what are the steps for using a compass and a straightedge to construct a line perpendicular to a given line through a point not lying on the given line?

Answers

Answer 1
Here is a picture of how to do it. (:
What Are The Steps For Using A Compass And A Straightedge To Construct A Line Perpendicular To A Given
Answer 2

Answer:

As mention in the explanation steps.

Step-by-step explanation:

Te following steps may be helpful for using a compass and a straightedge to construct a line perpendicular to a given line through a point not lying on the given line (as shown in the figure).

Step - 1. Draw a line (line AB)

Step- 2. Take a point (point P), that do not lie on the line AB.

Step - 3. Assume point p as a center an draw as arc which intersect the line AB at two point (point C and point D).

Step - 4. Now draw a line XY that is  the perpendicular bisector of line segment CD. This recurred line XY is the  line perpendicular to a given line (line AB) through a point not lying on the given line.  

What Are The Steps For Using A Compass And A Straightedge To Construct A Line Perpendicular To A Given

Related Questions

If f(x)= 2x+8 and g(x) = x^4, what is (g°f)(-3)?

Answers

g(f(x))=(2x+8)^4=>g(f(-3))=(2(-3)+8)^4=(-6+8)^4=(+2)^4=16
To answer this question, first you need to find the (g°f) function. It will be found by inserting the f(x) into g(x). It should be: 
g(x) = x^4
(g°f)(x)= (2x+8)^4
(g°f)(-3)= (2*-3+8)^4
(g°f)(-3)= (8-6)^4= 2^4= 16

(50 POINTS) Hi, I really need help on this first part of my portfolio it was due last week but I don't really get this part so if someone could explain it to me I could get the other four parts done on my own.
-------
Use the City Populations table found on the message board and select a city that is experiencing population growth. Determine the percentage growth and use that to write an exponential function to represent the city’s population, y, based on the number of years that pass, x from 2010 (i.e. 2011 means that x = 1)

City: Portland, Oregon 585,256 593,939 603,026 609,456 619,334 630621 639863

This was deleted once and idk why there is plenty of information :(

Ik this is a lot to ask of someone but I haven't had any luck with any function sites.

Answers

hello im sorry ur question got answered so late but i beleive the answer is 585,256(1+.015)^x

This is a number that can be divided out of each term in an expression.

Answers

Answer:

Hello!

Great question!

The correct answer would be "Common Factor."

Step-by-step explanation:

It is a common factor when it is a factor of two (or more) numbers.

The number which can be divided out of each term in an expression is called the GCF or greatest common factor of that number.

What is GCF (greatest common factor)?

GCF or greatest common factor is the common number which all the term has in a group of terms. It is the number which can divide each number of the group.

For example, let a group of number as,

[tex]\{1,2,4,8,16\}[/tex]

The number which can be divided out of each term in this data is 16 which is the greater common factor of this data set.

Thus, the number which can be divided out of each term in an expression is called the GCF or greatest common factor of that number.

Learn more about the GCF here;

https://brainly.com/question/219464

#SPJ2

For f(x)=3x+1 and g(x)=x squared - 6 find (f- g)(x)

Answers

It helps to first clarify that the notation (f - g)(x) simply means f(x) - g(x). Given that, let's look at our f(x) and our g(x) here, and use their definitions to find their difference.

[tex]f(x)=3x+1\\g(x)=x^2-6[/tex]

When we're taking (f - g)(x), we simply substitute the expression 3x + 1 for f(x) and the expression x² - 6 for g(x) to obtain:

[tex](3x+1)-(x^2-6)=3x+1-x^2+6[/tex]

Or, ordering the polynomial from highest power to lowest and combining the constants:

[tex]-x^2+3x+7[/tex]

Edit: By request, here's what would happen if you had something instead like:

[tex](f\times g)(x)[/tex]

In this case, you'd have to *multiply* the two function expressions together. Here's what that would look like:

[tex](3x+1)(x^2-6)[/tex]

Using the distributive property, we can distribute the expression [tex]3x+1[/tex] to the terms [tex] x^{2} [/tex] and [tex]-6[/tex]:

[tex](3x+1)x^2-(3x+1)6[/tex]

Distributing again, we get:

[tex]3x(x^2)+x^2-3x(6)+6=3x^3+x^2-18x+6[/tex]

And we're done.

