The region around a magnet where the magnetic force is exerted is known as

Answers

Answer 1
The region around a magnet where the magnetic force is exerted is known as the magnetic field.

Related Questions

A rocket moves upward, starting from rest with an acceleration of +29.4 for 3.98 s. it runs out of fuel at the end of the 3.98 s but does not stop. m/s2 how high does it rise above the ground?

Answers

consider the motion of rocket until it runs out of fuel

v₀ = initial velocity = 0 m/s

v = final velocity when it runs out of fuel = ?

t = time after which fuel is finished = 3.98 sec

a = acceleration = 29.4 m/s²

Y₀ = height gained when the fuel is finished = ?

using the kinematics equation

v = v₀ + a t

v = 0 + (29.4) (3.98)

v = 117.01 m/s


using the equation

v² = v²₀ + 2 a Y₀

(117.01)² = 0² + 2 (29.4) Y₀

Y₀ = 232.85 m


consider the motion of rocket after fuel is finished till it reach the maximum height.

Y₀ = initial position = 232.85 m

Y = final position at maximum height

v₀ = initial velocity just after the fuel is finished = 117.01 m/s

v = final velocity after it reach the maximum height = 0 m/s

a = acceleration due to gravity = - 9.8 m/s²

using the kinematics equation

v² = v²₀ + 2 a (Y - Y₀)

inserting the values

0² = (117.01)² + 2 (- 9.8) (Y - 232.85)

Y = 931.4 m

The total distance traveled by the rocket above the ground is 931.4 m.

The given parameters;

acceleration of the rocket, a = 29.4 m/s²time of motion of the rock, t = 3.98 s

The distance traveled by the rocket during the 3.98 s is calculated as follows;

[tex]h_1 = v_0t + \frac{1}{2} at^2\\\\h_1 = 0 + \frac{1}{2} (29.4)(3.98)^2\\\\h_1 = 232.85 \ m[/tex]

The final velocity of the rocket after 3.98 s is calculated as follows;

[tex]v_i= v_0 + at\\\\v_i= 0 + (29.4 \times 3.98)\\\\v_i = 117.01 \ m/s[/tex]

"when the rocket runs out of fuel, it moves at a constant speed and the acceleration is zero. The rocket will be moving against gravity."

The distance traveled by the rocket when it runs out of fuel is calculated as follows;

[tex]v_f^2 = v_i^2 - 2gh_2[/tex]

where;

[tex]v_f[/tex] is the final velocity of the rocket at maximum height = 0

[tex]0 = (117.01)^2 -2(9.8)h_2 \\\\2(9.8)h_2 = (117.01)^2\\\\h_2 = \frac{ (117.01)^2}{2(9.8)} \\\\h_2 = 698.54 \ m[/tex]

Total distance traveled by the rocket above the ground;

H = h₁ + h₂

H = 232.85 m + 698.54 m

H = 931.4 m

Thus, the total distance traveled by the rocket above the ground is 931.4 m.

Learn more here:https://brainly.com/question/10180477

A favorable entropy change occurs when δs is positive. what can be said about the order of the system when δs is positive?

Answers

Final answer:

A positive entropy change (delta S) indicates that the system has become less ordered, as there is an increase in the number of possible microstates. This is aligned with the Second Law of Thermodynamics, which states that entropy increases in spontaneous processes, leading to greater disorder.

Explanation:

When a system undergoes a change and the entropy change (δS) is positive, this implies that the order of the system has decreased. This is because positive entropy reflects an increase in the number of microstates or possible configurations that the system can adopt, leading to a less ordered, more random state. A common example is the melting of a solid into a liquid where the rigid structure of the solid is lost, providing the particles more freedom to move in the liquid state, which translates into an increased entropy.

As per the Second Law of Thermodynamics, for all spontaneous processes in the real world, the change in entropy is positive (dδS > 0), which is consistent with the natural tendency for systems to move towards greater disorder and randomness. This concept is fundamental in predicting the spontaneous direction of chemical and physical processes. For instance, when a liquid freezes into a solid, the process is accompanied by a negative entropy change, signifying increased order in the system.

Final answer:

A positive entropy change (δS > 0) means that the order of the system has decreased, leading to a more disordered and randomized state with more microstates. This is in line with the Second Law of Thermodynamics, which predicts that the entropy of an isolated system tends to increase in spontaneous processes.

