What is the difference between advanced calculus and real analysis?

Answers

Answer 1
The content of any course depends on where you take it--- even two courses with the title "real analysis" at different schools can cover different material (or the same material, but at different levels of depth).

But yeah, generally speaking, "real analysis" and "advanced calculus" are synonyms. Schools never offer courses with *both* names, and whichever one they do offer, it is probably a class that covers the subject matter of calculus, but in a way that emphasizes the logical structure of the material (in particular, precise definitions and proofs) over just doing calculation.

My impression is that "advanced calculus" is an "older" name for this topic, and that "real analysis" is a somewhat "newer" name for the same topic. At least, most textbooks currently written in this area seem to have titles with "real analysis" in them, and titles including the phrase "advanced calculus" are less common. (There are a number of popular books with "advanced calculus" in the title, but all of the ones I've seen or used are reprints/updates of books originally written decades ago.)

There have been similar shifts in other course names. What is mostly called "complex analysis" now in course titles and textbooks, used to be called "function theory" (sometimes "analytic function theory" or "complex function theory"), or "complex variables". You still see some courses and textbooks with "variables" in the title, but like "advanced calculus", it seems to be on the way out, and not on the way in. The trend seems to be toward "complex analysis."  hope it helps

Answer 2

Final answer:

Advanced calculus covers computational aspects and applications of calculus in multiple dimensions, while real analysis focuses on the theoretical fundamentals, such as rigorous development of the real number system and proof-based examination of limits and continuity.

Explanation:

The difference between advanced calculus and real analysis lies in the focus and depth of the subjects. Advanced calculus, also known as calculus III in some curricula, typically extends the study of calculus to multiple dimensions, covering topics such as partial derivatives, multiple integrals, and vector calculus. It focuses more on the computational aspects and applications of calculus.

Real analysis, on the other hand, delves deeper into the theoretical underpinnings of calculus and analysis. It deals with the rigorous development of the real number system, sequences and series, continuity, differentiation, integration, and convergence. Real analysis puts a strong emphasis on proof and logical reasoning, providing a foundation for the truth and logic behind the mathematics used in calculus.

While both subjects are mathematically advanced, real analysis is considered to be more abstract and is often a stepping stone for further study in pure mathematics. Familiarity with calculus is often a prerequisite before studying real analysis as it lays the groundwork for the more complex theoretical concepts.


Related Questions

what is the value for x (5x+15) (3x-3)

Answers

Final answer:

The value of x in the expression (5x+15) (3x-3) is 15x^2 + 30x - 45.

Explanation:

The expression (5x+15) (3x-3) represents the multiplication of two binomials. To find the value of x, we can use the distributive property to simplify the expression:

Multiply the terms within the first set of parentheses: 5x * 3x = 15x^2.Multiply the terms within the second set of parentheses: 5x * -3 = -15x.Multiply the terms between the parentheses: 15 * 3x = 45x.Multiply the constant terms within the parentheses: 15 * -3 = -45.

Putting it all together, we have 15x^2 - 15x + 45x - 45. Combining like terms, the expression simplifies to 15x^2 + 30x - 45.

So, the value for x in the given expression is 15x^2 + 30x - 45.

What is the expanded equivalent of cos(a – b)?

Answers

cos A cos B - sin A sin B
That should be your answer  Hope this helps

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770

Solve x + 9 = 18 - 2x

Answers

Add 2x to both sides,
3x+9=18
Subtract 9 from both sides. 3x=9
Divide both sides by 3. 
x=3

The solution to the equation x + 9 = 18 - 2x is x = 3.

What is the solution to the equation?

Given the equation in the question:

x + 9 = 18 - 2x

To solve the equation x + 9 = 18 - 2x, first, collect and combine the x terms on one side of the equation and the constant terms on the other side:

x + 9 = 18 - 2x

Add 2x to both sides of the equation:

x + 2x + 9 = 18 - 2x + 2x

x + 2x + 9 = 18

3x + 9 = 18

Subtract 9 from both sides of the equation:

3x + 9 - 9 = 18 - 9

3x = 18 - 9

3x = 9

Isolate x by dividing both sides by 3:

x = 9/3

x = 3

Therefore, the value of x is 3.

