In fruit flies, gray bodies (G) are dominant over black bodies (g), and red eyes (R) are dominant over orange eyes (r). Each individual possesses two alleles for each trait. If a fly that is homozygous dominant for both traits is crossed with a fly that is homozygous recessive for both traits, what is the predicted genotype of the offspring?

Answers

Answer 1

Answer:

The predicted genotype of the offspring is GgRr.

Explanation:

The gray body is dominant over black body. The genotype of gray body is GG and the genotype of black body is gg. Red eyes are dominant over orange eyes. The genotype for red eye is RR whereas the genotype of orange eye is rr.

GGRR is crossed with ggrr, the offspring produced by this cross is GgRr with gray body and red eyes.

GGRR  ×   ggrr

 GgRr.

Answer 2

In a cross between a homozygous dominant fruit fly and a homozygous recessive fruit fly, all offspring will have the heterozygous genotype GgRr. For X-linked traits, such as eye color in fruit flies, offspring ratios differ and are specific to whether the male or female expresses the recessive trait. These genetic principles also apply to human genetics.

Predicted Genotype of Offspring in a Fruit Fly Cross When a fruit fly that is homozygous dominant for both gray body and red eye traits (GGRR) is crossed with a fly that is homozygous recessive for both traits (ggrr), all the offspring will inherit one dominant and one recessive allele for each trait. Therefore, the predicted genotype of the offspring will be heterozygous for both traits (GgRr). This outcome is due to simple Mendelian inheritance, where each parent contributes one allele for each trait to their offspring. In the case of X-linked eye color traits, when a white-eyed male (XwY) is crossed with a female that is heterozygous for red eye color (XWXw), the offspring's eye color ratios can be predicted. The male offspring will have either red (XWY) or white (XwY) eyes, depending on whether they inherit the X chromosome carrying the dominant or recessive allele. The female offspring will all have red eyes since they will get the dominant XW allele from the mother and can only inherit the Y chromosome from the father. These principles are not only applicable in studying fruit fly genetics but also have implications in understanding human genetics, especially for X-linked conditions such as color blindness, hemophilia, and muscular dystrophy.


Related Questions

What does the interneuron do between the afferent and efferent neurons?

Answers

Answer:

Interneurons enable the communication between afferent and efferent neurons.  

Explanation:

Internerons are also known as relay neuron. These neurons are classified into local neuron and relay neuron. Interneurons are involved in the process of reflex action and neurogenesis.

Interneurons are known to create neural circuits between the afferent and efferent neuron. This circuit helps in communication and transfer the information between afferent and efferent neurons.

The sympathetic and parasympathetic nervous systems are divisions of which system?

Answers

Answer:

The correct answer is The autonomic nervous system (ANS).

Explanation:

The autonomic nervous system (ANS) controls the internal region of the human body. This type of nervous system takes information to the central nervous system which controls the internal parts like the gut, the heart by releasing noradrenaline and adrenalin from the adrenal gland and other.

The ANS has 2 divisions which are the parasympathetic division and the sympathetic division -

The sympathetic division can be defined as stress neurons or fight or flight neurons because it makes the body ready to prevent it from the impact of the injury.

The parasympathetic division function to recover and replace the activities of living. It has an antagonist effect in comparison to what sympathetic division does.

Thus, The correct answer is The autonomic nervous system (ANS).

Final answer:

The sympathetic and parasympathetic nervous systems are parts of the autonomic nervous system, which helps regulate the body's involuntary functions, maintaining homeostasis.

Explanation:

The sympathetic and parasympathetic nervous systems are divisions of the autonomic nervous system, which is a part of the peripheral nervous system. The sympathetic nervous system is responsible for the body's "fight-or-flight" response during stressful situations, whereas the parasympathetic nervous system promotes the "rest-and-digest" state during times of calm. These systems work together to maintain the body's homeostasis, or internal balance, by regulating internal organ function and processes.

Imagine you are a lawyer representing a man with blood type B. A woman with blood type O has a child with blood type A and is proposing that the man fathered the child. Using what you have learned about blood typing and genetics, construct an engaging evidence-based argument to the jury in defense of your client.

Answers

Answer:

Both type A and B blood are Dominate types and O is recessive. So the mother would Have to be oo and couldn't pass on an A and The man cant pass on an A because Type B blood can only be found as BB or Bo. This is due to A and B both being Dominate the would end up as AB not just A/B

Answer:

Both type A and B blood are Dominate types and O is recessive.