Explanation:

When the entropy change (δS) is positive, it indicates that the order of the system has decreased. This is because a positive δS suggests that the number of microstates and, therefore, the randomness of the system has increased. For example, when a solid changes into a liquid, there is an increase in entropy because the liquid state allows the particles more freedom of movement and positioning, leading to a higher number of microstates compared to the solid state. If the process were reversed and the liquid turned into a solid, δS would be negative, signifying a decrease in entropy as the system becomes more ordered.

Furthermore, the Second Law of Thermodynamics asserts that for any spontaneous process, the entropy of an isolated system will increase. This means the system will move towards a state with more microstates or higher disorder. It aligns with the observation that in irreversible processes, entropy tends to increase, indicating a spontaneous change in an isolated system.

In conclusion, a positive entropy change (δS > 0) aligns with the expectation that there are more microstates available in the final state compared to the initial one, resulting in a decrease in the orderliness of the system. The increase in entropy reflects the fundamental tendency for systems to evolve towards states of higher disorder and randomness.

Magnetic field lines curve out from one pole and return to the same pole.
t/f

Answers

That statement is a big fat prevarication.
Magnetic field lines start at one Pole and end at the OTHER one.

Answer:

the answer is false

Explanation:

your welcome

A satellite revolves around a planet at an altitude equal to the radius of the planet. the force of gravitational interaction between the satellite and the planet is f0. then the satellite is brought back to the surface of the planet. find the new force of gravitational interaction f4. express your answer in terms of f0.

Answers

Let
M = the mass of the planet
n = the mass of the satellite.
r = the radius of the planet

When the satellite is at a distance r from the surface of the planet, the distance between the centers of the two masses is 2r.
The gravitational force between them is
[tex]f_{0} = \frac{GMm}{(2r)^{2}} = \frac{1}{4} ( \frac{GMm}{r^{2}} )[/tex]
where
G =  the gravitational constant.

When the satellite is on the surface of the planet, the distance between the two masses is r.
The gravitational force between them is
[tex]f_{4} = \frac{GMm}{r^{2}} =4f_{0}[/tex]

Answer:  [tex]f_{4} = 4f_{0}[/tex]

f4 is 4 times larger than f0 The force of gravity between two masses is F = G M1M2/r^2 where F = Force G = Gravitational constant M1 = Mass of object 1 M2 = Mass of object 2 r = distance between the center of masses of the objects. So in the first case, the satellite is at an altitude of r above the surface. But it's really at a distance of 2r from the center of mass of the planet. And in the second case, the situation is that it's at distance r from the center of mass of the planet. So we have: f0 = G M1M2/((2r)^2) = G M1M2/(4r^2) and f4 = G M1M2/r^2 Let's divide f4 by f0 (G M1M2/r^2) / G M1M2/(4r^2) = (G M1M2/r^2) * (4r^2)/(G M1M2) = (1/r^2) * (4r^2)/1 = (4r^2)/r^2 = 4/1 = 4 So f4 = f0 * 4

What is the boiling point of oxygen

Answers

-297.3 Degrees F
or
-183 Degrees C

Hope this helps!

The boiling point of oxygen is 90.2 K or -183.15 °C.

At standard atmospheric pressure, the boiling point of oxygen is 90.2 K, which is equivalent to -183.15 °C or -297.67 °F.This allows oxygen to be separated from nitrogen and other components in liquid air through fractional distillation due to their different boiling points.

Encoding information occurs throughout?

Answers

Encoding information occurs throughout forming memory and is the first step of the memory process.
Final answer:

Encoding is a cognitive process happening at all stages of learning - acquisition, storage, and retrieval. It's crucial for learning new information or skills and happens continuously.

Explanation:

Encoding information occurs throughout the entire learning process. This cognitive process is essential in enabling us to acquire, store, and retrieve information. For example, while learning a new language, you first encode the foreign words and their meanings (acquisition), then store that encoded information in your memory (storage), and finally recall those words during a conversation (retrieval). Therefore, encoding is a continuous cycle that occurs throughout the process of learning any subject or skill.

Learn more about Encoding Information here:

https://brainly.com/question/31757060

#SPJ6

What determines the amount of chemical energy asubstance has

Answers

The amount of chemical energy a substance has is determined by its molecular structure and the type of chemical bonds it contains.

