in 35 days a person saved $70 what was the person's average daily savings

Answers

Answer 1
take the $70 and divide it by 35days. answer is $2 daily
Answer 2

The person's average daily savings is $2.00. The correct answer is option b $2.00.

Step 1

To find the average daily savings, we need to divide the total amount saved by the number of days over which the savings occurred.

Calculation:

1. Total savings: $70

2. Number of days: 35 days

Step 2

The average daily savings is calculated as:

[tex]\[\text{Average daily savings} = \frac{\text{Total savings}}{\text{Number of days}} = \frac{70}{35} = 2\][/tex]

The person's average daily savings is $2.00.

Complete question : In 35 days, a person saved $70. What was the person's average daily savings?

a $0.70

b $2.00

c $1.50

d $1.05

e $2.33

f none of these


Related Questions

Let n be a nonzero integer. find a domain on which f (x) = (1 − xn)1/n coincides with its inverse. hint: the answer depends on whether n is even or odd.

Answers

I believe that the correct equation given is:

f(x) = (1-x^n)^(1/n)

 

From this, we can say that:

 

When n is an odd number then f(x) is cubic root function. The domain is (-infinite, +finite) 
When n is an even number then f(x) is sqrt root function. The domain is (0, +finite) 

Solve x + 9 = 18 - 2x

Answers

Add 2x to both sides,
3x+9=18
Subtract 9 from both sides. 3x=9
Divide both sides by 3. 
x=3

The solution to the equation x + 9 = 18 - 2x is x = 3.

What is the solution to the equation?

Given the equation in the question:

x + 9 = 18 - 2x

To solve the equation x + 9 = 18 - 2x, first, collect and combine the x terms on one side of the equation and the constant terms on the other side:

x + 9 = 18 - 2x

Add 2x to both sides of the equation:

x + 2x + 9 = 18 - 2x + 2x

x + 2x + 9 = 18

3x + 9 = 18

Subtract 9 from both sides of the equation:

3x + 9 - 9 = 18 - 9

3x = 18 - 9

3x = 9

Isolate x by dividing both sides by 3:

x = 9/3

x = 3

Therefore, the value of x is 3.

Learn more about equations here: brainly.com/question/14686792

#SPJ6

Which equation best represents the line graphed above?

Answers

x=2 because for any y value the x value is always 2
the answer is y=2. i hope it helps

Which of the following lines goes downwards from left to right?
A. Y=2x+5 b. Y=2x-6
C. Y=2x d. Y=-2x+20

Answers

"Goes downwards from left to right" is basically saying that the slope of this line is negative. We go downhill from left to right. 

y = 2x+5 has a positive slope because m = 2 is the slope (b = 5 is the y intercept)
So choice A is out

Similarly choice B is eliminated as well because the slope is also m = 2

Choice C is false as well. The slope here is m = 2 (think of y = 2x as y = 2x+0)

The only choice with a negative slope is choice D. The slope is m = -2 

This is why the answer is choice D

Side Note: I'm using slope intercept form y = mx+b where m is the slope and b is the y intercept

¿A Sandra qué le gusta hacer los viernes?

A A Sandra le gusta comer papas fritas los viernes.

B A Sandra le gusta comer agua los viernes.

C A Sandra le gusta beber pizza los viernes.

D A Sandra le gusta beber galletas los viernes.

Answers

I think the answer is A it makes the most sense. 
A states that "Sandra likes to eat fries on fridays."

B states that Sandra likes to eat water on fridays? (makes no sense)
C states that Sandra likes to drink pizza on fridays? (again makes no sense)
D states that Sandra likes to drink cookies on fridays? (NO SENSE)
Best answer choice is A.
La respuesta correcta es A: A Sandra le gusta comer papas fritas los viernes. Es el unico respuesta que es lógico. La traducción para la frase es: Sandra likes to eat french fries on Friday. 

A sealed rectangular box measuring 8 x 6 x 18 contains 864 sugar cubes, each measuring 1 x 1 x 1. How many sugar cubes are touching the box?

Answers

Final answer:

A total of 456 sugar cubes touching the box.

Explanation:

To calculate the number of sugar cubes touching the box, we must consider the cubes that lie along each face of the box without double-counting the cubes that touch corners and edges.

The box dimensions are 8 x 6 x 18 inches, and each sugar cube is 1 x 1 x 1 inch.

For the top and bottom faces (6 x 18), we have

6*18 = 108 sugar cubes touching the box on each face, totaling 216 for both the top and bottom.

For the front and back faces (8 x 18), since we must exclude the top and bottom rows, we have

(8-2) x (18-2) = 6 x 16 = 96 sugar cubes for one face and 192 for both.

