Parts of Complex Numbers
z=4.1i+85
Re(z)=_____
Im(z)=_____

Answers

Answer 1
Variable z = a+bi is normally used to represent a complex number.
where a is the real number of z (Re z) while b is the imaginary part of z (im z)
Therefore in this case; z=4.1 i +85, therefore
Re(z) =85
Im(z) = 4.1

Related Questions

what is 1000x - 1x?

A) 101x
B) 1001x
C) 99x
D) 999x

Answers

Your answer is D) 999x
Hey there!

Let's think of what 1000x means.

We know that multiplication is repeated addition. For example, 5(5) = 5+5+5+5+5. It's 5 added five times.

It's no different here. That means we have x 1000 times. If we look at a simpler situation:

5x - 3x, we have (x + x + x + x + x) - (x + x + x)

That means we're getting rid of 3 x's, which means we have 2x. If we have different coefficients but the same variable, we can just subtract or add the coefficients but keep the variable. That means:

4x - 2x = 2x and 10x - 5x = 5x

Now, we can do this problem. We want:

(1000-1)x = 999x

Your answer is D.

Hope this helps!

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

a) Explain...
b) What is the probability that a person without HIV will have a test come out positive?
c) What is the probability that a person with HIV will have a test come out negative?
d) What is the probability that a person with HIV will have a test come out positive?

Answers

a) The cell corresponding to a positive diagnosis when the person has antibodies present as well as the cell for a negative diagnosis when the person has no antibodies present are the cells representing a CORRECT diagnosis.

The cell corresponding to a negative diagnosis when you actually have antibodies present is called a FALSE NEGATIVE and is considered as a TYPE II error.


The cell corresponding to a positive diagnosis when you actually don't have antibodies present is called a FALSE POSITIVE and is considered as a TYPE I error.

For the tree diagram for the questions below, refer to the picture attached.

b) To know the probability that a person without HIV will be diagnosed positive (false positive), we just trace the tree diagram from population to "antibodies not present" to "positive". The tree diagram will give us a value of 0.00588.

ANSWER: 
The probability of a false positive is 0.00588 or 0.588%.

c) We do the same thing as the previous subproblem to determine the probability that a person with HIV will be diagnosed as negative. We trace the tree diagram from population to "antibodies present" to "negative". The tree diagram will give us a value of 0.003.

ANSWER: 
The probability of a false negative is 0.003 or 0.3%.

d) Same thing for this subproblem. We trace the tree diagram from population to "antibodies present" to "positive" to know that the value is 0.01997.

ANSWER: 
The probability that a person with HIV will be diagnosed as positive is 0.01997 or 1.997%.

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

Need help asap please.

Answers

y intercept  replace x with 0 and solve = -3

axis of symmetry =  x = 3/2

coordinates of the vertex = (2,-9)

vertex form =  y = (x-7)^2-19

solution set = no real solution
 

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

The length of a rectangle is 5 ft less than three times the width, and the area of the rectangle is 28 ft2 . find the dimensions of the rectangle.

Answers

Let the width = w.
Then the length is 3w - 5.
The area = LW = 28

w(3w - 5) = 28

3w^2 - 5w = 28

3w^2 - 5w - 28 = 0

(3w + 7)(w - 4) = 0

3w + 7 = 0 or w - 4 = 0

w = -7/3 or w = 4

The width of a rectangle cannot be a negative number, so we discard w = -7/3.

The width is 4 ft.
The length is 3w - 5 = 3(4) - 5 = 12 - 5 = 7
The length is 7 ft

Answer: The dimensions are length 7 ft and width 4 ft.
Final answer:

The rectangle has a width of approximately 4.18ft and a length of approximately 7.55ft. These are obtained by setting up and solving a system of equations based on the given information.

