what is 18.23 rounded to the nearest tenth?

Answers

Answer 1

Answer:

The answer is 18.2.

Hope this helps!

Answer 2

Answer: 18.2

Step-by-step explanation:

you would round to 18.2 because with 5 and above, you give it a shove, 4 and below let it go


Related Questions

Josh bought four books at a bookstore. Here are their prices (in dollars).
19.5
,
16.87
,
4.02
,
2
What is the total amount Josh paid at the bookstore?

Answers

Answer:

Step-by-step explanation:19.5+16.87+4.02+2

=42.39$

What is the length of each side of the larger square

Answers

Answer:

The larger square is 6 cm on a side

Step-by-step explanation:

Let x = the side of square 1

Let y = side of square 2

A= s^2

Area of square 1 = x^2

Area of square 2 = y^2

The total area of both squares = x^2 +y^2 = 45

We know that y = 2x

Substituting in

x^2 + (2x)^2 = 45

x^2 +4x^2 = 45

5x^2 = 45

Divide each side by 5

5x^2/5 = 45/5

x^2 = 9

Take the square root of each side

sqrt(x^2) = sqrt(9)

x = 3

y = 2x = 2(3) = 6

The larger square is 6 cm on a side

A moving box one meter wide 1/2 meter long and 3/4 meter tall how many cubic meters can the Box hold?​

Answers

Here is the work and explained sentence :)


The point-slope form of the equation of the line that passes through (-9, -2) and (1.3) is y-3=1/2(x-1). What is the slope-intercept form of the equation for this line?

Answers

Answer:

y = 1/2x + 5/2

Step-by-step explanation:

y-3=1/2(x-1).

To get from point slope to slope intercept, distribute the slope

y-3 = 1/2 x -1/2

Then add 3 to each side

y-3+3 =1/2 x -1/2 +3

y = 1/2x +2 1/2

Or if we want the last term as an improper fraction

y = 1/2x + 5/2

Graph the image of the figure after a dilation with the scale factor of 3 centered at the origin.

Answers

Answer:

Shown below

Step-by-step explanation:

Dilation is when you stretch something by the same amount in two perpendicular directions. In other words, dilation changes size, not overall shape. Dilation factors greater than one makes the shape greater while dilation factors less than one makes the shape smaller. To dilate a shape with a certain scale factor centered at the origin, we just need to multiply each point by that scale factor. Since the figure is a rectangle, we just need to take the vertices of this figure, therefore:

A(-2,1)

B(1,1)

C(-2,3)

D(1,3)

So, the new points will be:

A'(-2x3, 1x3) = A'(-6, 3)

B'(1x3, 1x3) = B'(3, 3)

C'(-2x3, 3x3) = C'(-6, 9)

D'(1x3, 3x3) = D'(3, 9)

The new shape is shown below. As you can see, the new rectangle is greater than the original because the scale factor is greater than one.

the ratio of the number of men to the number of women on a bus was 2:3 at a bus stop. 4 women got off and the ratio became 4:5. 1 How many men were on the bus? b. How many women were on the bus in the end?

Answers

Answer:

At the beginning

16 men and 24 women

In the end

16 men and 20 women

Step-by-step explanation:

Call x the number of men on the bus and call y the number of women on the bus.

We know that the initial ratio between men and women is 2: 3

And the final ratio is 4: 5

So

[tex]\frac{x}{y}=\frac{2}{3}\\\\y = \frac{3}{2}x[/tex]   (1)

After the 4 women are down, the proportion is:

[tex]\frac{x}{y-4}=\frac{4}{5}\\\\y-4 = \frac{5}{4}x\\\\y= \frac{5}{4}x +4[/tex]   (2)

Substitute the value of y in the first equation and solve for x

[tex]\frac{5}{4}x +4=\frac{3}{2}x\\\\-\frac{1}{4}x=-4\\\\x=16\ men[/tex]

Now solve for y.

[tex]y = \frac{3}{2}(16)\\\\y=24\ women[/tex]

Then at the end there were

[tex]y = 24-4 = 20[/tex] women

Find the distance between the points given. (2, 2) and (5, 5) 3 3√2 7√2

Answers

Answer:distance=(3,3)

Step-by-step explanation:

5-2=3

Answer:

The answer is 3 square root 2.

