What is the expanded equivalent of cos(a – b)?

Answers

Answer 1
cos A cos B - sin A sin B
That should be your answer  Hope this helps

Answer 2

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770


Related Questions

A line goes through the points (8,9) and (-2,4) .
(a) What is the slope of the line? Show your work
(b) Write the equation of the line in point-slope form. Show your work
(c) Write the equation of the line in slope-intercept form.

show steps

Answers

(a)
9-4/8+2
5/10
1/2
(b)
y-4=1/2(x+2)
(c)
y-4=1/2(x+2)
y-4=1/2x+1
y=1/2x+5

The equation of the line in slope-intercept form would be; y=1/2x+5.

What is the slope?

The slope is the ratio of the vertical changes to the horizontal changes between two points of the line.

(a) The slope of line passing through two points is given by;

[tex]m = \dfrac{y-q}{x-p}[/tex]

Here m = 4 - 9/ -2 - 8

m = 5/10

m = 1/2

(b) The equation of line passing through a point and having slope is given by ;

y-y₁ = m(x-x₁)

Here, y-4 = 1/2(x+2)

(c) The slope intercept form;

y-4=1/2(x+2)

y-4=1/2x+1

y=1/2x+5

Hence, the equation of the line in slope-intercept form would be; y=1/2x+5.

Learn more about slope here:

https://brainly.com/question/2503591

#SPJ5

Which compound inequality has no solution? x ≤ –2 and 2x ≥ 6 x ≤ –1 and 5x ≤ 5 x ≤ –1 and 3x ≥ –3 x ≤ –2 and 4x ≤ –8

Answers

x <= -2  and 2x >= 6    is the smae as
 x <= -2 and x >= 3
Now x can not satisfy both inequalities so the first one has no solution

hope you have an amazing wonderful spectacular day/night 

Answer:x <= -2 and 2x >= 6 is the smae as

x <= -2 and x >= 3

Step-by-step explanation:

Kanisha has x green apples and y red apples.

Which statement explains why x + y and y + x will each find the total number of apples that Kanisha has?

In addition, the order of the variables matters in the expression.

The expressions are not equivalent because there are two variables.

The first expression has a greater value than the second expression.

In addition, the order of the variables does not matter in the expression.

Answers

the last one 
its the one because it makes the most sense

Answer:

the answer is in addition the order of the variables does not matter in the expression

Step-by-step explanation:

i took the test

What is the minimum value for P = x - 2y over the feasibility region defined by the constraints shown below?

A. 8
B. -2
C. -16
D. -14

Answers

the answer is -14

Hope this helps : )


Please help!
What is the equation of this graphed line?



Enter your answer in slope-intercept form in the box.

Answers

y=2x+2 because the slope of the line is 12/6 which simplifies to 2, and the y-intercept of the line is also 2.

Answer:

[tex]y=2x+2[/tex]

Step-by-step explanation:

step 1

Find the slope

The formula to calculate the slope between two points is equal to

[tex]m=\frac{y2-y1}{x2-x1}[/tex]

we have

[tex]A(-4,-6)\ B(2,6)[/tex]

Substitute the values

[tex]m=\frac{6+6}{2+4}[/tex]

[tex]m=\frac{12}{6}=2[/tex]

step 2

we know that

The equation of the line into slope intercept form is equal to

[tex]y=mx+b[/tex]

we have

[tex]m=2[/tex]

[tex]B(2,6)[/tex]

substitute and solve for b

[tex]y=mx+b[/tex] ------> [tex]6=(2*2)+b[/tex]

[tex]6=4+b[/tex]

[tex]b=2[/tex]

The equation of the line is equal to

[tex]y=2x+2[/tex]


A customer wants you to enlarge a photo to 2 3/4 its current height. The photo’s current height is 3 1/4 inches. What should its enlarged height be, in inches?

Answers

3 1/4 * 2 3/4  =  13/4 *  11/4 =143 /16  = 8 15/16 inches
2 3/4* 3 1/4 = 13/4*11/4= 143/16 WHICH IS EQUALS TO 8 15/16

Multiply. (7x+3)(4x−5) Enter your answer, in standard form, in the box.