Explanation:

Which of the following is (are) not the function (s) of the skeletal system: support, storage of minerals, strength, or production of blood cells (hematopoiesis)?

Answers

Answer:

strength

Explanation:

Skeletal system of the human body has 206 bones. Human skeleton is divided into appendicular skeleton and axial skeleton.

The skeletal system provide support to the other parts of body, chemicals like calcium are stored in the skeletal system and red bone marrow is the site of hematopoiesis. The skeletal system doesnot provide strength because muscles are mainly involved in providing strength to the body.

Thus, the correct answer is option (3).

True-breeding flies with red eyes and long wings were crossed to flies with white eyes and miniature wings. All F1 offspring had red eyes and long wings. The F1 females flies were then crossed to males with white eyes and miniature wings. The following results were obtained for the F2 generation:
204 red eyes, long wings
208 white eyes, miniature wings
40 red eyes, miniature wings
48 white eyes, long wings
What is the map distance between these two genes?

Answers

Answer:

176m.u.

Explanation:

Map distance can be calculated by the following formula:

Map distance = [tex]\frac{\text{Recombinant off spring}}{\text{total number of offspring}}\times 1000[/tex]

Recombinant offsprings are redeyes, miniature wings + white eyes, long wings.

Recombinant offspring = 40 + 48

=88.

Total number of offspring = 204 + 208 + 40 + 48

= 500

Map distance = [tex]\frac{88}{500}\times1000[/tex]

Map distance = 176 m.u.

The map distance between two genes is 176 m.u.

Compare parasympathetic and sympathetic nervous system

Answers

Answer:

The ANS ( Autonomous nervous system) is divided to PNS (parasympathetic nervous system) and SNS (sympathetic nervous system).

Explanation:

The PNS maintains homeostasis and digestive response. The SNS involves fight and flight response. The SNS releases adrenaline. PNS do not involve any secretion of adrenal gland. The PNS relaxes the  muscular system, The SNS allows muscles contraction. The PNS decreases heart rate. The SNS increases heart rate.  

Sometimes, two atoms of the same element have different numbers of neutrons. What is this known as? Valence electrons Orbits Radiation Isotopes

Answers

They are isotopes!
Good day

Answer:

Isotopes

Explanation:

Atoms of the same element sometimes have different forms just as we have plants of the same species having different varieties. These atoms usually have the same number of protons in their nuclei but different number of neutrons. They are referred to as isotopes.

A good example of atoms of the same element having different number of neutrons is [tex]^1^4C[/tex] and [tex]^1^2C[/tex]. Both atoms have 6 protons but while the latter has 6 neutrons, the former has 8 neutrons.

Valence electrons, orbits and radiation do not come close as atoms of the same elements with different neutrons.

The correct answer is Isotopes.

Explain the possible problems associated with the high diastolic pressure.

Answers

Answer:

High diastolic pressure can leads to kidney damage, vision less and chronic renal failure.

Explanation:

Diastolic pressure may be defined as the blood pressure in the arteries when the heart is completely filled. When the blood pressure is measured the lower value of blood pressure indicates the diastolic blood pressure.

Different problems associated with high diastolic pressure are:

Kidney damage: The high blood pressure can cause the narrow areteies around the kidney and may result in kidney damage.

Vision less: The blood vessel may damage in high diastolic pressure that may hinder the blood flow in the retina and results in vision less.

Chronic renal failure: High diastolic pressure damages the renal artery and causes chronic renal failure in an individual.

Clostridium botulinum is a bacterium that produces the botulinum toxin. When locally applied, to parts of the face for example, neuromuscular transmission is blocked, and muscles that cause wrinkles cannot contract (no more wrinkles). How exactly does the toxin block nueromuscular transmissions?

Answers

Answer:

Botulinum is a toxin that can be used to cure wrinkles in human beings by injecting it in very small concentrations and it works in preventing the signals from the nerve cells to muscles and thus paralyzing them by stopping wrinkle formation.

Wrinkles are caused by the contraction of muscles and this neurotransmitter does not allows the muscles to contract. In order to contract nerves release a chemical messenger called as acetycholine. This neurotransmitter is found at the junction where the nerve cell reaches the muscle cell. This causes contraction of muscles.