Multiplying by a conjugate gives a rational number because (a + b)(a -
b.= _____.

Answers

Use foil.

(a+b)(a–b)
a^2 -ab +ab -b^2
a^2 – b^2

Hope I helped :)

Factor the expression using the GCF. The expression 3y−24 factored using the GCF is

Answers

The GCF is three so it would be y-8.
take out a 3, you'll get
3(y-8)

Solve the following equation.75 = –5(–3 – 4x)

x = 3

x = –4

x = –3

x = 5

Answers

x=3. if u want me to explain it i will. yw
75 = –5(–3 – 4x)

x=3

75=-5(-3-4(3)
75=15+60
75=75 true

75 = –5(–3 – 4x)

x=-4

75=-5(-3-4(-4)
75=15-80
75=65 false

75 = –5(–3 – 4x)

x=-3

75=-5(-3-4(-3)
75=15+12
75=27 false

75 = –5(–3 – 4x)

x=5

75=-5(-3-4(5)
75=15-20
75=-5 false




A probability experiment consists of rolling a fair 16​-sided die. Find the probability of the event below of rolling a 5.

Answers

Lets first consider how many different possibilities there are: 16 sided die means it has 16 different numbers.

Only one of the numbers is 5, so the probability is 1 out of 16 also written as: 1/16. 

So the probabilty of rolling a 5 is 1/16.

Muchas luck on your math!

Answer:

The probability of the event below of rolling a 5 is 0.0625.

Step-by-step explanation:

Given is : A probability experiment consists of rolling a fair 16​-sided die. Find the probability of the event below of rolling a 5.

Total number of faces = 16

So, there is only one way for rolling a 5 on a die

And the probability of rolling a 5 on a die = [tex]\frac{1}{16}[/tex]

= 0.0625

A line goes through the points (8,9) and (2,4).

What is the slope of the line?

Write the equation of the line in point-slope form?

Write the equation of the line in slope-intercept form?

Answers

9-4/8-2
5/6
The slope is 5/6
y-4=5/6(x-2)
y-4=5/6x-5/3
y=5/6x+7/3
The equation of line in point-slope is y - 4 = 5/6(x - 2)
The equation of the line in slope-intercept is y = 5/6x + 7/3

Quadrilateral ABCD is located at A(−2, 2), B(−2, 4), C(2, 4), and D(2, 2). The quadrilateral is then transformed using the rule (x − 2, y + 8) to form the image A'B'C'D'. What are the new coordinates of A', B', C', and D'? Describe what characteristics you would find if the corresponding vertices were connected with line segments.



Answers

Quadrilateral ABCD is located at A(−2, 2), B(−2, 4), C(2, 4), and D(2, 2). The quadrilateral is then transformed using the rule (x − 2, y + 8) to form the image A'B'C'D'. What are the new coordinates of A', B', C', and D'? Describe what characteristics you would find if the corresponding vertices were connected with line segments. A!!!

Simplify 5 - 2 · 3 + 4. 13 -5 3 21

Answers

the answer is 3!

 P.S. Brainliest would be awesome! i am trying to rank up and this will really help! i only need one more brainliest!
Yes it is 3. She is right


Evaluate u + xy, for u = 20, x = 9, and y = 8.

Answers

92 is your answer
20 + 9(8)

10(2y+2)−y=2(8y−8). please help me

Answers

10(2y+2)−y=2(8y−8)
                =
               12-

What did the doctor say to the guy who thought he was a wigwam one day and teepee the next? math riddle

Answers

The correct answer is " too tense" This is the correct answer because it is a play on words comparing "tents" which describes the native american home structure of a wigwam and a teepee and "tense" which describes a physiological response to high anxiety.

Answer:

too tenes

This is the correct answer because it is a play on words comparing tents which describes the native american home structure of a wigwam and a teepee and tense, will which describes a physiological response to high anxiety6.

