What is equivalent to 5/9

Answers

Answer 1

Answer:

10/18

Step-by-step explanation:

U only asked for what is equivalent

Answer 2

Answer:

10/18, 15/27, 20/36, 25/45, 30/54, 35/63, 40/72, 45/81, 50/90, 55/99, 60/108.

Step-by-step explanation:


Related Questions

There are 12 pupils in a class.
They are each asked whether they have a brother or a sister.

9 say they have a brother.
7 say they have a sister.
2 say they have neither.
Fill in the Venn diagram.​

Answers

Answer:

The value in box of circle B is 3 and the value in box which belongs in both circle B and S is 6 and value which belongs in circle S is 1 and the value of box outside both the circle is 2.

Step-by-step explanation:

In given Venn diagram

ε = class of 12 pupils

pupils who have brother B = 9

pupils who have sister S = 7

pupils who have neither brother nor sister = 2

Hence the Venn diagram is drawn in the attachment for your reference.

n(E) =12

n(neither B nor S) = 2

So, n(B or S)= n(E) - n(neither B nor S)= 12-2=10

n(B) = 9

n(S) = 7

Now, addition theorem,

n(B or S) = n(B) + n(S) - n(B and S)

[tex]10=9+7-n(B\ and \ S)\\n(B\ and \ S) = 6[/tex]

So the value in box which is in both circle B and S is 6.

So the Box which contains only brothers = n(B) - n(B and S)  = 9 - 6 = 3

Value in box of circle B is 3.

So the Box which contains only Sisters = n(S) - n(B and S)  = 7 - 6 = 1

Value in box of circle S is 1.

There are 12 pupils in a class so, the number of pupils having both brother and sisters are 6 and the pupils had either brother or sister are 10.

Given :

There are 12 pupils in a class.9 say they have a brother. 7 say they have a sister. 2 say they have neither.

Given that there are pupils in a class that is, n(E) = 12

Pupils who have brother, n(B) = 9

Pupils who have sister, n(S) = 7

Pupils who have neither brother nor sister, n(neither B nor S) = 2

So,  n(B or S) = n(E) - n(neither B nor S)

                      = 12 - 2 = 10

n(B or S) = 10

Now, through the addition theorem:

n(B or S) = n(B) + n(S) - n(B and S)

10 = 9 + 7 - n(B and S)

n(B and S) = 6

For more information, refer to the link given below:

https://brainly.com/question/23017717

HELP WITH THIS???????????????????Will mark brainliest

Answers

Answer:

(1,c) (2,b) (3,A)

Step-by-step explanation:

May be right or worng i just read thought it better.

Eli took out a 20-year loan for $135,000 at 4.8% interest, compounded
monthly. If his monthly payment on the loan is $876.09, how much of his first
payment went toward note reduction?
O A. $876.09
B. $336.09
O
c. $540.00
D. $420.48

Answers

Answer:

B. $336.09

Step-by-step explanation:

Monthly payment = $876.09

Interest rate = 4.8%

Convert the annual interest rate to monthly rate = 4.8% / 12

Monthly rate = 0.4% or 0.004

Amount going towards interest payment = 0.004* loan amount

Interest = 0.004 * 135,000

Interest = $540

Therefore, from the monthly payment of $876.09 , $540 goes towards paying interest and the balance is the note reduction;

Note reduction = $876.09 - $540 = $336.09

Answer:

336.09

Step-by-step explanation:

this is the right anwser

In January Jennifer was allowed to use 150 text messages. If she is allowed to use the same amount of text messages every month. How many text messages would she have used in all by the month of August?

Answers

She would have used 1200 messages in all by the month of August.

Step-by-step explanation:

Messages allowed per month = 150

There will be 8 months starting from January to August, therefore,

Time period = 8 months

Messages in 8 months = Messages per month * Time period

[tex]Messages\ in\ 8\ months=150*8\\Messages\ in\ 8\ months=1200[/tex]

She would have used 1200 messages in all by the month of August.

Keywords: Multiplication

Learn more about multiplication at:

brainly.com/question/629998brainly.com/question/6208262

#LearnwithBrainly

6[4x(72-36) divided by 3

Answers

Answer : 288 x

workings in the pic below :))

Evaluate the expression for x = 5, y = 3, and z = 1/4 . 5x−6y+20z4yz Enter your answer in the box.