Step-by-step explanation:

Using the distance formula and you will get 4.242...... and then you will get 3 square root 2.

what is the measure of an angle that turns through 1/5 of a circle?an angle that turns through 3/5 of a circle?

Answers

A circle is a curve sketched out by a point moving in a plane. The measure of the angle is 72°.

And, The measure of the angle is 126°.

What is a circle?

A circle is a curve sketched out by a point moving in a plane so that its distance from a given point is constant; alternatively, it is the shape formed by all points in a plane that are at a set distance from a given point, the center.

Now, Let the angle that turns through 1/5 of the circle be x.

We know that the measure of the center of a circle is 360°, while it is given that the angle turns through 1/5 of the circle.

Therefore, the angle will turn 1/5 of 360°.

⇒ x = 1/5 × 360°

⇒ x = 72°

Thus, the measure of the angle is 72°.

And, For angle that turns through 3/5 of a circle.

The value of angle is,

⇒ x = 3/5 × 360°

⇒ x = 216°

Learn more about Circle visit:

brainly.com/question/11833983

#SPJ3

is this right? we are learning ‘applying systems of equations’

Answers

The system of equations is

X+y=70

X-y=36

Where x and y are the two numbers

X=36+y ( from second)

36+y+y=70;

2y=70-36;

y=17

X+17=70

X=70-17=53

Numbers are 17, 53.

Pick the correct graph to each category based on the slope of the graph.

Answers

Answer:

Slope 0: second graph

slope less than 0: fourth graph

slope undefined: fifth graph

slope greater than 1: third grpah

Step-by-step explanation:

Answer:

slope 0: second on the red line on top

less than 0: 4th graph \

undefined:5th graph |

greater than 1: first one /

Step-by-step explanation:

A circle has its center at (1,4) and a radius of 2 units what is the equation of the circle

Answers

Answer: x² + y² - 2x - 8y + 13 = 0

Step-by-step explanation:

the equation of the circle is in the form (x - a)² + (y - b)² = r²

where (a,b) is the center of the circle and r is the radius

      hence the equation is

                         (x - 1)² + (y - 4)² = 2²

                         x²-2x+1+y²-8y+16= 4

                         x²+ y² -2x- 8y + 17 =4

                         x² + y² - 2x - 8y = -13

                          x² + y² - 2x - 8y + 13 = 0

A circle is inscribed in a square with a side length of 12 cm. What is the area of the square not contained within the circle? Use π=3.14
.

Answers

The answer will be 48 is the area if the square

If 38 12-m – 82m, what is the value of m?

Answers

Answer:

[tex]m=-\frac{26}{83}[/tex]

Step-by-step explanation:

Since you are asking for the value of [tex]m[/tex], it is reasonable to assume that we are dealing with an equation here and you forgot to type the equal sign. Given that, I assume our equality is [tex]38=12-m-82m[/tex]. Let's solve it step-by-step:

Step 1. Subtract 12 from both sides of the equation

[tex]38-12=12-12-m-82m[/tex]

[tex]26=-m-82m[/tex]

Step 2. Combine like terms (m terms)

[tex]26=(-1-82)m[/tex]

[tex]26=-83m[/tex]

Step 3. Using the reflexive property of equality: if a = b, then b = a

[tex]26=-83m[/tex]

[tex]-83m=26[/tex]

Step 4. Divide both sides of the equation by -83

[tex]\frac{-83m}{-83} =\frac{26}{-83}[/tex]

[tex]m=-\frac{26}{83}[/tex]

We can conclude that the value of m is [tex]-\frac{26}{83}[/tex].

Next time be more careful writing your question :)

Need help on #7 please !!!

Answers

Solve by using Pythagoras triangle concept

x^2 + 15^2 = (9+x)^2

x^2 + 225 = 81 + 18x + x^2

x^2 - x^2 + 225 - 81 = 18x

144 = 18x

144/18 = x

x = 8

Answer:

x = 8

Step-by-step explanation:

Since the triangle is right use Pythagoras' theorem

The square on the hypotenuse is equal to the sum of the squares on the other 2 sides, that is

(x + 9)² = x² + 15² ← expand factor on left side

x² + 18x + 81 = x² + 225 ( subtract x² from both sides )

18x + 81 = 225 ( subtract 81 from both sides )

18x = 144 ( divide both sides by 18 )

x = 8

Using rigid motion, which statement is true about the triangles?