Injecting botulinum prevents the release of acetylcholine which prevents the contraction of muscle, causing reduction in wrinkles and muscles become stiff.

The transition from an afferent arteriole to an efferent arteriole occurs in the

A. glomerulus.

B. medulla.

C. cortical radiate veins.

D. peritubular capillaries.

Answers

Answer: A. glomerulus.  

Explanation:

Each kidney has about 1 million nephrons, the urine-forming unit, and each nephron is made up of a glomerulus (capillaries walls) and renal tubules. The glomerular is constituted by the capillaries walls, which branch out and form a network, covered by the Bowman's capsule that retains the liquid, and begin to form a sequence of tubes.

The blood reaches the kidneys through the renal artery, which branches into the afferent arterioles that attach to the glomerular capillaries (where blood is filtrated), then form the efferent arteriole, which again becomes capillaries - the peritubular capillaries, which surrounds the renal tubules.

The single best indicator of one's ability to sustain high intensity aerobic exercise is:

a. Maximal oxygen debt

b. Maximal oxygen deficit

c. VO2 max

d. Maximal Ventilation

Answers

Maximal oxygen debt

The best indicator of one's ability to keep a high-intensity aerobic exercise is Maximal oxygen debt thus option A is correct.

What is the Max oxygen debt ?

The maximum actuated oxygen deficit is the measurement for the capacity for the anaerobic oxygen that is uptake. This refers to the predicted demand for the oxygen and the oxygen uptake measured during the extensive exercise. It is available for oxidative metabolism and develops at the time of intensive body activity.

Find out more information about the aerobic exercise

brainly.com/question/14375834.

The blood lactate threshold refers to:

a. the work rate or oxygen uptake where there is a systematic rise in aerobic metabolism

b. the work rate or oxygen uptake where there is a systematic rise in blood levels of lactic acid

c. the work rate or oxygen uptake where there is a systematic decrease in blood levels of lactic acid

d. all of the above are correct

Answers

Answer: b. the work rate or oxygen uptake where there is a systematic rise in blood levels of lactic acid

Explanation:

Currently, the anaerobic threshold is one of the most commonly used parameters, both as an indicator of physical performance capacity and training prescription, and there is evidence that performance in continuous and prolonged exercises correlates better with the anaerobic threshold than with maximum aerobic power. The anaerobic threshold can be understood as the point of imbalance between lactate production and removal (blood lactate threshold).

If an animal’s body temperature exceeds the set point, which of the following is NOT a mechanism for lowering body temperature?

Sweating

Vasodilation

Panting

Vasoconstriction

Answers

Answer:

Vasoconstriction

Explanation:

Vasoconstriction is a process in which blood vessels get narrowed or get constricted by the activities of small muscles present in the wall of the blood vessels. When blood vessels constrict, the flow of blood flow is slow down. This process is to conserve body heat. Thus, by vasoconstriction does not help the animal body to lower the increased body temperature. Whereas vasodilation, sweating, and panting lower body temperature if an animal’s body temperature exceeds the set point.

Which of the following statements is FALSE? Which of the following statements is FALSE? The difference in melting temperature between a saturated fatty acid and an unsaturated fatty acid with the same chain length is only a few degrees C. Some unsaturated fatty acids are liquid at physiological temperatures. Most types of fat in many animals is used in energy production. The longer the chain length of a saturated fatty acid, the higher the melting temperature.

Answers

Answer:

Option (1).

Explanation:

Saturated fatty acid may be defined as the fatty acid with the single bonds between the carbon atoms. The unsaturated fatty acid consist of double and triple bond in its structure.

The melting points differs between the saturated and unsaturated fatty acid. The saturated and unsaturated fatty acids have high difference in their melting point and this difference may changes as the double and triple bonds are increased or decreased in the fatty acid structure.

Thus, the correct answer is option (1).

Choose the event below that does not occur during apoptosis Choose the event below that does not occur during apoptosis rupture of the cell, releasing cytoplasmic contents. flipping phosphatidylserine to the outer leaflet of the plasma membrane. bleb formation. DNase fragmentation of DNA. formation of apoptotic bodies.

Answers

Answer:

Rupture of the cell, releasing cytoplasmic contents.

