what is the answer to (3n-4)5

Answers

Answer 1

15n -20

Good luck!! :)

Answer 2

Answer:2

Step-by-step explanation:


Related Questions

what is 80 + 80 equals 80 + 80 * 80 equals ​

Answers

Answer:

80+80=160  

80+80+80=240

240 >160

so no it is not equal

thank you for your time!

Step-by-step explanation:

Final answer:

In Mathematics, the order of operations (BOMDAS or BIDMAS) dictates that multiplication operations should be performed before addition. Hence, in the mathematical expression '80 + 80 equals 80 + 80 * 80 equals', the multiplication operation (80*80) is performed first, resulting in '80 + 6400 = 6480'. Therefore, 80 + 80 equals 6480.

Explanation:

In Mathematics, the operation order matters, this order is known by the acronym BOMDAS or BIDMAS, which stands for Brackets, Orders, Multiplication and Division, and Addition and Subtraction. it is used to clarify which procedures should be performed first in a given mathematical expression.

In your question, '80 + 80 equals 80 + 80 * 80 equals', we have both addition and multiplication operations. According to BIDMAS rules, we perform multiplication first before addition. Hence, the given expression is equivalent to 80 + 80 equals 80 + (80 * 80), where (80*80) should be calculated first.

Putting this into practice, we get: 80 + (80 * 80) = 80 + 6400 = 6480. Therefore, 80 + 80 equals 6480, based on the principles of BIDMAS or BOMDAS.

Learn more about Mathematical Operations here:

https://brainly.com/question/8959976

#SPJ12

what is the numerical coefficient of the term 10x

Answers

Answer:

10

Step-by-step explanation:

10x = 10 · x =(10)(x)

The numerical coefficient of the term 10x is 10.

In which pair of numbers is the first number a multiple of the second number?

Group of answer choices

27, 9

25, 6

8, 72

52, 3

Answers

Answer:

27,9

Step-by-step explanation:

9x3=27

To do such problems we need to know the concept of multiple of a number.

A multiple is a number that is the result of multiplying a number by an integer (not a fraction).

Given options,

a.)  27, 9

We can write 27 as 9 x 3, therefore, we can see that 27 is a multiple of 9.

b.)  25, 6

We can write 25 as 5 x 5, we can see that 25 is not a multiple of 6.

c.) 8, 72

We can write 8 as 2 x 2 x 2, we can see that 8 is not a multiple of 72.

d.)  52, 3

We can write 52 as 2 x 2 x 13, we can see that 52 is not a multiple of 3.

Learn more about Multiple:

https://brainly.com/question/1562995


50 grams/Centimeters = kilograms/meters

Answers

Answer:

50g/cm is equal to 5 kg/m

Step-by-step explanation:

as we know that:

10g/cm = 1 kg/m

so,

50g/cm = 5kg/m

10g/cm = 1kg/m
50g/cm = ?? Kg/m
?? Kg/m = 50/10 = 5
So 10g/cm = 5 kg/m

If y(x) = 3(x+5) +-, what is
a + 2)?

Answers

Answer:

f(a + 2) = 3a + 21

Step-by-step explanation:

f(x) = 3(x+5)

x = a + 2

f(a + 2) = 3(a + 2 + 5)

f(a + 2) = 3(a + 7)

f(a + 2) = 3a + 21

The center is open for 11 hours each day. Each party takes three hours what is the maximum number of parties the Center can host in a day

Answers

it can host three party’s a day

The maximum number of parties the Center can host in a day is 12.

What is equation?Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side. It demonstrates the equality of the relationship between the expressions printed on the left and right sides. We have LHS = RHS (left-hand side = right-hand side) in every mathematical equation. To determine the value of an unknown variable that represents an unknown quantity, equations can be solved. A statement is not an equation if it has no "equal to" sign. It will be regarded as a phrase.Mathematicians refer to equations with a degree of 1 as linear equations. The largest exponent of terms in these equations is 1, which equals. These can also be broken down into linear equations with one variable, two variables, three variables, etc. A linear equation with the variables X and Y has the conventional form aX + bY - c = 0, where a and b are the corresponding coefficients of X and Y and c is the constant.