For the sides (8 x 6), excluding the top and bottom rows again, we have

(8-2) x (6-2) = 6 x 4 = 24 sugar cubes on one side and 48 in total for the two sides.

Adding all these together, we get 216 (top and bottom) + 192 (front and back) + 48 (sides) = 456 sugar cubes touching the box.

Remember, this method assumes a single layer of sugar cubes is in direct contact with the inside surface of the box.

What is the smallest number greater than 100 that is :
a)divisible by two ?
b)divisible by ten?
c)divisible by four ?

Answers

I'd start by listing out the multiplies of all three past 100, like this:
102, 104, 106, 108, 110, 112, 114, 116, 118, 120, 122, 124, 126, 128, 130
104, 108, 112, 116, 120, 124, 128, 132, 136
110, 120, 130, 140
Now it's just a matter of finding the number that is the same for all three of them, which is 120.

The smallest number greater than 100 divisible by 2 is 102, divisible by ten is 110, divisible by four is 104.

What is Divisibility Test?

It is an easy method of determining the divisibility of a number by a particular divisor, by just observing the number and not actually dividing it.

The number is 100

A smallest number greater than 100 has to be found which is divisible by 2.

All even numbers are divisible by 2, a number which has 0, 2, 4, 6, 8 at its ones position are divisible by 2.

The smallest number from 100 which is divisible by 2 is 102.

A smallest number greater than 100 has to be found which is divisible by 10.

A number is divisible by 10, if it has 0 at its ones position.

The number after 100 which has 0 at its ones position is 110.

A smallest number greater than 100 has to be found which is divisible by 4.

If last two digit of a number forms 00 or are divisible by 4, then the number is divisible by 4.

The smallest number from 100 which is divisible by 4 is 104.

To know more about Divisibility Rule

https://brainly.com/question/10703980

#SPJ5

A measurement is given as the length of an onion cell is 0.4mm to the nearest tenth of a millimeter. Find the minimum & maximum possible measurements

Answers

The least number which approximates to 0.4mm to the nearest tenth is 0.35 while the largest number which approximates to 0.4mm to the nearest tenth is 0.449

Therefore, the minimum & maximum possible measurements are 0.35 and 0.449 respectively.
0.35mm-0.45mm The actual length of the onion cell must be something that rounds to .4mm. Anything lower than 0.35mm would be closer to .3mm and anything over .45 would be closer to .5mm.

Solve for x.

7(x - 3) = 4(x + 5)

Answers

7(x-3) = 4(x+5)

distribute:

7x-21 = 4x+20

add 21 to both sides

7x = 4x +41

subtract 4x from both sides

3x = 41

divide both sides by 3

x = 41 /3 = 13.67 ( repeating 6's) so it can be 13 2/3 as a fraction

the answer is 13 2/3



If the decay of 742 mg of an isotope is described by the function A(t)= 742e-0.03t, where t is time in years. Find the amount left after 84 years. Round your answer to the nearest mg. 

Answers

57.701 mg before rounding

Answer:

The amount left after 84 years is 59.70 mg.                        

Step-by-step explanation:

Given : If the decay of 742 mg of an isotope is described by the function [tex]A(t)= 742e^{-0.03t}[/tex], where t is time in years.

To find : The amount left after 84 years?

Solution :

The function of decay of 742 mg of an isotope is given by,

[tex]A(t)= 742e^{-0.03t}[/tex]

We have to find the amount left after 84 years.

i.e. put t=84 in the given function,

[tex]A(84)= 742e^{-0.03\times 84}[/tex]

[tex]A(84)= 742e^{-2.52}[/tex]

[tex]A(84)= 59.701[/tex]

Therefore, The amount left after 84 years is 59.70 mg.

Terry bought 2 1/2 dozen chocolate chip cookies. She paid $15 for her purchase. If there were 12 cookies in each dozen, what was the cost per cookie?


$0.17


$0.83


$1.25


$0.50

Answers

Your answer Is $0.50 have a nice day my friend 

Antonio purchased adult and child tickets for the fair. Tickets cost $29.35 for each adult and $17.45 for each child. Let x represent the number of adult tickets purchased and y represent the number of child tickets purchased. Write an expression to represent the total cost of the tickets Antonio purchased.


$29.35y + $17.45x

$29.35x + $17.45y

($29.35 + $17.45)(x + y)

($29.35 - $17.45)(x + y)

Answers

The Correct Answer for your problem is: B

29.35x + 17.45y Is the correct selection. 

What is the slope of a line that is perpendicular to the line that goes through (5,4) and (-2,-3)?

Answers

First, let us solve for the slope of the line which it intersects with:

m’ = (y2 – y1) / (x2 – x1)

m’ = (-3 – 4) / (-2 – 5)

m’ = 1

 

The slope of the perpendicular line is the negative reciprocal, therefore:

m = - 1 / m’

m = - 1 / 1

m = -1

 

So the slope of the line is -1.

find f(-5) if f(x) = ???????

Answers

f(x) = Ιx+1Ι

x = -5

Ι-5Ι = 5

so equation is 5+1

answer is 6

I brought 1 1/4 lbs of grapes. 2 1/2 lbs of cherries and 2lbs of bananas. How much total pounds of fruit did i buy?

Answers

First, add the whole numbers together:
1 + 2 + 2 = 5
Now, add the fractions together:
1/4 = 2/8
1/2 = 4/8
2/8 + 4/8 = 6/8 or 3/4
Add your two amounts together to get:
5 3/4 lbs of fruit

Hope this helps!! :)
1 + 2 + 2 = 5

1/4 + 1/2

1/4 + 2/4 = 3/4

The answer will be 5 3/4

Hope I helped

To which graph does the point (8, −2) belong?

Answers

When you're given a list like that, the easiest way to find the answer is to just test the point in each one! Plug in -2 for y and 8 for x, and see which of the inequalities those values satisfy.

identify the like terms 3x,4y,4z,5x

Answers

the like terms are 5x and 3x because they both are apart of the x family !

Does believing in god increases the probability that god does exist

Answers

No.

If he exists then he does. More or less people "believing" doesn't change a fact.

It's like how we can't see all colors and other creatures can see "more" colors than us; and then having us claim they don't exist. Whether we decide to believe there's more colors we can't see or not will not change the fact of whether there IS or ISNT.

KInda if you love him then he loves personally i dont believe in him but thats everyone decision

What's 4.50+4.50+2.39+2.39+1.99? What's the answer minus 25?? pls halp meh '-'

Answers

4.50+4.50=9.00=9
+
2.39+2.39=4.78
+
1.99
=
15.77

15.77-25=-9.23

Jeffrey is planning to tile his bathroom. He is taking measurements before he goes to the hardware store to buy the tile. What is the best unit of measure for Jeffrey to use?

Answers

Square feet because it is an ideal unit to measure rooms.

Answer:

i think the answer would be square feet

Step-by-step explanation:


Please help!
This graph shows the amount of rain that falls in a given amount of time.


What is the slope of the line and what does it mean in this situation?


Select from the drop-down menus to correctly complete each statement

The slope of the line is ___

This means that ___ mm of rain falls every ___

Answers

the slope is 5/2. count up 5 then go right 2. this means that 5 mm of rain falls every 2 hrs

To find the slope, we use the formula for slope,

[tex]m=\frac{y_{2}-y_{2}} {x_{2}-x_{1}}[/tex]

Letting the point (2,5) be [tex](x_{1},y_{1})[/tex] and the point (4,10) be [tex](x_{2},y_{2})[/tex].

Now plugging in these values in the formula for slope, we get,

[tex]m=\frac{10-5}{4-2} =\frac{5}{2}[/tex]. The slope is [tex]\frac{5}{2}[/tex].

This basically means 5 mm of rain falls in every 2 hours, or 2.5 mm of rain falls every hour ([tex]\frac{5}{2} =2.5[/tex])


ANSWER: Slope is [tex]\frac{5}{2}[/tex] and 5 mm of rain falls every 2 hours.

Solve and justify each step
SHOW WORK

Solve: -4(n+5)>3n+8

Answers

-4n-20>3n+8

-7n-20>8

-7n<28
n<-4

What is the expanded equivalent of cos(a – b)?

Answers

cos A cos B - sin A sin B
That should be your answer  Hope this helps

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770

A rabbit lure on a greyhound racetrack is set to travel once around the track at 50 feet per second, and then its speed is increased to 65 feet per second for the second loop around the track. If the total time it takes for the lure to go around the track twice is 184 seconds, what is the distance once around the track?

Answers

184 sec = Circumference / 50 fps + Circumference / 65 fps 
184 = 65 Circumference/3250 + 50 Circumference/3250 
184 = 115 Circumflex/3250 
598000 = 115 Circumflex 
Circumflex = 5200 ft
the answer would be 5200ft

Lyle shot three times as many baskets as cliff, while kyle shot 12 more baskets than cliff. if lyle and kyle shot the same number of baskets, how many baskets did each of them shoot?

Answers

Final answer:

Cliff shot 6 baskets, Lyle shot 18 baskets, and Kyle also shot 18 baskets.

Explanation:

Let's represent the number of baskets Cliff shot as C.