Answers

Answer:

(b) ABC =  FED

Step-by-step explanation:

The rigid motion concept implies that you move your points relative to another. That also means the naming of the objects (in this case triangles) has to be consistent.

By naming the first triangle ABC, you start by the lower-right corner of the triangle, go up then finish on the left-most point.

So, to name the other triangle in rigid-motion manner, you have to follow the same sequence... so it is F first, then E then D... so FED.

Elsa makes and sells candles. The function C = 2n + 125 represents her costs, in dollars, for producing n candles. Her revenue, or the amount she receives for selling n candles, can be represented by the function R = 4n. Which function represents Elsa’s profit, P, for selling n candles?Elsa makes and sells candles. The function C = 2n + 125 represents her costs, in dollars, for producing n candles. Her revenue, or the amount she receives for selling n candles, can be represented by the function R = 4n. Which function represents Elsa’s profit, P, for selling n candles?

Answers

ANSWER

P(n)=2n-125

EXPLANATION

Profit equals selling price minus cost price.

P(n)=R(n)-C(n)

The cost price is given by the function;

C(n)= 2n + 125

The selling price is represented by the function:

R(n)=4n

The function that represents the profit function is :

P(n)=4n-(2n+125)

Expand

P(n)=4n-2n-125

Simplify:

P(n)=2n-125

Answer:P = 2n – 125

Step-by-step explanation: Ur welcome <3

the difference between 4 632 and 20 000 is what number?

Answers

u just divide 4,632 by 20,000

Answer:

-15368

Step-by-step explanation:

Emma decided to buy some paint to paint some of the rooms in his house. She found out that one room required 1 1/2 cans of paint. If Emma buys 9 cans of paint, how many rooms can she paint?

6
27/3
13 1/2
5

Answers

Answer:

6

Step-by-step explanation:

To solve this, divide 9 by 1 1/2.

To make this easier to divide, convert 1 1/2 into an improper fraction.

1 1/2 = 3/2

Dividing 9 by 3/2 is the same as multiplying 9 by 2/3

Multiply the numerators and denominators

[9 is the same as 9/1]

9 x 2 = 18

1 x 3 = 3

18/3 = 6

So, Emma can paint 6 rooms.

I hope this helps!

Answer:

I believe the answer would be six rooms

Step-by-step explanation: This may seem a little difficult, but really it is quite simple. All you have to do is divide the amount of paint she has (9) by how much it takes to paint one room (1 1/2). The equation would be,            (9 / 1 1/2) which equals 6. I hope this helps.

Latesha needs to simplify a polynomial expression for homework

16x^2y/ 24xy^3
What should Latesha write on her homework paper as the correct answer

A. 2x/3y^2
B. 2y^2/ 3x
C. 3y^2/ 2x
D. 3x/2y^2

Answers

A. 2x/3y^2

HOPE THIS WILL HELP YOU

The correct answer that Latesha should write on her homework paper is 2x/3y2. Hence, the correct option is A.

The polynomial expression that Latesha needs to simplify is 16x^2y / 24xy^3. To simplify this expression, each term in the numerator should be divided by each corresponding term in the denominator that it is divisible by. Her steps should be as follows:

Divide both coefficients (numbers) by their greatest common divisor, which in this case is 8. So, 16 divided by 8 is 2, and 24 divided by 8 is 3.

Look at the powers of x and y and simplify. Subtract the exponents of like bases (16x2y has x2 and 24xy3 has x1, so you subtract 1 from 2 and get x to the power of 1, or just x).

For y, since y is on the top and bottom, subtract the exponents (1 - 3 = -2), which means y squared will be in the denominator.

Putting it all together, you get 2x / 3y2
which corresponds to answer choice A. 2x/3y2.

Therefore, the correct answer that Latesha should write on her homework paper is A. 2x/3y2.

which number is 13 prime, composite, or nither

Answers

13 is prime because there is only 1 factor 1 and 13.

