The diagram shows a spherical wave.

Which letter represents a wavelet?

A. W
B. X
C. Y
D. Z

The Diagram Shows A Spherical Wave. Which Letter Represents A Wavelet?A. WB. XC. YD. Z

Answers

Answer 1

the answer to this question is y

Answer 2

Answer:

Y    

Explanation:

According to Huygen's principle, each point on a wavefront is a source of wavelets which generates the next wavefront.

In the given diagram, point source of light that is the primary source is represented by W. X and Z are wavefronts. The points marked on X are point source of wavelets. On Z, a wavelet is represented by Y. The wavelets spread out in forward direction. The envelope of wavelets forms a wavefront.


Related Questions

what is the weight of 0.12kg mass?

Answers

Answer

1.1772 N

Step by Step Explanation

Given in the question,

mass of an object = 0.12 kg

To find the weight of this object we will use formula

weight = mass x acceleration due to gravity

We know that acceleration due to gravity on earth is constant = 9.81 m/s²

So,

weight = 0.12 x 9.81

           = 1.1772 N

Since it is not mention that were the object is so i assume that it is on earth but if it is on moon then acceleration due to gravity will be 1.625 m/s²

Compare and contrast velocity and speed

Answers

Velocity and speed are basically the same thing but velocity has a direction and speed does not. Both are the rate at which something or someone moves :)

what is the difference between transformation of energy and transfer of energy​

Answers

Final answer:

Transformation of energy involves converting energy from one form to another, while transfer of energy involves the movement of energy from one system to another without a change in form.

Explanation:

The difference between transformation of energy and transfer of energy lies in the change of form and location of energy. Transformation of energy refers to the conversion of energy from one form to another, such as chemical energy being transformed into heat energy through metabolism. Transfer of energy, on the other hand, refers to the movement of energy from one system to another without a change in form, like the transfer of electrical energy to light energy in a light bulb.

Learn more about Difference between transformation of energy and transfer of energy here:

https://brainly.com/question/2505689

#SPJ1

A spacecraft is launched from Earth toward the moon where will the spacecraft be when the gravitational forces acting on it are equal

A closer to earth than to the moon because the moon has greater mass than the earth

B closer to the moon because the moon greater mass than the earth

C closer to earth than to the moon because earth has greater mass

D Closer to moon than earth because earth has a greater mass than the moon

Answers

Answer:

D Closer to moon than earth because earth has a greater mass than the moon

Explanation:

As we know that gravitational force is given by

[tex]F = \frac{Gm_1m_2}{r^2}[/tex]

so here if the net gravitational force at some distance between moon and earth is zero or equal due to moon and earth then in that case

[tex]F_{moon} = F_{earth}[/tex]

so here we can say

[tex]\frac{GM_m m}{r_1^2} = \frac{GM_e m}{r_2^2}[/tex]

so here we will have

[tex]\frac{M_m}{M_e} = \frac{r_1^2}{r_2^2}[/tex]

since mass of earth is more than mass of moon so we can say

[tex]\frac{r_1}{r_2} < 1[/tex]

so here we have

[tex]r_1 < r_2[/tex]

so the position is closer to moon because moon is of smaller mass than earth

Final answer:

In a spacecraft launched from Earth toward the moon, the spacecraft will be closer to the moon than to Earth when the gravitational forces acting on it are equal.

Explanation:

In a spacecraft launched from Earth toward the moon, the spacecraft will be closer to the moon than to Earth when the gravitational forces acting on it are equal.

The gravitational force between two objects depends on their masses and the distance between them. Although the moon has smaller mass compared to Earth, it is much closer to the spacecraft when it reaches that point where the gravitational forces are equal. This is because the spacecraft has traveled a greater distance away from Earth.

So, the correct answer is option B, closer to the moon because the moon has greater mass than the earth.

PLEASE HELP ASAP!!! 40 POINTS AND BRAINLIEST TO FASTEST AND BEST ANSWER!!!
DO NOT ANSWER IF YOU DO NOT KNOW!!!
Ben made the following bar graph shown to represent the relative distances of four different astronomical bodies from Earth.
If A represents the sun, which of the following could be represented by C and D?