Auto insurance options offered by AA Auto Insurance are outlined in the table below.  What monthly payment would you expect for an insurance policy through AA Auto Insurance with the following options? Bodily Injury:  $25/50,000 Property Damage:  $25,000 Collision:  $250 deductible Comprehensive:  $100 deductible
a.
$43.23
b.
$46.10
c.
$54.85
d.
$64.44


 

Answers

Option C. 54.85
22.5 + 120.5 + 415.25 + 100 = 658.25
658.25/12 = 54.854
round down and get answer c

In this exercise we have to use the knowledge of finance to calculate the monthly amount of insurance, so the best alternative that represents this amount is:

Option C

In this exercise we want to calculate the monthly insurance payment amount, so from the given values ​​we find:

[tex]Payment= (Bodily Injury)+ (Property Damage)+ (Collision)+(Comprehensive)[/tex]

Substituting the values ​​in the formula given above we find that:

[tex]Payment= 22.5 + 120.5 + 415.25 + 100 \\= 658.25\\658.25/12 = 54.854[/tex]

See more about finances at brainly.com/question/10024737

What is the value of x in the figure below? In this diagram, ΔABD ~ ΔCAD.

Answers

The Answer would be [tex] \sqrt{45} [/tex] aka A i hope this helps

The value of x in the figure given is E. √70.

The answer is E. √70.

The two triangles are similar by the AAA Similarity Theorem, since they have two pairs of congruent angles, namely ∠ABD and ∠CAD, and ∠BAD and ∠CDA.

Since the triangles are similar, the ratio of corresponding sides is constant. In particular, the ratio of AD to CD is the same as the ratio of BD to AD.

We are given that AD = 14 and CD = 20, so the ratio of AD to CD is 14/20. We are also given that BD = x, so the ratio of BD to AD is x/14.

Setting these two ratios equal to each other, we get x/14 = 14/20, which simplifies to x = √70.

Here is a proof that shows why the two triangles are similar:

AAA Similarity: Triangles ABD and CAD have two pairs of congruent angles, namely <ADB> and <CAD>, because they are both right angles.

SSS Similarity: Triangles ABD and CAD have three pairs of corresponding sides that are proportional, namely AD/CD = 14/20, BD/AD = x/14, and AB/CD = √70/20. Therefore, the two triangles are similar by the SSS Similarity Theorem.

To learn more about value here:

https://brainly.com/question/28787935

#SPJ2

You want to put a 5 inch thick layer of topsoil for a new 23 ft by 18 ft garden. the dirt store sells by the cubic yards. how many cubic yards will you need to order? the store only sells in increments of 1/4 cubic yards.

Answers

Answer:

You need to buy 6.5 cubic yards.

Step-by-step explanation:

You want to put a 5 inch thick layer of topsoil for a new 23 ft by 18 ft garden.

We know 1 yard = 3 feet or 1 yard = 36 inches

Then 1 inch = [tex]1/36[/tex] yard.

1 feet = 1/3 yard

The volume of the layer of the topsoil is given by:

= [tex]5(1/36)(23)(1/3)(18)(1/3)[/tex] cubic yards

[tex]2070/324=6.39[/tex] cubic yards

Now, the store only sells increments of 1/4 = 0.25 cubic yards.

So, we need to buy [tex]6.39/0.25=25.56[/tex] increments

Rounded to 26 increments.

Therefore, we need to buy 26 increments of 1/4 cubic yards.

That becomes 6.5 cubic yards.

Which number line represents the solutions to |x + 4| = 2?

Answers

The number line for [tex]\fbox{\begin\\\ \bf \text{option 1}\\\end{minispace}}[/tex] represents the solution for the equation [tex]|x+4|=2[/tex].

Further explanation:

The equation is given as follows:

[tex]|x+4|=2[/tex]

In the above equation [tex]||[/tex] represents the modulus function.

Modulus function is defined as a function which gives positive value of the function for any real value of [tex]x[/tex].

For example: The function [tex]y=|x|[/tex] is a modulus function in which [tex]y>0[/tex] and [tex]x<0[/tex] or [tex]x>0[/tex].

In the given equation [tex]|x+4|[/tex]  is a modulus expression.  

