what is 3.1n - 1.1n =

Answers

Answer 1
2n is the answer because take away .1 n and you have 3 then take away another n to get 2
Answer 2
2n is the answer to this equation

Related Questions

PLEASE HELP!!!!!!!!!!!!!

Answers

Answer:

24

Step-by-step explanation:

in this, the blank is 'y'. I filled the x with -8

)(−8)−(−8−40)=(2)(−8)−(y−8)

Step 1: Simplify both sides of the equation.

(10)(−8)−(−8−40)=(2)(−8)−(y−8)

(10)(−8)+−1(−8−40)=(2)(−8)+−1(y−8)(Distribute the Negative Sign)

(10)(−8)+(−1)(−8)+(−1)(−40)=(2)(−8)+−1y+(−1)(−8)

(10)(−8)+8+40=(2)(−8)+−y+8

−80+8+40=−16+−y+8

(−80+8+40)=(−y)+(−16+8)(Combine Like Terms)

−32=−y+−8

−32=−y−8

Step 2: Flip the equation.

−y−8=−32

Step 3: Add 8 to both sides.

−y−8+8=−32+8

−y=−24

Step 4: Divide both sides by -1.

−y

−1

=

−24

−1

y=24

Answer:

y=24

The measure of each Interior angle of a regular polygon is 135º. Find the number of sides.
Number of sides
5
?​

Answers

Answer:

The number of sides of the polygon with 135° interior angle is 8  

Step-by-step explanation:

Given as :

The measure of each interior angle of regular polygon = 135°

Let The total number of sides = n

So, each internal angle of a regular polygon with n sides = [tex]180^{\circ}- \frac{360^{\circ}}{n}[/tex]

or,   135°  = [tex]180^{\circ}- \frac{360^{\circ}}{n}[/tex]

or, [tex]\frac{360^{\circ}}{n}[/tex] = 180° - 135°

or,   [tex]\frac{360^{\circ}}{n}[/tex] = 45°

∴   n = [tex]\frac{360^{\circ}}{45^{\circ}}[/tex]

I.e  n = 8

Hence the number of sides of the polygon with 135° interior angle is 8  Answer

write a short paragraph about things you should and shouldnot do to stay healthy( at least 50 words)​

Answers

Answer:

what' you should do to stay healthy is eat vegetables and fruits grains and anything else you know is good for you and you should also drink water everyday. what you shouldn't do to stay healthy is basically eat junk food and drink soda also eat lots of candy but eating healthy is much better

Answer:

Staying healthy physically can help you stay healthy emotionally too. If you're eating the right food and keeping fit, your body will be strong and help you to cope with stress and also fight illness. Eating well and exercising often when you're a teenager will also help you stay in good health later in life.

Step-by-step explanation:

need help
with these​

Answers

1. 4(2+3c) = 56

c = 4

3. -29 = 5(2a-1)+2a

a = -2

5 . 7p-(3p+4) = -2(2p-1)+10

p=2

7. 1/2 (-4+6x) = 1/3x + 2/3*(x+9)

x=4

Step-by-step explanation:

1. 4(2+3c) = 56

[tex]4(2+3c) = 56\\8+12c = 56[/tex]

Subtracting 8 from both sides

[tex]8-8+12c = 56-8\\12c = 48[/tex]

Dividing both sides by 12

[tex]\frac{12c}{12} = \frac{48}{12}\\c = 4[/tex]

Checking:

[tex]4[2+3(4)] = 56\\4(2+12) = 56\\4(14) = 56\\56 = 56[/tex]

3. -29 = 5(2a-1)+2a

Simplifying

[tex]-29 = 10a-5+2a\\-29 = 12a-5[/tex]

Adding 5 on both sides

[tex]-29+5 = 12a - 5+5\\-24 = 12a[/tex]

Dividing both sides by 12

[tex]\frac{12a}{12} = \frac{-24}{12}\\a = -2[/tex]

Checking:

[tex]-29 = 5(2a-1)+2a\\-29 = 5[2(-2)-1]+2(-2)\\-29 = 5(-4-1) -4\\-29 = 5(-5) -4\\-29 = -25-4\\-29 = -29[/tex]

5 . 7p-(3p+4) = -2(2p-1)+10

Simplifying

[tex]7p-3p-4 = -4p+2+10\\4p-4 = -4p+12[/tex]