1. Molecular Structure:

  - The arrangement of atoms within a molecule determines its potential energy content.

  - Different substances have varying numbers and arrangements of atoms, leading to differences in chemical energy.

2. Type of Chemical Bonds:

  - Chemical energy is stored in the bonds between atoms within molecules.

  - The strength and type of chemical bonds, such as covalent bonds, ionic bonds, and hydrogen bonds, dictate the amount of energy stored in the substance.

  - Stronger bonds require more energy to break and thus store more chemical energy.

3. Potential Energy:

  - Chemical energy represents the potential energy stored within a substance's chemical bonds.

  - When chemical bonds are broken during a chemical reaction, the stored energy is released as heat or used to perform work.

4. Examples:

  - Substances with complex molecular structures and strong chemical bonds, such as hydrocarbons in fossil fuels, tend to have high chemical energy content.

  - Conversely, simpler molecules with weaker bonds, such as gases like hydrogen and oxygen, have lower chemical energy content.

Therefore, the amount of chemical energy a substance possesses is determined by its molecular structure and the type of chemical bonds it contains, with stronger bonds and more complex structures generally correlating with higher chemical energy content.

The complete Question is given below:

What determines the amount of chemical energy a substance has?

Is it possible to compress an ideal gas isothermally in an adiabatic piston–cylinder device? explain?

Answers

Answer: Since, Q = U+W (Q-W = U) With adiabatic, Q =0 If some work is done then, U will be non zero. And since U is internal energy change it should result in a temperature change. With isothermal process we are also saying U=0 but that would imply that W=0. However we did work since compression requires work to be done. So it is not possible.

12 points. Change of state:
Identify the process that causes each change of sate describe below, Write the appropriate answer on the space provided.
_______a. an ice cube left in a freezer for a month becomes smaller.

_______b. drops of water appear on the side of a glass of ice water.

_______c. a rainy morning turns sunny, and puddles disappear from a sidewalk.

Answers

Sublimation: A) an ice cube left in a freezer for a month becomes smaller.

Condensation: B) drops of water appear on the side of a glass of ice water.

Evaporation: C) a rainy morning turns sunny, and puddles disappear from a sidewalk.

An object starts from rest and falls under the influence of gravity. draw graphs of its speed and the distance it has fallen as a function of time from t=0 to t=5s

Answers

For an object that is under the pull of only the force of gravity, the motion is called free-fall. The equations that would allow us to calculate for the speed and distance is,

        Speed = gt

Where g is the acceleration due to gravity and the t is the time.

For the distance, it is calculated through the equation,

     Distance = vt + 1/2gt^2

Where v is the initial velocity and is equal to zero.

 

The graphs are attached.



A golf ball is hit with an initial speed of 33 m/s at an angle less than 45∘ above the horizontal.

Answers

what is the question?

What kind of materials can become electrically charged when they are rubbed together?

Answers

Negatively charged particles called electrons move from one material to the other. But i am not sure what kind of material 

Answer:

When insulating materials rub against each other, they may become electrically charged . Electrons , which are negatively charged, may be 'rubbed off' one material and on to the other. The material that gains electrons becomes negatively charged.

Explanation:

[tex]hope \: it \: helps \: you \: [/tex]

The carpal bones in the hands are an example of __________.

Answers

The carpal bones in the hands are an example of __________.
Answer: gliding joints

A gliding joint means a freely moving joint in which the articulations allow only gliding motions

Answer:

A gliding joint means a freely moving joint in which the articulations allow only gliding motions

Explanation:

In a local bar, a customer slides an empty beer mug down the counter for a refill. The height of the counter is 1.14 m. The mug slides off the counter and strikes the floor 0.60 m from the base of the counter.

Answers

Say the horizontal component of the velocity is vx and the vertical is vy.
Initially at t=0 (as the mug leaves the bar) the components are v0x and v0y.
Obviously (I hope!) v0y = 0.