C could be Venus, and D could be the moon.
C could be Uranus, and D could be the moon.
C could be the moon, and D could be Venus.
C could be Uranus, and D could be Venus.

Answers

The answer is C could be the moon, and D could be Venus. ;)

The answer is C could be the moon, and D could be Venus Good looks out there

PLEASE ANSWER!!!!!

nova, whose mass is 50.0kg, stays out skiing for too long and her body temperature drops by 2.00 degrees celcius. what is the amount of heat lost from novas body? (human body = 3470J/kg degrees celcius)

Answers

Use the equation q=mc/\T, where q is the heat lost, m is mass, and /\T is the change in temperature, and c is the specific heat.

q=50kg(3470J/kg K)(2K)

q=347000 J

Any other questions, just ask.

Final answer:

The heat lost from Nova's body is calculated using the specific heat formula Q = mcΔT. Substituting in the given values, we find that Nova's body lost 347,000 joules of heat.

Explanation:

The amount of heat lost by Nova's body can be calculated using the specific heat formula which is: Q = mcΔT, where 'Q' is the heat transferred, 'm' is the mass, 'c' is the specific heat, and 'ΔT' is the change in temperature. In this case, you would substitute the given values into this formula: Q = (50.0kg) * (3470J/kg°C) * (2.00°C)

When you multiply these together, the resulting heat loss is 347,000 joules. Therefore, Nova's body lost 347,000 joules of heat while she was skiing.

Learn more about Heat Lost here:

https://brainly.com/question/16170617

#SPJ3

What do radio waves carry

Answers

The answer is modulation. In modulation a radio wave (also called the "carrier signal") is changed by the signal we want to send to the receiver, for example a song, or, in a wireless network, some data from a computer.

Answer:

Radio waves carry conversations, music, pictures, and information.

Explanation:

How much work is done if 10 N is applied to a 5kg object for 10 meters if there is an opposing force of 5 N

Answers

Answer:

50 J

Explanation:

The net force acting on the box is given by the algebraic sum of the two forces, so:

[tex]F=10 N -5 N = 5 N[/tex]

The net work done on the box is equal to (assuming the net force is parallel to the displacement of the object)

[tex]W=Fd[/tex]

where

F = 5 N is the net force on the object

d = 10 m is the displacement of the object

Substituting,

[tex]W=(5 N)(10 m)=50 J[/tex]

Are the wires ever empty of charge? (5 points) Yes No

Answers

Yes without an eletrical current attached there would be no electrons.

The wires are empty of charge when there is no current flowing and no electrons moving through wire.

What is charge?

The charge is the physical quantity which defines the object's electric field. The charged objects creates the electric field around it and attracts or repels another objects coming into that field.

The like charges repels each other and unlike charges attract each other.

When a wire is connected with battery or voltage source and switch is on, the electrons leave from positive terminal and heading towards the negative terminal. Thereby, resulting in flow of current through wire.

Charge q = no of electrons x charge on electrons

Thus, Yes, wires are ever empty of charge.

Learn more about charge.

https://brainly.com/question/19886264

#SPJ2

a player passes a 0.600kg basketball down court for a fast break.the ball leaves the player hands with a speed of 8.30m/s and slows down to 7.20 m/s at its highest point. Ignoring air resistance,how high above the release point it is at its maximum height?

Answers

At the release point, the ball has kinetic energy,

[tex]\dfrac12m{v_0}^2[/tex]

and at its maximum height it has potential and kinetic energy,

[tex]-mgy+\dfrac12mv^2[/tex]

where [tex]y[/tex] is the maximum height attained above the release point.