Answers

(7x+3) x (4x-5)

7x*4x = 28x^2

7x*-5 = -35x

3+4x = 12x

3*-5 = -15

so you get 28x^2 -23x -15

Answer:  The required multiplied expression is [tex]28x^2-23x-15.[/tex]

Step-by-step explanation:  We are given to multiply the following linear factors and write the answer is standard form :

[tex]M=(7x+3)(4x-5)~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~(i)[/tex]

We will be using the following distributive property :

[tex](a+b)(c+d)=a(c+d)+b(c+d).[/tex]

From (i), we get

[tex]M\\\\=(7x+3)(4x-5)\\\\=7x(4x-5)+3(4x-5)\\\\=28x^2-35x+12x-15\\\\=28x^2-23x-15.[/tex]

Thus, the required multiplied expression is [tex]28x^2-23x-15.[/tex]

the ordered pair (2 16) is a solution to which equation(s)

A. y=(2x)^2

B. y=2x^2

C. y=2x+2

D. y=(x+2)^2

Answers

A. y = (2x)^2


Replace x and y with your point
16= (2•2)^2
16= (4)^2
16= 16

Please help! Use the quadratic function to predict y if x equals 6. Y=2x^2-2x-2

A) y= -58
B) y= 58
C) y=-60
D) y= 60

Answers

b) y=58 you follow the instructions

Answer:

The correct option is B.

Step-by-step explanation:

The given quadratic function is

[tex]y=2x^2-2x-2[/tex]

We have to find the value of the function y at x=6.

Substitute x=6 in the given function.

[tex]y=2(6)^2-2(6)-2[/tex]

[tex]y=2(36)-12-2[/tex]

[tex]y=72-14[/tex]

[tex]y=58[/tex]

The value of the function is 58 at x=6 is 58.

Therefore the correct option is B.

How to find the angle measure of an isosceles triangle if you only know the side lengths?

Answers

Hello Tbeck227, how to find the angle measure of an isosceles triangle if you only know the side lengths is, for all the angles, though it would be unreasonable to use it for all three, since once we know two the third is easy. Lubin suggested using the Cosine Law for the first calculation and the Sine Law for the second. This is faster than Cosine Law done twice. The suggestion is to use the Cosine Law to determine the angle opposite a largest side.

Determine if the statement is always, sometimes or never true. A natural number is a whole number.

Answers

true, soo true, because every number that is natural is whole  
Natural numbers are the positive integer set. Those are the numbers from 1 to infinity. (also called counting numbers) That does does NOT include fractions, negatives, or decimals. Zero is the ONLY whole number that is NOT a natural number. So yes, a natural number is always a whole number. :) 

A chess board has 64 squares. if you put one grain of rice on the first square, two grains on the second square, four grains on the third, eight grains on the fourth, and so on. how many grains are on the last square. no calculators.

Answers

On the first square, you have 2^0 rice grains on it.
On the second, you have 2^1 rice grains on it.
On the third, you have 2^2 rice grains on it.
Repeat this pattern.
On the 64th (last square), you have 2^63 rice grains on it.
I'm not sure how you would calculate 2^63 without a calculator...
Have an awesome day! :)
Consider this geometric sequence.

1, 2, 4, 8, ...
By considering the ratio between the first and the second, and the second and the third, we can begin to see that it has an equal ratio of 2.

Using the geometric sequence formula:
[tex]T_{n} = a_1 \cdot r^{n}[/tex]
[tex]T_{n} = 1 \cdot 2^{n}[/tex]
[tex]\text{Last square occurs when n = 64: } T_{64} = 2^{64}[/tex]

This means there will be 2^64 grains on the last square.

Two cards are drawn at random without replacement from a standard 52-card deck. what is the probability we see at least one club and at least one ace?

Answers

What do you mean "one club"? Like any card that has the symbol of clubs?

The probability we see at least one club and at least one ace would be 0.019225

What is the probability?

Probability refers to a possibility that deals with the occurrence of random events.

The probability of all the events occurring need to be 1.

The formula of probability is defined as the ratio of a number of favorable outcomes to the total number of outcomes.