Given, the center is open for 11 hours each day and each party takes three hours. There are 4 rooms.

Therefore, 11 ÷ 3 = 3 (approx)

Each room can host 3 parties each day.

=3 × 4 = 12

The center can host up to 12 parties in a day.

To learn more about equation, refer to

https://brainly.com/question/25976025

#SPJ2

What type of number is -5.41? 1. Whole number 2. integer 3. Rational 4. Irrational

Answers

3. it’s rational ...........
Final answer:

The number -5.41 can be classified as a Rational number because it can be expressed as a fraction where both the numerator (-541) and the denominator (100) are integers and it's not a whole number or an integer because it's negative and has a decimal part.

Explanation:

The number -5.41 is a type of number classified as a Rational number. Rational numbers are numbers that can be written as a fraction, where both the numerator and the denominator are integers (whole numbers), and the denominator is not zero. They can also be positive, negative, or zero, and they can be represented as decimals that terminate (like 0.2 or -1.75) or repeat (like 0.333... or -0.666...).

The number -5.41 is not a positive whole number nor an integer because it is negative and has a decimal part, which disqualifies it from both categories. An irrational number, on the other hand, is a number that cannot be expressed as a simple fraction, which clearly does not apply to -5.41 as it can be easily expressed by the fraction -541/100.

Learn more about Rational Numbers here:

https://brainly.com/question/24398433

#SPJ3

Please answer this correctly

Answers

Answer:

Kang

Step-by-step explanation:

Janelle ran longer than Kang

Janelle>Kang

Janelle ran shorter than Annette

Annette>Janelle>Kang

Janelle ran longer than John and John ran longer than Kang

Annette>Janelle>John>Kang

Kang will be the answer :DD

Donnie and Tania are math tutors. The amount Donnie charges for a session h hours long is represented by the function D(h) = 40h + 10. Tania charges a flat fee of $30 plus $15 an hour. Write a function, T(h), that represents the amount in dollars that Tania charges for h hours of tutoring. Graph both functions on the same coordinate grid, and label each line. Compare the slopes and y-intercepts of the graphs.

Answers

Answer:

Step-by-step explanation:

Answer:

[tex]T(h)=15h+30[/tex]

The graph is shown below.

Step-by-step explanation:

The amount Donnie charges for a session h hours long is represented by the function

[tex]D(h)=40h+10[/tex]

Tania charges a flat fee of $30 plus $15 an hour. The amount in dollars that Tania charges for h hours of tutoring is represented by the function

[tex]T(h)=15h+30[/tex]

Slope intercept form of a line is y=mx+b, where m is slope and b is y-intercept.

For Donnie:

Slope = 40 and y-intercept = 10

For Tania:

Slope = 15 and y-intercept = 30

It means slope of Donnie is greater than Tania and y-intercept of Tania is greater than Donnie.

Table of values for Donnie:

x      y

0     10

1     50

2     90

Table of values for Tania:

x      y

0     30

1     45

2     60

Plot these ordered pair on same coordinate plane and connect them to draw both functions.

The graph is shown below.

Fill in the table using this function rule.
y=28 - 3x
X Y
1
3
4
6

Answers

Answer:

So, you just end up plugging in your numbers.

y = 28 - 3(1)

y = 28-3

y = 25

Y = 28 - 3(3)

y = 28 - 9

y = 19

y = 28 - 3x

y = 28 - 3(4)

y = 28 - 12

y = 16

y = 28 - 3x

y = 28 - 3(6)

y = 28 - 18

y = 10

Step-by-step explanation:

The completed table is:

X   Y

1   25

3   19

4   16

6   10

How to fill the table

To fill in the table using the function rule y = 28 - 3x, we can substitute the given values of x into the equation to find the corresponding values of y.

X Y

1 28 - 3(1) = 28 - 3 = 25

3 28 - 3(3) = 28 - 9 = 19

4 28 - 3(4) = 28 - 12 = 16

6 28 - 3(6) = 28 - 18 = 10

So, the completed table is:

X Y

1 25

3 19

4 16

6 10

For each value of x, we substituted it into the function rule and performed the necessary calculations to determine the corresponding value of y.

