What is the following following product 4 square 7 • 4 square root 7• 4 square root 7 •4 square root 7

Answers

Answer 1

Answer:

The value of product is 7.

Step-by-step explanation:

Since we have given that

4 square 7x4 square root 7x4 square root 7x4 square root 7

We need to find the product of the following terms:

We will apply the "law of exponents":

i.e.

(a^m)^n=a^{mn}

4 square 7x4 square root 7x4 square root 7x4 square root 7

=7 ^(1/4)4=7

Hence, the value of product is 7.

Answer 2

The value of product is 7.

What is product?

The term "product" refers to the result of one or more multiplications. For example, the mathematical statement would be read " times equals ," where is called the multiplier, the multiplicand and is their product.

Given is an expression, 4 square 7 • 4 square root 7• 4 square root 7 •4 square root 7

Converting into mathematical notation,

= [tex]\sqrt[4]{7} . \sqrt[4]{7} . \sqrt[4]{7} . \sqrt[4]{7} .[/tex]

We need to find the product of the following terms:

We will apply the "law of exponents":

(xᵃ)ᵇ = xᵃᵇ

[tex](\sqrt[4]{7})^4\\\\= (7^\frac{1}{4})^4\\\\= 7[/tex]

Hence, the value of product is 7.

Learn more about products, click;

https://brainly.com/question/22852400

#SPJ2


Related Questions

a rectangles width is 4 less than its area and its length is 19. what is it’s width?

Answers

The width of the rectangle is [tex]\frac{2}{9}[/tex] unit

Step-by-step explanation:

The given is:

A rectangles width is 4 less than its areaIts length is 19 units

We need to find the width of the rectangle

Assume that the width of the rectangle is x units

∵ The area of the rectangle = length × width

∵ The width of the rectangle = x units

∵ The length of the rectangle = 19 units

∴ The area of the square = 19 × x = 19 x units²

∵ The width of the rectangle is 4 less than its area

- That means subtract 4 from the area to find the width

∴ x = 19 x - 4

- Subtract 19 x from both sides

∴ -18 x = -4

- Divide both sides by -18

∴ x = [tex]\frac{-4}{-18}[/tex]

- Reduce the fraction by dividing up and down by -2

∴ x = [tex]\frac{2}{9}[/tex]

The width of the rectangle is [tex]\frac{2}{9}[/tex] unit

Learn more:

You can learn more about the rectangles in brainly.com/question/12919591

#LearnwithBrainly

dis
You roll a fair 6-sided die.
What is P(not 5)?
If necessary, round your answer to 2 decimal places.
ro

Answers

Answer:

There would be an 83.3% chance (0.83 chance) that the die would not land on 5.

Step-by-step explanation:

Use the probability formula: [tex]\frac{desired}{total}[/tex] (desired events over total events)

There are 5 desired events. (The events that the die would not land on five)There are 6 total events.

[tex]\frac{desired}{total} =\frac{5}{6}= 0.8333333[/tex]

Rounded to two decimal places, there would be a 0.83 chance that the die would not land on 5.

Why there is 1/3 cup of fruit in half a smoothie

Answers

Answer: because the other half is used on the base solution

Step-by-step explanation:

solve 2cos^2x+sinx-1=0, if 0<=x<=2pi​

Answers

Final answer:

The equation 2cos²x + sinx - 1 = 0 can be solved by converting terms involving cosine to sine, simplifying the equation, and then solving the resulting quadratic equation for sinx and consequently solving for x.

Explanation:

To solve the trigonometric equation 2cos²x + sinx - 1 = 0, we can first convert the terms in the equation involving cosine to terms involving sine.

We know that cos²x= 1 - sin²x. Substituting this into the equation, we will have 2(1 - sin^2x) + sinx - 1 = 0.

This simplifies to 2 - 2sin²x + sinx - 1 = 0. Reordering terms, we get 2sin²x - sinx + 1 = 0. If we solve this quadratic equation for sinx, we can then solve for x. Assuming the domain 0<=x<=2pi, this will give us the possible values of x that satisfy the original equation.