Answer:

prime

Step-by-step explanation:

Jesse has a bottle of lemonade one third has been drunk he shares it between himself and his three friends what fraction of the full bottle do they each get?

Answers

Answer:

1/9

Step-by-step explanation:

1/3 times 1/3 = 1/9

The fraction of lemonade bottle each of them get is 16.67/100 or 16.67 %

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data ,

Jesse has a bottle of lemonade

The lemonade is 1/3 empty

So , the amount of lemonade left in the bottle is = 1 - 1/3

                                                                                = 2/3

The number of friends Jesse shares the lemonade with = 3 people

So , the total number of people = 4 people

Now , the equation will be

Total lemonade each person get =
Amount of lemonade left in the bottle / total number of people

Total lemonade each person get = ( 2/3 ) / 4

                                                       = 2/12

                                                       = 1/6

                                                       = 0.1667

Hence , The fraction of lemonade bottle each of them get is 16.67/100 or 16.67 %

To learn more about equations click :

https://brainly.com/question/10413253

#SPJ5

A ruler can measure the length to the nearest 0.1 centimeter. Which of these lengths is the most precise measurement the ruler could make of a wire that measures 13.58cm

Answers

Answer:

13.6

Step-by-step explanation:

"A ruler can measure the length to the nearest 0.1 centimeter. Which of these lengths is the most precise measurement the ruler could make of a wire that measures 13.58cm"

Down to the nearest .1 centimeter means round to the nearest .1, so the solution is 13.6cm

Final answer:

A ruler that can measure to the nearest 0.1cm would be able to accurately measure a wire of 13.58cm up to 13.5cm. The remaining 0.08cm cannot be measured accurately by this ruler.

Explanation:

In this context, the term 'precision' refers to the smallest measurement that can be reliably marked by an instrument. Given that the ruler can measure to the nearest 0.1 centimetre, the most precise measurement the ruler can make is till decimals of one place. Therefore, for a wire measuring 13.58cm, the ruler will be able to precisely measure till 13.5cm. The wire's length of '0.08cm' beyond '13.5cm' cannot be accurately measured with this ruler as it doesn't have markings to measure in this range.

Learn more about Precision here:

https://brainly.com/question/32100314

#SPJ2

PLS HELP I WILL GIVE BRAINLIEST

Answers

So, you just have to recognize the line splitting the circle in half, line LJ.  So, if JC (arc) is 94, then do 180-94=86.  ∠LJC is an inscribed angle, so it's half of 86, which is 43°.

43° is your answer.

The length of a rectangle is 45 inches more than the width. The perimeter is 346 inches. Find the length and the width.

Answers

Solution:

Perimeter of Rectangle = 346

Let Required length of breadth be x

Then, Length of Rectangle = 45 + x

Now, We have ;

Perimeter of Rectangle = 2(l+b)Perimeter of Rectangle = 2 ( 45 + x + x346 = 2 ( 45 + 2x )346 = 90 + 4x 346 - 90 = 4x 256 = 4x x = 256 ÷ 4 x = 64 inches

So, Length of Rectangle = x + 46

Length of Rectangle = 64 + 46

Length of Rectangle = 110 inches

Now, Breadth of Rectangle = 64 inches.

Answer:

Length = 109 inches and width = 64 inches

Step-by-step explanation:

Perimeter = 2(length + width)

Let the width of the rectangle be 'w' inches

Length of the rectangle would be = 45+w inches

2((45+w)+w) = 346

2(45+2w) = 346

90 + 4w = 346

4w = 346 - 90

4w = 256

w = [tex]\frac{256}{4}[/tex]

w = 64 inches

Length = 45 + 64 = 109 inches

Length = 109 inches and width = 64 inches

Coordinate Plane
Drag the item from the item bank to its corresponding match.


Ordered Pair
Quadrant
Coordinate Plane
Coordinates
Origin
X-Axis
X-Intercept
Y-Axis
Y-Intercept



1. This is a plane with two axes as a frame of reference. The x-axis is a horizontal line and the y-axis is perpendicular to it (i.e., the y-axis is vertical). The intersection of the two axes is called the origin.

