * 8.4 + 3.15 * 6

Simplifying the expression:

Total amount spent = 23.94 + 18.90

Total amount spent = 42.84 dollars

what is the solution to this equation 8x-5(x-3)=18​

Answers

Answer:

x=1

Step-by-step explanation:

use distributive property for the negative 5, then simplify, then bring the 15 to the other side, then divide by 3. picture included.

Simplify 5 over 3/5 divided 7/8

Answers

Step-by-step explanation:

When you divide fractions, you multiply by the reciprocal.

The new equation would be:

[tex] \frac{5}{\frac{3}{8} \times \frac{8}{7} } [/tex]

When you multiply fractions, you go straight across. You'd get 24/56 and I can already see this can be simplified.24/56 = 3/7Now you could just plug 5 ÷ 3/7 in your calculator but let's just actually solve itTurn 5 into 5/1 and then flip 3/7 to its reciprocal (7/3)

[tex] \frac{5}{1} \times \frac{7}{3} = \frac{35}{3} [/tex]

35/3 = 11.66 repeating or simply:[tex]11 \frac{2}{3} [/tex]

Answer:

200/21

Step-by-step explanation:

5/(3/5) divided by 7/8

First divide 5 by 3/5. To do this you must write 5 as 5/1, and multiply 5/1 by the reciprocal of 3/5 (5/3).

5/1 (5/3)

numerator: 5*5=25

denominator: 1*3=3

25/3

Then divide 25/3 by 7/8 by multiplying 25/3 by the reciprocal of 7/8 (8/7).

25/3 (8/7)

numerator: 25*8= 200

denominator: 3*7= 21

200/21 or 9 11/21



Listed below are the numbers of words spoken in a day by each member of eight different randomly selected couples. Complete parts​ (a) and​ (b) below.

Male Female

16,051 24,017

26,378 12,962

1440 17,644

7875 17,399

18,237 12,486

15,728 16,581

14,306 16,533

26,823 18,967


a. Use a 0.05 significance level to test the claim that among​ couples, males speak fewer words in a day than females.

In this​ example, mu Subscript d is the mean value of the differences d for the population of all pairs of​ data, where each individual difference d is defined as the words spoken by the male minus words spoken by the female. What are the null and alternative hypotheses for the hypothesis​ test?


The test statistic is -0.35

The P-value is 0.369

What is the conclusion based on the hypothesis​ test?

Answers

Final answer:

We are testing the claim that males speak fewer words than females. With a p-value of 0.369, which is greater than the significance level of 0.05, we fail to reject the null hypothesis. Therefore, no significant evidence supports the claim that males speak fewer words than females.

Explanation:

The objective here is to test the claim that on average, males speak fewer words in a day than females. To do this, we compare two means using a hypothesis test for paired data.

The null hypothesis (H0) is that there is no difference between the mean number of words spoken by males and females. The alternative hypothesis (Ha) is that the mean number of words spoken by males is less than that spoken by females.

Since the p-value (0.369) is greater than the significance level of 0.05, we fail to reject the null hypothesis. This means we do not have significant evidence to support the claim that males speak fewer words than females.

A key takeaway from this is that the test statistic and p-value are critical elements in hypothesis testing. They determine whether or not you have significant evidence to reject the null hypothesis.

Learn more about Hypothesis Testing here:

https://brainly.com/question/34171008

#SPJ11

Select all irrational numbers.




4√

8√

10√

15√

36√

Answers

The irrational numbers would be:

8

10

15

started a new ixl and i have no idea how to do this

Answers

Answer:

y = - [tex]\frac{1}{6}[/tex] x - [tex]\frac{8}{9}[/tex]

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c

Rearrange 3x + 18y = - 16 into this form

Subtract 3x from both sides

18y = - 3x - 16 ( divide all terms by 18 )

y = - [tex]\frac{3}{18}[/tex] x - [tex]\frac{16}{18}[/tex], that is

y = - [tex]\frac{1}{6}[/tex] x - [tex]\frac{8}{9}[/tex] ← in slope- intercept form

Students were asked to name their favorite sport. Seven students chose soccer, nine chose basketball, four chose baseball, and five chose tennis. Write the ratio in simplest form that compares the number of students
who chose tennis to the total number of students.

Answers

Answer:

Total number of students= 7+ 9+4+5= 25

Tennis: total= 5:25= 1:5 (simplify by dividing both sides by 5

Answer:

1:5

Step-by-step explanation:

First We Add The Number Of Students.