Learn more about equations here: brainly.com/question/14686792

#SPJ6

What is the numerator of the fraction equivalent to 25/135 that has a denominator of27

Answers

It's 5 because 5/27 is equal to 25/135

What is the slope of a line that is perpendicular to the line that goes through (5,4) and (-2,-3)?

Answers

First, let us solve for the slope of the line which it intersects with:

m’ = (y2 – y1) / (x2 – x1)

m’ = (-3 – 4) / (-2 – 5)

m’ = 1

 

The slope of the perpendicular line is the negative reciprocal, therefore:

m = - 1 / m’

m = - 1 / 1

m = -1

 

So the slope of the line is -1.

If you know that two triangles are congruent, you know that any unmarked corresponding parts are also congruent by

Answers

The SSS, SAS, ASA, AAS, and HL theorems. These theorems state that if any of those combinations of angles or sides are congruent, the triangles are congruent. That means that you can apply it in reverse, because if two triangles are congruent then SSS, SAS, ASA, AAS, and HL (if a right triangle) are also all congruent.

in a survey respondents were asked which type of movie they watched most often. the bar graph shows how many males and how many females said they watched each type of movie most often.

how many more males said they watched action movies than drama movies

2
4
5
8

Answers

males that watched action movies : 13
males that watched drama movies : 5

so there are (13 - 5) = 8 more that watched action then drama

Answer:

Option D) 8

Step-by-step explanation:

We are given the following information in the question:

A bar graph is given that shows how many males and how many females said they watched each type of movie most often.

To find:

We have to find that how many males said that they watched action movies than drama movies .

In the bar graph:

Number of action movies watched by males = 13

Number of drama movies watched by males = 5

Number of males males said that they watched action movies than drama movies  = 13 - 5  =  8

Males watched 8 action movies more than the drama movies.

Hence, the correct option is D.

Solve for x.

7(x - 3) = 4(x + 5)

Answers

7(x-3) = 4(x+5)

distribute:

7x-21 = 4x+20

add 21 to both sides

7x = 4x +41

subtract 4x from both sides

3x = 41

divide both sides by 3

x = 41 /3 = 13.67 ( repeating 6's) so it can be 13 2/3 as a fraction

the answer is 13 2/3



Triangle A′B′C′ is the image of triangle ABC after a dilation. What is the scale factor of the dilation?

Answers

Unfortunately, I can't really explain it that well, but AB is 6, and A'B' is 2.
6 / 3 = 2
BC is 3, and B'C' is 1.
3 / 3 = 1
Therefore the dilation factor would be 1/3.

Hope this helps! :)

Kari is flying a kite. She releases 50 feet of string. What is the approximate difference in the height of the kite when the string makes a 25o angle with the ground and when the string makes a 45o angle with the ground? Round to the nearest tenth.

A) 14.2 feet
B) 17.1 feet
C) 47.6 feet
D) 55.2 feet

Answers

This one is going to be a

Answer:

its 14.2

Step-by-step explanation:

What is the domain and range of f(x) = |x + 6|?
domain: (negative infinite,infinite); range: f(x) (greater than or equal to) 0
domain: x (less then or equal to)-6; range: (negative infinite,infinite)
domain: x(greater than or equal to)-6 ; range: (negative infinite,infinite)
domain:(negative infinite,infinite) ; range: f(x) (less than or equal to) 0

Answers

x can be any real value so domain is (-INF, INF) .  The range can be 0 or greater than zero because it is an absolute function.

The first choice is the correct one.

Answer:

domain: (negative infinite,infinite); range: f(x) (greater than or equal to [tex]0[/tex]

Step-by-step explanation:

we have

[tex]f\left(x\right)=\left|x+6\right|[/tex]

The vertex of the function is the point [tex](-6,0)[/tex]

The domain is the interval--------> (-∞,∞)

The domain is all real numbers

The range is the interval ------> [0,∞)

[tex]f(x)\geq 0[/tex]

The range is all real numbers greater than or equal to zero

To better understand the problem see the attached figure

identify the like terms 3x,4y,4z,5x

Answers

the like terms are 5x and 3x because they both are apart of the x family !

