integrate ∫dx/(64−x2) from 0 to 8.

Answers

Answer 1
Given integral does not converge in the given region.

Related Questions

Which of the binomial is a factor of this trinomial x2-7x-44?

Answers

I hope this helps you



x^2-7x-44

x -11



x +4



(x-11)(x+4)

Factor -9x^2-36x-36 please.

Answers

Tricky Trinomial
-9x^2-36x-36
(-9x^2-18x)(-18x-36)
-9x(x+2)-18(x+2)
=(-9x-18)(x+2)
factor out -9
-9(x^2+4x+4)
what 2 numbers multiply to 4 and add to 4
 2 and 2

-9(x+2)(x+2)

Given the equation Square root of 2x plus 1 = 3, solve for x and identify if it is an extraneous solution.

^ I really don't understand this topic, whatsoever. Could someone help?

Answers

The answer is 4.

Square root of 2x plus 1 = 3:
[tex] \sqrt{2x+1} =3[/tex]

Square both sides:
[tex]( \sqrt{2x+1} )^{2} =3^{2} \\ \\ 2x+1=9 \\ 2x = 9 - 1 \\ 2x =8 \\ x = 8:2 \\ x =4 [/tex]

By squaring both sides and solving for [tex]\(x\),[/tex] we find [tex]\(x = 4\)[/tex] as the solution, which is not extraneous upon substitution into the original equation.

To solve the equation [tex]\(\sqrt{2x + 1} = 3\),[/tex] we need to isolate[tex]\(x\).[/tex] Here's how:

1. Square both sides of the equation to eliminate the square root:

[tex]\[ (\sqrt{2x + 1})^2 = 3^2 \][/tex]

[tex]\[ 2x + 1 = 9 \][/tex]

2. Subtract 1 from both sides to isolate [tex]\(2x\)[/tex]:

[tex]\[ 2x = 9 - 1 \][/tex]

[tex]\[ 2x = 8 \][/tex]

3. Divide both sides by 2 to solve for [tex]\(x\)[/tex]:

[tex]\[ x = \frac{8}{2} \][/tex]

[tex]\[ x = 4 \][/tex]

Now, we have [tex]\(x = 4\)[/tex]. To determine if it's an extraneous solution, we need to check if it satisfies the original equation.

Substitute [tex]\(x = 4\)[/tex] into the original equation:

[tex]\[ \sqrt{2(4) + 1} = 3 \][/tex]

[tex]\[ \sqrt{9} = 3 \][/tex]

[tex]\[ 3 = 3 \][/tex]

Since the equation holds true, [tex]\(x = 4\)[/tex]is a valid solution, not an extraneous one.

Therefore, the solution to the equation [tex]\(\sqrt{2x + 1} = 3\) is \(x = 4\),[/tex]and it is not an extraneous solution.

Tyrone’s hourly wage is $18 and his net pay is 72% of his earnings. Tyrone spends about $1,800 on his monthly expenses. If Tyrone works 40 hours per week and has no other sources of income, what is his total monthly cash inflow? (Hint: Assume that there are 4 pay periods per month.)

Answers

$2073.60 per month

===================

To calculate Tyrone's total monthly cash inflow, we need to determine his weekly and then monthly earnings.

Calculate weekly gross income:

$18/hour * 40 hours/week = $720/week

Calculate net pay per week:

$720/week * 72% = $518.40/week

Calculate monthly cash inflow:

$518.40/week * 4 weeks/month = $2073.60/month

Tyrone's total monthly cash inflow is $2073.60.


If x = a + bi and y = –a – bi, x + y = 0

Answers

That would be the inverse property of addition. When you add the opposite of a number to that number, your sum will be zero. -a is the opposite of a and -bi is the opposite of bi. When you add x + y (aka the opposites) your total is absolutely nothing!  

Answer:

inverse property

What are odd numbers 1-35?

Answers

1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35
Is that what you meant.
Odd numbers between 1 and 35 are: 1, 3, 5, 7, 9, 11, 13, 15, 17, 19, 21, 23, 25, 27, 29, 31, 33, 35. So, you count every second number, because the remaining numbers are even numbers.