Answers

Final answer:

To evaluate the given expression 5x−6y+20z4yz, for x = 5, y = 3, and z = 1/4, we substitute the given values and apply the order of operations to solve the problem.

Explanation:

The question requires us to evaluate the mathematical expression given as 5x−6y+20z4yz with provided values of x = 5, y = 3, and z = 1/4. Let us substitute the values into the expression as follows:

First, replace each 'x', 'y', 'z' in the expression with the given values:

= 5×5 - 6×3 + 20×(1/4) / (4×3×(1/4))

= 25 - 18 + 20 / (3)

= 7 + 20/3

Finally, you can calculate the exact numerical result depending on whether you are allowed to leave it as an improper fraction or if you need to convert it to a mixed number or decimal form.

Learn more about Evaluating Expressions here:

https://brainly.com/question/21469837

#SPJ12

The graph shows the relationship between time and the number of soda bottles a machine can make. Use the points ​(4​,80​) and ​(7​,140​) to find the number of soda bottles the machine can make each minute.

Answers

Final answer:

This is a mathematics problem involving the calculation of the slope of a line graph. The machine produces 20 soda bottles per minute as concluded from the given coordinates (4,80) and (7,140).

Explanation:

The subject of this question falls under Mathematics, specifically the topic of linear relationships or functions. The task is to calculate the rate at which soda bottles are made per minute using the given coordinates of the graph, (4,80) and (7,140).

First, we need to calculate the slope of the line represented by these points since the slope corresponds to the number of soda bottles produced per minute. In a linear relationship, the slope of the line can be found using the formula: slope = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points.

In this case, (x1, y1) is (4,80) and (x2, y2) is (7,140). Plugging these values into the slope formula, we get: slope = (140 - 80) / (7 - 4) = 60 / 3 = 20.

So, the machine produces 20 soda bottles per minute.

Learn more about Slope Calculation here:

https://brainly.com/question/3796508

#SPJ12

5 divide 3/4 in simplest

Answers

Answer:

20/3

Step-by-step explanation:

5/(3/4)=(5/1)(4/3)=20/3

Three consecutive integers have a sum of 132

Answers

Answer:

43+44+45

Step-by-step explanation:

X + X + 1 + X + 2 = 132

3X + 3 = 132

3X + 3 - 3 = 132 - 3

3X = 129

3X/3 = 129/3

X = 43

consecutive means numbers after

Simplify the expressions:


2(3a+1)-5a

Answers

Answer:

6a+2-5a

ascending

2+a

descending

a+2

How is the number 6.24 x 10^-4 expressed in regular numbers?

Answers

Answer:

The scientific notation, 6.24 x 10^-4, means that the 6.24 is multiplied to 10 which is raised to exponent -4. 10^-4 has a regular number value of 0.0001. So, to find the answer you should multiply 6.24 by 0.0001 which gives an answer of 0.000624.20

Step-by-step explanation:

Kayla is buying fruit for packed lunches. She needs to buy an assortment of at least 15 apples and oranges and spend less than $20.00. Apples (x) cost $0.65 each, an oranges (y) cost $0.78 each. Which system of linear inequalities models this situation?

Answers

Final answer:

The system of linear inequalities for Kayla's fruit purchase is x + y ≥ 15 to represent the quantity of fruit, and 0.65x + 0.78y < 20 to represent the budget constraint.

Explanation:

The student's question is asking for a system of linear inequalities that would model the situation in which Kayla wants to buy at least 15 fruits consisting of apples and oranges, without spending more than $20. Given that apples (x) are $0.65 each and oranges (y) are $0.78 each, we can set up the following inequalities:

x + y ≥ 15

0.65x + 0.78y < 20

The first inequality represents the requirement that Kayla needs to buy at least 15 pieces of fruit. The second inequality represents the constraint that she needs to spend less than $20 on her purchase.