7+9+4+5=25

the students were divided into 5 kind of sports so it will be 5/25

5/25 means 1/5 and

1/5 means 1:5

need help solving this ​

Answers

Answer:

p( <18 years old) =[tex]\frac{72162}{330623}=0.2183=21.83\%[/tex]. Here you evaluate the probability of finding people who are less than 18 years old, by comparing the amount of people who are less than 18 years old (72162), with to the total amount of people in the sample (330623).p( <18 years old /no health insurance)= [tex]\frac{7663}{46340} =0.1654=16.54\%[/tex]. This means that assuming that people does not have insurance (this happens in 46340 cases), in 7663 of this cases, besides not having insurances, the persons are lessthan 18 years old.This events are not independent, because the condition that should hold to obtain independece is that P(<18 years old/ no health insurance)= P(<18 years old), which would mean that, knowing that a person has not health insurance should not add any information to the main fact: that the person's age is below 18. If the equality does not hold, then, knowing that the person has not health insurance helps knowing about the age of the person.

Jackie has 6 skirts and 2 dresses. she has brown shoes and black shoes. if each choice is equally likely how much greater is the probability of her choosing a skirt and brown shoes than the probability of her choosing a dress and black shoes?​

Answers

Answer:

1/2

Step-by-step explanation:

both have equal chances

The required probabilities are 3/8 and 1/8 respectively.

What is probability?

Probability is a measure of the likelihood of an event occurring. The probability formula is defined as the possibility of an event happening is equal to the ratio of the number of favorable outcomes and the total number of outcomes. Probability of event to happen P(E) = Number of favorable outcomes/Total Number of outcomes.

Given here: Jackie has 6 skirts and 2 dresses.

Total number of dresses=8

Thus the probability of picking a skirt is = 6/8

                                                                   =3/4

And the probability of picking a dress is =2/8

                                                             =1/4

Also, the probability of choosing either shoe is 1/2

Therefore the conditional probability that she chooses a skirt and brown shoes is = 3/4×1/2

              =3/8

Similarly Probability( dress+black shoes)=1/4×1/2

                                                                   =1/8

Hence, The required probabilities are 3/8 and 1/8 respectively.

Learn more about probability here:

https://brainly.com/question/30034780

#SPJ5

What is one fourth of sixty?

Answers

Answer:

fifteen

Step-by-step explanation:

Answer:

15

Step-by-step explanation:

1/4(60)=60/4=15


Find the x- and y intercepts for the linear equation

4. 3x + 2y = 6

5. 4x – 9y = 36

6. x + y = -3

8. Xx - 3y = 12

Answers

4. 3x + 2y = 6

x-intercept = 2 ,  y - intercept = 3

5. 4x – 9y = 36

x-intercept = 9, y - intercept = -4

6. x + y = -3

x-intercept = -3, y - intercept = -3

8. x - 3y = 12

x-intercept = 12, y - intercept = -4

Step-by-step explanation:

To find the x-intercept we put y=0 in the equation and to find the y-intercept we put x = 0 in the equation

4. 3x + 2y = 6

Putting y = 0

[tex]3x + 2y = 6\\3x +2(0) = 6\\3x = 6\\\frac{3x}{3} = \frac{6}{3}\\x= 2[/tex]

Putting x=0

[tex]3x + 2y = 6\\3(0) + 2y = 6\\2y = 6\\\frac{2y}{2} = \frac{6}{2}\\y= 3[/tex]

5. 4x – 9y = 36

Putting y = 0

[tex]4x -9y = 36\\4x - 9(0) = 36\\4x = 36\\\frac{4x}{4} = \frac{36}{4}\\x = 9[/tex]

Putting x=0

[tex]4(0) -9y = 36\\-9y=36\\\frac{-9x}{-9} = \frac{36}{-9}\\x =-4[/tex]

6. x + y = -3

Putting y = 0

[tex]x+y=-3\\x+0 = -3\\x = -3[/tex]

Putting x=0

[tex]x + y = -3\\0+y=-3\\y=-3[/tex]

8. X - 3y = 12

Putting y=0

[tex]x - 3(0) = 12\\x -0 = 12\\x = 12[/tex]

Putting x = 0

[tex]0-3y = 12\\-3y = 12\\\frac{-3y}{-3} =\frac{12}{-3}\\y=-4[/tex]

Keywords: Linear equation

Learn more about linear equations at:

brainly.com/question/2150928brainly.com/question/2154850

#LearnwithBrainly

suppose that 17 inches of wire costs 51 cents. at the same rate, how much ( in cents ) will 33 inches of wire cost?