Adding 4 on both sides

[tex]4p-4+4 = -4p+12+4\\4p = -4p+16[/tex]

Adding 4p on both sides

[tex]4p+4p = -4p+4p+16\\8p = 16[/tex]

Dividing both sides by 8

[tex]\frac{8p}{8} = \frac{16}{8}\\p = 2[/tex]

Checking:

[tex]7p-(3p+4) = -2(2p-1)+10\\7(2)-[3(2)+4] = -2[2(2)-1] +10\\14 - (6+4) = -2 (4-1) +10\\14 - 10 = -2(3) +10\\4 = -6+10\\4=4[/tex]

7. 1/2 (-4+6x) = 1/3x + 2/3*(x+9)

Simplifying

[tex]\frac{1}{2} (-4+6x) = \frac{1}{3}x+\frac{2}{3}(x+9)\\\frac{-4}{2}+\frac{6x}{2} = \frac{x}{3} +\frac{2x}{3} + \frac{18}{3}\\-2+3x = \frac{x+2x+18}{3}\\-2+3x = \frac{3x+18}{3}\\3(-2+3x) = 3x+18\\-6+9x = 3x+18[/tex]

Adding 6 on both sides

[tex]-6+6+9x = 3x+18+6\\9x = 3x+24[/tex]

Subtracting 3x from both sides

[tex]9x-3x = 3x-3x+24\\6x = 24[/tex]

Dividing both sides by 6

[tex]\frac{6x}{6} = \frac{24}{6}\\x = 4[/tex]

Checking:

[tex]\frac{1}{2} [-4+6(4)] = \frac{1}{3}(4)+\frac{2}{3}(4+9)\\\frac{1}{2}(-4+24) = \frac{4}{3}+\frac{2}{3}(13)\\\frac{1}{2}(20) = \frac{4}{3} +\frac{26}{3}\\15 = \frac{4+26}{3}\\15 = \frac{30}{3}\\15=15[/tex]

Keywords: Linear equations

Learn more about linear equations at:

brainly.com/question/3614284brainly.com/question/3783529

#LearnwithBrainly

Write 4 over 6 in simplest form.

Answers

Answer:

2/3

Step-by-step explanation:

Cancel the common factor 2 = 2/3

A man is standing on a bridge 30 feet above sea level. A turtle is swimming directly belo him 7 feet below sea level. What is the distance between the man and the turtle

Answers

The answer is 37 feet

You add the feet you need to get to sea level 30 to the distance the turtle is from sea level 7 and you get 37 feet between them

What’s the standard form of the line that passes through (7,-3) and has a y-intercept of 2?

Answers

Answer:

Step-by-step explanation:

(y-y)=m(x-x)

(y--3)=2(x-7)

y+3=2x-14

y+3+14=2x

First, let's solve in slope-intercept form since it's easier. After that, we can turn it into standard form.

Recall the format of slope-intercept form: y = mx + b

We know that the y-intercept is 2, so we can input it into our equation ('b' represents the y-intercept!)

y = mx + 2
In order to solve for the slope, input the coordinates (7, -3)

-3 = 7m + 2
-5 = 7m
m = -5/7

y = -5x/7+ 2
In order to turn it into standard form, just make sure 'x' and 'y' are on the same side:

y + 5x/7 = 2 is the standard form of the line

-T.B.

1. 6 ÷ 2/3
A. 4
B. 8
C. 9
D.12

2. 3/4 ÷ 2/5
A. 1 7/8
B. 1 3/4
C. 1 4/5
D. 3/10

Answers

Answer:

1. C

2. A

The drawings will help

Remember: Keep, Change, Flip

80% of_
games is 32 games.

Answers

Answer:

40 games

Step-by-step explanation:

Here we need to find a number, x, such as 32 is the 80% of x. In this case x is our 100%.

So, if our x number is the correct it must be that the following ratios are equivalent:

100%/80% = x/32 if 32 is the 80% of x

Lets drop the % sign for simplicity:

100/80 = x/32

Now, multiply both sides by 32 to eliminate the 32 on the right side:

(100/80)*32 = (x/32)*32

100*32/80 = x

3200/80 =x

320/8 = x

40 = x

So 32 is the 80% of 40.