What is the smallest number greater than 100 that is :
a)divisible by two ?
b)divisible by ten?
c)divisible by four ?

Answers

I'd start by listing out the multiplies of all three past 100, like this:
102, 104, 106, 108, 110, 112, 114, 116, 118, 120, 122, 124, 126, 128, 130
104, 108, 112, 116, 120, 124, 128, 132, 136
110, 120, 130, 140
Now it's just a matter of finding the number that is the same for all three of them, which is 120.

The smallest number greater than 100 divisible by 2 is 102, divisible by ten is 110, divisible by four is 104.

What is Divisibility Test?

It is an easy method of determining the divisibility of a number by a particular divisor, by just observing the number and not actually dividing it.

The number is 100

A smallest number greater than 100 has to be found which is divisible by 2.

All even numbers are divisible by 2, a number which has 0, 2, 4, 6, 8 at its ones position are divisible by 2.

The smallest number from 100 which is divisible by 2 is 102.

A smallest number greater than 100 has to be found which is divisible by 10.

A number is divisible by 10, if it has 0 at its ones position.

The number after 100 which has 0 at its ones position is 110.

A smallest number greater than 100 has to be found which is divisible by 4.

If last two digit of a number forms 00 or are divisible by 4, then the number is divisible by 4.

The smallest number from 100 which is divisible by 4 is 104.

To know more about Divisibility Rule

https://brainly.com/question/10703980

#SPJ5

what is the answer for 5kx+6=7kx solve for x

Answers

7kx-5kx=6
2kx=6
x=3/k
All the best
Let's solve for x.5kx+6=7kx
Step 1: Add -7kx to both sides.5kx+6+−7kx=7kx+−7kx−2kx+6=0
Step 2: Add -6 to both sides.−2kx+6+−6=0+−6−2kx=−6
Step 3: Divide both sides by -2k.‌−2kx−2k‌=‌−6−2k‌x=‌3/k

Let n be a nonzero integer. find a domain on which f (x) = (1 − xn)1/n coincides with its inverse. hint: the answer depends on whether n is even or odd.

Answers

I believe that the correct equation given is:

f(x) = (1-x^n)^(1/n)

 

From this, we can say that:

 

When n is an odd number then f(x) is cubic root function. The domain is (-infinite, +finite) 
When n is an even number then f(x) is sqrt root function. The domain is (0, +finite) 

A sealed rectangular box measuring 8 x 6 x 18 contains 864 sugar cubes, each measuring 1 x 1 x 1. How many sugar cubes are touching the box?

Answers

Final answer:

A total of 456 sugar cubes touching the box.

Explanation:

To calculate the number of sugar cubes touching the box, we must consider the cubes that lie along each face of the box without double-counting the cubes that touch corners and edges.

The box dimensions are 8 x 6 x 18 inches, and each sugar cube is 1 x 1 x 1 inch.

For the top and bottom faces (6 x 18), we have

6*18 = 108 sugar cubes touching the box on each face, totaling 216 for both the top and bottom.

For the front and back faces (8 x 18), since we must exclude the top and bottom rows, we have

(8-2) x (18-2) = 6 x 16 = 96 sugar cubes for one face and 192 for both.

For the sides (8 x 6), excluding the top and bottom rows again, we have

(8-2) x (6-2) = 6 x 4 = 24 sugar cubes on one side and 48 in total for the two sides.

Adding all these together, we get 216 (top and bottom) + 192 (front and back) + 48 (sides) = 456 sugar cubes touching the box.

Remember, this method assumes a single layer of sugar cubes is in direct contact with the inside surface of the box.