The equations for horizontal and vertical projectile motion (with the positive direction up) are

x = x0 + v0x t
y = y0 + v0y t - 1/2 g t^2 = y0 - 1/2 g t^2

Now choose the origin to be the end of the counter. x0=0 and y0=0. The equations simplify to

x = v0x t
y = - 1/2 g t^2

You know that x = 1.20m when y = -0.88m
From the y equation (and g=10 m/s^2) you can calculate the time that the mug hits the floor.
t = 0.420s
From the x equation we get the initial horizontal velocity
v0x = x/t = 1.2/0.42 = 2.86 m/s

(b) x-component of velocity is constant since there are no horizontal forces so vx = 2.86 m/s
y-component is given by v = u+at with u=0 and a=-g
vy = -gt = -4.2m/s

Now tan(angle) = vy/vx so angle = arctan(vy/vx)
Final answer:

The student's question pertains to the physics concept of projectile motion. The mug's trajectory is determined by its initial horizontal velocity, the counter's height, and gravity. One could compute the time it takes for the mug to hit the ground and its initial speed.

Explanation:

This question is about the physics concept of projectile motion. When the beer mug slides off the counter and falls to the ground, it follows a trajectory determined by the initial horizontal velocity at which it was pushed, the height of the counter, and the acceleration due to gravity.

To find out how long it takes for the mug to hit the ground, we can use the equation of motion: h = 0.5gt^2, where h is the height from which the object is dropped (1.14m in this case), g is acceleration due to gravity (approximately 9.8 m/s^2) and t is time. Solving for t gives us the time it takes for the mug to hit the floor.

Once we know the time, we can find the initial horizontal velocity using the formula v = d/t, where v is velocity, d is distance (0.60m) and t is time. This gives us the initial speed at which the mug was slid.

Learn more about Projectile Motion here:

https://brainly.com/question/29545516

#SPJ12

what energy is the flow of electrons that creates a charge, one of the main forms of energy

Answers

What energy is the flow of electrons that creates a charge, one of the main forms of energy=  Electrical Energy

Answer:

electricity

Explanation:

just got the question and it was right

Which of the advantages to social media as a new media could also be viewed as a disadvantage

Answers

Fast Communication, can be used for good and can be used for bad hackers.
talking to people over the internet because some people would rather hang out online as some would like to go out to hang out

A second order chemical reaction involves the interaction (collision) of one molecule of a substance p with one molecule of a substance q to produce one molecule of a new substance x; this is denoted by p + q → x. suppose that p and q, where p = q, are the initial concentrations of p and q, respectively, and let x(t) be the concentration of x at time t. then p − x(t) and q − x(t) are the concentrations of p and q at time t, and the rate at which the reaction occurs is given by the equation dx/dt = α(p − x)(q − x), (i) where α is a positive constant. (a) if x(0) = 0, determine the limiting value of x(t) as t → ∞ without solving the differential equation. then solve the initial value problem and find x(t) for any t.

Answers

From (i) it’s indistinct that there are two equilibrium solutions x = p and x = q. Since p 6= q we might as well accept p < q (or else we just switch the roles of p and q). By examining the derivatives of f(x) = α(p − x)(q − x) at p and q we see that f 0 (p) = −α(q − p) < 0 and f 0 (q) > 0. Therefore x = p is an asymptotically stable solution and we expect x → p as t → ∞

(see attached file for the solution) the answer would be if we use the initial condition we get C = p/q.

During cooling, the kinetic energy of the molecules falls. Why does this happen?

Answers

because the motion of the molecules slow down

The correct answer of this question is : Molecular motion or vibration slows down

EXPLANATION :

The kinetic energy of the molecule depends on the molecular motion. Molecules might have different types of kinetic energy depending on the type of substance i.e solid,liquid or gases.

During cooling, we are reducing the temperature of the substance. Due to the decrease of temperature, the molecular speed is also decreased. It is so because the molecular speed is dependent on the temperature of the substance.

Hence, the vibration, rotation or translation motion of the molecule slows down during cooling, which in turn, decreases the kinetic energy of the molecule.

the work a force does on an object depends on

Answers

the work a force does on an object depends on amount of force exerted on the object and the amount of distance the object moves. According to Newton's Second Law of Motion, the net force on an object is dependent on the mass of the object, and its acceleration during the movement.
The work a force does on an object depends on...Mass. I'd say mass as it typically depends on mass on how much force is needed. Hope this helps.

A basket of negligible weight hangs from a vertical spring scale of force constant 1500 n/m . if you suddenly put an adobe brick of mass 3.00 kg in the basket, find the maximum distance that the spring will stretch.