Learn more about function rule at

https://brainly.com/question/30139621

#SPJ6

HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16​

Answers

Answer:

Step-by-step explanation:

Oof, all 6?  That's not fun.  

I'm going to show you one for the first bunch, (4-12) and hopefully you can get the rest.  If not let me know and I can more carefully work you through some others on here.

4)  So first we need the angle.  How do we find that?  Well, we know it's somewhere between 270 and 360 degrees (or 3pi/2 and 2pi radians) since it's in the fourth quadrant.    The method to finding the angle is ifferent for each quadrant, but it's nice to know around where you'll get.  Anyway,, if we take 360 and subtract that little space  that is unlabeled  we will know  the rest.    Hopefully that makes sense, but let me know if not, it's important to understand.  Maybe think of what happens if you add the two together, you get around the whole circle then.  

Anyway, to find that little sliver, we are going to construct a right triangle wherethe x axis is one side.  If you draw a line connecting point p and the x axis you have this right triangle.  I am going to call this sliver we don't know s.  ANyway, now we use trig here.  

s = arcsin(3/5) (you can find 5 pretty easily but let me know if you don't see it.)

You may think to use -3 instead of 3, and  it wouldn't be a huge mistake, it will just give you the negative version of what we want.  

Anyway, now we know theta is 360-s (or 2pi-s).  You can solve s or leave it as arcsin(3/5) so you don't have to round.

Now we can solve the trig functions.  If you don't know the sum and difference trig identities  you will have to round.  They are pretty simple formula though.  For instance, sin(2pi - arcsin(3/5)) = sin(2pi)cos(arcsin(3/5))-cos(2pi)sin(arcsin(3/5)) = 0 - 3/5 = -3/5  You will also want to know that s = arcsin(3/5) = arccos(4/5) = arctan(3/4).  ROunding will get you close but not exact.

Again, let me know ifyou need any more help, they should just be a lot of doing the same thing over and over and over again though.  

14)  For 14 and 16 you just need to know how the graphs of sin, cos and tan look.  Is this something you have trouble with?  Like could you draw the graphs at the intervals of increasing/ decrasing and all.  if not I can give a quick explanation.

I can’t do math someone help me out lol 6.51-9.32+h=1.02

Answers

Answer:

h = 3.83

Step-by-step explanation:

Solve for h:

h - 2.81 = 1.02

Add 2.8100000000000005` to both sides:

h + (-2.81 + 2.81) = 2.81 + 1.02

2.81 - 2.81 = 0:

h = 1.02 + 2.81

1.02 + 2.81 = 3.83:

Answer: h = 3.83

Your water is 5/6 full. After Tennis Practice, the bottle is 3/8 full. How much water did you drink?

Answers

Answer: 11/24

Step-by-step explanation:

5/6 - 3/8 = 11/24

in the diagram below, <AFB = <EFD. if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)°, find m<AFE​

Answers

Answer:

m<AFE​ =  128°.

Step-by-step explanation:

Step 1: Find the value of x

Angle EFD + Angle DFC = Angle EFC

5x + 6 + 19x - 15 = 17x + 19

24x - 9 = 17x + 19

7x = 28

x = 4

Step 2: Find all angles

Angle AFB=Angle EFD= 5x + 6

5(4) + 6 = 26°

Angle DFC = 19x - 15

19(4) - 15 = 61°

Step 3: Find angle AFE

Line BD is a straight line and all angles on a straight line are equal to 180°.

Angle AFB + Angle AFE + Angle EFD = 180°

26 + BFC + 26 = 180°

BFC = 180 - 52

BFC = 128°

Therefore, m<AFE​ is equal to 128°.

!!