Find x if et = 3x+2 and em = 5x

Answers

Answer:

x = 6

Step-by-step explanation:

The centroid (T) always splits the lines so one side is 2/3 and the second is 1/3 of the entire median line. This can also be written as 2x + x. That being said, ET isn't equal to EM, it's only equal to 2/3 of EM so that's what you have to write.

3x + 2 = 2/3 * 5x

3x + 2 = 10/3 x

*3 (3x+2) = *3(10/3x)

9x+6 = 10x

-9x      -9x

x = 6

The value of x is 6.

Triangles

The polygon has three sides. the sum of all the internal angles is 180 degrees.

Given

ET = 3x+2

EM = 5x

To find

The value of x.

How to find the value of x?

We know that the centroid of triangles divides it into 2:3.

Then

[tex]\begin{aligned} \dfrac{ET}{EM} &= \dfrac{2}{3} \\\\ \dfrac{3x+2}{5x} &= \dfrac{2}{3} \\\\ 3x+2 &= \dfrac{2}{3} * 5x \\\\ 3x+2 &= \dfrac{10x}{3} \\\\ 3x - \dfrac{10x}{3} &=-2\\\\ \dfrac{-x}{3} &= -2 \\\\ x &= 6\end{aligned}[/tex]

Hence the value of x is 6.

Thus the value of x is 6.

More about the triangle link is given below.

https://brainly.com/question/25813512

Can someone please help me with math

Answers

1 meter is 3.3 ft.....so 70 meters is (70 * 3.3) = 231 ft.....so ft per second is 231 ft per second

at 2 seconds.....231 * 2 = 462 ft

Measurement is ___________ when it yields the same values across repeated measurement of the same event.

Answers

The answer is reliable. A measure is assumed to have a high reliability if it yields parallel results under steady conditions. It is the characteristic of a set of test scores that relates to the quantity of accidental or random error from the measurement procedure that might be rooted in the scores. Marks that are highly reliable are precise, reproducible, and constant from one testing time to another. To be exact, if the testing method were to be repeated with a different group of test takers, fundamentally the same results would be gotten. 

Antonio purchased adult and child tickets for the fair. Tickets cost $29.35 for each adult and $17.45 for each child. Let x represent the number of adult tickets purchased and y represent the number of child tickets purchased. Write an expression to represent the total cost of the tickets Antonio purchased.


$29.35y + $17.45x

$29.35x + $17.45y

($29.35 + $17.45)(x + y)

($29.35 - $17.45)(x + y)

Answers

The Correct Answer for your problem is: B

29.35x + 17.45y Is the correct selection. 

¿A Sandra qué le gusta hacer los viernes?

A A Sandra le gusta comer papas fritas los viernes.

B A Sandra le gusta comer agua los viernes.

C A Sandra le gusta beber pizza los viernes.

D A Sandra le gusta beber galletas los viernes.

Answers

I think the answer is A it makes the most sense. 
A states that "Sandra likes to eat fries on fridays."

B states that Sandra likes to eat water on fridays? (makes no sense)
C states that Sandra likes to drink pizza on fridays? (again makes no sense)
D states that Sandra likes to drink cookies on fridays? (NO SENSE)
Best answer choice is A.
La respuesta correcta es A: A Sandra le gusta comer papas fritas los viernes. Es el unico respuesta que es lógico. La traducción para la frase es: Sandra likes to eat french fries on Friday. 

There are 10 red marbles and 8 green marbles in a jar. if you take three marbles from the jar (without replacement), the probability that they are all red is:

Answers

10 Red and 8 Green marbles
P(3 Red w/o replacement) = (10/18)(9/17)(8/16)= 0.147

There are 10 red marbles and 8 green marbles in a jar. So, the probability that all three marbles taken from the jar are red is 0.147.

Given :

Number of red marbles = 10

Number of green marbles = 8

Probability is the department of mathematics concerning numerical depictions of how likely the event is to happen or how likely it is that suggestion is genuine. The probability of an event could be number between 0 and 1 , where o shows difficulty of the event and 1 shows certainty.