Answers

Refer to the diagram shown below.

k = 1500 N/m, the spring constant
W = (3 kg)*(9.8 m/s²) = 29.4 N, the weight of the brick

Let d =  the deflection of the spring.
By definition,
W = k*d
d = (29.4 N)/(1500 N/m) = 0.0196 m

Answer: 0.0196 m
The maximum distance the spring will stretch is 3.92 cm or 0.0392 m.

Describe what would happen if you rubbed a mineral with a Mohs hardness value of 7 against a mineral with a value of 5?

Answers

The mineral with Mohs hardness would be scratched because the mineral with Mohs 7 hardness is stronger than the Mohs 5 mineral. Eventually, that mineral would turn into dust if you kept rubbing it.

If a mineral with a Moh's hardness value of 7 is rubbed against the mineral with a value of 5, the mineral with value 5 get scratched with the mineral with hardness value 7.  

• A scale of relative mineral hardness invented by German scientist Mohs is known as the Mohs scale of hardness or Mohs scale.  

• It is a 10 point scale, with 10 given to mineral diamond as the most hardest mineral, which can scratch the minerals below it, that is, coming below it in the hardness scale.  

• The minerals coming in the 7 scale are Quartz, Citrine, Agate, and Amethyst, and the mineral coming in the 5 scale is apatite.  

• Thus, when one rubs the mineral with 7 hardness with a mineral with 5 hardness, than the mineral with 5 hardness will easily get scratched as it is less harder to the mineral in the 7 scale.  

Thus,  the mineral with value 5 get scratched with the mineral with hardness value 7.

To know more about:

https://brainly.com/question/11451129

The branch of mechanics dealing with the mathematical methods of describing motion is calle

Answers

This branch of mechanics is called kinematics. A way to remember this is to remember that energy in motion is called kinetic energy. So, kinematics deals with describing motion. 

\a stone is dropped from the top of a cliff. it hits the ground below after 3.80s. how high is the cliff in meters?

Answers

no velocity ws given? let's use
H= ½gt²
H= ½×10×3.8
H= 19m

A car goes from 40n/s to 60 m/s in 8s the acceleration of the car is

Answers

Acceleration= change in velocity/ change in time.

60-40=20 m/s (change in speed)
Time= 8 seconds

20/8= 2.5
Acceleration= 2.5 m/s^2

Hope this helps! :)
The acceleration is the change in velocity. The kinematic formula that is used is a=Δv/Δt.
Δ- stands for change in velocity 
given: vi=40 m/s, vf=60 m/s, t= 8s
Δv= vf-vi= 60-40=20
a=20/8=2.5
a=2.5 m/s^2

Part b suppose the magnitude of the gravitational force between two spherical objects is 2000 n when they are 100 km apart. what is the magnitude of the gravitational force fg between the objects if the distance between them is 150 km ? express your answer in newtons to three significant figures. hints fg = 889 n submitmy answersgive up correct significant figures feedback: your answer 890 n was either rounded differently or used a different number of significant figures than required for this part. part c what is the gravitational force fg between the two objects described in part b if the distance between them is only 50 km ?

Answers

b) The force with a distance of 150 km is 889 N c) The force with a distance of 50 km is 8000 N This question looks like a mixture of a question and a critique of a previous answer. I'll attempt to address the original question. Since the radius of the spherical objects isn't mentioned anywhere, I will assume that the distance from the center of each spherical object is what's being given. The gravitational force between two masses is given as F = (G M1 M2)/r^2 where F = Force G = gravitational constant M1 = Mass 1 M2 = Mass 2 r = distance between center of masses for the two masses. So with a r value of 100 km, we have a force of 2000 Newtons. If we change the distance to 150 km, that increases the distance by a factor of 1.5 and since the force varies with the inverse square, we get the original force divided by 2.25. And 2000 / 2.25 = 888.88888.... when rounded to 3 digits gives us 889. Looking at what looks like an answer of 890 in the question is explainable as someone rounding incorrectly to 2 significant digits. If the distance is changed to 50 km from the original 100 km, then you have half the distance (50/100 = 0.5) and the squaring will give you a new divisor of 0.25, and 2000 / 0.25 = 8000. So the force increases to 8000 Newtons.