Explanation:

Rupture of the cell to release the cell content into the intercellular space occurs in necrosis. This event does not occur in apoptosis. Release of the cell content into the intercellular space in necrosis results in stimulation of inflammatory response. Apoptosis does not include inflammatory reaction and hence, the cells do not rupture to release their content.

Class ii mhc proteins are found on which of the following cell types?

Answers

Answer:

The answer to the question: Class II MHC proteins are found on which of the following cell types, would be: on macrophages and lymphocytes, particularly T-Cells.

Explanation:

MHC, or Major histocompatibility complex, is a very important part of the immune response that the body gives against an invading pathogen, or other foreign substances. There are three types in the human body, Class I, Class II and Class III and each of them will play a role on the cellular membrance of different types of cells and mediate different types of responses. In the human body, this histocompatibility complex is best known as HLA, or human leukocyte antigen, and it will ensure the recognition, or non-recognition of substances, tissues, and other organisms, by the human immune system. Class II, as mentioned before, are most usually found on the immune cells macrophages and lymphocytes, and they are the ones responsible for presenting antigens to these proteinic antibodies so that the immune cells can initiate a proper immune response.

Final answer:

Class II MHC proteins are present on professional antigen-presenting cells such as macrophages, dendritic cells, and B cells.

Explanation:

Class II MHC proteins are found on a specific group of cells within the immune system known as professional antigen-presenting cells. These include macrophages, dendritic cells, and B cells. Unlike MHC I molecules that are found on all nucleated cells, MHC II molecules play a crucial role in the adaptive immune response by presenting abnormal or nonself pathogen antigens to T cells, leading to their activation.

Which of the following statements is true regarding water as a substance?

Answers

Hey buddy, you forgot to show the statements

Answer:

show the statements

Explanation:

You exhale about .0800 liters of CO2 (carbon dioxide) gas in a single breath. 22.4 liters of CO2 contain 6.022 x 1023 molecules. 6,022 x 1023 CO2 molecules have a mass of 44.0 grams. Find the A) number of carbon dioxide molecules you exhale in each breath. Find the mass of the CO2 you exhale in a single breath.

Answers

Answer:

A) [tex]2.150 * 10^{22}[/tex]

B) 1.57 grams

Explanation:

Given -

Amount of gas exhaled in one single breathe [tex]= 0.080[/tex] liters

[tex]22.4[/tex] liter of carbon dioxide contains [tex]6.022 * 10^{23}[/tex] molecules

One liter of carbon dioxide contains [tex]= \frac{6.022*10^{23}}{22.4}\\= 2.688 * 10^{23}[/tex]

A) Number of molecules in [tex]0.08[/tex] liter of carbon dioxide [tex]= 0.08 * 2.688 * 10^{23}\\= 2.150 * 10^{22}[/tex]

B) Mass of [tex]6.022 * 10^{23}[/tex] molecules is equal to [tex]44[/tex] grams

Mass of one molecule [tex]= \frac{44}{6.022*10^{23}} \\= 7.306*10^{-23}\\[/tex]

Mass of molecule is[tex][tex]7.306*10^{-23} * 2.150 * 10^{22}\\= 1.57\\[/tex][/tex]  gram

Taking into account the rule of three:

the number of carbon dioxide molecules you exhale in each breath is 2.15×10²¹.the mass of the CO₂ you exhale in a single breath is 0.157 grams.

Rule of three

In first place, the rule of three is a way of solving problems of proportionality between three known values and an unknown value, establishing a relationship of proportionality between all of them.

That is, what is intended with it is to find the fourth term of a proportion knowing the other three.  

If the relationship between the magnitudes is direct, that is, when one magnitude increases, so does the other (or when one magnitude decreases, so does the other) , the direct rule of three must be applied.

To solve a direct rule of three, the following formula must be followed, being a, b and c known data and x the variable to be calculated:

a ⇒ b

c ⇒ x

So: [tex]x=\frac{cxb}{a}[/tex]

Number of carbon dioxide molecules

To find the number of carbon dioxide molecules, you know that 22.4 liters of CO₂ contain 6.022×10²³ molecules.

If you exhale about 0.0800 liters of CO₂ (carbon dioxide) gas in a single breath, you can aply the following rule of three: if 22.4 liters of CO₂ contain 6.022×10²³ molecules, 0.0800 liters contain how many molecules?