Explanation:

Let's start by setting up equations based on the problem statement. Let's denote the width of the rectangle as

w and the length as l. From the problem, we know two things: one is that the length is 5 feet less than three times the width, which can be written as  l = 3w - 5. The second thing we know is that the area of the rectangle, which is obtained by multiplying the length by the width, is 28 square feet, written as l*w = 28 . By substituting the first equation into the second, we can solve for w: (3w - 5)*w = 28

. This simplifies to a quadratic equation 3w^2 - 5w - 28 = 0 which can be solved to give w=~4.18 ft and w=-2.02ft. Because the width cannot be negative, we discard the second solution. Substituting w=~4.18ft into l = 3w -5 gives

l=~7.55 ft . Therefore, the dimensions of the rectangle are approximately 4.18ft (width) and 7.55ft (length).

Learn more about Algebra here:

https://brainly.com/question/32436021

#SPJ2

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 

Makhaya is required to spend more than 300 minutes to complete assignments, and he can use at most 20 paper sheets. Let W denote the number of writing assignments he completes and M the number of math assignments he completes.

Write an inequality that represents the condition based on the number of minutes.

Write an inequality that represents the condition based on the number of paper sheets.

Answers

The constraint on time is
.. 75W +15M ≥ 300 . . . . . . . minutes

The constraint on paper is
.. 3W +M ≤ 20 . . . . . . . . . . . sheets of paper

PLEASE SOMEONE HELP ON THIS !!!
BRAINLIEST WILL BE GIVEN TO CORRECT ANSWER

TRY TO EXPLAIN IT....

Answers

The order will be B,C,A

B and C are both 30cm of water, but B filled up 1 minute faster than C

A waterfall has a height of 900 feet. A pebble is thrown upward from the top of the falls with an initial velocity of 12 feet per second. The​ height, h, of the pebble after t seconds is given by the equation h equals negative 16 t squared plus 12 t plus 900. How long after the pebble is thrown will it hit the​ ground?

Answers

A graphing calculator shows the time to be 7.884 seconds.

_____
The quadratic formula tells you the time is
.. t = (-12 -√(12^2 +4*16*900))/(-32) = (3/8)*(1 +√401) . . . seconds

Final answer:

To find when the pebble hits the ground, solve for time using the quadratic equation from the given height function, resulting in around 6 seconds.

Explanation:

To find how long the pebble takes to hit the ground, we need to find the time t when its height h becomes 0. This means we need to solve the equation for t when h = 0:

-16t² + 12t + 900 = 0

This is a quadratic equation, and we can solve it using various methods like factoring, the quadratic formula, or completing the square. Here, we'll use the quadratic formula:

t = (-b ± √(b² - 4ac)) / 2a

where a = -16, b = 12, and c = 900:

t = (-12 ± √(12² - 4 × -16 × 900)) / (2 × -16)

t = (-12 ± √(614400)) / -32

t ≈ (-12 ± 247.88) / -32

There are two possible solutions:

t1 ≈ 25.50 seconds

t2 ≈ -5.50 seconds (we can discard this since time cannot be negative)

The pebble will hit the ground approximately 6 seconds after it is thrown.

what is the value of z so that -9 and 9 are both solutipns fo x^2+z=103

Answers

well, we know the solutions are -9 and 9, so, let's just FOIL them then

[tex]\bf \begin{cases} x=-9\implies &x+9=0\\ x=9\implies &x-9=0 \end{cases} \\\\\\ (x+9)(x-9)=\stackrel{original~polynomial}{0}\implies x^2+0x-81=0 \\\\\\ x^2\underline{-81}=0\qquad \textit{and we can write }-81=\underline{-103+22} \\\\\\ x^2\underline{-103+22}=0\implies x^2+22=103[/tex]

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.

There are 6 speakers at a conference: Ms. Sally, Ms. Elaine, Ms. Boo-Koo, Mr. Adam, Mr. Jones, and Mr. Tall. In how many ways can we order the speakers so that Mr. Adam doesn’t speak first?

Answers

Problems such as this are called counting problems. They often ask "in how many way" something can occur. Here we have 6 speakers and need to arrange them in order. We can use the counting principle which tells us that the number of ways can be obtained by considering how many speakers could be chosen for each position (first, second, third, ...  sixth) and multiplying these.