(b). The gravitational force between the objects when they are 150 km apart is [tex]\boxed{889\,{\text{N}}}[/tex].

(c). The gravitational force between the objects when they are 50 km apart is [tex]\boxed{8000\,{\text{N}}}[/tex] .

Further Explanation:

The gravitational force of attraction between the two bodies is given by the Newton’s Law of Gravitation. According to Newton’s law of Gravitation, the gravitational force between two bodies is directly proportional to the product of their masses and inversely proportional to the square of the distance between them.

The gravitational force is expressed mathematically as:

[tex]F = \dfrac{{G{m_1}{m_2}}}{{{r^2}}}[/tex]

Here, [tex]G[/tex] is the gravitational constant, [tex]{m_1}[/tex] is the mass of first body, [tex]{m_2}[/tex] is the mass of second body and [tex]r[/tex] is the distance between two bodies.

For two bodies kept at a distance of 100 Km , the gravitational force of attraction is 2000 N.

Substitute 200 N for [tex]F[/tex] and 100 Km for r in above equation.

[tex]\begin{aligned}2000=\frac{{G{m_1}{m_2}}}{{{{\left( {100\times {{10}^3}}\right)}^2}}}\hfill\\G{m_1}{m_2} = 2\times {10^{13}}\hfill\\\end{aligned}[/tex]

Part (b):

Now, the force experienced by the bodies when they are 150 Km apart is:

[tex]F = \dfrac{{G{m_1}{m_2}}}{{\left( {150 \times {{10}^3}}\right)}}[/tex]

Substitute [tex]2 \times{10^8}[/tex] for [tex]G{m_1}{m_2}[/tex] in above equation.

[tex]\begin{aligned}F&=\frac{{2 \times {{10}^{13}}}}{{{{\left( {150 \times {{10}^3}}\right)}^2}}}\\&= 888.9\,{\text{N}}\\&\approx {\text{889}}\,{\text{N}}\\\end{aligned}[/tex]

Thus, the gravitational force between the objects when they are 150 Km  apart is [tex]\boxed{889\,{\text{N}}}[/tex].

Part (c):

Now, the force experienced by the bodies when they are 50 km apart is:

[tex]F =\Dfrac{{G{m_1}{m_2}}}{{\left( {50 \times {{10}^3}}\right)}}[/tex]

Substitute [tex]2 \times {10^8}[/tex] for [tex]G{m_1}{m_2}[/tex] in above equation.

[tex]\begin{aligned}F &=\frac{{2 \times {{10}^{13}}}}{{{{\left({50 \times {{10}^3}}\right)}^2}}}\\&= 8000\,{\text{N}}\\\end{aligned}[/tex]

Thus, the gravitational force between the objects when they are 50 Km  apart is  [tex]\boxed{8000\,{\text{N}}}[/tex].

Learn More:

1. Calculate the total force on the earth due to Venus, Jupiter, and Saturn https://brainly.com/question/2887352

2.Compare the surface area–to–volume ratios of Earth and Venus https://brainly.com/question/7227193

3.A rocket being thrust upward as the force of the fuel being burned https://brainly.com/question/11411375

Answer Details:

Grade: College

Subject: Physics

Chapter: Newton’s law of Gravitation

Keywords:  Gravitation, newton’s law, force of attraction, 2000N, 100km, 150 km, 50 km, gravitational force, two spherical objects, 889 N, 8000 N.

Which of the following is an example of speed?
A) 8m/s
B) 7 m/s north
C) -3 m/s^2 east
D) 5 m/s^2 east

Answers

The answer should be a. Speed is not related to the direction

The right ventricle transports oxygenated blood to the lungs.


Please select the best answer from the choices provided.

T
F

Answers

Answer: False

Explanation: The circulatory system of the body consists of the heart, blood vessels and blood. The deoxygenated blood from the body is carried to the heart.

Here, the deoxygentaed blood is converted into oxygenated by removing carbon dioxide from them and making it oxygenated.

The impure blood from the body is collected by the right ventricle and transported to the lungs for purification and then transported to the body.