Answers

[tex]\bf \begin{array}{ccll} inches&cents\\ \cline{1-2} 17&51\\ 33&x \end{array}\implies \cfrac{17}{33}=\cfrac{51}{x}\implies 17x=33\cdot 51\implies x = \cfrac{33\cdot 51}{17} \\\\\\ x = 33\cdot \cfrac{51}{17}\implies x = 33\cdot 3\implies x = 99[/tex]

Final answer:

To find the cost of 33 inches of wire, we calculate the cost per inch from the given 17 inches costing 51 cents, which is 3 cents per inch, and then multiply by 33 inches to get a total cost of 99 cents.

Explanation:

The student is asking to determine the cost of 33 inches of wire based on the given rate of 17 inches costing 51 cents. To solve this, we can set up a proportion where we compare the given inches of wire to the given cost and then find the cost for the desired inches of wire.

Step-by-Step Calculation:

First, we determine the cost per inch of wire by dividing the total cost by the total length of wire: 51 cents ÷ 17 inches = 3 cents per inch.

Next, we multiply the cost per inch by the desired length of wire to find the total cost: 3 cents/inch × 33 inches = 99 cents.

Therefore, 33 inches of wire will cost 99 cents at the same rate.

Solve x2 – 8x = 3 by completing the square. Which is the solution set of the equation?

(4 minus StartRoot 19 EndRoot comma 4 + StartRoot 19 EndRoot)
(4 minus StartRoot 11 EndRoot comma 4 + StartRoot 11 EndRoot)
(4 minus StartRoot 8 EndRoot comma 4 + StartRoot 8 EndRoot)
(4 minus StartRoot 3 EndRoot comma 4 + StartRoot 3 EndRoot)

Answers

Answer:

x = 4 ± [tex]\sqrt{19}[/tex]

Step-by-step explanation:

Given

x² - 8x = 3

To complete the square

add ( half the coefficient of the x- term )² to both sides

x² + 2(- 4)x + 16 = 3 + 16

(x - 4)² = 19 ( take the square root of both sides )

x - 4 = ± [tex]\sqrt{19}[/tex] ( add 4 to both sides )

x = 4 ± [tex]\sqrt{19}[/tex], that is

x = 4 - [tex]\sqrt{19}[/tex], 4 + [tex]\sqrt{19}[/tex]

Final answer:

The solution set for the quadratic equation x² - 8x = 3 is found by completing the square, resulting in (4 - √19, 4 + √19).

Explanation:

To solve the quadratic equation by completing the square, we start with x² – 8x = 3. First, we move the constant term to the other side of the equation:

x² – 8x + ____ = 3 + ____

Now we need to find a number to fill in the blanks that makes the left side a perfect square trinomial. To do this, take half of the coefficient of x, which is -8/2 = -4, and then square it, which gives us 16. Add 16 to both sides:

x² – 8x + 16 = 3 + 16

x² – 8x + 16 = 19

The left side is now a perfect square, (x – 4)² = 19. Taking the square root of both sides gives us:

x – 4 = ±√19

Add 4 to both sides to solve for x:

x = 4 ±√19

Therefore, the solution set for the equation x² – 8x = 3 is (4 – √19, 4 + √19).

Which expression is equivalent to the given expression? 2(3a+2b−7) ​




A 5a+4b−5

B 6a+2b−7

C 6a+4b−7

D 6a+4b−14

Answers

The expression which is equivalent to the given expression; 2(3a+2b−7) is; 6a +4b -14

Equivalent expressions

The given expression is;

2(3a+2b−7)

Upon expansion by multiplying all elements in the parenthesis by 2; we have;

2(3a+2b−7) = 6a +4b -14

Read more on equivalent expressions;

https://brainly.com/question/2972832

Final answer:

By distributing the 2 across each term in the expression 2(3a+2b-7), the equivalent expression is 6a + 4b - 14, which corresponds to answer choice D.

Explanation:

To determine which expression is equivalent to 2(3a+2b-7), we need to distribute the 2 across each term in the parentheses. This means we'll multiply 2 by 3a, 2b, and -7 separately. Here's the step-by-step distribution:

2 × 3a = 6a2 × 2b = 4b2 × -7 = -14

Combining these results, we get the equivalent expression: 6a + 4b - 14, which matches answer choice D.