Lyle shot three times as many baskets as Cliff, so Lyle shot 3C baskets.

Kyle shot 12 more baskets than Cliff, so Kyle shot C + 12 baskets.

Since Lyle and Kyle shot the same number of baskets, we can set their expressions equal to each other: 3C = C + 12.

Solving this equation, we find that C = 6.

Therefore, Cliff shot 6 baskets, Lyle shot 3C = 3(6) = 18 baskets, and Kyle shot C + 12 = 6 + 12 = 18 baskets.

Learn more about mathematics here:

https://brainly.com/question/27235369

#SPJ12

what is the value for x (5x+15) (3x-3)

Answers

Final answer:

The value of x in the expression (5x+15) (3x-3) is 15x^2 + 30x - 45.

Explanation:

The expression (5x+15) (3x-3) represents the multiplication of two binomials. To find the value of x, we can use the distributive property to simplify the expression:

Multiply the terms within the first set of parentheses: 5x * 3x = 15x^2.Multiply the terms within the second set of parentheses: 5x * -3 = -15x.Multiply the terms between the parentheses: 15 * 3x = 45x.Multiply the constant terms within the parentheses: 15 * -3 = -45.

Putting it all together, we have 15x^2 - 15x + 45x - 45. Combining like terms, the expression simplifies to 15x^2 + 30x - 45.

So, the value for x in the given expression is 15x^2 + 30x - 45.

2x7+2 ?
What does x =

Answers

The x is the variable so you have to find what the equation equals in order too find out what variable x is.  2 x7+2 = 16. So now x = 16

A rental car service charges $25 to rent a car, plus $2 per mile. If x represents the number of miles driven, then the expression for the total cost to rent the car is 2x + 25. Which table shows the total cost to rent a car?

Answers

2x + 25 represents the equation for total cost with a variable of how far you drive.

Triangle A′B′C′ is the image of triangle ABC after a dilation. What is the scale factor of the dilation?

Answers

Unfortunately, I can't really explain it that well, but AB is 6, and A'B' is 2.
6 / 3 = 2
BC is 3, and B'C' is 1.
3 / 3 = 1
Therefore the dilation factor would be 1/3.

Hope this helps! :)

What is the numerator of the fraction equivalent to 25/135 that has a denominator of27

Answers

It's 5 because 5/27 is equal to 25/135
Other Questions
In mosses, the green, leafy portion represents which generation in the alternation of generations? haploid sporophyte diploid gametophyte haploid gametophyte diploid sporophyte haploid spore The definition is the ability of the body to carry out physical task with out becoming overly tired A _____ cost occurs when the amount used varies based on the volume of service provided. The equation below shows the total volume (V),in cubic units, of 2 identical boxes with each side equal to s units:V = 2s3If s = 3.5 units, what is the value of V?A: 21.0 cubic unitsB: 24.5 cubic unitsC: 36.75 cubic unitsD: 85.75 cubic units Car 6 truck 10 suv 14 minivan 15 at this rate how many trucks would pass Luann if 90 vehicles passed her? what drug causes overactive eye movement The supreme court has ruled that a. flag burning is not symbolic speech.b. symbolic speech is always protected.c. symbolic speech is not protected when it is most likely to inspire fear of bodily harm.d. symbolic speech is never protected. What was the constitution that some puritan colonists wrote to govern themselves? Which visual aid is best used for percentages?bar graphline graphpictographpie chart An object is projected horizontally at 8.0 m/s from the top of a 122.5 m cliff. how far from the base of the cliff will the object strike the ground? The speed of a wagon increases from 2.5 meters per second to 9.0 meters per second in 3.0 seconds as it accelerates uniformly down a hill. What is the magnitude of the acceleration of the wagon during this 3.0 second time interval? Someone relying on divergent thinking would answer _____ to the query "what can you do with a pencil?" what type of biomolecule is starch? describe what it looks like structurally Calculus: Help ASAPEvaluate the integral of the quotient of the secant squared of x and the square root of the quantity 1 plus tangent x, dx. More than half of which climate type averages between 40 and 59 inches of precipitation a year? Fill in the blank with the correct indirect object pronoun. A Florencia_____queda un ao para graduarse.LesLeOsTe Item 9Evaluate (31)3+7(6)52(31)3+7(6)52. All real numbers that are less than -3 or greater than it equal to 5 According to johnston and pennypacker's definition of behavior, why is "waiting for someone" not a behavior? Does this figure have rotational symmetry?A)No, pentagons cannot be rotated.B)No, it has five lines of symmetry.C)Yes, it has five lines of symmetry.D)No, it only looks the same if it is rotated 360.