The correct answer is F (False)

Explanation:

In anatomy, the heart which is the organ in charge of pumping blood to all the body is divided into different sections that include the aorta, the superior vena cava, the right/left atrium, the pulmonary valve, and the right/left ventricles. In the case of the right ventricle, this is a chamber located on the right side of the hearth and the main function of this is to pump blood that is low in oxygen or de-oxygenated blood to the lungs through the pulmonary artery. On the other hand, the left ventricle pumps oxygenated blood to all the body. This implies, it is false the right ventricle transports oxygenated blood to the lungs because it pumps de-oxygenated rather than oxygenated blood.

which measurement gives the most accurate number for a population in an area?

A) add the biodiversity of an area to the carrying capacity.

B) add the individuals who come into an area because of reproduction or immigration.

C) add the individuals living or born in an area and subtract those who die.

D) subtract the animals that die from the total carrying capacity.

Answers

The most accurate number for a population in an area is measured by adding the individuals living or born in an area and subtract those who die. So, option C.

The amount of people living in a particular area is called population density.

The majority of the time, it applies to people, but occasionally it also does to other living things. It is a significant geographic term. Population density is the total number of people residing in a certain area per square kilometer, or other units of land area.

Demography is the statistical study of populations and how they change through time.

Population size, or the total number of people, and population density, or the number of people per unit of space or volume, are the two most important measurements of a population.

To learn more about population, click:

https://brainly.com/question/16894337

#SPJ1

Final answer:

The most accurate way to measure population size is by adding the number of births and individuals present, while subtracting the number of deaths (which corresponds to option C). Sampling techniques like quadrats and mark-recapture are often used due to the impracticality of counting all individuals.

Explanation:

In the context of estimating population size, the most accurate measurement for a population in an area would be to add the individuals living or born in an area and subtract those who die (Option C). This method accounts for natural population changes such as births and deaths.

Although counting all individuals would provide the most precise number, this is often not feasible. Instead, scientists often use sampling techniques to estimate population size. For stationary or slow-moving organisms, a quadrat can be used, while for mobile organisms, methods like mark and recapture might be employed.

Carrying capacity is a separate concept indicating how many individuals an area can sustain based on resources. Adjustments to population estimates may be necessary when populations near their carrying capacity, as density-dependent factors might affect population growth.

if you push a block across the floor with constant force the block will

Answers

Move I'm not sure if that is what you were looking for though

Why is the primary mirror in a telescope curved?
to magnify the image
to direct light rays to a focal point to intensify them
to change the direction of the rays
to bend the rays
to absorb extra light

Answers

Answer: to direct light rays to a focal point

Explanation:

A reflecting telescope uses curved mirror as primary and a plane mirror placed at an angle as secondary. A curved mirror is used as primary because this mirror collects the light from distant celestial object and converges its light at focus where the plane mirror is kept at an angle so that the reflected light is received by the eyepiece.

It is used as a curved primary mirror in a telescope because to direct light rays to a focal point.

What lenses are used in the telescope?

For the construction of a telescope, the physicist Galileo used a lens of the converging type and a lens of the diverging type. In his telescope, the first lens, called the objective, formed a real image of the object in question.

A reflecting telescope uses curved mirror as primary because this mirror collects the light from distant celestial object and converges its light at focus where the plane mirror is kept at an angle so that the reflected light is received by the eyepiece.

See more about telescope at brainly.com/question/556195

Other Questions
How many moles of c9h8o4 are in a 0.300 g tablet of aspirin? Preferred stock of leaping dolphin inc. pays 8% on the $100 par value. what is the value of the stock if the appropriate discount rate is 6%? Which of these excerpts from "The First Seven Years" by Bernard Malamud best exemplifies the desire to improve one's socioeconomic status? Bill has a mortgage loan on his personal residence. he decides to pay 18 months of interest in advance on october 1, 2016. the total advanced interest payment is $36,000. how much of the advance interest payment can he deduct in 2016?a. $36,000b. $6,000c. $24,000d. mortgage interest is not deductible.e. if a taxpayer makes an advance payment, he may not deduct any interest. What are some questions that a 1700's colonist might ask someone who is moving to the United States today? Which is a characteristics of an autobiography? What do you think tom and daisy were saying in the kitchen? a population that increases 5 percent every year is said to be experiencing What is the equation of the quadratic function with roots -3 and 1 and a vertex a (-1, -8)? Unlike the kings and queens of England, monarchs in France Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart?