Let f(x)=3x and g(x)=x^2+5. Perform function operation g(x)/f(x). State the domain.

Answers

Answer 1
we have that

f(x)=3x
g(x)=x²+5
g(x)/f(x)=[x²+5]/[3x]

that new function will exist for all real numbers except the value of zero, value for which it becomes indefinite

the domain is the interval (-∞,0) U (0,∞)

using a graph tool
see the attached figure
Let F(x)=3x And G(x)=x^2+5. Perform Function Operation G(x)/f(x). State The Domain.

Related Questions

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

How to find side of triangle if two sides and one angle is known?

Answers

The Law of Cosines can be used.

If the given angle is opposite one of the given sides, the Law of Sines can be used.

Law of Cosines:
.. c^2 = a^2 +b^2 -2ab*cos(C) . . . . . for any permutation of sides a, b, c, and opposite angle C

Law of Sines:
.. a/sin(A) = b/sin(B) = c/sin(C)

there are four brands of smartphones that are most popular in the united states . the number of people in the united states that have each brand is given.
brand A; 4.48x104;
brand b : 3.84 x107; brand c : 6.4x10^6; brand d: 1.50 x107
what is the order of these brands from most to least popular?

Answers

Brand B; brand D; Brand C; Brand A

For this case we must write the numbers from highest to lowest.

We observe that the numbers are written in exponential notation.

Therefore, by rewriting we have:

Brand A:

[tex] 4.48 * 10 ^ 4 = 44,800
[/tex]

Brand B:

[tex] 3.84 * 10 ^ 7 = 38,400,000
[/tex]

Brand C:

[tex] 6.4 * 10 ^ 6 = 6,400,000
[/tex]

Brand D:

[tex] 1.50 * 10 ^ 7 = 15,000,000
[/tex]

Ordering from highest to lowest we have:

[tex] 3.84 * 10 ^ 7 = 38,400,000

1.50 * 10 ^ 7 = 15,000,000

6.4 * 10 ^ 6 = 6,400,000

4.48 * 10 ^ 4 = 44,800
[/tex]

Answer:

The order of these brands from most to least popular is:

Brand B

Brand D

Brand C

Brand A

Solve the following inequality. 2x < 8

Answers

2x < 8
2x / 2 < 8/2
  x < 4

hope it helps

The required solution of the given inequality 2x < 8 is x < 4.

What is inequality?

The relation between two expressions that are not equal, employing a sign such as ≠ ‘not equal to’, > ‘greater than’, or < ‘less than’.

Given:

The given  inequality is

2x < 8

According to given question we have

Write inequality

2x < 8

Divide both sides by 2 we get,

x < 4

Therefore, the required solution of the given inequality 2x < 8 is x < 4.

Learn more details about inequality here:

https://brainly.com/question/20383699

#SPJ2

First combined weight of three packages that weigh 5 1/2 pounds 4 7/16 pounds and 3 3/8 pounds

Answers

5 1/2 + 4 7/6= 9.9+3 3/8=13.37

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 


Hint: Omars equation doesn't work!
Identify his error and correct it by showing the steps Omar should have taken and determine the correct value of x.

Answers

His Error: He set the expressions 10x-1 and 59 equal to each other. Those two angles are not congruent. 

He should have added the two expressions to get 180
(10x-1) + (59) = 180
10x+(-1+59) = 180
10x+58 = 180
10x+58-58 = 180-58
10x = 122
10x/10 = 122/10
x = 12.2

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

urgent help needed!

write y = (-5/8)x + 3 in standard form using integers.
a. 5x + 8y = -24
b. 5x + 8y = 24
c. 5x - 8y = 24
d. -5x + 8y = 24

Answers

To write this in standard form, you need to eliminate the fraction in the coefficient of variable x. You can do this by multiplying 8 to the two sides of the equation:

8(y) = 8[(-5/8)x + 3]

8y = -5x + 24

Transpose the variable x to the other side:

5x + 8y = 24        

 

 

In Washington, D.C., Constitution Ave. meets Pennsylvania Ave. at a 25° angle. What is the measure of the complementary angle to the angle formed by these two avenues?

Answers

By definition, the complementary angles are those that have a sum of 90° (Right angle). 

 The problem indicates that Constitution Avenue meets Pennsylvania Avenue at a 25° angle. Then, the complementary angle is:

Complementary angle=90°-25°
Complementary angle=65°

  What is the measure of the complementary angle to the angle formed by these two avenues?

 The answer is: The measure of the complementary angle to the angle formed by these two avenues is 65°. 

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.



The graph shows the path of a rider on a ride at an amusement park.