The Total number of cards in a deck = 52

Number of aces in a standard deck = 4

Number of clubs in a standard deck = 13

The Probability = required outcome / Total possible outcomes

P(ace) = 4 / 52 = 0.0769

P(club) = 13 / 52 = 1/4 = 0.25

Therefore, the probability we see at least one club and at least one ace

0.0769 x 0.25

= 0.019225

Learn more about probability here;

https://brainly.com/question/11234923

#SPJ2

Which is the directrix of a parabola with equation x^2=y

Answers

[tex]\bf \textit{parabola vertex form with focus point distance}\\\\ \begin{array}{llll} (y-{{ k}})^2=4{{ p}}(x-{{ h}}) \\\\ \boxed{(x-{{ h}})^2=4{{ p}}(y-{{ k}})} \\ \end{array} \qquad \begin{array}{llll} vertex\ ({{ h}},{{ k}})\\\\ {{ p}}=\textit{distance from vertex to }\\ \qquad \textit{ focus or directrix} \end{array}\\\\ -------------------------------\\\\ x^2=y=(x-0)^2=1(y-0)\implies (x-0)^2=4\stackrel{p}{\left( \frac{1}{4} \right)}(y-0)[/tex]

now, notice, the vertex is at h = 0, k = 0, or 0,0, at the origin, the squared variable is the "x", and thus is a vertical parabola.  The leading term's coefficient is positive, so is going upwards, and the "p" distance is that much.

So the directrix is from the vertex, down "p" distance, check the picture below.

HELP ME PLEASE ! I NEED TO DO THIS QUICKLY !!!!! Translate each sentence into an equation!!!!!!!!!!!! 7 berries are 5 less than twice them number of berries Mickey had for lunch! AND also another one Negative 4 times the difference of a number and 7 is 12

Answers

7 + 5 = 2M (any variable)

-4 * (n-7) = 12
first one: (7 - 5) ÷ 2 = 1
the other im not sure about.

HELP PLEASE
Solve the system by substitution
-4.5x - 2y = -12.5
3.25x - y = -0.75

Answers

from the second equation ,we can know that y=3.25x+0.75
plug it into the first equation
-4.5x-2(3.25x+0.75)=-12.5
-4.5x-6.5x-1.5=-12.5
-11x=-11
x=1
plug it back into the second equation, y=3.25x+0.75=4
the answer would be (1,4)
You can also go on mathwey it would solve it fast

Given: AB = 12
AC = 6
Prove: C is the midpoint of AB.


Proof:
We are given that AB = 12 and AC = 6. Applying the segment addition property, we get AC + CB = AB. Applying the substitution property, we get 6 + CB = 12. The subtraction property can be used to find CB = 6. The symmetric property shows that 6 = AC. Since CB = 6 and 6 = AC, AC = CB by the property. So, AC ≅ CB by the definition of congruent segments. Finally, C is the midpoint of AB because it divides AB into two congruent segments.

Answers

Answer:

Pretty sure its the Transitive Property

Step-by-step explanation:

It's a dropdown on Edge so there's no A B C or D

Final answer:

To prove that point C is the midpoint of segment AB, we apply the segment addition property and the definition of congruent segments.

Explanation:

To prove that point C is the midpoint of segment AB, we can use the segment addition property. We are given that AB = 12 and AC = 6. By applying the segment addition property, we get AC + CB = AB. Substituting the given values, we have 6 + CB = 12. Solving for CB using the subtraction property, we find that CB = 6.

Now, by using the symmetric property, we can see that 6 = AC. Since CB = 6 and 6 = AC, we can conclude that AC is congruent to CB by the definition of congruent segments. This implies that C is the midpoint of AB, as it divides AB into two congruent segments.

Lonnie ordered 12$ copies of the same book.h3 books cost 19$ each and the order has a 15$ charge.what is the total cost of Lonnie's order?

Answers

19 * 12 = 228

228 + 15 = $243

$243 is your answer
First do 12 times 19 which is 228 and then add 15 which is 243 dollars

can you please explain to me which functions are odd?

f(x)=-1/2x^4+5

f(x)=-8x^3+5x

f(x)=-4/x^3-x+1

f(x)=x^5/x^4-1

f(x)=-sqrt2x

f(x)=3sqrtx -x^3

thank you!

Answers

A function is odd if f(-x)=-f(x).
So given a function, to check whether it is odd or not, we calculate f(-x). If it is equal to -f(x), then the function is odd; if not, it is not odd.