The LoCoE tells us that we should have

[tex]\dfrac12m{v_0}^2=-mgy+\dfrac12 mv^2[/tex]

[tex]\implies v^2-{v_0}^2=-2gy[/tex]

[tex]\implies\left(7.20\dfrac{\rm m}{\rm s}\right)^2-\left(8.30\dfrac{\rm m}{\rm s}\right)^2=-2\left(9.80\dfrac{\rm m}{\mathrm s^2}\right)y[/tex]

[tex]\implies y=0.870\,\mathrm m[/tex]

Answer: The maximum height of the ball is 0.87 m

Explanation:

To calculate the height of the ball, we use third equation of motion:

[tex]v^2-u^2=2as[/tex]

where,

s = distance traveled  / height of the ball = ?

u = initial velocity of the ball = 8.30 m/s

v = final velocity of the ball = 7.20 m/s

a = acceleration due to gravity = [tex]-9.8m/s^2[/tex]  (negative sign represents the ball is going upwards that is against gravity)

Putting values in above equation, we get:

[tex](7.20)^2-(8.30)^2=2\times (-9.8)\times s\\\\s=\frac{(7.20)^2-(8.30)^2}{(2\times (-9.8))}=0.87m[/tex]

Hence, the maximum height of the ball is 0.87 m

What happens to sound waves when you are moving toward the source of the sound?

Answers

Answer: Each consecutive disturbance has a further distance to travel before reaching observer A. For this reason, observer A observes a frequency of arrival that is less than the frequency at which the disturbances are produced.

Explanation:

The Doppler Effect

Suppose that there is a happy bug in the center of a circular water puddle. The bug is periodically shaking its  legs in order to produce disturbances that travel through the water. If these disturbances originate at a point, then they would travel outward from that point in all directions. Since each disturbance is traveling in the same medium, they would all travel in every direction at the same speed. The pattern produced by the bug's shaking would be a series of concentric circles as shown in the diagram at the right. These circles would reach the edges of the water puddle at the same frequency. An observer at point A (the left edge of the puddle) would observe the disturbances to strike the puddle's edge at the same frequency that would be observed by an observer at point B (at the right edge of the puddle). In fact, the frequency at which disturbances reach the edge of the puddle would be the same as the frequency at which the bug produces the disturbances. If the bug produces disturbances at a frequency of 2 per second, then each observer would observe them approaching at a frequency of 2 per second.

Now suppose that our bug is moving to the right across the puddle of water and producing disturbances at  the same frequency of 2 disturbances per second. Since the bug is moving towards the right, each consecutive disturbance originates from a position that is closer to observer B and farther from observer A. Subsequently, each consecutive disturbance has a shorter distance to travel before reaching observer B and thus takes less time to reach observer B. Thus, observer B observes that the frequency of arrival of the disturbances is higher than the frequency at which disturbances are produced. On the other hand, each consecutive disturbance has a further distance to travel before reaching observer A. For this reason, observer A observes a frequency of arrival that is less than the frequency at which the disturbances are produced. The net effect of the motion of the bug (the source of waves) is that the observer towards whom the bug is moving observes a frequency that is higher than 2 disturbances/second; and the observer away from whom the bug is moving observes a frequency that is less than 2 disturbances/second. This effect is known as the Doppler effect.

Answer:frequency increases

Normal force is exerted _____to the surface of an object.

A. perpendicular
B. 45 degrees
C. horizontal

Answers

The normal force is always (underline, bold) is always perpendicular to the surface an object is sitting on. If the object is on an inclined plane, then the normal will not be vertical but it will be perpendicular to the angle of the incline.

The diagram below (left) shows a normal force (GH) that is not vertical, but it is perpendicular to the surface. The object on the right is the more usual normal a mass on a table top.

The vertical line on the right is the normal and it points up.

Answer:

The correct option is A. perpendicular

Explanation:

In Physics, the normal force is the component of a contact force that is perpendicular to the surface that an object contacts. It is the support force exerted upon an object that is in contact with another stable object. Normal Force will be always acting opposite to the force falling on the surface. For example, if a book is resting upon a surface, then the surface is exerting an upward force upon the book in order to support the weight of the book.

A sodium has an atomic number of 11 and the atomic mass of 23. Determine the its proton, electrons, and neutrons

Answers

The mass number of an element tells us the number of protons AND neutrons in an atom (the two particles that have a measurable mass). Sodium has a mass number of 23amu. Since sodium has 11 protons, the number of neutrons must be 23 – 11 = 12 neutrons.