There are two cases formed for [tex]|x+4|[/tex].

First case:  [tex]x>-4[/tex]

If [tex]x>-4[/tex] then [tex]|x+4|\rightarrow (x+4)[/tex].

Substitute [tex]|x+4|=(x+4)[/tex] in [tex]|x+4|=2[/tex].

[tex]\begin{aligned}x+4&=2\\x&=2-4\\&=-2\end{aligned}[/tex]

Therefore, for [tex]x>-4[/tex] the value of [tex]x[/tex] which satisfies the equation [tex]|x+4|=2[/tex] is [tex]x=-2[/tex].

Second case:  [tex]x<-4[/tex]

If [tex]x<-4[/tex] then [tex]|x+4|\rightarrow -(x+4)[/tex].

Substitute [tex]|x+4|=-(x+4)[/tex] in [tex]|x+4|=2[/tex].

[tex]\begin{aligned}-(x+4)&=2\\-x-4&=2\\-x&=2+4\\-x&=6\\x&=-6\end{aligned}[/tex]

Therefore, for [tex]x<-4[/tex] the value of [tex]x[/tex] which satisfies the equation [tex]|x+4|=2[/tex] is [tex]x=-6[/tex].

This implies that the solution for the equation [tex]|x+4|=2[/tex] or the value of [tex]x[/tex] which satisfies the given equation are [tex]\fbox{\begin\\\ \math x=-2\ \text{and}\ x=-6\\\end{minispace}}[/tex].

Option 1:

The number line in option 1 shows that the solutions of the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-6[/tex].

As per our calculation made above the solutions for the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-6[/tex].

This implies that option 1 is correct.

Option 2:

The number line in option 2 shows that the solutions of the equation [tex]|x+4|=2[/tex] are [tex]x=2[/tex] and [tex]x=4[/tex].

As per our calculation made above the solutions for the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-6[/tex].

This implies that option 2 is incorrect.

Option 3:

The number line in option 3 shows that the solutions of the equation [tex]|x+4|=2[/tex] are [tex]x=2[/tex] and [tex]x=6[/tex].

As per our calculation made above the solutions for the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-6[/tex].

This implies that option 3 is incorrect.

Option 4:

The number line in option 4 shows that the solutions of the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-4[/tex].

As per our calculation made above the solutions for the equation [tex]|x+4|=2[/tex] are [tex]x=-2[/tex] and [tex]x=-6[/tex].

This implies that option 4 is incorrect.

Therefore, the number line for [tex]\fbox{\begin\\\ \bf \text{option 1}\\\end{minispace}}[/tex] represents the solution for the equation [tex]|x+4|=2[/tex].

Learn more:

1. A problem on composite function https://brainly.com/question/2723982  

2. A problem to find radius and center of circle https://brainly.com/question/9510228  

3. A problem to determine intercepts of a line https://brainly.com/question/1332667  

Answer details:

Grade: High school

Subject: Mathematics

Chapter: Functions

Keywords: Functions, modulus, modulus function, number line, real line, |x+4|=2, equation, root, zeroes, solutions,  absolute function, x=-6 and x=-2.

Option A is correct, the values of [tex]x[/tex] staisfying the given equation [tex]|x+4|=2[/tex] are [tex]-2[/tex] and [tex]-6[/tex].

Modulus function always returns a positive value to the equation.

Here, [tex]|x+4|[/tex] will give positive result if [tex]x>-4[/tex] and negative value if, [tex]x<-4[/tex].

Case 1: When [tex]x>-4[/tex]

According to the given equation,

[tex]|x+4|=2\\x=2-4\\x=-2[/tex]

So, the value of [tex]x[/tex] which satisfies the given equation [tex]|x+4|=2[/tex] for [tex]x>-4[/tex] is [tex]x=-2[/tex].

Case 2: When [tex]x<-4[/tex]

According to the given equation,

[tex]|x+4|=2\\-x-4=2\\x=-6[/tex]

So, the value of [tex]x[/tex] which satisfies the given equation [tex]|x+4|=2[/tex] for [tex]x<-4[/tex] is [tex]x=-6[/tex].