[tex]amount of molecules=\frac{0.0800 litersx6.022x10^{23} molecules}{22.4 liters}[/tex]

amount of molecules= 2.15×10²¹

Finally, the number of carbon dioxide molecules you exhale in each breath is 2.15×10²¹.

Mass of the CO₂ you exhale in a single breath

To find the mass of the CO₂, you know that 6.022×10²³ molecules have a mass of 44.0 grams.

If you exhale about 2.15×10²¹ molecules of CO₂ (carbon dioxide) gas in a single breath, you can aply the following rule of three: if 6.022×10²³ molecules have a mass of 44.0 grams, 2.15×10²¹ molecules contain how much mass?

[tex]mass=\frac{2.15x10^{21}moleculesx44 grams }{6.022x10^{23} molecules}[/tex]

mass= 0.157 grams

Finally, the mass of the CO₂ you exhale in a single breath is 0.157 grams.

Learn more with this examples:

https://brainly.com/question/9833027?referrer=searchResults

https://brainly.com/question/11451896?referrer=searchResults

https://brainly.com/question/2321729?referrer=searchResults

Which of the following is NOT true of adaptation?

adaptations account for why organisms are suited to their way of life

adaptations account for why organisms can escape predators

natural selection causes adaptive traits to be increasingly represented in future generations

an adaptation evolves quickly, because it is necessary for survival

an adaptation takes many generations to evolve

Answers

Answer:

The correct answer will be option an adaptation evolves quickly, because it is necessary for survival .

Explanation:

Adaptation is a trait or feature which has been acquired by the organism by the changes in physiology, structure and behaviour which are more suited to the environment.

Adaptation is a pre-requisite of natural selection and evolution which enables the organism to survive and reproduce. Adaptation or an organism is not an instant response but to become permanent in a population adapted trait must be passed on to the generations that involve gene level.

Thus, option an adaptation evolves quickly, because it is necessary for survival is the correct answer.

The correct answer is: an adaptation evolves quickly, because it is necessary for survival.

Adaptations are traits that have evolved through natural selection to help organisms survive and reproduce in their specific environments. Here's the reasoning behind why each option is or isn't true:

1. Adaptations account for why organisms are suited to their way of life. This is true because adaptations are specific traits that enable organisms to survive and thrive in their particular habitats and lifestyles.

2. Adaptations account for why organisms can escape predators. This can be true because some adaptations, such as camouflage or the ability to run quickly, can help organisms avoid being eaten by predators.

3. Natural selection causes adaptive traits to be increasingly represented in future generations. This is true because individuals with advantageous traits are more likely to survive and reproduce, passing those traits on to their offspring.

4. An adaptation takes many generations to evolve. This is generally true because evolution is a gradual process that occurs over long periods of time. Adaptations develop through the accumulation of small genetic changes over numerous generations, rather than quickly.

The statement that is NOT true is:

5. An adaptation evolves quickly, because it is necessary for survival. This is not true because the evolution of an adaptation is typically a slow process. While the need for an adaptation can be immediate due to environmental pressures, the actual development of that adaptation through natural selection and genetic changes occurs incrementally over many generations.

Therefore, the option that is NOT true of adaptation is the idea that an adaptation evolves quickly simply because it is necessary for survival.

Farmers use fertilizers to improve crop growth which can impact the environment though agricultural runoff. What is agricultural runoff? Provide two examples of how farmers can prevent it.

Answers

This is the washing away of the topsoil (including agricultural chemicals applied in the soil) by surface runoffs into rivers and water bodies after precipitation.

Agricultural runoff can be prevented by adopting good farming management practices such as rotation farming to prevent loosening the topsoil such that it is easily eroded by runoffs. It can also be done by avoiding farming in floodway zones such as in the banks of rivers.

Agricultural runoff is water carrying pollutants like fertilizers from farmlands to water bodies, leading to eutrophication and 'dead zones'. To prevent this, farmers can use buffer strips and contour farming methods.

Agricultural runoff refers to water that collects and carries away various pollutants from agricultural lands into lakes, rivers, and oceans. This runoff can include excess fertilizers, containing nitrogen and phosphorus, which leads to eutrophication. Eutrophication is a process where excess nutrients stimulate excessive plant and algae growth, which, when they die and decompose, increase the biochemical oxygen demand. This process can eventually create 'dead zones' in water bodies where aquatic life cannot survive due to lack of oxygen. To prevent agricultural runoff, farmers can employ several strategies. One example is the use of buffer strips, which are areas of vegetation planted between farmlands and waterways that act as a filter for pollutants. Another method is the implementation of contour farming, where crops are planted across the slope of the land, which helps to reduce erosion and runoff.