Please hurry

Which facility relies on a nonrenewable source of energy?
f A wind farm that uses wind turbines
g A dam that uses the power of water
h A solar farm that collects sunlight
j A power station that burns coal

Answers

power station that burns coal

Non- renewable source of energy is exhaustible resources. The facility relies on a non-renewable source of energy is a power station that burns coal.

What is Non- renewable source of energy?These are the sources that cannot be produced again if exhausted once. They may take millions of years to form. Such as coal, and natural gas.

Renewable sorces:

These are the source of energy that is present in inexhaustible amounts. Such as solar energy, water dams, wind power.

Therefore, the facility relies on a non-renewable source of energy is a power station that burns coal.

Learn more about the non-renewable source,

https://brainly.com/question/877821

what causes the phases of the moon as seen from earth brainly

Answers

From the Earth, we can see multiple phases of the Moon in a 28 days cycle. These phases are not changes int he Moon or how much of it is lightened, but instead it is a result of the positions that the Earth, Moon, and Sun have in relation to each other. The Sun is always lighting one half of the Moon, which is the half that is turned toward it. From the Earth it doesn't seem that way, as we can see Moon that seems fully light, partially light on the left side, partially light on the right side, or totally dark, but all of that depends on how much of the lighted side of the Moon is turned toward the Earth.

PLZ HELP ME FAST! How is frequency related to energy? Graph the relationship between the frequency and energy of a radio wave vs other types of electromagnetic waves on the graph below. Write 1- 2 sentences explaining the relationship you drew.

Answers

Do Not Know but let me ask my Brother bc he did it last Year

50 ml of milk at 5°C is added to 200 ml of hot chocolate at 95°C. What do you think the approximate new temperature is?

Answers

Answer;

76.3°C

Explanation;

Considering the fact that;

Specific heat capacity of the hot chocolate = 3.751 kJ/kg C°

Specific heat capacity of milk is 3.93 kJ/(kg.C°)

But;

Heat gained by milk = Heat lost by hot chocolate

If the final temperature is x , then

Heat gained by milk

= 0.05 × 3.93 × (x-5)

= 0.1965x - 0.9825

Heat lost by hot chocolate;

= 0.2 × 3.751 × (95-x)

= 71.269 - 0.7502x

Therefore;

0.1965x - 0.9825 = 71.269 - 0.7502x

0.1965 x + 0.7502x = 71.269 + 0.9825

                  0.9467 x  = 72.2515

                               x = 76.319 °C

Approximately, the new temperature is 76.3°C

Please help! last test of the week, and i can have a long weekedn! Friday and Sun and Sat.

Answers

It must have a medium to travel through.

Happy to help. Marking me the brainliest would really be appreciated.

Which statement is true of a concave lens?

Answers

The list of choices you gave us doesn't have any true statements on it.

The statement  true of a concave lens  is Option A.

What is concave lens?

Concave lens is a type of spherical lens which is polished from outside and it reflects the light coming from the object through its inner surface.

This lens is diverging in nature which means that the light rays gets diverged after reflection.

The nature of the image formed by these lens is virtual and the size of the image will be less than the object and the image formed will be upright.

Hence, the correct option is A.

Learn more about concave lens.

https://brainly.com/question/2919483

#SPJ2

In which situation is the gravitational force between two objects hard to detect? (Options)
a. If the mass of each object is very small.
b. If the objects are very close together.
c. If the mass of one of the objects is very great.
d. If the mass of both objects is very great.

Answers

Answer:

Hence, the correct option is (A) "If the mass of each object is very small".

Explanation:

The gravitational force between two objects is directly proportional to the product of masses and inversely proportional to the square of the distance between them.

The mathematical expression is given by :

[tex]F=G\dfrac{m_1m_2}{d^2}[/tex]

d is the distance between masses

Gravitational force is one of the fundamental force in the universe. If the masses of objects is too small, then their interaction with each other is hard to detect.

Hence, the correct option is (A) "If the mass of each object is very small".

7. A rock is projected upward from the surface of the moon, at time t = 0.0 s, with a velocity of The acceleration due to gravity at the surface of the moon is What is the maximum height of the rock above the surface?
278 m
202 m
245 m
115 m
125 m

Answers

The maximum height of the rock above the surface is 202 m

two wires a and b have equal lengths and are made of same material. If the diameter of wire A is twice that of wire B, which has the greater extension for a given load?