Learn more about Trigonometric equation here:

https://brainly.com/question/37290767

#SPJ12

There are 325 rows of 9 chairs in the theater. There are 102 chairs in the the balcony. About how many chairs are there?

Answers

The total number of chairs there are in the theater and balcony is; 3027 chairs.

According to the question;

There are 325 rows in the theater.

Each row contains 9 chairs.

Additionally, there are 102 chairs in the balcony.

In essence, The number of chairs in the theater is;

= 325 × 9

= 2925 chairs.

Additionally, there are 102 chairs in the balcony;

In essence, the total number of chairs is;

= 2925 + 102

= 3027 chairs.

Read more:

https://brainly.com/question/1098659

Final answer:

To find the total number of chairs in the theater, multiply the number of rows by chairs per row and add the chairs in the balcony, resulting in approximately 3027 chairs.

Explanation:

To calculate how many chairs there are in total, we need to add the number of chairs in the rows to the number of chairs in the balcony.

First, multiply the number of rows by the number of chairs per row to find the total number of chairs in the rows: 325 rows × 9 chairs per row = 2925 chairs.

Then, add the number of chairs in the balcony to this total: 2925 chairs + 102 chairs in the balcony = 3027 chairs. So, there are approximately 3027 chairs in the theater.

Determine algebraically whether the function is even, odd, or neither even nor odd. f(x) = x + 4/x

Answers

Answer:

The given function is an odd function.

Step-by-step explanation:

We define a function f(x) as even function when f(-x) = f(x) and odd function when f(-x) = - f(x) and otherwise it is neither even nor odd function.

Now, we are given a function of x as [tex]f(x) = x + \frac{4}{x}[/tex] and we have to deternime whether the function f(x) is even, odd, or neither even nor odd.

Now, [tex]f(-x) = - x + \frac{4}{- x} = - x - \frac{4}{x} = - [x + \frac{4}{x}] = - f(x)[/tex]

Therefore, the given function is an odd function. (Answer)

Alex bought a new truck for $42,935. According to the dealer, the truck will depreciate approximately $4,200 per year. Write and solve a linear equation to find how many years until the car is worth $5,135

Answers

Answer:

The truck is worth $5,135 when 9 years have passed

Step-by-step explanation:

Initial value of Alex's new truck: $42,935

Loss of value per year: $4,200

If n years passed, the truck would have lost

[tex]4,200n\ dollars[/tex]

The current value of the truck will be

[tex]V(n)=42,935-4,200n[/tex]

We want to know the value of n at which V is 5,135

[tex]5,135=42,935-4,200n[/tex]

Solving for n

[tex]n=\frac{42,935-5,135}{4,200}[/tex]

n=9 years

Final answer:

The truck will depreciate to a value of $5,135 in approximately 9 years, given a yearly depreciation rate of $4,200.

Explanation:

This problem involves finding the duration it will take for the truck to depreciate from $42,935 to $5,135, given it depreciates at a rate of $4,200 per year. The difference in value is $42,935 - $5,135 which equals $37,800. This depreciation amount has to be distributed over the years so we divide it by the yearly depreciation rate. This is represented by the equation 37,800 = 4,200x, with x being the number of years. Thus, solving for x gives x = 37,800 / 4,200 which is approximately 9 years. Therefore, it will take about 9 years for the truck to depreciate to a value of $5,135.

Learn more about Depreciation here:

https://brainly.com/question/17827672

#SPJ3

A dairy needs 332 gallons of milk containing 6% butterfat. How many gallons each of milk containing 7% butterfat and milk containing 3% butterfat must be used to obtain the desired 332 gallons?