The measure of m<AFE  if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)° is 128degrees

Angle is the point where two or more lines meet. From the given diagram:

m<EFC = m<EFD + m<DFC

Given the following:

m<EFC = 17x + 19

m<EFD = 5x+6

m<DFC = 19x - 15

Substitute the given values into the expression

17x + 19 = 5x + 6 + 19x - 15

17x - 5x - 19x = -19 - 9

12x - 19x = -28

-7x = - 28

x = 28/7

x= 4

Get the angle m<AFE

m<AFE  + m<ABF + m<EFD = 180

Since  <AFB = <EFD

m<AFE  + m<EFD + m<EFD = 180

m<AFE + 2m<EFD = 180

m<AFE + 2(5x+6) = 180

m<AFE + 2(5(4) + 6) = 180

m<AFE +2(26) = 180

m<AFE + 52 = 180

m<AFE = 180 - 52

m<AFE = 128 degrees

Hence the measure of m<AFE is 128degrees

Learn more here: https://brainly.com/question/16686601

What is 40% of $20 show the work too please :)

Answers

Answer:

$8

Step-by-step explanation:

Convert 40% into decimal  form: 0.4

Multiply it by 20.

=0.4 * 20

Simplify 0.4 * 20

= 8

What are the solutions of the following equation?
4|x -9| +9 = -3|x -9| +9 4∣x−9∣+9=−3∣x−9∣+9

Answers

Answer:

x = 9

Step-by-step explanation:

4∣x−9∣+9 = −3∣x−9∣+9

cancel equal terms on both sides of the equation

4∣x−9∣+9 = −3∣x−9∣+9

the statement is true but only if both sides equal 0

4∣x − 9∣= −3∣x − 9∣4 x | x - 9| = 0−3∣x − 9∣= 0

solve the equation for x

4x |x -9| = 0

divide both sides of the equation by 4

|x-9| = 0

when the absolute value of x - 9 equals 0, then x - 9 = 0

x - 9 = 0

move the constant to the right side and change it´s sign

x - 9 = 0x = 9

so the answer would be x = 9

Answer: it's x=9

Step-by-step explanation:

Need help ASAP 3 question. WILL GIVE BRAINLIEST

Answers

Answer:

Exact form: 11/125

Decimal Form: 0.088

Step-by-step explanation:

If every 9 Points Equals 1 Dollar How Many Points Do I Need To Make One Thousand Dollars?


First One To Answer Correctly Gets Brainliest!


It has to be correct.

pls hurry

Answers

Since 9 points is a dollar and you need a thousand dollars multiply 1000 by 9

9*1000=9000

Answer: 9,000$

Step-by-step explanation: if 9 = $1

You multiply 9 by $1,000 and get 9,000

The coordinates of the verticals of JKL are J(-2,1), K(-1,3) and L(-3,4). Can someone please check my answer?

Answers

Your answer is correct

What is the lower quartile of 27,5,11,13,10,8,14,18,7 a. 7 b. 7.5 c. 8 d. 8.5

Answers

Answer:

Lower Quartile = 7.

Step-by-step explanation:

Given  : 27,5,11,13,10,8,14,18,7

To find : What is the lower quartile .

Solution : We have given 27, 5, 11, 13, 10, 8,  14 , 18 , 7.

Step 1 : Arrange in order

5 , 7 ,8 ,10 ,11, 13 , 14 ,18 , 27.

Step 2 : divide in to Quartile

Lower Q1 = 5 ,7 ,8

Middle Q2 = 10, 11 , 13.

Highest Q3 = 14 ,18 , 27.

Hence Lower Quartile = 7.

Therefore, Lower Quartile = 7.

Answer:

A=7!

Step-by-step explanation:

Evaluate 2x^2 – 1 when x=3

Answers

Answer:

17

Step-by-step explanation:

Given: 2x² – 1

when x=3

2(3)² – 1

= 2(9) -1

= 18 - 1

= 17

Answer:

17 .

Step by step explanation:

Substitute the value of x into the equation and square it.

the equation then becomes 2(3)^2- 1

but 3^2 =3×3 =9

So the equation is changed to 2(9)-1 after the simplification

given you 18-1

=17

What is the reason for each step in the solution of the equation?
-5(x – 6) = 10x
Drag and drop the reasons into the boxes to correctly complete the table.​

Answers

Answer:

Step-by-step explanation:

-5(x – 6) = 10x

-5x+30=10x

-5x-10x = -30

-15x = -30

x= -30/-15 = 2

Assume that a bacteria population doubles every second. Which of the following tables of data, with X representing time in seconds and y representing the count of bacteria, could represent the bacteria population with respect for time?
(answers in the pic)​

Answers

Answer: Table A

Step-by-step explanation:

Because it doubles every second. At 0s, its 3. Then at 1s, it doubles which means 3x2=6, which is in table. then at 2s, that doubles to 6x2=12....and so on

help please and thank you!!!