Answers

Answer:

It should be A.

Explanation:

Wire A and wire B are made from the same material and have the same length, however, wire A is wider which would allow more electricity or power to be transformed.

Unless im understanding your question wrong, but from what I do understand it is most likely A.

Hope this helps, could you mark me brainliest if it is right?

Meteoroids that strike Earth are called _____.

Answers

meteorite is when a meteor survives the earth atmosphere and Impacts the earth successfully.

The little stone while it's still in space . . . "meteoroid" .

The streak of light it makes shooting through atmosphere . . . "meteor" .

The piece of it that's left when it gets to the ground . . . "meteorite" .

Which describes how to compare the energy of two different waves?

A. measure their frequencies

B. measure their periods

C. measure their amplitudes

D. measure their wavelengths

Answers

Answer;

C. measure their amplitudes

Explanation;The amount of energy in a wave is related to its amplitude and its frequency.The amplitude of a wave is how the wave is measured from the rest position or mid-line to the top of a crest or bottom of a trough, measured in meters.A high amplitude wave is a high-energy wave, and a low-amplitude wave is a low-energy wave. For instance in the case of sound waves, a high amplitude sound will be loud, and a low amplitude sound will be quiet.

C measures their amplitudes. Hope this helps! :)

A garage door opener has a component that stop the door from coming down if something is in the way. This component is made up of a laser light on one side and a receiver on the other. Which best explains why this component works.

A) The receiver collects the laser light indicating that something is in the way.

B) Any object blocking the path of the laser will reflect the beam into the reciever.

C) Any object in its path changes the color of the laser before it gets to the reciever.

D) The laser light travels in a straight line towards the receiver, an object in the way blocks this straight line path.


The wavelength of a sound will give us information about________________.
A) how loud the sound will be
B) what produced the sound
C) the high or low pitch of the sound
D) the speed of sound

Which statement about how sound travels is true?
A) The speed of sound is the same at all times.
B) The speed of sound depends on the material it travels through.
C) Sound vibrations only move through a vacuum.
D) Sound moves faster through insulators than conductors.

Which statement about the electromagnetic spectrum is false?
A) There are wavelengths other than those of visible light in the spectrum.
B) Microwaves have a longer wavelength than visible light.
C) The higher the energy of the wavelength, the more dangerous they are.
D) Infrared light waves are visible.

Answers

laser in the garage . . . D

wavelength of a sound . . . C

how sound travels . . . B

electromagnetic spectrum . . . D

Final answer:

The garage door safety mechanism functions by blocking a laser beam, which triggers the system to halt the door. The wavelength of sound informs us about pitch, with longer wavelengths corresponding to lower pitches. The speed of sound is dependent on the medium it travels through, and infrared light waves are not visible to the human eye.

Explanation:

The component that prevents a garage door from closing if there is an obstruction works as follows: The laser light travels in a straight line towards the receiver, and if an object blocks this path, the door will not close. The correct answer is D. An object in the path interrupts the beam, which signals the system to stop the door.

Regarding sound waves, the wavelength of a sound provides information about the pitch of the sound, which means C is the correct answer. A longer wavelength correlates with a lower pitch, and vice versa.

The speed of sound does not remain constant and varies depending on the material through which it travels, making B the correct statement. This variability is due to differences in density and elasticity of different media.

In the electromagnetic spectrum, D is the false statement because infrared light waves are not visible to the human eye. The electromagnetic spectrum includes a range of wavelengths, some visible and some not, such as infrared.

a hot metal bolt of mass 0.05 kg and specific heat capacity 889 joules per kg degree celsius is dropped into a calorimeter containing 0.15 kg water at 21 degrees celsius. the bolt and water resch a final temperature of 25 degrees celsius. what is the initial temperature of the bolt? the specific heat capacity of water is 4186 joules per kilogram degrees celsius.