What does the x-coordinate of the vertex represent?



The rider’s minimum height above the ground is 25 ft.
The rider travels a total distance of 25 ft.
The difference between the rider’s maximum and minimum’s height above the ground is 25 ft.
The rider is closest to the ground when he is 25 ft from the left side of the ride.

https://static.k12.com/nextgen_media/assets/8090397-NG_AL1_O_07_U12_Quiz_08.png

Answers

The rider is closest to the ground when he is 25 ft from the left side of the ride.

Answer:

D. The rider is closest to the ground when he is 25 ft from the left side of the ride.

Step-by-step explanation:

The vertex of x-coordinate represents the distance from the from the origin of the pendulum, which is the closest to the ground when he is 25 ft away from 0.

Hope this will helpful.

Thank you.

Anslee is designing a doll house shaped like a rectangular prism. The doll house is 8 feet long, 2 feet wide and 3 feet high. What is the surface area of the doll house?

Answers

we know that
L=8 ft
W=2 ft
H=3 ft
[surface area of the doll house]=2*[W*H]+2*[L*H]+2*[W*L]
[surface area of the doll house]=2*[2*3]+2*[8*3]+2*[2*8]
[surface area of the doll house]=2*[6]+2*[24]+2*[16]
[surface area of the doll house]=12+48+32--------> 92 ft²

the answer is 92 ft²

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

Sarah draws a rectangle with an area of 4,875 square units and a length of 65 units. What is the width of the rectangle? 70 units 75 units 85 units 95 units

Answers

To calculate area of a rectangle you multiply the length and width together so to find the width you divide the area by the length: 4875÷65=75 so the width is 75 units.

Singing "row, row, row your boat," in a round (each group starting at a different time) would be considered which texture? music appreciation

Answers

Yuh, ooh, brr, brr
Gucci gang, ooh
(That's it right there, Gnealz)
Yuh, Lil Pump, yuh
Gucci gang, ooh
(Ooh, Bi-Big Head on the beat)
Yuh, brr

Math help!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

6,023 
6,032
6,407
6,704
From least to greatest:

6,023; 6,032; 6,407; and 6,704.
From this list, the most accurate answer choice is the first one, A.

I hope this helps!

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

16. Which of the following are the measures of a right isosceles triangle?

a. 36°, 60°, 90°
b. 40°, 40°, 90°
c. 60°, 60°, 60°
d. 45°, 90°, 45°

17. Of the following triangles, which one is impossible to construct?

a. acute scalene
b. acute equilateral
c. obtuse scalene
d. obtuse equilateral

Answers

16. 
The angles of right isosceles triangle are such that there is the right angle, 90 degrees, and there are two identical angles that add up to 90.

17. 
It is impossible to have an obtuse equilateral because and obtuse triangle has an angle that is more than 90 but less than 190. The equilateral triangle has all the angles equaling the same; 60 degrees. 60 degrees isn't obtuse so it is impossible to have an obtuse equilateral triangle. 

Hope this helps :)

Answer for number 5?

Answers

you should try to divide 192 by the 4 sides on the rectangle.
The first thing you should know is that the perimeter of a rectangle is given by:
 P = 2L + 2W
 Where,
 L: side
 W: width
 On the other hand we have that the ratio is:
 L / W = 5/3
 Clearing L we have:
 L = (5/3) * (W)
 Substituting in the expression of the perimeter:
 P = 2 ((5/3) * (W)) + 2W
 Rewriting:
 P = (16/3) W
 The perimeter is 192:
 192 = (16/3) W
 We cleared W:
 W = (3/16) * (192)
 W = 36
 Finally we substitute W in the expression for L:
 L = (5/3) * (W)
 L = (5/3) * (36)
 L = 60
 Answer: 
 The width and length are: 
 W = 36 yards 
 L = 60 yards

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

Which of the following is the solution to the equation 25^(z + 2) = 125?

Answers

Answer:

z = -0.5

Step-by-step explanation:

Using exponent rule:

[tex]x^a = x^b[/tex] then a = b

Given the equation:

[tex]25^{z+2} = 125[/tex]

We can write 25 and 125 as:

[tex]25 = 5 \cdot 5 = 5^2[/tex]

[tex]125 = 5 \cdot 5 \cdot 5 = 5^3[/tex]

then;

[tex]5^{2(z+2)}= 5^3[/tex]

Apply the rule:

[tex]2(z+2) = 3[/tex]

using distributive property [tex]a \cdot (b+c) = a\cdot b+ a\cdot c[/tex]

[tex]2z+4 = 3[/tex]

Subtract 4 from both sides we have;

[tex]2z = -1[/tex]

Divide both sides by 2 we have;

z = -0.5

Therefore, the solution for the given equation is, z = -0.5

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

Sarah is shopping for groceries at the local supermarket. She paid for her groceries using a $100 bill recently issued by the US government. What type of money did Sarah use for this transaction? commodity money fiat money digital money representative money

Answers

It is not digital because that would something like applepay. It is also nt representative, since that would be something like food stamps. Commodity money is also a bad answer, since it is goods. You answer would be fiat money, which is paper tender issued by the government. Hope this helps.