Answers

Hello!

So, let's go over some information we know. We know that all the interior angles of a triangle add up to 180 degrees. We know that a line measures 180 degrees. We, therefore, know that angles which make up a line are supplementary, and must add up to 180 degrees.

So, first, we can find angle ABC. We can find this because angle ABC and ABT add up to 180 degrees, and we know the measure of ABT to be 125 degrees. Therefore:

ABC + 125 = 180

ABC = 55 degrees

Now, we can find angle ACB. We can find this as we have angle ABC and CAB, and angle ACB + ABC + CAB = 180 degrees (as they are the three interior angles of triangle ABC). ABC measures 55 degrees, and CAB 60 degrees. Therefore:

55 + 60 + ACB = 180

115 + ACB = 180

ACB = 65 degrees

Finally, we can find angle ACR based off of ACB, as ACB and ACR make up one line, and, therefore, add up to 180 degrees. ACB measures 65 degrees.

ACR + 65 = 180

ACR = 115 degrees

Therefore, your answer is choice 2, or 115 degrees.

Hope this helps!

Answer:

115°

Step-by-step explanation:

m∠ABC = 180° - 125° = 55° (angles in a straight line add up to 180°)

Given that m∠CAB = 60°,

Then m∠ACR = m∠CAB + m∠ABC (exterior angle is equal to the sum of opposite interior angles).

m∠ACR = 60° + 55° = 115°

A pond is being drained through an outlet pipe, then will be filled through an inlet pipe. If the inlet pipe can fill the pond in 9 hours and the outlet pipe can empty the pond in 15 hours, how long would it take to fill the pond if the outlet pipe was left open?

Answers

Answer:

22.5 hours

Step-by-step explanation:

I am using "1 pond" to mean the volume of water that fits in the pond.

The inlet pipe fills the pond in 9 hours.

The filling rate is (1 pond)/(9 hours) = 1/9 pond/hour

The outlet pipe empties the pond in 15 hours.

The emptying rate is (1 pond)/(15 hours) = 1/15 pond per hour

The difference in rates is the net rate at which the pond is filling up.

1/9 pond/hour - 1/15 pond/hour =

= 5/45 pond/hour - 3/45 pond /hour

= 2/45 pond/hour

The pond is filling at a rate of 2/45 pond/hour.

To find the time it takes to fill the pond, we divide 1 pond by the rate.

(1 pond)/(2/45 pond/hour) = 45/2 hour = 22.5 hours

It took Reza 2 hours to edit 6 math
problems. At that rate, how many math
problems could Reza edit in 45 hours?

Answers

Answer:

135

Step-by-step explanation:

My method 45 hours - 1  so i could divide by 2 because its 2 hours every 6 problems and 1 hour would be 3 math problems we can add that to the total

44 / 2 = 22, 22 * 6 = 132, 132 + 3 = 135

Alternate method

45 * 3 = 135

135
45/2 =22.5x 6 = 135

Use complete sentences to describe what it means to prove a statement in Geometry.

Answers

Answer:

Step-by-step explanation:

To use the information and to show, using work, how to step by step solve a problem.

Answer:

He's correct.

Step-by-step explanation:

what is 25 ties 3 divited by 19

Answers

Answer:3.9

Step-by-step explanation:

Answer: 25 x 3 divided by 19 is 3.94736842105

How do you find the product of -2(3.1)

Answers

Answer:

- 6.2

Step-by-step explanation:

The product of - 2 (3.1) is - 6.2.

Brackets mean to multiply so we have to multiply the - 2 by 3.1 which gives a result of - 6.2.