Even though there are 6 speakers, Mr. Adam cannot go first so there are 5 choices for who goes first. That leaves 5 speakers who can go second. As we already picked two people, there are 4 speakers who can go third and 3 who can go fourth. That leaves 2 that can go fifth and 1 that is left for the last slot.

The total number of ways is given by (5)(5)(4)(3)(2)(1) = 600

the area of a rectangle is 20x^2-27x-8.the length is 4x+1. What is the width?

Answers

w= (5x - 8) this is your answer
⇒w=(5x−8)
Explanation:
Let width be w
Then w(4x+1)=20x2−27x−8
So
(?x+?)(4x+1)=20x2−27x−8
Note that
5×4=20 and (−8)×(+1)=−8
⇒w(4x+1)
=(5x-8)(4x+1)=20x2+5x−32x−8
⇒w(5x−8)

Which of the following is the solution of 5e^2x-4=11

Answers

Asked and answered elsewhere.
https://brainly.com/question/9020620

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7

What is the equation of the function y=3/x translated 4 units to the right and 5 units down

Answers

Translate 4 units right by replacing x with x-4. Translate down by subtracting that amount from the function.

y = 3/(x -4) -5

Answer:

The required equation is [tex]g(x)=\frac{3}{x-4}-5[/tex].

Step-by-step explanation:

The given function is

[tex]y=\frac{3}{x}[/tex]

It can be written as

[tex]f(x)=\frac{3}{x}[/tex]

The transformation of a function is defined as

[tex]g(x)=f(x+a)+b[/tex]

Where, a represents the horizontal shift and b represents the vertical shift.

If a>0, then the function f(x) shifts a units left and a<0, then the function f(x) shifts a units right.

If b>0, then the function f(x) shifts b units up and b<0, then the function f(x) shifts b units down.

Since the function translated 4 units to the right and 5 units down, therefore the value of a is -4 and bis -5.

[tex]g(x)=f(x-4)-5[/tex]

[tex]g(x)=\frac{3}{x-4}-5[/tex]                         [tex][\because f(x)=\frac{3}{x}][/tex]

Therefore the required equation is [tex]g(x)=\frac{3}{x-4}-5[/tex].

Mario bought a shirt priced at $ 24.99 and a pair of pants priced at $ 39.99. For these items, he paid a total of $ 69.53 , sales tax included. What was the sales tax rate?

Answers

24.99 + 39.99 = 64.98

69.53-64.98 = 4.55


4.55/69.53 = 0.0654 = 6.5% sales tax

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

Help me ASAP!!! THANKS!




RANDOM ANSWERS WILL BE MODERATED!

Answers

It isn't clear to me whether you want a graph of that region, or you want a graph of a function that has those characteristics. Either way, ....

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

An airline requires carry on luggage to weigh at most 40 pounds. Your suitcase currently weighs 10 pounds. How many pounds p are available for you to fill your suitcase with other items?

Answers

30 pounds is available to fill the suitcase with other items.

What is Algebra?

A branch of mathematics known as algebra deals with symbols and the mathematical operations performed on them.

Variables are the name given to these symbols because they lack set values.

In order to determine the values, these symbols are also subjected to various addition, subtraction, multiplication, and division arithmetic operations.

Given:

An airline requires carry on luggage to weigh at most 40 pounds.

The Suitcase presently carry 10 pounds.

Let  p be the pound available to fill your suitcase with other items.

So, p= 40- 10

p = 30 pounds

Hence, 30 pounds is available to fill the suitcase with other items.

Learn more about Algebra here:

https://brainly.com/question/24875240

#SPJ5

Y varies directly as x and inversely as the square root of w; write the sentence as an equation.