Answers

Answer:

249 gallons of 7% butterfat milk and 83 gallons of 3% butterfat milk

Step-by-step explanation:

If x is the gallons of 7% butterfat milk, and y is the gallons of 3% butterfat milk, then:

x + y = 332

0.07x + 0.03y = 0.06(332)

Solve the system of equations using substitution:

0.07x + 0.03(332 − x) = 0.06(332)

0.07x + 9.96 − 0.03x = 19.92

0.04x = 9.96

x = 249

y = 332 − x

y = 83

You need 249 gallons of 7% butterfat milk and 83 gallons of 3% butterfat milk.

10. Write an equation in point-slope form and slope-intercept form for the line.
Passes through (2,-2) and (4,-1)​

Answers

We can use the points (2, -2) and (4, -1) to solve.

Slope formula: y2-y1/x2-x1

= -1-2/4-(-2)

= -3/6

= -1/2

Point slope form: y - y1 = m(x - x1)

y - 2 = -1/2(x + 2)

Solve for y-intercept.

-2 = -1/2(2)  + b

-2 = -1 + b

-2 + 1 = -1 + 1 + b

-1 = b

Slope Intercept Form: y = mx + b

y = -1/2x - 1

______

Best Regards,

Wolfyy :)

Height is proportional to foot length. A person whose foot length is 10 inches is 67 inches tall. A human-like creature has a foot length of 35 inches. Use a proportion to find the height of the creature.

Answers

Answer:

the creature 268 inches tall

Step-by-step explanation:

set it up and cross multiply!

10 = 40

67    X

67*40=10*X

2680=10X

then divide 10 from both sides:

so X=268

The student setup 30 games booths;the teachers also setup some. If 5/6 of the game booths were set up by the students, how many game booths are there in total?

Answers

Final answer:

The total number of game booths is 36, with the students setting up 30 booths denoting 5/6 of the total, and teachers setting up the remaining 6 booths which corresponds to 1/6 of the total.

Explanation:

The student question asks about finding the total number of game booths if 5/6 of them were set up by students, and it is known that students set up 30 booths. First, we assume the fraction 5/6 represents the portion of booths that the students were responsible for setting up. Since 5/6 equates to the 30 booths the students set up, each fraction of 1/6 represents 6 booths (30 divided by 5). As there are 6 fractions of 1/6 in a whole, to find the total (which is 6/6), you simply multiply 6 (the value of 1/6) by 6.

The calculation is as follows: 6 booths per 1/6 x 6 = 36 game booths in total. Therefore, the teachers set up the remaining sixth, which corresponds to 6 game booths, making the combined total 36. This result indicates that there is a total of 36 game booths when we include the contributions from both students and teachers.

In this case, There are 36 game booths in total.

Let's denote the total number of game booths as T.

According to the information given, 5/6 of the game booths were set up by the students.

Since the students set up 30 game booths, we can write the following equation:

[tex]\[\frac{5}{6}T = 30\][/tex]

To find the total number of game booths, T, we need to solve for T.

We can do this by multiplying both sides of the equation by the reciprocal of 5/6, which is 6/5:

[tex]\[T = 30 \times \frac{6}{5}\][/tex]

Now, we calculate the value of T:

[tex]\[T = 30 \times \frac{6}{5}\][/tex]

T = 36

 Therefore, there are 36 game booths in total.

What is another way to write 75 ?


5×5×5×5×5×5×5

7+7+7+7+7

7×7×7×7×7

5+5+5+5+5+5+5




Answers

Answer:

All Of these Answer are INCORRECT!

Step-by-step explanation:

You Can tell by the first three fives in the first answer..

5*5=25*5=125=NOT GONNA WORK!

7+7+7+7+7=35= NOT GONNA WORK!

7x7 wont make it= NOT GONNA WORK!

There Never Gonna Work!

The factors of a number is are those which produce the same number when two numbers are multiplied together. It can be written as 3 × 5² or also as 15 × 5 and also as 1 × 75. The given options are not correct.

What are  factors of 75?

The factors of 75 are defined as the numbers which are multiplied in pairs resulting in the original number 75. In other words, the factors of 75 are also the numbers which divide the number 75 exactly without leaving the remainder.