Total number of marbles in a jar = 10 + 8 = 18

Total number of red marbles in a jar = 10

So, the probability that all three marbles taken from the jar are red is:

[tex]= \dfrac{10}{18}\times\dfrac{9}{17}\times\dfrac{8}{16}[/tex]

[tex]= 0.147[/tex]

For more information, refer the link given below

https://brainly.com/question/14210034

Which equation best represents the line graphed above?

Answers

x=2 because for any y value the x value is always 2
the answer is y=2. i hope it helps

Carly is 3 times her brother's age. The sun of their age is no more than 24 years.

Answers

brothers age = x

 carly's age = 3x

3x +x <=24

4x<=24

x<=24/4 = 6

brothers age is x<=6

 

Carly is 18 and her brother is 6

A rabbit lure on a greyhound racetrack is set to travel once around the track at 50 feet per second, and then its speed is increased to 65 feet per second for the second loop around the track. If the total time it takes for the lure to go around the track twice is 184 seconds, what is the distance once around the track?

Answers

184 sec = Circumference / 50 fps + Circumference / 65 fps 
184 = 65 Circumference/3250 + 50 Circumference/3250 
184 = 115 Circumflex/3250 
598000 = 115 Circumflex 
Circumflex = 5200 ft
the answer would be 5200ft

The equations y = -0.38x + 56.6 and y = 0.38x + 43.4 represent the percent of men and women, respectively, receiving bachelor's degrees, where x is the number of years since 1968. in approximately what year did the same percent of men and women receive bachelor's degrees?

Answers

Begin by using simultaneous equations to find the values of x and y. 

y=-0.38x+56.6
y=0.38x+43.4 

-0.38x+56.6=0.38x+43.4 
-0.38x-0.38x=-56.6+43.4 
-0.76x=-13.3 
x=-13.3/-0.76 
x=17.5 

y=0.38(17.5)+56.6
y=63.25 

Knowing that the initial year was 1968, add 17.5 years to find to find out when the same percent of men and women received a bachelor's degree. 

1968+17.5= 1985.5 

So, in the year 1985 and half, both men and women got the same number of bachelor's degrees. 

Hope I helped :) 

The mean weight of a litter of kittens is 3.1 pounds, with a standard deviation of 0.9 pound. Lawrence wants to know the weight of the kitten he is buying, but the seller only has the z-score of 1.22. How much does the kitten weigh?

Answers

Let x be the weight the kitten

z = (x- mean)/σ
1.22 = (x-3.1)/0.9
(1.22)(0.9) = x -3.1

and x = 4.198 pounds 

The weight of kitten is 4.198 pounds

What is z-score?

A z-score describes the position of a raw score in terms of its distance from the mean, when measured in standard deviation units.

Given that, the mean weight of a litter of kittens is 3.1 pounds, with a standard deviation of 0.9 pound, Lawrence wants to know the weight of the kitten he is buying, but the seller only has the z-score of 1.22.

Let x be the weight of the kitten

We know that,

z = (x- mean)/σ

Therefore,

1.22 = (x-3.1)/0.9

(1.22)(0.9) = x -3.1

x = 4.198

Hence, the weight of kitten is 4.198 pounds

Learn more about z-score, click;

https://brainly.com/question/15016913

#SPJ3

The starting salaries of individuals with an mba degree are normally distributed with a mean of $40,000 and a standard deviation of $5,000. refer to exhibit 6-4. what is the probability that a randomly selected individual with an mba degree will get a starting salary of at least $30,000

Answers

With the mean of 40k and standard deviation of 5k, we need to find P(x>=30k). P((30k-40k)/5k) = P(z<-2) = 1-0.0228 which is equal to 0.9772. There is a 97.72% chances that the starting salary will be at least 30k.
Final answer:

The probability that a randomly selected individual with an MBA degree will receive a starting salary of at least $30,000, considering the mean salary is $40,000, and standard deviation is $5,000, is approximately 97.72%.