2. This is a way of expressing a relationship between x and y in set notation.

3. This is one of four sections formed by the intersection of the x-axis and y-axis on a Cartesian coordinate plane.

4. This is the point where the x-axis crosses the y-axis. The coordinate location is the ordered pair (0,0).

5. This is the horizontal axis in a coordinate graph.

6. This is the vertical axis in a coordinate graph.

7. This is the pair of numbers giving the location of a point.

8. This is a point at which a graph intersects the x-axis.

9. This is a point at which a graph intersects the y-axis.

Answers

Answer:

1.  coordinate plane

2. ordered pair

3. quadrant

4. origin

5. X-axis

6. Y-axis

7. coordinates

8. X-intercept

9. Y-intercept

Step-by-step explanation:

Answer:

1.Coordinate Plane

2.Ordered pair

3.Quadrant

4.Origin

5.X-axis

6.Y-axis

7.Coordinates

8.X-intercept

9.Y-intercept

Step-by-step explanation:

1.Coordinate Plane is a plane with two axes as a frame of reference. The x-axis is a horizontal line and the y-axis is perpendicular to it (i.e., the y-axis is vertical). The intersection of the two axes is called the origin.

2.Ordered pair is a way of expressing a relationship between x and y in set notation.

3.Quadrant is one of four sections formed by the intersection of the x-axis and y-axis on a Cartesian coordinate plane.

4.Origin is the point where the x-axis crosses the y-axis. The coordinate location is the ordered pair (0,0).

5.X-axis  is the horizontal axis in a coordinate graph.

6.Y-axis is the vertical axis in a coordinate graph

7.Coordinates is the pair of numbers giving the location of a point.

8.X-intercept is a point at which a graph intersects the x-axis.

9.Y-intercept is a point at which a graph intersects the y-axis.

16) through: (1,1), slope = 6
A) y = 5x–5. B) y = -2x - 5
C) y=-6x – 5 D) y = 6x - 5

Please help

Answers

the correct answer is D

Answer:

D

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

here slope m = 6, thus

y = 6x + c ← is the partial equation

To find c substitute (1, 1) into the partial equation

1 = 6 + c ⇒ c = 1 - 6 = - 5

y = 6x - 5 → D

What is the median from the following set of data:1,2,3,3,3,8,8,11,15?

Answers

Answer:

3

Step-by-step explanation:

The median is the # in the middle, and since 3 is used 3 times, it´s the most used # and is in the middle

[tex]\huge{\boxed{3}}[/tex]

The median is the middle number when the numbers are arranged least to greatest, which they already are.

Take numbers away two at a time, one from the front and one from the back.

1,2,3,3,3,8,8,11,15

2,3,3,3,8,8,11

3,3,3,8,8

3,3,8

This means that the median is [tex]\boxed{3}[/tex]

Brainliest + 20 Points!

I need help I'm struggling..

The ratio of side lengths for two similar cubes is 2/5

Show your work or explain how you got your answers.

a.The perimeter of one face of the smaller cube compared to the perimeter of one face of the larger cube

Answers

Answer:

The perimeter of one face of the smaller cube compared to the perimeter of one face of the larger cube is [tex]\frac{2}{5}[/tex]

Step-by-step explanation:

we know that

If two figures are similar, then the ratio of its corresponding sides is proportional and this ratio is called the scale factor

and

If two figures are similar, then the ratio of its perimeters is equal to the scale factor

Let

z-----> the scale factor

x-----> the perimeter of the smaller cube

y ----> the perimeter of the larger cube

[tex]z=\frac{x}{y}[/tex]

in this problem we have

[tex]z=\frac{2}{5}[/tex] ----> scale factor

substitute

[tex]\frac{x}{y}=\frac{2}{5}[/tex]

The ratio of blue to yellow is 4:5 and there are 15 yellow how many blue is there?

Answers

Answer: 12 blue marbles

Step-by-step explanation: Set up a proportion.

4/5 = x/15

Solve for x, the number of blue marbles. Cross multiply. You will get 60 = 5x

Divide by 5 on each side.

x = 12

There are 12 blue marbles.