Find the sum. Write the addition property you used. 28+29+42=

Answers

Step-by-step explanation:

28+29=57

57+42=99 so 99 should be your answer

Answer:

Step-by-step explanation:

First your gonna brake up each number and seperate them for example

28

29

42

then your going to add up the ones side, 8,9,2, to get 19.

Then your going to add the tens side, 2,2,4, to get 8.

take the one from 19 and put it in the tens place to get 9 in the tens and 9 in the ones.

put 9 and 9 together to get 99.

Other Questions
Why is the structure of a dna molecule sometimes referred to as having the the shape of a spiral staircase Calculate the freezing point of the solution.After mixing these 2 bottles together, set Kf of water = 1.86 C / m.Bottle 1 contained 0.3 grams of glucose in 1000 grams of water.The 2nd bottle contains 0.5 mol fructose in 1000 grams of water. Surrealists emphasized _____________ instead of ____________.a.rationalism; irrationalismb.rationalism; fantasyc.irrationalism; rationalismd.irrationalism; conscious thought declaration a plane at the uniform rate of 8.0 meter/second ^2 , a pilot stops the plane in 484 meters. how fast was the plane going before breaking began ? Trucks that travel on highways have to stop at various locations to be weighed and inspected for safe brakes and light systems. Of these trucks, 76% are on interstate commerce while 24% are intrastate. Of the intrastate trucks, 3.4% are flagged for safety defects compared to 0.7% of those that are on interstate business. Complete parts a through c below. a. Calculate the probability that a randomly chosen truck is an interstate truck and is not flagged for a safety violation. The probability is nothing. (Round to three decimal places as needed.) How do we know our current money has value? People talk about money a lot. It is backed by gold. People accept it in exchange for goods or services. It has many security measures. What is 14/18 in simplist form A 35-mm single lens reflex (SLR) digital camera is using a lens of focal length 35.0 mm to photograph a person who is 1.80 m tall and located 3.60 m from the lens. (a) How far is the CCD sensor from the lens when the person is in focus?(b) How tall is the person's image on the CCD sensor? A certain corner of a room is selected as the origin of a rectangular coordinate system. If a fly is crawling on an adjacent wall at a point having coordinates (2.1, 1.9), where the units are meters, what is the distance of the fly from the corner of the room? In the Concepts in Play activity, Robert sought to bridge the cultural divide between his experience and his customers' culture by sharing relevant, intercultural information he learned from a TV show. Which of the following attributes of intercultural communication competence does he most strongly exhibit by sharing this detail?a. motivationb. tolerance for ambiguityc. open-mindednessd. knowledge and skill Jorge's cell phone plan costs $20.00 each month plus $0.15 per minute. If his bill for the month is58420, how many minutes did Jorge use? (Round to the nearest whole number).1064428561 According to the ruling in New York Times v. United States, which best describes what the government had to prove for itscensorship of the New York Times to have been acceptable? how much does 4 5/7 kg of candy cost if 5/6 kg costs $7.50 Choose the correct form of the word tocomplete the sentence.new position is chairpersonof the Senate Foreign Relations Committee.Select the correct answer.A.)womensB.)womansC.)woman's A delivery truck travels 278 miles each day.How far does it go in 25 days Describe the relationship between linkage groups and chromosomes. What are the differences between the Shia and Sunni? Every financial market performs the following function: A) It determines the level of interest rates. B) It allows common stock to be traded. C) It allows loans to be made. D) It channels funds from lenders-savers to borrowers-spenders. The sticker inside the door of my car says that the tire pressure should be 32 psig (322 kPa) when the tire is cold. Before a road trip, I fill the tire to this pressure on a cold morning when the temperature is 15 C, and then head out towards Las Vegas. When I make a rest stop in Barstow, it is now quite warm out, and the air in my tires has also warmed up from friction during the long drive. So, the air in the tires is now 60 C. Assuming my tires don't leak or expand (volume is constant), what is the expected tire pressure at this rest stop? Explain how the situation with Mrs. Dubose illustrates the following themes: A) Appearances are not what they seem. B) Atticus' definition of courage: "when you know you are licked before you begin but you begin anyway and see it through no matter what."