The term “survival of the fittest” refers toA. the most reproductively successful in an environment.B. the strongest competing and surviving in an environment.C. the weakest being unable compete for resources and dying in an environment.D. the strongest surviving and reproducing in an environment.E. heterozygote advantage in an environment.

Answers

Answer:

The correct option is : A. the most reproductively successful in an environment.

Explanation:

The phrase ''survival of the fittest" originated from the evolution theory given by Darwin. In the Darwin's theory of Evolution, this phrase was used to describe the process of natural selection, which defines the concept of fitness as the reproductive success. Therefore according to this theory, the species which will leave the most copies of itself in the successive generations will survive.

Therefore, the term “survival of the fittest” refers to the most reproductively successful in an environment.

The term “survival of the fittest” refers to individuals who are most reproductively successful in an environment, highlighting the essence of natural selection as the mechanism by which species evolve. Therefore, the correct answer is A. the most reproductively successful in an environment.

The term “survival of the fittest” does not imply that only the physically strongest or largest survive, but rather refers to those more reproductively successful due to traits that confer survival advantages in their environment. Natural selection, another term for “survival of the fittest,” operates when individuals with beneficial traits are more likely to reproduce and pass those traits to future generations. This evolutionary mechanism is central to the theory of evolution, elaborating on how species adapt over time through the differential survival and reproduction of individuals.

It's essential to understand that the 'fittest' in this context is about reproductive success and the ability to pass on advantageous traits that increase an organism's chances of survival, not necessarily brute strength or speed. A classic example is the development of antibiotic resistance in bacteria; those with genetic mutations that resist antibiotics are more likely to survive and reproduce, spreading this trait within the population.

Describe the function of a chemical synapse.

Answers

The nervous system is one of the most important elements for our existence and survival, since it allows the management, organization and functioning of the rest of the corporal systems.

The synapse is a communication mechanism that occurs between two or more neurons in order to massively transmit a nerve impulse in order to coordinate a function in the organism.

The Chemical Synapse is the type of major synapse in our body. In these synapses the information is transmitted chemically, through the sending by the presynaptic neuron of different neurotransmitters that the postsynaptic neuron captures through different receptors, whose action generates an alteration in the form of excitatory or inhibitory postsynaptic potential that may end or not with the generation of an action potencial by the postsynaptic neuron. They are versatile synapses, since some neurons can inhibit the action of others depending on what is activated. There is no physical contact between both neurons.

2)

The RNA type that is translated into a polypeptide is _____.

rRNA

mRNA

tRNA

nuclear RNA

none of the above

Answers

Answer:

mRNA

Explanation:

The messenger RNA also called mRNA is the type of RNA that serves to carry the genetic information from DNA to the cytoplasm. The mRNA is formed by the process of transcription using the DNA template strand.

The mature mRNA enters the cytoplasm and joins with the ribosome. The nucleotide sequence of mRNA is translated into the amino acids sequence of polypeptides. The nucleotide sequence of mRNA is read in the form of triplet genetic codes by tRNA.  

Muller’s ratchet is the

a. breaking down of adaptive combinations of genes by recombination.

b. elimination of deleterious mutations due to sexual reproduction.

c. maintenance of genetic variation via disruptive selection.

d. crossing over and independent assortment of chromosomes during meiosis.

e. accumulation of deleterious mutations in asexual lineages.

Answers

Answer: e. accumulation of deleterious mutations in asexual lineages.

Explanation:

Muller's ratchet is a process of deleterious mutation accumulation that can drive to the extermination of a population of asexuals. This Ratched would ultimately create a vicious cycle of mutation accumulation that would lead to a population decline and finally pushes an entire population to extinction, which is called mutational meltdown. Muller’s Ratchet has been invoked to explain the evolution of sex, the extinction of small populations, the accelerated rate of evolution of endosymbiotic bacteria, the degeneration of Y-chromosomes, and cancer progression

Children's long bones have growth plates called __________.

Answers

Answer:

the answer is the epithelial plates.