Hence, the values of [tex]x[/tex] staisfying the given equation [tex]|x+4|=2[/tex] are [tex]-2[/tex] and [tex]-6[/tex].

Now, according to the options, Option A is correct.

Learn more about number line here:

https://brainly.com/question/24279896?referrer=searchResults

calculate the rate of change for the quadratic function over the given interval:
f(x)=x^2 + 4x +5 ; -4 =< x =< -2

Answers

The rate of change of the quadratic function over the interval −4≤x≤−2 is 2.

To find the rate of change of the quadratic function [tex]$f(x)=x^2+4 x+5$[/tex] , over the interval −4≤x≤−2, we need to find the average rate of change over that interval.

The average rate of change of a function f(x) over an interval [a,b] is given by:

[tex]Average Rate of Change =\frac{f(b)-f(a)}{b-a}$[/tex]

So, in this case:

a=−4

b=−2

We calculate f(−4) and f(−2):

[tex]$\begin{aligned} & f(-4)=(-4)^2+4(-4)+5=16-16+5=5 \\ & f(-2)=(-2)^2+4(-2)+5=4-8+5=1\end{aligned}$[/tex]

Now we can find the rate of change:

Rate of Change = [tex]$\frac{1-5}{-2-(-4)}=\frac{-4}{-2}=2$[/tex]

The average rate of change of the function f(x)=x² + 4x + 5 over the interval from x = -4 to x = -2 is -2.

The rate of change for the quadratic function f(x)=x² + 4x + 5 over the interval from x = -4 to x = -2 can be calculated using the average rate of change formula. This formula is given by:

Rate of Change = [f(x2) - f(x1)] / (x2 - x1)

Where x1 = -4 and x2 = -2. We first calculate f(-4) and f(-2) by plugging these values into the function:

f(-4) = (-4)² + 4(-4) + 5 = 16 - 16 + 5 = 5

f(-2) = (-2)² + 4(-2) + 5 = 4 - 8 + 5 = 1

Now we use these results in our rate of change formula:

Rate of Change = (1 - 5) / (-2 + 4) = -4 / 2 = -2

The average rate of change of the function f(x) over the interval from x = -4 to x = -2 is -2.

What is the simplified value of the expression below?

A.4.8
B.19.2
C.22.1
D.57.6

Answers

Remember your order of operation, and go from left to right

12/2 = 6
6 x 3.2 =  19.2
24 - 19.2 = 4.8

A. 4.8 is your answer

hope this helps

Answer: Option C i.e. 22.1 is correct


Step-by-step explanation:

The given expression follows pemdas rule

PEMDAS:

P for Paranthesis

E for Exponents

M for Multiplication

D for division

A for Addition

S for Subtraction

Given :24 -12 /2 *3.2

=  24-12/2*3.2     [Multiplication]

= 24- 12/6.4      [Division]

=24-1.875         [Subtraction]

=22.125

So the answer is C. 22.1

If f(x) = 3x2 - x, find f(-2).

10
14
38

Answers

f(x) = 3x^2-x

F(-2)

 replace x with -2

3(-2)^2 - -2 =

3*4 +2 = 14

 Answer is 14


'Ello. 

Just plug in the values.
 
f(-2) = 3(-2)^2 - (-2) {Equation}
f(-2) = 3(4) - (-2) {Multiply}
f(-2) = 12 - (-2) {The signs become a positive; add}
f(-2) = 14 {Answer}

You're welcome. 

The distance d in feet that dropped object falls in t seconds is givin by the equation d divided 16 = tsquared how long does it take a dropped object to fall 64 feet

Answers

d / 16 = t^2

when d = 64

64 /16 = t^2

t^2 = 4 

t = 2     

answer is 2 seconds

The point p(x, y) on the unit circle that corresponds to a real number t is given. find the values of the indicated trigonometric function at t.

Answers

Unit circle : a circle with radius of one. Unit circle is centered at the origin.

Use the formula cot x = base / perpendicular, where x is the angle. Substituting x,y and t to the formula, we get cot (t) = x / y.