32 games is the 80% of 40 games.

Answer: 40

Step-by-step explanation:

The quotient of a number and 4 is -7 write an equation and solve

Answers

Answer:

equation- 4÷x=-7

x= -4/7

Step-by-step explanation:

I think the answer is -4/7 i tried my best :)

so x=-4/7

PLEASE HELP!!! What is the simplified form of square root of 2160x^8/ 60x^2? Assume

Answers

Answer:

6x^3

Step-by-step explanation:

2160x^8/ 60x^2

2160/60=36

x^8-2 because your dividing

x^6

36x^6 (you're not done)

after you've got the square root

6x^3 because

36=6*6

and the square root of 6 is 2.45 which rounds to 3

(I'm pretty sure this is the answer).

The simplified form of [tex]\rm \sqrt{\dfrac{2160 x^8}{60x^2}[/tex] is 6x³ , Option C is the right answer.

What is Square root ?

Square root of a positive square number is the number itself.

[tex]\rm \sqrt{y^8} = y^4[/tex]

In the given question the expression given is

[tex]\rm \sqrt{\dfrac{2160 x^8}{60x^2}[/tex]

To simplify this

the numerator and the denominator has to be simplified first

[tex]\rm \dfrac{2160x^8}{60x^2}\\[/tex]

[tex]\rm \dfrac{2160}{60}\\ \\\\\ \dfrac{1080}{30}\\\\\\ \dfrac{540}{15} \\\\\\ \dfrac{108}{3}\\\\= 36[/tex]

[tex]\rm \dfrac{x^8}{x^2} \\\\= x^{8-2}\\\\= x^6[/tex]

Therefore

[tex]\rm \sqrt{36x^6}[/tex]

6x³

The simplified form of [tex]\rm \sqrt{\dfrac{2160 x^8}{60x^2}[/tex] is 6x³ , Option C is the right answer.

To know more about Square root

https://brainly.com/question/3120622

#SPJ2

a magazine is offering a special subscription rate of $30 per year for 12 issues the regular price for the magazine is $4 per issue if you subscribe at the special rate how much money will you save for the year​

Answers

Answer:

Step-by-step explanation:

c

Answer:

$18

Step-by-step explanation:

12*4=48

48-30=18

Help plz
How do you solve

Answers

Answer:

[tex]y=4\sqrt{3}\ units[/tex]

Step-by-step explanation:

Triangle MRN is created by folding an equilateral triangle by half. Since triangle MRN is right triangle, the equilateral triangle must be folded along the height drawn to one side.

In equilateral triangle with side length of a units, the height is [tex]\dfrac{a\sqrt{3}}{2}\ units[/tex] and the height is greater than half the side because

[tex]\dfrac{a\sqrt{3}}{2}>\dfrac{a}{2}.[/tex]

The leg with length x units has the smaller projection (2 units long) than the leg with length y units has (6 units long).

This means the leg with length y units is the height of the equilateral triangle. If the leg with length y units is the height of the equilateral triangle, then the hypotenuse MN = 8 units is the side of the equilateral triangle and lex with length x units is half the side, so x = 4 units.

By the Pythagorean theorem,

[tex]y^2=8^2-4^2\\ \\y^2=64-16\\ \\y^2=48\\ \\y=4\sqrt{3}\ units[/tex]

The value of y is 4*sqrt(3) units.

The problem states that triangle MRN is created by folding an equilateral triangle in half. Since triangle MRN is a right triangle, the equilateral triangle must have been folded along its height. We are given that the side length of the equilateral triangle is 8 units. We are asked to find the value of y, which is the length of the leg of triangle MRN that is opposite the right angle.

Here's how we can solve the problem:

1. Identify the relevant information:

   - Triangle MRN is a right triangle.

   - The original equilateral triangle has side length 8 units.

   - We want to find the value of y, which is the length of the leg of triangle MRN opposite the right angle.

2. Use the properties of equilateral triangles:

   - In an equilateral triangle, all sides are equal and all angles measure 60 degrees.

   - The height of an equilateral triangle divides the triangle into two 30-60-90 triangles.

   - The height of an equilateral triangle with side length a is sqrt(3)*a / 2.