Explanation:

this plate allows height and hardens at the age of around 17-20 years old when the youth is done growing.

Mina had a throat infection; in a few days it had spread to her ear. What part of her ear would be affected first?
Select one:
a. middle ear
b. inner ear
c. pinna
d. external auditory canal

Answers

Answer: Middle Ear

Explanation:

Ear is one of the most important part of human body by which an individual is able to hear sounds. It also helps in maintaining pressure inside body.

The Eustachian tube found inside the ear is a canal which is connects middle ear to the nasopharynx. This area consists of back of nasal cavity and the upper throat.

Its main function is to control the pressure within the middle ear, making it equal to the pressure outside the body.

Hence, the correct answer is option A

Final answer:

The middle ear, connected to the throat via the Eustachian tube, would be the first part of the ear affected when a throat infection spreads.

Explanation:

When Mina's throat infection spread to her ear, it would have likely first affected the middle ear. The middle ear is the section of the ear directly connected to the throat via the Eustachian tube. It's this connection that enables bacteria or viruses causing throat infections to potentially move up to the ear. Common conditions such as otitis media, an infection of the middle ear, often occur as a result of an infection spreading from the throat.

Learn more about Middle ear here:

https://brainly.com/question/38424649

#SPJ3

What are the 3 portions of the brain stem and what do each do?

Answers

Answer: The brain stem is a terminology used to refer collectively to the midbrain, pons, and medulla oblongata.

Explanation:

The midbrain is composed primarily of the optic lobes, which receive and process visual information it is responsible for reflexes involving eyes and ears. Pons is responsible for the reticular activating system and visceral control. The Medulla Oblongata is responsible for the sensory nuclei, reticular activating system, and visceral control.

Superficial region around the renal medulla

Answers

Answer:

Renal cortex

Explanation:

The renal medulla of a kidney is surrounded by renal cortex. The renal cortex is the granulated layer. It is the renal cortex in which the renal corpuscle (glomerulus and Bowman's capsule) are present. The renal cortex is reddish brown in color. This is due to the fact that most of the renal arteries deliver the blood to the cortex.

Parents of a 3-year-old boy noticed that their son was walking "on his toes", had a waddling gait, fell frequently, had difficulty getting up again, and was not able to run because of the difficulty in lifting his knees. At age five, there was progressive muscular weakness and atrophy. Weakness of the trunk muscles led to increased lordosis and a protuberant abdomen. He was able to speak clearly and the muscles of his face functioned normally. At age 9, he was confined to a wheelchair. Circle the disorder you believe is the cause of the described symptoms. Explain your choice, including why the other disorder were eliminated.

a. Muscular dystrophy

b. Multiple sclerosis

c. Myasthenia gravis

d. Polio

Answers

Answer:

The answer is A muscilar dystrophy

Explanation:

Progressive muscular dystrophy, which shows the patient by the symptoms that were manifested from three years of age and who started with walking on his toes and the difficulty in raising the legs accompanied by progressive weakness confirm this diagnosis worsening his clinical manifestation at nine years of age, where there is a marked skeletal muscle deformity that makes the use of a wheelchair necessary. we can discard miestemia gravis and multiple scoliosis because they are not pathologies of this age group, polio in turn is a contagious infectious disease that is eradicated in much of the world, mostly in developed countries thanks to the vaccine.

Final answer:

The most likely cause of the described symptoms is Muscular dystrophy.

Explanation:

The disorder that is most likely the cause of the described symptoms is Muscular dystrophy. Muscular dystrophy is a genetic disorder that causes progressive weakness and degeneration of the muscles. The symptoms described, such as walking on toes, waddling gait, frequent falls, difficulty in getting up, and difficulty in lifting knees, are characteristic of muscular dystrophy.

The other disorders can be eliminated:

Multiple sclerosis: Multiple sclerosis is a central nervous system disorder that affects the brain and spinal cord. It does not typically present with progressive muscular weakness and atrophy.Myasthenia gravis: Myasthenia gravis is an autoimmune neuromuscular disorder that causes muscle weakness and fatigue. However, it usually does not lead to progressive weakness and atrophy as described in the case.Polio: Polio is a viral infection that can lead to muscle weakness and paralysis. However, the symptoms described are not consistent with the typical progression of polio.