Answers

Y varies directly as x
y = kx

Y varies inversely as the square root of w
y = [tex] \frac{k}{ \sqrt{w} } [/tex]
Final answer:

The relationship where y varies directly as x and inversely as the square root of w can be represented by the equation y = k * (x / sqrt(w)). Here, k is a constant of proportionality.

Explanation:

From the statement given, we can deduce an equation representing a direct proportionality to x and an inverse proportionality to the square root of w.

In mathematics, direct and inverse proportionality relationships are commonly depicted as y = kx and y = k/x respectively, where k is a constant. For direct proportionality, as x increases, y also increases. Contrastingly, for inverse proportionality, as x increases, y decreases.

Given the statement, we can represent the relationship as follows: y = k * (x / sqrt(w)).

Here, y varies directly as x and inversely as the square root of w. The constant k is the constant of proportionality which can be determined based on specific values of x, y and w.

Learn more about Proportionality here:

https://brainly.com/question/32437705

#SPJ3

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

Look at the picture below // 99 points // PLEASEE HELPP

Answers

The answer will be A





area of hexagon = 3√3a^2 / 2 = 3√3 (18^2) / 2 = 842
area of rectangle = 21*18 = 378

area of shaded = 842 - 378 = 464

answer
A) 464  square units

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3
Other Questions
Why did the Soviet Union block all roads, rail, and river traffic into Berlin? hoow did rosa parks impact the civil rights movement In Mobutu Sese Sekos final years of rule, Zaire was largely reduced to a _____ economy. What is the product?5k/6 . 3/2k^3 Paul and jose are trying to measure the height of a tree. paul is standing 19m from the foot of the tree and measures the angle of elevation to the top of the tree to be 59o. jose measures it to be 43o, how far is jose from the base of the tree? Which statements about mutations are true? Check all that apply. The _____ theory suggests that the interstellar dust within a nebular cloud is the most important component of planet formation.nebularcondensationcometbig bang Justine is 14 years old. her parents are frequently annoyed because justine tends to ask critical questions such as, "why can't i have wine with dinner? you do." or "i don't understand why i'll be able to vote when i'm 18, but i have to wait until i'm 21 to buy alcohol!" this demonstrates justine's Both my daughters husbands are terrible cooks. Where are the apostrophes Use your knowledge of social studies and the information in the box to answer the following question. States' rights, including secession Equality of the sexes Abolition of slavery What do these social causes have in common? Their arguments are justified by the original language of the U.S. Constitution. They were all causes championed by Thomas Jefferson and George Washington. They use the language of the Declaration of Independence in their arguments. They are each specifically addressed in different sections of the Bill of Rights. how to set the answer up If simon wants to manage his relationships on facebook effectively, he will __________. Which statement about the following argument is true? Argument: If it snows, the roads will get slippery. It's snowing. Therefore, the roads are slippery. A:The argument is valid by the Law of Syllogism. B: The argument is valid by the Law of Detachment. C: The argument is invalid. D: The argument is valid but does not follow the Law of Syllogism or the Law of Detachment. During a construction project, heavy rain filled construction cones with water. The diameter of a cone is 12 in. and the height is 27 in. What is the volume of the water that filled one cone? Enter your answer as a decimal in the box. Use 3.14 for pi. What is the area of the composite figure whose vertices have the following coordinates?(4,3) , (2,3) , (4,1) , (0,3) , (2,1) Did you see those cars?Viste esas coches?Viste eses coches?'Viste astos coches?Viste aquellos coches? A scientist observes the ocean tides moving large amounts of sand from one part of the beach to another. This is evidence for which type of natural process? Physical weathering ,Chemical Weathering ,Erosion ,Deposition When he became president of the Confederacy, Jefferson Davis believed thatA Southern slavery would remain safe under Lincoln.B secession of the Southern states should be encouraged.C Lincoln would force states that seceded back into the Union. You need a method to remotely manage a few servers from any client within the enterprise. you want to avoid any method that requires additional client software except a web browser. what will you use? give an outline of tasks. Summarize the precedent of "judicial review," which was established in the case of Marbury v. Madison.