Somebody help quick please

Answers

Answer:

106°

Step-by-step explanation:

For the equilateral ΔBCD all angles are 60° (180/3 = 60).

m∠ADB is 67° Since the triangle is isosceles the base angles are =.

m∠ ABD will be 180 - (67+67) = 46°.

m∠DBC = 60° so  m∠ABC = 46 + 60 = 106°

Answer:

For the equilateral ΔBCD all angles are 60° (180/3 = 60).

m∠ADB is 67° Since the triangle is isosceles the base angles are =.

m∠ ABD will be 180 - (67+67) = 46°.

m∠DBC = 60° so  m∠ABC = 46 + 60 = 106°

Read more on Brainly.com - https://brainly.com/question/14051785#readmore

Step-by-step explanation:

Last Monday, two law students met up at café Literatura after school to read the pages they were assigned in the legal methods class. Alejandro can read 1 page per minute, and he has read 28 pages so far. Carly, who has a reading speed of 2 pages per minute has read 12 pages so far.

Part A: Define the variables and write two equations to represent the number of pages that each student read.

Variables:

Alejandro:

Carly:

Answers

Answer:

Step-by-step explanation:

Variables:

let x be the number of minutes

let y be the total number of pages read

Use the form y = mx + b

"b" is irrelevant in this context because the initial value is 0 (they have not read it before or it is not given)

m is the rate, how fast they can read, how many pages each minute

Alejandro:

28 = 1x   <=Simplify because any number multiplied by 1 is itself.

28 = x

Carly:

12 = 2x

Sandria earned $24 babysitting. She owes her friend $7 for dinner, and she owes her mom $4. She will make $15 later this week for mowing the yard.

How much money will she have at the end of the week?

Answers

Answer:

28

Step-by-step explanation:

24-7-4=13

13+15=28

Name the only type of polygon that must be regular if it is equiangular?

Answers

an equiangular polygon is a polygon whose vertex angles are equal. If the lengths of the sides are also equal (that is, if it is also equilateral) then it is a regular polygon

The only type of polygon that must be regular if it is equiangular is a regular polygon.

Here, we have,

we know that,

A polygon is a two-dimensional geometric figure that has a finite number of sides. The sides of a polygon are made of straight line segments connected to each other end to end. Thus, the line segments of a polygon are called sides or edges.

an equiangular polygon is a polygon whose vertex angles are equal.

If the lengths of the sides are also equal (that is, if it is also equilateral) then it is a regular polygon.

Hence, The only type of polygon that must be regular if it is equiangular is a regular polygon.

To learn more on polygon click:

brainly.com/question/24464711

#SPJ2

15. Which of the following equations was
used to graph the line shown?
A. y=6 + x
B. y=6 - x
C. y=x- 6
D. y=6x

Answers

Answer:

B

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c (m is the slope and c the y- intercept )

Calculate m using the slope formula

m = (y₂ - y₁ ) / (x₂ - x₁ )

with (x₁, y₁ ) = (0, 6) and (x₂, y₂ ) = (6, 0)

m = [tex]\frac{0-6}{6-0}[/tex] = [tex]\frac{-6}{6}[/tex] = - 1

Note the line crosses the y- axis at (0, 6 ) ⇒ c = 6

y = - x + 6 or y = 6 - x ⇒ B

Suppose the x-axis of a density graph represents someone's height in inches.
If the area under the density curve from 60 inches to 70 inches is 0.55, what
is the probability of someone's height being anywhere from 60 inches to 70
inches?
A.70%
B.55%
C.65%
D.60%

Answers

The correct answer is b 55%

What is the minimum cuts
needed to cut a circle into 8
equal parts?

Answers

What is the minimum cuts  needed to cut a circle into 8  equal parts ?

A : 4 cuts

Answer:

4 cuts.

Step-by-step explanation:

When we have a circle, each cut (supposing the curst are in the exact middle) which give use two haves. So, if we cut one time, we'll have two equal parts, if we cut a second time, we'll have 4 equal parts, a third time, we'll get us 6 equal parts, and if we cut a fourth time, we'll have 8 equal parts.

So, whenever we have this kind of problem dividing circles, we just say that each cut in the exact middle equals two equal haves, so if we have 4 cuts, we just multiply them by 2, 4(2)=8. Therefore, we have 8 equal parts.