Answers

Answer;

80.87 °C

Explanation;

Change in Temp of metal = (C of water *mass of water* Change in temp of water)/(C of metal*mass of metal)

That is;

Change of temp. of metal

   = [(4186 J/kg*°C)×(0.15kg)×(25°C-21°C)/[(899 j/kg*C)×(0.050kg)

     = 55.87 °C

The change in temp of the metal is -55.87 °C  as the metal cools down

Therefore;

Change in temperature = Final Temperature-Initial Temperature Initial                                       Temperature = Final Temp.-Change in Temp

                      =25 °C- (-55.87 °C)

                       = 80.87 °C

how are power ratings used to describe machines?

Answers

power ratings basically just compare with how many watts are used, like a tackle in football compares to a car engine

For historical reasons, the horsepower is occasionally used to describe the power delivered by a machine. One horsepower is equivalent to approximately 750 Watts. ... Thus, the power of a machine is the work/time ratio for that particular machine. A car engine is an example of a machine that is given a power rating.

how does a pedometer help people reach their fitness goals

Answers

how does a pedometer help people reach their fitness goals?

a. It measures calories burned.  

b. It usually doubles as an MP3 player and keeps people motivated.  

c. They count steps during a workout.  

d. They measure the number of lifts done per exercise.

Answer:

By counting the steps it allows you to know the distance you have walked or ran.

Explanation:

A pedometer is an instrument that estimates the distance traveled by foot. It does this by recording the number of steps walked.

Some pedometers apps also have a feature that counts the calories burnt and lets you set the number of steps and calories you need to burn daily.

I hope this answer helps you.

At what point in its motion is the KE of a pendulum bob a maximum? 1. The KE does not change. 2. at the lowest point 3. at the highest point 4. midway between the highest and lowest points

Answers

Answer:

2. at the lowest point

Explanation:

The motion of the pendulum is a continuous conversion between kinetic energy (KE) and gravitational potential energy (GPE). This is because the mechanical energy of the pendulum, which is sum of KE and GPE, is constant:

E = KE + GPE = const.

Therefore, when KE is maximum, GPE is minimum, and viceversa.

So, the point of the motion where the KE is maximum is where the GPE is minimum: and since the GPE is directly proportional to the heigth of the bob:

[tex]GPE=mgh[/tex]

we see that GPE is minimum when the bob is at the lowest point,so the correct answer is

2. at the lowest point

Final answer:

The kinetic energy of a pendulum is maximum at the lowest point of its swing, where potential energy has been fully converted into kinetic energy.

Explanation:

The kinetic energy (KE) of a pendulum bob is at its maximum at the lowest point of its swing. This is because, as the pendulum falls from its highest point, it converts potential energy into kinetic energy. At the lowest point, all the potential energy that was present at the top has been transformed into kinetic energy, assuming no energy losses due to air resistance or friction. Conversely, at the highest points in the swing, the pendulum has maximum potential energy and minimum kinetic energy. Midway between the highest and lowest points, the pendulum has a mix of both kinetic and potential energy.

In Niels Bohr's model of the atom, electrons move

Answers

Answer:

they move in an orbit of a fixed size and also energy

Answer:

the electrons move by describing circular orbits around the nucleus.

Explanation:

The main characteristic of the Bohr model is that the electrons are located around the nucleus at certain determined distances. Bohr's model is simple and similar to Copernicus' planetary model, where the planets describe circular orbits around the Sun. The electron in an atom describes circular orbits, but the radii have fixed values.