Ms. Chloe has 5 cups of popcorn, which she is serving as a snack to a group of children. Each serving is 1/4 of a cup. How many children can get a serving of popcorn as a snack?

Answers

20 children can get a serving of popcorn

Since each serving is 1/4 of a cup, each cup can provide for 4 children. Since there are 5 total cups, multiplying 5 by 4 will give you 20.

The answer is 20 because first you have to set up a division equation. It would be 5 divided by 1/4.You can’t divid with a fraction so you must change it into a multiplication sentence. The new equation would now be 5 times 4/1 and the answer would be 20. Therefore, Ms.Chloe can freed 20 children.

Other Questions
What were the goals/policies of the Johnson administration and how did they impact the nation Which statements describe the use of gamma rays to treat cancer? Check all that apply.Gamma rays have low energy and a source must be placed in the body.Gamma rays are absorbed by only the cancer cells.High-energy gamma rays are directed at a tumor from outside of the body.Gamma rays kill cancer cells in a tumor.Gamma rays are applied to a large area of the body. Jane entered her artworks in a state competition. Her art scores from 7 judges are listed. 9,9,8,7,9,6,8 what is Janes mean score? A.6 B.7 C. 8 D.9 When you use the distance Formula you are building a right triangle whose ____ connects two given points.... I NEED HELP ASAP I WILL GIVE BRAINLIST !!!!!!!!!Assignment water and oceans graphic organizer exploration k12 1. Where does the energy that causes evaporation come from2. What role does gravity play in the water cycle?3. Describe the flow of one molecule of water through the water cycle, beginning in the ocean. suppose that one student is randomly selected during lunch time. what is the experimental probability if students the brought lunch from house is 55 and students that order school lunch is 45 Which two of these sentences are in passive voice if dy/dt=-10e^-t/2 and y(0)=20 what is the value of y(6) A land rush happened in Oklahoma in the 1890s thanks to the discovery of which mineral? A. gold B. gypsum C. lead D. zinc Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct What would the charge be on an ion of boron (B)? If Johnny has twice more bottles of dish soap than Carolyn, and Carolyn has 20 more bottles of dish soap than Mr. White, how many bottles of dish soap does Johnny have if Mr. White has 35 bottles of dish soap? Using the properties of exponents and logarithms, find the value of x in 19+2 in x=25 What are two reasons that the development of the Model T was important?It was the first car to be manufactured on a moving chassis assembly line.It was the first vehicle model to be manufactured in the United States. was the largest, fastest, and the most luxurious car of the twentieth century.It was affordable and enabled average Americans to own a car. Jimi Hendrixs version of the "Star Spangled Banner" is quite poignant because obviously he feels patriotic about his country, but there are some underlying themes if you listen carefully. The destructive explosions on the guitar are a protest to the war in Vietnam, and his sadness for innocent lives being lost is represented by the "taps" theme at 2:40. He also plays part of the melody in a minor key ("our flag was still there") to represent that although he loves his country, he recognizes that there are some things that need fixing and healing in order to move forward. The performance of this at Woodstock in 1969 must have been a very moving moment. Through all the craziness, guitar soloing and sounds of destruction, Hendrix makes the National Anthem still hold true. The question is Does Hendrix actually play the whole National Anthem (sing the lyrics in your head as he plays to find out)? In the field of health science, what characteristics are employers not looking for?diligenceintelligenceportabilityreliability For which triangle is the length of the hypotenuse an INTEGER? drama that are broken in smaller pieces are called The names and chemical formulae of some chemical compounds are written in the first two columns of the table below. Each compound is soluble in water.Imagine that a few tenths of a mole of each compound is dissolved in a liter of water. Then, write down in the third column of the table the chemical formula of the major chemical species that will be present in this solution. For example, you know water itself will be present, so you can begin each list with the chemical formula for water (H2O).Note: "major" chemical species are those present in concentrations greater than 10^-6 mol. major species present when dissolved in waterzinc iodide ZnI2 nitrous oxide N2Osodium nitrate NaNO2glucose C6H12O6nickel (II) Iodide NiL2 !!!!?!?!?!!!?!!?!!!!!?!!?!?!?!?!!?!?!?!