3. **Relate the information to find y:**

   - Since the equilateral triangle was folded along its height, the height of the equilateral triangle is also the hypotenuse of triangle MRN (side MN).

   - Therefore, MN = sqrt(3)*8 / 2 = 4*sqrt(3).

   - We are given that MN = 8, so 4*sqrt(3) = 8.

   - Solving for sqrt(3), we get sqrt(3) = 2.

   - Now we can use the Pythagorean theorem in triangle MRN: y^2 + (4)^2 = (8)^2.

   - Substituting sqrt(3) = 2, we get y^2 + 16 = 64.

   - Solving for y, we get y = sqrt(48) = 4*sqrt(3).

Therefore, the value of y is 4*sqrt(3) units.

The number y of hits a new website receives each month can be modeled by
y = 4090ekt,
where t represents the number of months the website has been operating. In the website's third month, there were 10,000 hits. Find the value of k. (Round your answer to four decimal places.)

Answers

Answer:

k = 0.2980

Step-by-step explanation:

Given:

number of months t =3

number of hits y = 10000

The equation is modeled as

[tex]y= 4090e^{kt}[/tex]

We need to find value of k.

Now Substituting the values in above equation we get.

[tex]10000= 4090e^3k\\e^{3k}=\frac{10000}{4090}\\\\[/tex]

Now taking Anti log on both side to remove e we get,

[tex]3k = \ ln \frac{10000}{4090}\\\\3k = 0.8940\\k = \frac{0.8940}{3}= 0.2980[/tex]

Hence the value of k = 0.2980.

The value of k is 0.2981.

We are given that in the website's third month (t = 3), there were 10,000 hits. We need to find the value of k.

1. First, substitute y = 10000 and t = 3 into the given equation:

10000 = 4090e3k

2. Next, solve for the exponential term:

10000 / 4090 = e3k

This simplifies to:

10 / 4.09 = e3k

2.444 = e3k

3. Take the natural logarithm (ln) of both sides to solve for k:

ln(2.444) = 3k

Calculating ln(2.444) yields approximately 0.8944.

0.8944 = 3k

4. Finally, solve for k:

k = 0.8944 / 3

k ≈ 0.2981

Therefore, the value of k, rounded to four decimal places, is approximately 0.2981.

To start her collection of comic books, Joylin’s uncle gives her a box of comic books and several monthly subscriptions to comic books. the number of comic books in her collection, y, after x months is modeled by the equation shown: y=40+6x. What does the number 40 represent?

Answers

40 would represent the starting number of comics.
Final answer:

In the equation y=40+6x, 40 represents the initial number of comic books in Joylin's collection, given to her by her uncle. Over time, she gains additional comic books from monthly subscriptions.

Explanation:

In the provided equation, y=40+6x, the number 40 represents the initial amount of comic books Joylin has before the monthly subscriptions start. This is essentially the number of comic books Joylin's uncle gave her to start her collection. The number 6 represents the number of books she receives monthly from the subscriptions. Therefore, 'x' months after receiving the initial batch of comic books, Joylin has 40 + 6x comic books in her collection.

Learn more about Linear Equations here:

https://brainly.com/question/32634451

#SPJ2

please help, i would really appreciate it, thank you

Answers

Answer:

A'(-16,4), B'(16,-12), C'(8,12), D'(-4,16)

Step-by-step explanation:

The dilation with a center of dilation at (0,0) and scale factor of [tex]\frac{1}{4}[/tex] has the rule

[tex](x,y)\rightarrow \left(4x,4y\right)[/tex]

Quadrilateral ABCD has vertices at points A(-4,1), B(4,-3), C(2,3) and (-1,4).

Therefore, the image vertices are

[tex]A(-4,1)\rightarrow A'(-16,4);[/tex][tex]B(4,-3)\rightarrow B'(16,-12);[/tex][tex]C(2,3)\rightarrow C'(8,12);[/tex][tex]D(-1,4)\rightarrow D'(-4,16).[/tex]

A realtor makes 5% commission on each sale how much commission will the realtor earn for selling a $150,000 house

Answers

Answer:

$7,500.00

Step-by-step explanation:

The Realtor commission will be 5% of $150,000.00

(5% * $150,000)/100% = $7,500.00

The realtor makes a 5% commission on a $150,000 house, which equates to a commission of $7,500 by multiplying the sale price by the commission rate (0.05).

To calculate the amount of commission a realtor earns on a house sale, you simply multiply the sale price of the house by the commission rate. In this case, the realtor makes a 5% commission on a $150,000 house sale. We calculate the commission as follows:

First, convert the percentage rate to a decimal: 5% = 0.05.Then, multiply the sale price by this decimal: $150,000 x 0.05.Do the multiplication to find the commission: $150,000 x 0.05 = $7,500.

Therefore, the realtor will earn a commission of $7,500 for selling the $150,000 house.

30 points !!!! :)) please help thanksss

Answers

Answer:

A = 10⁰

Step-by-step explanation:

We have 2.247 and this to represented as [tex]$ 2 \times A + 2 \times B + 4 \times C + 7 \times D $[/tex]

[tex]$ 2.247 = \frac{2247}{1000} $[/tex]

[tex]$ 2.247 = 2 \times 10^0 + 2 \times \frac{1}{10} + 4 \times \frac{1}{10^2} + 7 \times \frac{1}{10^3} $[/tex]

Comparing with the given data, we have:

A = 10⁰

B = [tex]$ \frac{1}{10} $[/tex]

C = [tex]$ \frac{1}{10^2} $[/tex]

D = [tex]$ \frac{1}{10^3} $[/tex]

Hence the answer A = 10⁰.

Help me solve it the system by substitution

Answers

Answer:

x=-3, y=5. (-3, 5).

Step-by-step explanation:

y=x+8

x+y=2

----------

x+x+8=2

2x+8=2

2x=2-8

2x=-6

x=-6/2

x=-3

y=-3+8=5

Answer:

(-3,5)

Step-by-step explanation:

A basketball player scored 19 times during one game. He scared a total of 28 points, two for each two-point shot and one for each free throw. How many two-point shots did he make? How many free throws?

Answers

Answer: 10 free throws made, 9 two-point shots made

Step-by-step explanation:

x=number of free throws

y=number of two-point shots

x+y=19

x+2y=28

solve by elimination

x+2y=28

-(x+y=19)

--------------

y=9

x=10

Answer: 10 free throws made, 9 two-point shots made

Step-by-step explanation:

x=number of free throws

y=number of two-point shots

x+y=19

x+2y=28

solve by elimination

x+2y=28

-(x+y=19)

(Y=9

X=10)

how many pounds of candy worth $12 per pound should be mixed with candy costing $19 per pound to produce a 70 pound mixture that sells for $15 per pound?

Answers

Answer:

40 pounds

Step-by-step explanation:

Given: Cost of a candy [tex](c_1)[/tex]= [tex]\$ 12[/tex] per pound

           Cost of candy [tex](c_2) = \$ 19\ per\ pound[/tex]

           Total amount of mixture of be produced = [tex]70\ pound[/tex]

           Selling price of mixture = [tex]\$ 15 \ per\ pound[/tex]

Let´s x be the amount of [tex]c_1 [/tex] to be mixed in the mixture.

∴ Cost of [tex]c_1[/tex] in the mixture = 12x

Next, Cost of [tex]c_2[/tex] in the mixture = [tex](70 - x)\times 19[/tex]

And we know the cost of final mixture = [tex]70 \times 15 = 1050[/tex]

Now, putting all the value in the equation

⇒ [tex]12x + 19 \times (70 - x) = 1050[/tex]

⇒ [tex]1330 - 7x = 1050[/tex]

⇒ [tex]-7x = -280[/tex]

∴ [tex]x = 40\ pound[/tex]

40 pounds of candy worth $12 per pound to be mixed in the mixture.

Simplify 5n - 2n - 3 + n

Answers

Answer:

that's your answer...

4n-3 is your answer!

Kelly and Rachel collected 193 pounds of newspaper between them. Kelly collected 35 pounds more than Rachel. How many pounds of newspaper did each girl collect?

Answers

Answer:take 193 and subtract 35. you should get 158 then divide 158 bby 2 you should get 79 add 35 to 79 you should get 114. therefore kelly will have 114 and rachel will have 79

Step-by-step explanation:

Answer:

Kelly collected 114 pounds of newspaper. Rachel collected 79 pounds of newspaper.

Step-by-step explanation:

Write an expression for each girl to figure out how many pounds of newspapers they each collected:

(x represents pounds of newspapers)   Rachel = x     Kelly = x + 35

To solve, combine the two expressions into one equation: 2x + 35 = 193

Then, subtract 35 from both sides of the equation. Make sure you subtract from both sides of the equation to keep it equal: 2x + 35 - 35 = 193  - 35

The equation left is: 2x = 158

Divide both sides by two in order to get the x by itself: 2x ÷ 2 = 158 ÷ 2

The answer will be: x = 79

Then, substitute 79 for x in the first equations:

Rachel = 79    Kelly = 79 + 35

Solve for the final answer: Rachel = 79    Kelly = 114

A clogged bathtub drains at a constant rate. The amount of water in the bathtub changes by –3.75 gallons in one hour. What is the change in the amount of water in the bathtub after 13 hour?

Answers

Final answer:

To calculate the change in water amount after 1/3 hour, the draining rate of -3.75 gallons per hour is multiplied by 1/3, resulting in a total change of -1.25 gallons of water.

Explanation:

The student has asked about the change in the amount of water in a bathtub after a certain period, given a constant rate of draining. The bathtub drains at a rate of -3.75 gallons per hour. To find the total change in the amount of water after 1/3 hour (20 minutes), we multiply the rate by the time.

First, we convert 1/3 of an hour to minutes:

1/3 hour = 60 minutes / 3 = 20 minutes.

Next, we calculate the change in water:

Change in water = Rate  imes Time

Change in water = -3.75 gallons/hour  imes 1/3 hour

Change in water = -3.75 gallons/hour  imes 0.3333... (repeating)

Change in water = -1.25 gallons.

Therefore, the bathtub will drain 1.25 gallons of water in 1/3 of an hour.

y9/8 divided by y5/8
write the expression in simplified radical form

Answers

Answer : A

Workings in the picture below :)

Mr. Mole left his burrow that lies below the ground and started digging his way at a constant rate deeper into the ground. After
5
minutes of descending at a rate of
1.8
Meters per minute, he was
13.5
meters below the ground.

Answers

Answer: –1.8x – 4.5

Step-by-step explanation:

The guy above me obviously doesn’t know how to do this so here this is the correct answer

Answer:

–1.8x – 4.5

Step-by-step explanation:

f(4) if f(x) = 3x - 1​

Answers

Answer: 11

Step-by-step explanation:

plug in 4 any instance you see "x"

f(x) = 3x - 1​

f(4) = 3(4) - 1 = 11

Functions are mappings who map inputs to at max one corresponding outputs. The value of function at x=4 is: [tex]f(4) = 11[/tex]

How to evaluate a given function  if values of the variables are known?

You can simply replace those variables with the value you know of them and then operate on those values to get a final value. This is the result of that expression at those values of the considered variables.

For given case, we have:

[tex]f(x) = 3x - 1[/tex]

Taking x = 4, we get:

[tex]f(4) = 3(4) - 1 = 3 \times 4 - 1 = 12 - 1\\f(4) = 11[/tex]

Thus, The value of function at x=4 is: f(4) = 11

Learn more about evaluating functions here:

https://brainly.com/question/2753269

A triangular flowerbed is being planted inside a circular area of grass. What is the area of the triangular flowerbed? (Use 3.14 for π.)



1,350 ft 2
1,566 ft 2
1,450 ft 2
675 ft 2

Answers


Area for a triangle is (1/2)bh

Find the area by plugging in 27 for b and 50 for h

Answer:

675 ft 2

Step-by-step explanation:

just did it in a test

Please hurry I need help
4x-3=2x-13
Find x

Answers

move the x’s to one side and the numbers to another

4x-3=2x-13
2x=-10

divide by 2

x=-5

Answer: x=-5

(^._.^)ノ

Step-by-step explanation:

4x-3=2x-13

Subtract

4x−3−2x=−13

Simplify

2x−3=−13

Add 3 to both sides

2x=−13+3

Simplify again

2x=-10

Divide both sides by 2

x=[tex]-\frac{10}{2}[/tex]

Simplify one last time

x=-5

You're finished! Not only that but you found the answer :3

Hope this helps, have a BLESSED and wonderful day! :-)

What is a simple way to solve for the sum and difference of 2 cubes? For example, 27+64[tex]x^3[/tex] and 64[tex]m^3[/tex]-1

Answers

Answer:

(3 + 4x)(9 - 12x + 16x²) = 0

(4m - 1)(16m² + 4m + 1) = 0

Step-by-step explanation:

Here we have to solve the sum of two cubes which is [tex]27 + 64x^{3}[/tex]

Now, the equation is [tex]27 + 64x^{3} = 0[/tex]

⇒ 3³ + (4x)³ = 0

⇒ (3 + 4x)[3² - 3(4x) + (4x)²] = 0

(3 + 4x)(9 - 12x + 16x²) = 0

So, (3 + 4x) = 0 or (9 - 12x + 16x²) = 0

Therefore, from the above two relation we can solve for x.

One root will be [tex]- \frac{3}{4}[/tex] and the others we will get by applying Sridhar Acharya Formula, which will give a pair of conjugate imaginary roots of the equation.  

Again, we have to solve the difference of two cubes which is [tex]64m^{3} - 1[/tex]

Now, the equation is [tex]64m^{3} - 1 = 0[/tex]

⇒ (4m)³ - 1³ = 0

⇒ (4m - 1)[(4m)² + 4m(1) + 1²] = 0

(4m - 1)(16m² + 4m + 1) = 0

So, (4m - 1) = 0 or (16m² + 4m + 1) = 0

Therefore, from the above two relation we can solve for m.

One root will be [tex] \frac{1}{4}[/tex] and the others we will get by applying Sridhar Acharya Formula, which will give a pair of conjugate imaginary roots of the equation.  (Answer)

Other Questions
I need help putting these sentences in present progressive form. pleeeease help me1. Nosotros / practicar deportes2. Carmen / comer en casa3. Nuestro equipo / ganar el partido4. Yo / leer el peridico5. l / pensar comprar una bicicleta roja6. Ustedes / jugar a las cartas7. Jos y Francisco / dormir8. Marisa / leer el correo electrnico9. Yo / preparar sndwiches10. Carlos / tomar fotos11. dormir / t? A product modification differs from a line extension in that _______. The U.S. Congress enacted the CAN-SPAM Act in 2003. This act: a. limits advertisers from sending more than one ad per month per email address. b. does not view sending multiple spam emails with the use of a hijacked computer as an offense. c. prohibits the use of false or misleading subject lines on emails used for advertising. d. requires spammers to register with the Federal Trade Commission. All of the following statements are consistent with the kinetic molecular theory of gases EXCEPT: A. The gas molecules collide with each other and with the surfaces around them.B. Strong attractive forces hold the gas molecules together. C. The average kinetic energy of the molecules of a gas is proportional to the temperature of the gas in kelvins. D. The size of the gas molecules is negligible compared to the total volume of the gas. E. none of the above. What is a non-example of unit rate 14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line Linda says she values education. Over the years she has had several employees who worked for her and earned their degrees at the same time. To support them, Linda allowed them to flex their daily work hours. In this example, Linda demonstrates_____________. A 1.00-L gas sample at 100.C and 500. torr contains 52.0% helium and 48.0% xenon by mass. What are the partial pressures of the individual gases? Consider this simplified balance sheet for Geomorph Trading: Current assets $ 275 Current liabilities $ 210 Long-term assets 650 Long-term debt 205 Other liabilities 120 Equity 390 $ 925 $ 925 a. What is the companys debt-equity ratio? 6% of what number is 2.36 GEICO has decided that everyone will work in units with people who perform similar jobs. All of the procurement employees work in one department. All of the human resource employees work in one department and all of the printing employees work in the print shop. This type of structure is called_________. Consider the reaction 2Na(s) + 2H2O(l)2NaOH(aq) + H2(g) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 1.74 moles of Na(s) react at standard conditions. Ssurroundings = J/K g A two party political system is defined as having: a. two parties on the ballot c. two dominant parties with numerous minor parties b. three parties at any given time d. two minor parties with multiple dominant parties A 28-year-old presets to the ER reporting severe chest pain that worsens with respirations or lying down. Other signs include a fever, tachycardia, and a friction rub. Assessment findings support which medical diagnosis?A. Acute pericarditis.B. Myocardial infarction (MI).C. Stable angina.D. Pericardial effusion.