A jacket that originally cost 20 is on sale for 75% off what is the sale price of the jacket? What was the amount of the discount?

Answers

Thus, a product that normally costs $20 with a 75 percent discount will cost you $5.00, and you saved $15.00. You can also calculate how much you save by simply moving the period in 75.00 percent two spaces to the left, and then multiply the result by $20 as follows: $20 x .75 = $15.00 savings.

Answer: $35

Step-by-step explanation:

20(75%)=15+20= $35

Solve 3x - 5 = 16.
9
8
6
7

Answers

Answer:

7

Step-by-step explanation:

3(7)=21-5=16

The answer is seven, because
3x-5=16, you add five to both sides, you get 21 divided by three and you get 7

is abc = dce? justify your answer below, please explain why! please help :)

Answers

Answer:

Step-by-step explanation:

∡ECD = 90°

∡DCA= 90°

∡BCA=90°

∡BCE =90°

⇔ ABC=DCE

Solve for x in the following situation. Show your work.
11x-4/50=70/60

Answers

Answer:

x=17/150

Step-by-step explanation:

11x-4/50=70/60

11x-2/25=7/6

11x=7/6+2/25

11x=187/150

x=(187/150)/11

x=(187/150)(1/11)

x=187/1650

simplify,

x=17/150

Answer:

x=17/150

Step-by-step explanation:

Graph the solutions of the inequality

Answers

Answer:

The graph in the attached figure

Step-by-step explanation:

Graph the solution of the inequality

[tex]t\leq -4[/tex]

we know that

The solution is the interval ---> (-∞,-4]

All real numbers less than or equal to -4

In a number line the solution is the shaded area at left of t=-4 (closed circle, because the number -4 is included in the solution))

using a graphing tool

The graph in the attached figure

62 is 50% of what number?

Answers

Answer:

62 is 50% of 31

Step-by-step explanation:

For example: 50% of 62 = 31; Example 2: Calculate a percentage based on 2 numbers. For example: 31/62 = 50%

Answer:

31

To calculate a percentage of some number, change the percentage into a decimal, and the word "of" into multiplication

What is the factored form of 8x^2+ 12x? 4(4x^2+8x) 4x(2x+3) 8x(x+4) 8x(x^2+4)

Answers

Answer:

4x(2x+3)

Step-by-step explanation:

The answer is 4x(2x+3)

Is 312 evenly divisible by 3?

Answers

Answer:

Yes

Step-by-step explanation:

312/3=104

312 divided by 3 is evenly divisible. That is because the answer is 104

Evaluate the expression. 8 x 7 - 12 ÷ 6 please anwser fast

Answers

Answer:

54

Step-by-step explanation:

8*7-12/6=56-2=54

Answer:

56-2=54

Step-by-step explanation:

8×7 - 12÷6 =56 - 2= 54

Nathan estimated 67*36 by finding 70*40. Nathan’s estimate be greater than or less than the actual product? Explain.

Answers

Answer:

Nathan's estimate would be greater than the actual product.

Step-by-step explanation:

Let a, b, c, d be natural numbers such that a<c and b<d

Multiplying a positive number on both sides doesn't affect the inequality

⇒a×b < c×b and c×b < c×d

⇒a×b < c×d

Here 67<70 and 36<40

67×36<70×40

Hence, Nathan's estimate would be greater than the actual product.          

A​ long-distance telephone company charges a rate of 8 cents per minute or a 50​-cent minimum charge per completed​ call, whichever is greater. Find the​ cost, in cents per​ minute, for a 3​-minute call.

Answers

Answer:

Cost of a 3 minute call is 50 cents at a rate of 16.67 cents per minute.

Step-by-step explanation:

We are given the following in the question:

Plan A

A rate of 8 cents per minute.

Plan B

A 50​-cent minimum charge per completed​ call.

We have to find the​ cost, in cents per​ minute, for a 3​-minute call.

Cost according to plan A:

[tex]\text{Cost per minute}\times \text{Call length in minutes}\\= 8 \times 3\\=24 \text{cents}[/tex]

Cost according to plan B:

50 cents for a 3 minute call

Rate =

[tex]\displaystyle\frac{\text{Total cost}}{\text{Duration of call}} = \frac{50}{3} = 16.67 \text{ cents per minute}[/tex]

The company chooses the plan with greater cost, thus, it chooses plan B.