To find the trigonometric function values for a point on the unit circle corresponding to a real number t involves using the x and y coordinates, which are derived from the cosine and sine functions at that angle t.

The student's question involves finding the values of trigonometric functions for a point p(x, y) on the unit circle that corresponds to a real number t. This typically involves understanding the relationship between the coordinates of a point on the unit circle and the trigonometric functions sin, cos, and tan. In this context, x(t) and y(t) are understood as the x and y coordinates of a point on the unit circle at a certain angle t. The point p(x, y) would be given by the cosine and sine functions: x(t) = cos(t) and y(t) = sin(t). In more advanced contexts, these functions can take different forms like x(t) = A cos(wt + p) where A, w, and p are constants. The solution to trigonometric equations may involve differential equations or complex numbers in such cases.

Solve for t.

q=r+rst

Answers

t=(q-r)/rs

q=r+rst
subtract r from both sides
q-r=rst
divide rs from both sides
(q-r)/rs=t

Final answer:

The equation q=r+rst can be rearranged to isolate t, with the final solution being t=(q-r)/rs.

Explanation:

To solve for t in the equation q=r+rst, first, you need to isolate t on one side of the equation. You can do this by subtracting r from both sides so that you have q-r=rst. Next, divide both sides by rs, which gives you the final solution: t=(q-r)/rs.

Learn more about Algebra here:

https://brainly.com/question/32436021

#SPJ3

Both Pythagorean Theorem and trigonometric ratios are used with right triangles. Explain what information you need to apply to these different methods and include examples to show how to use each.

Answers

If given the value of an angle of the right triangle (aside from the 90° angle), then the trigonometric ratios will be more useful for solving for the sides of the triangle. One could use sin, cosin, and tangeant, the main trigonmetric ratios to solve for all sides and angles of the triangle, if given at least one angle and one side length. 

The Pythagorean Theorem as it is generally applied, helps solve for the third side of a triangle, given that you know the other 2 sides. This is less applicable, and trigonometric ratios can also be used in this case to solve for the rest of the triangle's angles and the third side. 
Final answer:

To apply the Pythagorean Theorem, you need the lengths of the two legs of a right triangle. Trigonometric ratios involve the angles and ratios of sides in a right triangle. Examples are provided for both methods.

Explanation:

In order to apply the Pythagorean Theorem, you need the lengths of the two legs of a right triangle. The theorem states that the square of the hypotenuse (the side opposite the right angle) is equal to the sum of the squares of the other two sides. For example, if we have a triangle with legs of lengths 3 and 4, we can use the theorem to find the length of the hypotenuse. The square of the hypotenuse is 3^2 + 4^2 = 9 + 16 = 25, so the hypotenuse has a length of 5.

Trigonometric ratios, on the other hand, involve the angles of the right triangle and ratios of its sides. The three main trigonometric ratios are sine, cosine, and tangent. For example, if we have a right triangle with an angle of 30 degrees and one leg of length 5, we can use trigonometry to find the length of the other leg. The sine of the angle is given by the ratio of the opposite side (the leg we want to find) to the hypotenuse. So, sin(30 degrees) = opposite / hypotenuse = x / 5. Solving for x, we get x = 5 * sin(30 degrees) = 5 * 0.5 = 2.5.

What is the value of the 7 digit in 91,764,350?

Answers

700,000 is the value of the digit

700,000 is the value

Find the equation of a line perpendicular to another line

Answers

You'll need to present the "other line" so that you have a reference.

If you start with y = mx + b, the slope of a line perpendicular to this line is -1/m.

Then the equation of the new line is    y = (-1/m)x + c, where c is the y-intercept of the new line.


Final answer:

To find the equation of a line perpendicular to another, determine the slope of the original line and use the negative reciprocal of that slope for the perpendicular line. Choose a point on the perpendicular line, and apply the point-slope form to get the equation.