[tex]\displaystyle{f(x)= -\frac{1}{2}x^4+5 [/tex]

[tex]\displaystyle{f(-x)= -\frac{1}{2}(-x)^4+5= -\frac{1}{2}x^4+5\neq-f(x)[/tex]

thus the function is not odd


[tex]\displaystyle{f(x)=-8x^3+5x[/tex]

[tex]\displaystyle{f(-x)=-8(-x)^3+5(-x)=8x^3-5x=-(-8x^3+5x)=-f(x)[/tex]

thus the function is odd



[tex]\displaystyle{f(x)=- \frac{4}{x^3}-x+1 [/tex]

[tex]\displaystyle{f(-x)=- \frac{4}{(-x)^3}-(-x)+1= \frac{4}{x^3}+x+1\neq-f(x)[/tex]

thus the function is not odd



[tex]\displaystyle{f(x)= \frac{x^5}{x^4-1} [/tex]

[tex]\displaystyle{f(-x)= \frac{(-x)^5}{(-x)^4-1}= \frac{-x^5}{x^4-1}=- \frac{x^5}{x^4-1}=-f(x) [/tex]

thus the function is odd



[tex]\displaystyle{f(x)=-\sqrt{2x}[/tex]

[tex]\displaystyle{f(-x)=-\sqrt{2(-x)}= -\sqrt{-2x} [/tex]

In this particular case f(x) and f(-x) can both exist only for x=0 (because one of them is certainly negative). Thus the function is not odd


[tex]\displaystyle{f(x)=3 \sqrt{x} -x^3[/tex]

similarly to the previous case,  the Domain of f is [0, infinity) and f(-x) cannot be calculated except for x=0. So the function is not odd.

What is two times a number n is three times the sum of n and nine

Answers

2n=3(n+9)
2n=3n+27

n = -27

A professional basketball player makes 80 % of the free throws he tries. assuming this percentage will hold true for future attempts, find the probability that in the next 8 tries, the number of free throws he will make is exactly 8.

Answers

the answer  he will likely miss the other 20% of the free throws

ray OJ bisects angle IOK, if angle IOJ= 2x-5 and measure of angle JOK=x+11, then find measure of angle IOJ

Answers

Final answer:

Given ray OJ bisects angle IOK, we can set an equation for angles IOJ and JOK, solve for x and substitute x into the given measure of angle IOJ: 2*(16)-5 equals 27 degrees.

Explanation:

Since ray OJ bisects angle IOK, it means that angle IOJ and angle JOK are equal in measurement. Given in the problem, angle IOJ= 2x-5 and angle JOK= x+11. Because they are equal, we can set up the equation 2x-5 = x+11.

To solve for x, we subtract x from both sides of the equation, resulting in x-5 =11. And then, if we add 5 to both sides of the equation, the end result is x = 16.

Substituting x into the given measurement for angle IOJ, which is 2x-5, we would get the measure of angle IOJ as 2*(16)-5 = 27 degrees.

Learn more about Angle Bisector here:

https://brainly.com/question/37543581

#SPJ12

The sum of two numbers is 68 . the smaller number is 12 less than the larger number. what are the numbers?

Answers

The larger number is 56 because if you do 68-12=56

Final answer:

To solve the problem, we defined two variables for the larger (x) and smaller (y) numbers. Using the provided information, we set up two equations and solved them to find the numbers: x (the larger number) is 40, and y (the smaller number) is 28.

Explanation:

Step-by-Step Solution to Find the Two Numbers

Let's denote the larger number as x and the smaller number as y. We are given two pieces of information:

The sum of the two numbers is 68.

The smaller number is 12 less than the larger number.

These two statements can be turned into two equations:

x + y = 68 (Equation 1)

y = x - 12 (Equation 2)

Now, we can substitute Equation 2 into Equation 1 to find x:

x + (x - 12) = 68

2x - 12 = 68

Add 12 to both sides:

2x = 80

Divide both sides by 2:

x = 40

Now that we know the larger number, x, we can find y using Equation 2:

y = 40 - 12

y = 28

So, the two numbers are 40 and 28

Solve for x: 3 over 4 x + 5 over 8 = 4x. . x = __________________ Write your answer as a fraction in simplest form. Use the \"/\" symbol for the fraction bar