Thus, cost of a 3 minute call is 50 cents at a rate of 16.67 cents per minute.

Other Questions
3. The angular dispersion of a prism depends onA. the index of refraction only B. the angle ofincidence as well as the index of refraction C. theangle of incidence only D. the hi thickness of theprism E, the prism angie. In October, Pine Company reports 18,600 actual direct labor hours, and it incurs $126,540 of manufacturing overhead costs. Standard hours allowed for the work done is 22,200 hours. The predetermined overhead rate is $5.75 per direct labor hour. Compute the total overhead variance. A metallurgist has one alloy containing 34% copper another containing 48% copper. How many pounds of each alloy must he use to make 46 pounds of the third alloy containing 37% copper A 1.2 kg ball drops vertically onto a floor from a height of 32 m, and rebounds with an initial speed of 10 m/s. (a) What impulse acts on the ball during the contact? (b) If the ball is in contact with the floor for 0.020 s, what is the magnitude of the average force on the floor from by the ball? Neglect air resistance The nine basic training principles are specificity, overload, progression, recovery, variation, transfer, balance, individualization, and reversibility. How can the basic training principles influence the type of location that you choose? Select at least three of nine training principles to write about. On January 1, Innovative Solutions, Inc. issued $220,000 in bonds at face value. The bonds have a stated interest rate of 5 percent. The bonds mature in 10 years and pay interest once per year on December 31.Required:1, 2 & 3. Complete the required journal entries to record the bond issuance, interest payment on December 31, early retirement of the bonds. Assume the bonds were retired immediately after the first interest payment at a quoted price of 103. (If no entry is required for a transaction/event, select "No Journal Entry Required" in the first account field.) Mark Welsch deposits $8,000 in an account that earns interest at an annual rate of 8%, compounded quarterly. The $8,000 plus earned interest must remain in the account 4 years before it can be withdrawn. How much money will be in the account at the end of 4 years? Cousin Hector drove 1,851 miles to the reunion. He lives in Mexico and drove 747 miles through that country to the United States border. How many miles did he drive in the United States? 3.Mitosis and meiosis are similar processes, but they have some very important differences. Explain how mitosis and meiosis are alike and how they are different. Provide at least two similarities and three differences. The height of your success is equal to the depth of your gratitude. Explain this quote A total of $150000 is invested in two funds paying 6.25% and 6% simple interest. If the total interest for the year is $9212.50, how much is invested at each rate? I need help on these three. A car originally priced at $8,900 is on sale at 15% off. If the sales tax rate is 8.25%, what is the sale price of the car? alculate the enthalpy of the reaction 4B(s)+3O2(g)2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)3O2(g)+B2H6(g), HA=+2035 kJ 2B(s)+3H2(g)B2H6(g), HB=+36 kJ H2(g)+12O2(g)H2O(l), HC=285 kJ H2O(l)H2O(g), HD=+4 HELP I NEED YOUR HELP MATH ONE PROBLEM 10 POINTS HELP When you drink cold water, your body must expend metabolic energy in order to maintain normal body temperature (37 C) by warming up the water in your stomach. Could drinking ice water, then, substitute for exercise as a way to "burn calories?" Suppose you expend 286 kilocalories during a brisk hour-long walk. How many liters of ice water (0 C) would you have to drink in order to use up 286 kilocalories of metabolic energy? For comparison, the stomach can hold about 1 liter. Find the area and circumference of a circle with radius 2 cm use 3.14 for pie do not round answers Theodore Roosevelt is often called a "Progressive" President. Which of these would BEST be an example of this label? Which choice could be the equation of a line perpendicular to the line represented by this equation?y = 5x 2A.B.y = 5x +2C.D.y = 5x + 5 1. In dialogue, periods, commas, question marks, and exclamation points gomarks2. List the ways to make your writing sound more natural.3. List three ways to vary your sentences.4. Why is it important to use a personal touch?5. One way to add humor to your writing is by using