Other Questions
Given AB= BC= CD. What is the measure of angle AFB? An article reports "attendance dropped 8 precent this year, to 3800." What was the attendance before the drop? A town has approximately 1000 homes the town Council is considering plans For future development plan a calls for an increase of 200 home per year Plan B calss for a 10% increase each year compare the plans 4x-11=3.2x+13. Write the lesser solution first. Round to the nearest tenth if needed Moving aside as their dad opened the garage door, Parker and Blaire gasped when they saw what was inside. It was the old and rare car model their dad had been searching years to find! The model looked completely alien to Parker, and he cautiously moved closer to examine it. He didn't understand why his father was so fascinated by something that looked so prehistoric and odd. Blaire's eyes, on the other hand, were ablaze with excitement. She ran to the car and stroked its hood. "This car is so beautiful and aristocratic that I can actually imagine the Queen sitting in the back!" Blaire said. For the last couple of months, Parker had been begging his dad to let go of his craze for old cars and buy a new car instead. But now, seeing the car in the garage, Parker felt he had no means left to convince his dad to change his mind. "What do you think, Parker?" Parker's dad asked with a grin. Parker could not be honest with his dad. Lately, Parker had realized that his father was always in his own little sphere of thought and passion when it came to collecting old and rare objects, and nothing Parker could say would change that. The barrier between their thoughts was not going to fade away. "It's great, Dad! The car will need a bit of a touch-up, though," Parker said. Blaire giggled when she saw her brother trying to act enthusiastic. 1 How does the first sentence develop the plot of the passage? A. It reveals Parker lack of excitement about his dad's new car. B. It conveys how excited Blaire is to see her dad's new car in the garage. C. It reveals that the kids are going for a ride in Dad's new car. D. It builds anticipation about what the characters will see in the garage. HELP Nevin started a geometric sequence. The first four terms of his sequence are show below. 162,54,18,6, . . .3.) What is the sixth therm of Nevin sequence? Show or explain how you got the answer. 4.) Write an expression that represents the term of Nevin sequence. Name an odd number that doesn't have an E in it Children from Chinas many different ethnic groups are taught to read and write in _____.the main dialect of their regionthe dialect they speak at homeMandarin, the northern dialectboth English and Chinese Two containers designed to hold water are side by side, both in the shape of a cylinder. Container A has a radius of 13 feet and a height of 13 feet. Container B has a radius of 9 feet and a height of 14 feet. Container A is full of water and the water is pumped into Container B until Conainter B is completely full. To the nearest tenth, what is the percent of Container A that is full after the pumping is complete? According to the federal regulations, which of the following studies meets the definition of research with human subjects?A. A researcher conducts a comparison of the comments made in a publicly available blog and the blogger's comments on a similar topic in a weekly magazine.B. A researcher sets up a meeting with the superintendent of a large and diverse public school system to get data about the ethnic composition of the school system and the number of students receiving free lunches.C. A cognitive psychologist enrolls undergraduate students for a computer-based study about the effect of mood on problem solving behaviors.D. Undergraduate students in a field methods class are assigned a research question and asked to interview another classmate, to be followed by a class discussion on interview techniques. Solve the triangle that has a=4.6, B=19, A=92 (picture provided) Consider the following balanced equation: SiO2(s)+3C(s)SiC(s)+2CO(g) Complete the following table showing the appropriate number of moles of reactants and products. If the number of moles of a reactant is provided, fill in the required amount of the other reactant, as well as the moles of each product formed. If the number of moles of a product is provided, fill in the required amount of each reactant to make that amount of product, as well as the amount of the other product that is made.Mol SiO2 Mol C Mol SiC Mol CORow 1: 3 _____ _____ _____Row 2: _____ 6 _____ _____Row 3: _____ _____ _____ 16Row 4: 2.8 _____ _____ _____Row 5: _____ 2.45 _____ _____A. complete the first row. Express your answers using one significant figure separated by commas. Mol C, Mol SiC, Mol CO =B. Complete the second row. Express your answers using one significant figure separated by commas. Mol SiO2, Mol SiC, Mol CO =C. Complete the third row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =D. Complete the fourth row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =E. Complite the fifth row. Express your answers using three significant figures separated by commas. Mol SiO2, Mol SiC, Mol CO = The emergence of__________ led people to question the role of religion in government. what is -4,5 reflected across the x axis 3(14-5x) = 72what is x A(n) __________ consists of independent firms at different levels of production and distribution joining together through contracts. Suppose there are ten five- and six-year-olds attending a birthday party. when a 30-year-old mother walks into the room with an infant in her arms, what happens to the mean age in the room? what happens to the standard deviation of ages in the room? remmi wrote the equation of the line y=1/3(x+2). He solved for x and got x=3y-2. which following is an equivalent equation for x? The belief that some races are innately superior to others is called _____ sidaanth kept a chart of his savings .which point represents this relationship?