Explanation:

The process of finding a perpendicular line involves first understanding the slope of the given line. To find the equation of a line that is perpendicular to another, you need to identify the slope (m) of the original line and use the fact that the slopes of perpendicular lines are negative reciprocals of each other (meaning if the slope of the first line is m, the slope of the line perpendicular to it will be -1/m). In the context of vectors and analytical methods in physics, components can help describe forces or directions. If we consider the example of a skier on a slope, breaking down the weight force into components parallel and perpendicular to the slope helps analyze the motion. However, for strictly finding a perpendicular line in mathematics, we focus on the slopes of the lines. Suppose you have the equation of the original line. If it is in the format y = mx + b, where m is the slope and b is the y-intercept, you can find the slope of the perpendicular line by taking the negative reciprocal of m. If the slope is not readily apparent, you might need to rearrange the equation into this format. Once you have the slope of the perpendicular line, choose a point through which the line passes (this could be the original point or any particular point you're given). Then, use the point-slope form (y - y1) = m(x - x1) to write the equation of the line.

Consider this equation (csc x+1)/cot x = cot x/(csc x +1) is it an identity?

Answers

cross multiplying:-
cot^2 x = (csc x+ 1)(csc x + 1)

also  cot^2 x =  csc^2 x - 1  = (csc x + 1)(csc x - 1)  (Known Identitiy)

so the equation is not an identity

If a penny is tossed three times and comes up heads all three times, the probability of heads on the fourth trial is ___.

Answers

the probability is 1/2 to get heads on the fourth trail.

The coming head in the fourth time is independent of the coming head in the first three times thus the probability of coming head in the fourth time is 1/2.

What is probability?

Probability is also called chance because if you flip a coin then the probability of coming head and tail is nothing but chances that either head will appear or not.

In our daily time, there are several instances in the everyday world where we may need to draw conclusions about how everything will turn out.

As per the given,

In the first three attempts coming head in the first three times.

In the fourth attempt, the probability will be independent of the first three events.

Thus, the probability of coming ahead in the fourth time will be as,

Number of desire output/number of total output

=> 1 / 2

Hence "The coming head in the fourth time is independent of the coming head in the first three times thus the probability of coming head in the fourth time is 1/2".

For more information about the probability,

brainly.com/question/11234923

#SPJ6

A store sells an item for $180. This is 12/7 of their wholesale cost for the item. How much does the store mark the item up?

Answers

Make an algebraic formula:

12/7x = 180

Solving:

12/7x (7/12) = 180 * 7/12
x = 105

Hope this helps!
Other Questions
Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart? Identify the participle in the sentence.The idling engine sound fine to me now._______Is there a business future in manufactured houses, Dad?A: FutureB: IsC: housesD: DadPaying for the flute, Tammy smiled happily and skipped all the way home.A: none of the above B: smiled happilyC: all the way home D: Paying for the flute What specific nutrition guidelines has your school district put in place?Name at least three. Select the correct statement to describe when a sample of liquid water vaporizes into water vapor.A. Temperature decreases and molecular motion increases while shape becomes less defined.B. Temperature decreases and molecular motion decreases while shape becomes more defined.C. Temperature increases and molecular motion decreases while shape becomes more defined.D. Temperature increases and molecular motion increases while shape becomes less defined. Write an equation to represent: four-fifths of z added to six equals eightA) 4/5 z + 6 = 8 B) 4/5 + 6z = 8 C) 4/5 (6)(z) = 8 D) 4/5 (6) + z = 8 A fruit juice container holds 16 servings. If the servings size in 6 ounces, how many ounces does the container hold in all? How does the graph of g(x)=x+7 differ from the graph of f(x)=x?The graph of g(x)=x+7 is the graph of f(x)=x shifted right 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted up 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted left 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted down 7 units. who were the first hominids to walk upright? A. homo erectus B. homo habilis c. Australopithecus d. neanderthals In a cross-country race with a 35 participants, the mean finish time was 21 minutes . Which statement must be true ? Find the total capacity of twenty five containers of cranberry juice if each bottle holds 5 quarts 1 pint 6 oz A) 142 pints 6 oz B) 140 pints 6 oz C) 142 pints 9 oz D) 142 pints 1 pint 6 oz E) None Which is more volatile benzene or toluene? The children in France are wearing costumes and adults are having a last party before lent. What are they celebrating? How is mexico government similar to and different from the government of the united states What is the value of x when f(x) 25?