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

[100 POINTS]

Question 1)
The graph for the equation y = 2x - 2 is shown below.
If another equation is graphed so that the system has one solution, which equation could that be?
A) y = 2(x+1)
B) y = 2(x-1)
C) y = 2(x-2)
D) y = -2(x+1)

Question 2)
Solve the inequality and then graph its solution.
1/5(x-2) > -1

a) x > -7
b) x < -3
c) x > -3
d) x > 3

Answers

Question 1)

D

The answer is D because every other option has the same slope (2), and even if the intercepts are different, the lines would only be parallel, whereas in D, the slope is -2, which has one solution.

Question 2)

C

You would multiply everything by 5 to get rid of the fraction. Then, you can simplify and get the answer.

The first question is D, because when graphed, intercepts with the slope of 3, the only with the solution.

The second question is C, because u can multiple the LHS and RHS to get x-2 is greater than -5. Add 5 to get x is greater than -3

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7
Other Questions
If a company's revenue is 50 billion USD a year, how much money does it make per hour? Timmy has been imprisoned for theft. he is worried about his three children, who are dependent on him. his attorney tells him that he should not worry, because federal legislation will provide counseling, education, and training to them. which act is timmy's attorney talking about? A number has the digits 9 and 7. To the nearest 10, the number rounds to 100. what is the number? Eder needs 6 cookies and 2 brownies for every 4 plates he makes for a bake sale. Drag cookies and brownies into the box to show how many Eder needs for 10 plates. Which statement best describes how southern slaveholders reacted to the Emancipation Proclamation. a. they were furious.b. they staged work slowdowns c. they joined the union armyd. they freed their enslaved people The length of time the valve is open, expressed in degrees of crankshaft rotation, is called camshaft A. duration. B. overlap. C. lobe separation angle. D. lift. Cul es uno de los grupos tnicos que no habitaron el territorio de Oaxaca? a. Aztecas c. Mixtecos b. Toltecas d. Zapotecas Please select the best answer from the choices provided Choose all the answers that apply.The greenhouse effect is:a) slowly increasing global temperatureb) caused when atmospheric gases trap heatc) melting the polar ice capsd) slowly increasing sea levelse) increasing because of carbon dioxide emissions How does the immune system protect the body againstChanges of the internal body temperature Changing environmental conditions Changes cause by harmful pathogens Changes in the pH of the blood (-3,2) 90 degrees about the origin clockwise Dakotas dance troupe sold T-shirts as a fundraiser so that they could go to summer camp. When the girls began their fundraiser, 600 people wanted their T-shirts. They were actually short by 210 T-shirts, so the troupe ordered more. They raised the price in hopes of earning more profit, but when the price increased, the demand went down. Use the given information to analyze what happened with the fundraiser.What happens when the quantity is above the equilibrium point? write a congruence statement for the pair of triangles zyb What does the 10th amendment mean in simple terms? What does a completely filled circle represent on a pedigree chart? Which anole species seems to have a brighter dewlap? (remember that 1 corresponds to least bright and 6 to brightest.)? Consider the vector b with magnitude 4.00 m at an angle 23.5 north of east. what is the x component bx of this vector? express your answer in meters to three significant figures. Will mark Brainliestif you answer the question correctly.A word or compound word is considered the nicest word in the language. What is that word?(Please answer if you KNOW the answer)This question is extra credit. Overall, how do the images of the poem I Could Not Stop for Death reinforce the meaning of the poem? Check the two boxes that best apply.They suggest that death is a journey.They suggest that farm work is very important to society.They suggest that death is not to be feared.They suggest that carriages are a very reliable means of transportation. How did the supreme courts decision in schenck v united states affect free speechA. It expanded it by saying that burning draft cards was a permitted form of symbolic speechB. It limited it by saying that people could not dishonor the U.S. flagC. It expanded it by saying that speech intended to cause people to break the law was permittedD. It limited it by saying that opposition to the draft was a danger to the country during wartime When the same force is applied. Which wagon will accelerate faster