What is the length of segment A.B.

Answers

Answer:

The distance between A and B is l(AB) = 13 units

Step-by-step explanation:

Given:

let,

A ≡ ( x1, y1 ) ≡ ( 0, 12 )

B ≡ ( x2, y2 ) ≡ ( 5, 0 )

To Find:

Length AB = ?

Solution:

Distance Formula for the distance between the two points ( x1, y1 ) and ( x2, y2 ) we have,

[tex]l(AB) = \sqrt{((x_{2}-x_{1})^{2}+(y_{2}-y_{1})^{2} )}[/tex]

On substituting the above values we will get,

[tex]l(AB) = \sqrt{((5-0)^{2}+(0-12)^{2} )}\\l(AB)=\sqrt{(5^{2} +(-12)^{2} } \\l(AB)=\sqrt{(25+144)}\\ l(AB)=\sqrt{169} \\l(AB)=13\ unit[/tex]

Therefore the distance between A and B is l(AB) = 13 units

x² + 4x + 3
How is this solved step by step it needs to be in factored form

Answers

Do c=b meaning that you need to number that multiply to c but the sum of those numbers give u the value of b. The answer would be (x+3)(x+1) because both are positive.

Answer:

[tex]\large\boxed{x^2+4x+3=(x+3)(x+1)}[/tex]

Step-by-step explanation:

[tex]x^2+4x+3\\\\\text{We are looking for a and b, for which a + b = 4 and (a)(b) = 3}\\\\\text{a=3,\ b=1}\\\\=x^2+3x+1x+3\qquad\text{use the distributive property:}\ a(b+c)=ab+ac\\\\=x\underbrace{(x+3)}_{(*)}+1\underbrace{(x+3)}_{(*)}\qquad\text{use the distributive property}\\\\=\underbrace{(x+3)}_{(*)}(x+1)[/tex]

Other Questions
Vectors such as pUC18 and others of the pUC series contain a large number of restriction enzyme sites clustered in one region. Which term describes this advantageous arrangement of restriction sites? How do you think the Gilded Age and Progressive Era will change the country after Reconstruction? Which example describes biological evolution?a.Over time, a caterpillar species becomes as green as the leaves it eats.b.The average woman's dress size has increased over the last 50 years.c.You are vaccinated against polio and are protected against the disease.d.A tree branch is broken off and another grows in its place. Knowing his last days were near, Harrison chose to die at home. He was clear-minded during his final hours, allowing him to review his life and say farewell. Like Harrison, about 20 percent of people experience a gentle death. about 25 percent of people experience a long and drawn-out death. most Americans die at home. most people experience a quick, agony-free death. In which circumstances is a person most likely to be entranced?Awhen watching a beautiful sunsetB. when hearing a window break in a stormC. when looking for a lost walletD. when saying goodbye to old friends A survey questioned 1000 people regarding raising the legal drinking age from 18 to 21. Of the 540 who favored raising the age, 390 were female. Of the 460 opposition responses, 130 were female. If a person selected at random from this group is a man, what is the probability that the person favors raising the drinking age? Which of the following is NOT a political right? what is the slope for (12,5) (9,8) I need help putting these sentences in present progressive form. pleeeease help me1. Nosotros / practicar deportes2. Carmen / comer en casa3. Nuestro equipo / ganar el partido4. Yo / leer el peridico5. l / pensar comprar una bicicleta roja6. Ustedes / jugar a las cartas7. Jos y Francisco / dormir8. Marisa / leer el correo electrnico9. Yo / preparar sndwiches10. Carlos / tomar fotos11. dormir / t? A product modification differs from a line extension in that _______. The U.S. Congress enacted the CAN-SPAM Act in 2003. This act: a. limits advertisers from sending more than one ad per month per email address. b. does not view sending multiple spam emails with the use of a hijacked computer as an offense. c. prohibits the use of false or misleading subject lines on emails used for advertising. d. requires spammers to register with the Federal Trade Commission. All of the following statements are consistent with the kinetic molecular theory of gases EXCEPT: A. The gas molecules collide with each other and with the surfaces around them.B. Strong attractive forces hold the gas molecules together. C. The average kinetic energy of the molecules of a gas is proportional to the temperature of the gas in kelvins. D. The size of the gas molecules is negligible compared to the total volume of the gas. E. none of the above. What is a non-example of unit rate 14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line