Answers

[tex] { \frac{3}{4x} } + { \frac{5}{8} } = 4x \\ 3 + { \frac{5(4x)}{8} } = 4x(4x)
[/tex]
[tex] (8)3 + 20x = (8)16x^2 [/tex]
[tex] 24 + 20x = 128x^2 \\ 128x^2 - 20x - 24 = 0 \\ 4(32x^2 - 5x - 6) = 0 \\ 32x^2 - 5x - 6 = 0 [/tex]

[tex] Solve\ using\ the\ formular\ \boxed{ x= { \frac{-b \pm \sqrt{b^2 - 4ac}}{2a} } } \\ x= { \frac{-(-5) \pm \sqrt{(-5)^2 - 4(32)(-6)}}{2(32)} } \\ x= { \frac{5 \pm \sqrt{793}}{64} } \\ x = 0.51812\ or\ x=-0.36187 [/tex]

[tex] x [/tex] cannot be written as a fraction.

Solve by substitution-5x+4y=22 x - 3y = 0A) No solution.
b. (6, 2)
c. Infinitely many solutions.
d. (-6, 2)
e. (-6, -2)

Answers

We want to use substitution to solve
-5x + 4y = 22           (1)
 x - 3y = 0                (2)

From (2), obtain
x = 3y                      (3)
Substitute (3) into (1).
-5(3y) + 4y = 22
-15y + 4y = 22
-11y = 22
y = -2
From (3), obtain
x = 3y = 3*(-2) = -6

Answer: e. (-6, -2)

2 sides of an isoceles triangle are 2 and 12. find the length of the third side

Answers

To the length of the third side, we need to know the angle between the given sides.

You did not provide this information.

You then need to use the law of cosines.

The third side of the isosceles triangle with the given sides of 2 and 12 is 12 units.

To find the length of the third side of an isosceles triangle where two sides are given as 2 and 12, we must consider two cases.

In an isosceles triangle, two sides are equal in length and the two angles opposite these sides are also equal. This means either the two given sides are the equal sides, which is not possible since they are different lengths, or one of the given lengths will be the base and the equal sides are yet to be determined.

Case 1: If the side of length 2 is the base, the length of the equal longer sides will both be 12.

Case 2: If the side of length 12 is the base, then the length of the two equal sides must both be 2.

However, we must recognize that the first case is incorrect because it does not form a triangle (a triangle cannot have two sides of length 12 and one side of length 2, as the two longer sides would be parallel and never meet to form a triangle).

Therefore, the correct answer is given by Case 2: the third side of the triangle, which is the base, is 12 units long, and the two equal sides are 2 units long each.

Using exponents what is the simplified form of the expression 12x^5/6x^2

Answers

First, we can simplify the 12/6 to 2/1 by factoring our 6. Next, remember that when we divide the same base with different exponents, we subtract the exponents. Thus, x^5/x^2 = x^(5-2) = x^3. Thus, the answer is 2x^3.

The required simplified form of the expression 12x⁵/6x² is 2x³.

What are exponential expressions?

Exponential expressions, as the name indicates, involve exponents. We already know that the exponent of a number (base) specifies how many times the number (base) has been multiplied. To answer the exponential expressions, we may need to apply the relationship between exponents and logarithms.

The exponential expression is given in the question as:

12x⁵/6x²

To simplify the expression 12x⁵/6x², we can start by dividing 12 by 6 to get:

12x⁵/6x² = (12/6)x⁵/x² = 2x⁵/x²

Then, we can use the quotient of powers rule, which states that when we divide two powers with the same base, we can subtract the exponents to get:

2x⁵/x² = 2x⁵⁻² = 2x³

Therefore, the expression is 2x³ equivalent to the given expression 12x⁵/6x².

Learn more about exponential function here:

brainly.com/question/11487261

#SPJ5

Q.17

Select the correct numerical form of this number written in scientific notation.

1.2 × 10^4

0.00012
120,000
12,000
1,200

Answers

The answer is:  [D]:  "1,200" .
________________________________________
We take the "1.2" and move the decimal FOUR (4) places to the right.

So, when we move the decimal place ONE place to the right, we have "12". 
When we move it TWO places to the right, we have "120".
When we move it THREE places to the right, we have 1200".
When we move it FOUR places to the right, we have "1200".
_________________________________________________
Note:  When we move the "decimal place" to the right or left, and that "decimal place is "non-existent", we add a "zero to the [right or left].