Learn more about Muscular dystrophy here:

https://brainly.com/question/3497922

#SPJ3

All of the following statements are true, except: Question 24 options: 1) Renin is a hormone produced by JG cells 2) JG cells are present in the vasa recta 3) Macula densa cells are present in the ascendinng limb of henle's loop and distal convoluted tubule 4) The JG apparatus play a role in BP regulation

Answers

Answer:

2) JG cells are present in the vasa recta.

Explanation:

The vasa recta is a web of the blood capillary which supply blood to the medulla region of a kidney due to its high permeability of solutes and water. It runs parallel to the loop of Henle. It does not composed of the  juxtaglomerular cells (JG cells). The juxtaglomerular cells (JG cells) present in kidney which synthesise and stores enzyme renin. Thus, option 2) JG cells are present in the vasa recta is not a true statement.  

Other Questions
PLEASE HELP PRECALCULUS WILL MARK BRAINLIEST -SEE ATTACHMENT- Which algebraic expression represents "the difference of 54 and a number"? In order for a theory to be considered valid it must be: observed at least one time recorded repeatable inferred from personal interpretation You have $500,000 saved for retirement. Your account earns 4% interest. How much will you be able to pull out each month, if you want to be able to take withdrawals for 25 years? What is the area of triangle ACD A meteoroid is traveling east through the atmosphere at 18. 3 km/s while descending at a rate of 11.5 km/s. What is its speed, in km/s? Why did President Jefferson want the Louisiana territoryexplored? In his study of pea plants, Gregor Mendel used which method to produce offspring?O cross-pollination, by using parents that had identical traitsO cross-pollination, by using parents that had different traitsO self-pollination, by using one parentO random pollination, by using both identical- and different-trait matings If you are asked to provide a set of two or more numeric answers, separate them with commas. For example, to provide the year that Sputnik (the first satellite to be sent into orbit around the Earth) was launched and the year humans first walked on the Moon, you would enter 1957,1969 in the answer box.A rectangle has a length of 5.50 m and a width of 12.0 m. What are the perimeter and area of this rectangle?Enter the perimeter and area numerically separated by a comma. The perimeter should be given in meters and the area in square meters. Do not enter the units; they are provided to the right of the answer box. In circle C, r= 32 units.What is the area of circle C?32tt units6411 units?O256T1 units?1024T units? Determine the value of the equilibrium constant, Kgoal, for the reaction CO2(g)C(s)+O2(g), Kgoal=? by making use of the following information: 1. 2CO2(g)+2H2O(l)CH3COOH(l)+2O2(g), K1 = 5.401016 2. 2H2(g)+O2(g)2H2O(l), K2 = 1.061010 3. CH3COOH(l)2C(s)+2H2(g)+O2(g), K3 = 2.68109 Please answer this correctly Writeas a percentage. Which of the following ions: K, Cl, or Mg is most similar to the ion trigger for muscles based on its position on the periodic table? In the late 1800s, Cecil Rhodes took the money he made from renting water pumps to miners and used it to buy up the claims of small mining operations. In time, and with the help of funding from the Rothschild family, he formed De Beers, which would become the largest diamond mining company in the world. Which of the following best describes the role Cecil Rhodes played for De Beers?A. CapitalB. LandC. Entrepreneurial abilityD. Labor Select all the correct answers.What are the purposes of a prologue in a play?-to provide information about the inner thoughts and feelings of a character-to set the mood and tone of the play and provide background information-to provide information about how the stage should be set and what props are needed-to give some insight into the relationships among different characters-to provide a hint to the audience about what will happen later in the play What is the length of BC in the right triangle below? A golf ball is at rest on the grass when a golfer walks up and applies 10 N of force to it. There is 2 N of friction, resulting in 8 N of net force. What will happen to the ball? (4 points)It will remain at rest.It will move in the direction opposite the net force.It will move slowly at first, then speed up.It will move in the direction of the net force. what are the physiological reactions to stress in the alarm stage Select the correct answer.In chapter 3 of Franz Kafkas The Metamorphosis, Gregor is confined to his room after an injury inhibits his movement. However, he finds solace in being able to hear his familys conversations through his open bedroom door. What does this detail show about Gregors state of mind?A. He still feels the need for human company.B. He feels trapped in his house with his family.C. He misses interacting with his kind, loving mother.D. Hes bored and wants to go back to work.