Is 89 prime or composite

Answers

it is a prime number. 89=1×89 hope it helps

Answer:

Prime

Step-by-step explanation:

A prime number is a number that has only one factor. A composite number is a number that has more than one factor.

-kiniwih426

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

how is a tangent different from a chord

Answers

Answer:

A tangent is a line, ray, or line segment that intersects a circle at exactly one point (called the point of tangency) and contains no points inside the circle. A chord is a segment with both endpoints on a circle. Tangents intersect the circle at one point, while a chord intersects at two.

I've checked this answer, E counted it as correct. Hope this helped!!!

A tangent touches a circle at one point, while a chord connects any two points on the circle's circumference.

A tangent and a chord are both important concepts in geometry, but they have distinct characteristics.

A tangent is a line that intersects a circle at exactly one point, touching the circle's circumference at that point.

It never crosses the circle. Tangents are perpendicular to the radius that intersects the point of tangency.

On the other hand, a chord is a line segment connecting any two points on a circle's circumference. Unlike tangents, chords can intersect the circle at multiple points.

The diameter is a special case of a chord that passes through the center of the circle.

Hence,

Tangents touch a circle at one point, while chords connect two points on a circle's circumference.

To learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ6

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

Paul plans to put concrete on a rectangular portion of his driveway. The portion is 12 feet long and 6 inches high. The price of concrete is $98 per cubic yard. The total cost of the concrete Paul needs is $108.89. Which of the following is closest to the width of the portion of the driveway on which Paul plans to put concrete?

[1 foot = 12inches; 1 yard = 3 feet]

3 feet

5 feet

8 feet

10 feet

Answers

The width needed is 5 feet.

Answer:

The answer is b. 5 feet

Step-by-step explanation:


A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

Simplify each given equation and show your work. Tell whether it has one solution, an infinite number of solutions, or no solutions, and identify each equation as an identity, a contradiction, or neither. Explain your answers.
(a)6x + 2(2x – 3) = 24 + 9x
(b)25 – 4x = 3(5 – x) + 10 – x
(c)4(x + 2) = 2x + 7 + 2(x – 10)

Answers

a) The answer is one solution, neither

6x + 2(2x - 3) = 24 + 9x
6x + 2 * 2x + 2 * (-3) = 24 + 9x
6x + 4x - 6 = 24 + 9x
10x - 6 = 24 + 9x
10x - 9x = 24 + 6
x = 30

b) The answer is infinity solutions, identity
25 – 4x = 3(5 – x) + 10 – x
25 - 4x = 3 * 5 - 3 * x + 10 - x
25 - 4x = 15 - 3x + 10 - x
25 - 4x = 25 - 4x
4x - 4x = 25 - 25
0x = 0

x can be any number, so an infinite number of solution

c) The answer is no solution, contradiction

4(x + 2) = 2x + 7 + 2(x – 10)
4 * x + 4 * 2 = 2x + 7 + 2 * x - 2 * 10
4x + 8 = 2x + 7 + 2x - 20
4x + 8 = 4x - 13
4x - 4x = - 8 - 13
0 = -13

this is contradiction

Vanessa deposited money into a bank account that earned 1.25% simple interest each year. After 1/2 year, she had earned $5.00 in interest on the account. If no other money was deposited into or withdrawn from the account, how much was her initial deposit? Uhh... I was just testing...oops

Answers

so the answer is 800. I guarantee you this will be the answer I promise

Final answer:

Vanessa's initial deposit in the bank, earning 1.25% simple interest per year, was $800. This is calculated using the simple interest formula, rearranged to solve for the principal based on the $5 interest earned in half a year.

Explanation:

To find Vanessa's initial deposit, we use the simple interest formula, which is Interest = Principal × Rate × Time. Given Vanessa earned $5.00 in interest in half a year (0.5 years) at a rate of 1.25% per annum, we can rearrange the formula to solve for the principal (initial deposit).

Using the given information: $5 = Principal × 0.0125 × 0.5, we can solve for the Principal as follows:

$5 = Principal × 0.00625
Principal = $5 ÷ 0.00625
Principal = $800

Therefore, Vanessa's initial deposit was $800.

Josephine started a business selling cosmetics. She spent $4500 to obtain her merchandise, and it costs her $200 per week for general expenses. She earned $550 per week in sales. What is the minimum number of weeks it will take for Josephine to make a profit? Write an inequality to model the problem.

A.)550w > 4500 + 200w

b.)200w > 4500 + 550w

c.) 550w < 4500 + 200w

d.)200w 4500 + 550w
...?

Answers

Answer:

a

Step-by-step explanation:

Final answer:

Josephine will need at least 13 full weeks to start making a profit. The correct inequality that models this economic scenario is 550w > 4500 + 200w.

Explanation:

The minimum number of weeks it will take for Josephine to make a profit in her cosmetics business can be determined by setting up an inequality where the total earnings must be greater than the sum of the initial investment and the running costs. We define w as the number of weeks. Josephine earns $550 per week, so her earnings after w weeks are 550w. The initial investment is $4500 and the weekly expense is $200, so the total expenses after w weeks are 4500 + 200w. To make a profit, the earnings must be greater than the expenses:

550w > 4500 + 200w

To solve for w, we need to collect like terms:

550w - 200w > 4500

350w > 4500

Dividing both sides by 350:

w > 4500 / 350

w > 12.86

This means Josephine will need to work for at least 13 full weeks to make a profit.

mr. and mrs. boyce bought a house for 96000 in 1995. real estate values in their area increase approximately 4% each year. what was the value of the house in 2007?

Answers

Use this formula:
[tex]P(t) = P_0 (1 + r)^t[/tex]
[tex]P(12 years) = (96000) \cdot (1.04)^{12}[/tex]
[tex]P(12) = 153699[/tex]
Final answer:

The Boyce's house bought for $96,000 in 1995, increased approximately 4% yearly. By applying the compound interest formula, the house's value in 2007 would be approximately $139,254.09.

Explanation:

We need to use the compound interest formula to calculate the value of Boyce's house in 2007 because the house price increase is compounded annually. The formula is P(1 + r/n)^(nt). Here, P is the initial amount (i.e., the original house price), r is the annual interest rate (the rate of increase in house value), and n is the number of times interest is compounded yearly. T is the number of years the money is invested.

However, as we deal with annual compounding, the formula simplifies to P(1 + r)^t. In this case, P = $96,000, r = 4% or 0.04, and t = 2007 -1995 = 12 years.

Inserting these values, we get 96000(1 + 0.04)^12 = $139,254.09 (rounded to the nearest cent).

So, according to the 4% annual increase rate, Boyce's house would be worth approximately $139,254.09 in 2007.

Learn more about Compound Interest here:

https://brainly.com/question/14295570

#SPJ2

A new law requires that 12% of an individual's income be invested in the stock market. Your accounts show that you need to put $420 in the stock market this year. How much did you earn this year.
A $5,040 B $350 C $504** D $3,500

Answers

Final answer:

The problem can be solved by setting up the equation 0.12x = $420, where 'x' stands for your total income. Dividing both sides of the equation by 0.12 gives x = $3500 which is the total annual income. Thus, you earned $3,500 this year.

Explanation:

To solve this mathematical problem, you can set up an equation that represents the problem context. You know that 12% of your whole year's income equals $420. So if 'x' represents your total income, the equation becomes 0.12x = $420. To solve for 'x' (your total income), you would divide both sides of the equation by 0.12.

So, x = $420 ÷ 0.12. When you perform this calculation, you'll find that 'x' equals $3,500. Therefore, you earned $3,500 this year.

The answer to the problem is D. $3,500.

Learn more about Percentage here:

https://brainly.com/question/35647344

#SPJ12

Use substitution to solve the system
5x+4y=12
Y=2x-10

Answers

ok so do you know the steps for substitution

Substitute the 2x-10 in for I in the first equation:
5x+4(2x-10) =12

Distribute the 4:
5x+8x-40=12

Add 40 to both sides and combine the x terms:
13x=52

Divide by 13:
x=4

Plug the 4 into either equation for the x value:
y=2(4)-10
y=8-10
y=-2

Answer:
X=4
Y=-2

To check you can plug them into either one of the equations.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

Which of the following statements is true of chords?

A chord is a line segments.A chord connects two points on a circle.A chord can be a radius of a circle.A chord can be a diameter of a circle.A chord divides a circle into two regions

Answers

All of those are true, except the one about the radius.  Because alternate definition of diameter uses the idea of chord. So, both ends of a chord have to be on the circle, but one end of a radius is at the center, so a radius can't be a chord.

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

108/250 in simplest form in a whole number.

Answers

You cannot express 108/250 in a whole number but it can be simplified to 54/125

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

Suppose f(π/3) = 3 and f '(π/3) = −7,
and let
g(x) = f(x) sin x
and
h(x) = (cos x)/f(x).
Find the h'(x)

Answers

Final answer:

To find h'(x), differentiate the function h(x) = (cos x)/f(x) using the product rule.

Explanation:

To find h'(x), we need to differentiate the function h(x) = (cos x)/f(x).

First, let's find the derivative of cos x, which is -sin x.

Next, we need to find the derivative of f(x). Since f(π/3) = 3 and f '(π/3) = −7, we know the slope of the tangent line at x = π/3 is -7.

Using the product rule, we can now differentiate h(x) = (cos x)/f(x) as follows:

h'(x) = [f(x)(-sin x) - cos x(f '(x))]/[f(x)]^2

Other Questions
2) all state legislatures possess which broadly defined power that allows them to protect and promote the health and safety of citizens? A) police powerB)nonlegislative powerc) veto powerD) judicial power Which relation is a direct variation that contains the ordered pair (2, 7)?Y=4x-1y=2/7xy=7/2xy=7/x "In ABC, mBAC = 5x + 8, mABC = 6x + 22, and mBCA = 3x 25. A.Find the value of x.B.Find the measure of 3. Show your work." What is the solution to this system of equations? x 2y = 152x + 4y = -18Please explain! the sooner the better Which of the following correctly expresses the number below in scientific notation? 0.00000765 A.7.65 10-6 B.7.65 10-7 C.7.65 10-5 D.76.5 10-7 E.765 10-8 F.765 10-6 Fill in the blank: To find the values of p, q, r and s, you should start by finding all factor ___ of the leading coefficiant and constant term. Then try them to determine which ones give you the correct product ...? What is the subject in this sentence? Monkeys are fun animals because they make people laugh out loud. Which of the following flower tissues is reproductive?carpelpetalsepaltepal A 420-N force acts on a 400-N object, and the force is from the north. In which direction will the object move? A) SOUTHB)NOURTHC)FORWARDD)BACKWARD winston churchill urging americans to enter world war ii in a radio speech is an example of what ? Many amines with useful medicinal properties are sold as their ammonium salts true or false UPVOTES HERE!!What is the main purpose of a memoir?1.inform2.teach3.entertain4.persuade y = 5x + 7x = 8 A.(0, 8) B.(8, 15) C.(0, 7) D.(8, 47) Work still needs to be done to achieve our american ideal of what? A science test, which is worth 100 points, consists of 24 questions. Each question is worth either 3 points or 5 points. If x is the number of 3-point questions and y is the number of 5-point questions, the system shown represents this situation.x + y = 243x + 5y = 100What does the solution of this system indicate about the questions on the test? Carlos______________ al parque. (andar) Explain how conduction can increase the temperature of the air above Earth's surface. ...? How did the radio help create common culture in the united states Which best describes how Tom Canty's mother treats Prince Edward at Offal Court? A. She ignores him completely. B. She is cruel to him. C. She is kind to him. D. She treats him as though he really is royalty.18 POINTS FOR THIS QUESTION Reduce this algebraic fraction 27c^4d^5/9c^7d^4 ...?