Explanation:

The question pertains to the use of the normal distribution in probability, particularly in determining the probability of a randomly selected individual with an MBA degree getting a starting salary of at least $30,000. Given that the mean starting salary is $40,000 and the standard deviation is $5,000, we first need to standardize the salary amount to a z-score using the formula z = (X - μ) / σ. In this context, X refers to the salary amount in question, μ is the mean salary, and σ is the standard deviation.

So, z = (30,000 - 40,000) / 5000 = -2. This means the $30,000 salary is 2 standard deviations below the mean. When we look at the standard z-table, we find that the area to the left of z = -2 is approximately 0.0228. However, because we are looking for the probability of a salary being at least $30,000, we need to consider the area to the right, which is 1 - 0.0228 = 0.9772. So, the probability that a randomly selected MBA graduate will have a starting salary of at least $30,000 is approximately 97.72%.

Learn more about Normal Distribution here:

https://brainly.com/question/34741155

#SPJ11

What is the solution to the system of equations below? 2x - 5y = 11 and -2x + 3y = -9

Answers

x=3
y=-1

2(3)-5(-1)=11
6+5=11

-2(3)+3(-1)=-9
-6-3=-9

Does believing in god increases the probability that god does exist

Answers

No.

If he exists then he does. More or less people "believing" doesn't change a fact.

It's like how we can't see all colors and other creatures can see "more" colors than us; and then having us claim they don't exist. Whether we decide to believe there's more colors we can't see or not will not change the fact of whether there IS or ISNT.

KInda if you love him then he loves personally i dont believe in him but thats everyone decision

Other Questions
The speed of light is about 3x10 to the 8th power meters per second. About how far can light travel in 30 minutes? Almost all people say _____ as their first category of speech regardless of the language spoken. What is the measure of an exterior angle in a regular dodecagon? The most important factor in homeopathy's nineteenth-century popularity is said to be that? Which cell structure is the gatekeeper, controlling what goes in and out of the cell?A)c - nucleusB)e - vacuoleC)a - cell membraneD)b - endoplasmic reticulum A person can become what if he or she does strength training improperly Some materials can move across the cell membrane against a concentration gradient by what HELP PLEASEThe following is an example of what kind of figurative language?"He had been driven hither by the impulse of that Remorse which dogged him everywhere, and whose own sister and closely linked companion was that Cowardice." A. Hyperbole B. Simile C. Personification D. Metaphor Ron works 5 hours for a total of $300. He deposits all of his money in his account. He is trying to save $500 for a new LED TV. How many hours must he work to take home $500, if he saves all of his earnings A number divided by -9 is 16. What is the missing number? While working independently, you need to weigh your options on a topic. You research and analyze the topic so you can ensure your resolution is the best for everyone. What is this processed called?Conflict resolutionDecision-makingNegotiationVerbal communication Why do we use molecular models to represent atoms? Carla bought a shirt for $14 and a jacket for $69. She gave the cashier $100. How much change should Carla get back? From which parts if the world did immigrants come to the u.s in this era? Which of the following can occur during an earthquake? Select all that apply. ()Crust can fold or wrinkle ()Part of the crust may sink under the ocean ()Sections of the crust are demolished into clouds of dust ()Cliffs and cracks form Sheila is building a model for class. It's a tower that's designed to withstand high winds. She can use a maximum of 700 support beams and knows that each floor will require 22 beams. Sheila will track the number of beams that remain as she adds floors. She can predict the number of beams that remain by using this function: remaining beams (y) is function of floor number (x). How many beams will remain after she built 6 floors? Y=700-22(x) BRAINLIEST!Henry's rocket is designed to launch to a height of 100 feet in the air. The measurements so far have the launch height (h) varying no more than 4 feet. Which inequality below represents this scenario? |h 4| less than or equal to 100 |h + 4| greater than or equal to 100 |h 100| less than or equal to 4 |h + 100| greater than or equal to 4 what is 230000 in standard form Steven ballard has a strategic initiative for east carolina to be known as Cynthia tells darryl that she will deliver his boxes of paradise cookies as he directs. a declaration that one will do something in the future is part of the definition of