"1200" can be written as:  "1,200" .
_________________________________________________
The answer is:  [D]:  " 1,200 " .
_________________________________________________

Answer:

its 12,000

Step-by-step explanation:

"if calvin buys 4 pounds of starfruit and 3 pounds of oranges, how much is his total utility"

Answers

He would have bought 7 pound
This is because you would add 4 and 3 together

Hope this helps!

The Calvin has a total of 252 utility coming from Oranges and Starfruit.

What is the unitary method?

The unitary method is a method for solving a problem by the first value of a single unit and then finding the value by multiplying the single value.

Given that oranges cost $2 per pound and starfruit costs $5 per pound.

The utility coming from Oranges and Starfruit, therefore he needs to spend his $26 on buying the oranges and starfruit

Since all in all he also spend $23 on it, and still has remaining $3 in his pocket,

Thus his total utility is 252.

Hence, The Calvin has a total of 252 utility coming from Oranges and Starfruit.

Learn more about the unitary method, please visit the link given below;

https://brainly.com/question/23423168

#SPJ5

The complete question is

The oranges cost $2 per pound and starfruit costs $5 per pound. calvin has $26 to spend. if calvin buys 4 pounds of starfruit and 3 pounds of oranges, how much is his total utility?

Which undefined geometric term is described as a location on a coordinate plane that is designated by an ordered pair, (x, y)?

Answers

The undefined geometric term that is described as a location on a coordinate plane is called a point. It is a single dot that you can find in the coordinate plane.
Other Questions
Gustation is to olfaction what _____ is to _____. What is the climate of MEXICO?Question 6 options:varying from maritime to temperate.varying from desert to tropical.varying from steppe to desert.varying from tropical wet to tropical dry. How was Christopher Columbus a villain Our narrator is scout, a girl who will grow from age 6 to almost 9 during the story. what do you suppose we, as the readers, should be aware of as we listen to scout tell her story? is a child a reliable or unreliable narrator? defend your answer. Which sound device is expressed by the bolded letters? ruBBer BaBy Buggy Bumpers(Bolded all B's)A: alliterationB: refrainC: rhymeD: rhythm Question25 warmliquid corp., a manufacturer of water heaters, produces 30 water heaters per week. past records indicate that 10% of total water heaters produced in a week are likely to be defective. suppose a quality check was conducted on a sample of six water heaters. what is the probability that four out of six water heaters will be defective? A line has slope 56 and yintercept 3. Which answer is the equation of the line? y=3x+5/6 y=5/6x3 y=3x+5/6 y=5/6x+3 The final electron acceptor in aerobic respiration isA)ATP.B)NADPH.C)oxygen.D)water. If 20 pounds of fertilizer will cover 1500 square feet of lawn, how many pounds are needed for 2500 square feet Using the approximation 3.14 for pi, what is the radius of a circle with circumference 28.3 m? The measures of the interior angles in a polygon are consecutive integers. the smallest angle measures 136 degrees. how many sides does this polygon have? Guerry found that _____ crimes were higher in wealthy areas but _____ crime was higher in poor areas. A student scored 83 and 91 on her first two quizzes. Write and solve a compound inequality to find the possible values for a third quiz score that would give her an average between 85 and 90, inclusive ...? What percent yield of ammonia is produced from 15.0 kg each of h2 and n2, if 13.7 kg of product are recovered? assume the reaction goes to completion? Why is it important that the electrons and protons are attracted to each other in an atom? Which theme is best expressed in "The Gift of the Magi"?True love is immeasurable.True love is something that rarely occurs.True love is unchallenged.True love is thoughtful and considerate. Which is one common element of the major world religions? A random sample of n = 4 scores is obtained from a population with a mean of m = 80 and a standard deviation of s = 10. if the sample mean is m = 90, what is the z-score for the sample mean which is the smallest particle into which a compound can be broken down and still remain the same compound PLEASE HELP ME!!!! 20 PNTS!!!!!Simplify the expression:[tex] \frac{ \sqrt{ - 16} }{(3 - 3i) + (1 - 2i)} [/tex]A. [tex] \frac{ - 20 - 16i}{9} [/tex]B. [tex] \frac{8 + 4i}{15} [/tex]C. [tex] \frac{8 - 4i}{15} [/tex]D. [tex] \frac{ - 20 + 16i}{41} [/tex]