Here 75 is a composite number and it has many factors other than the number itself. The factors of 75 are 1, 3, 5, 15, 25 and 75. In order to obtain a pair factor, multiply the two numbers in a pair to get the original number.

The pair factors of 75 are:

3 × 25 = 75

5 × 15 = 75

25 × 3 = 75

15 × 5 = 75

So the given options are not correct.

To know more about factors, visit;

https://brainly.com/question/30764248

#SPJ3

What is the slope of a line perpendicular to the line -3x + 6y = -15?

Answers

The slope of a line perpendicular to the line -3x + 6y = -15 is 2

Answer:

slope of a line perpendicular to the line -3x + 6y = -15 is -2

Step-by-step explanation:

-3x + 6y = 15

solve for y,

y = 1/2 x + 15/6

slope of a line perpendicular is the "negative reciprocal" of the slope of the original line, thus

y = -2 x + b

The difference between two numbers is 53. Five times the smaller is equal to 3 more than larger. What are the numbers?

Answers

First, let's assign two variables: one for the bigger one, and one for the smaller one. The smaller number will be represented as 's,' and the bigger one will be 'b.'

Since their difference is 53, we can make an equation:
b - s = 53

Since 5 times the smaller is equal to 3 times the bigger, we can make one more equation:
5s = 3b

We can divide both sides by 5 to simplify this equation:
s = 3b/5

Input this value of 's' into our first equation:
b - (3b/5) = 53

In order to get rid of that pesky denominator, multiply everything by 5:
5b - 3b = 265
2b = 265

b = 132.5
Input this into our first equation to find the smaller number:
s = (3*132.5)/5
s = 79.5

The two numbers are 132.5 and 79.5
-T.B.

The next model of a sports car will cost more than the current model. The current model costs . How much will the price increase in dollars? What will be the price of the next model?

Answers

Answer:

$1677

$40677

Step-by-step explanation:

Compared to the price of the current model sports can the next model price will be 4.3% higher.

The cost of the current model sports car is $39000.

Therefore, the price will increase in the next model by [tex]\frac{39000 \times 4.3}{100} = 1677[/tex] dollars. (Answer)

Now, the price of the next model will be $(39000 + 1677) = $40677 (Answer)

Final answer:

The price increase in dollars for the next sports car model, priced at 4.3% more than the current value, is $1,677. So, the next model of the sports car will cost $40,677.

Explanation:

The subject of this question is about the calculation of a price increase in mathematical terms. If the next model of a sports car is going to cost 4.3% more than the current model, which costs $39,000, then first we need to find out how much exactly 4.3% of $39,000 is. The calculation involves multiplying 39,000 by 4.3%, which comes out to $1,677.

Therefore, the price of the next model of a sports car will be the current price which is $39,000 plus the price increase in dollars i.e., $1,677. Hence, adding the two amounts gives us a total cost of $40,677 which is the price of the upcoming model.

Learn more about Percentage Increase here:

https://brainly.com/question/20818421

#SPJ11

When 4 is subtracted from the square of a number, the result is 3 times the number. Find the positive solution.

Answers

Answer:

4

Step-by-step explanation:

The square of 4 is 16, or 4 times 4.

When you subtract 4 from it, it becomes 3 times 4.

Therefore, 4 is the answer.

Answer:

The positive solution is 4.

Step-by-step explanation:

x^2-4=3x

x^2-3x-4=0

factor out the trinomial

(x-4)(x+1)=0

zero property,

x-4=0, x+1=0

x=0+4=4

x=0-1=-1

-------------

x=4, -1

the dimensions of a blackboard are 9/10 of a meter by 7/10 of a meter. In drawing of the blackboard given below, 1/2 of a inch represents 2 meters. What is unit rate of area in square meters of the blackboard per square inch of area in the drawing?

Answers

Answer:

16 square meters per square inch

Step-by-step explanation:

we know that

The scale drawing is

[tex]\frac{(1/2)}{2}=\frac{1}{4}\ \frac{in}{m}[/tex]

That means ---> 1 in in the drawing represent 4 meters in the actual

Find the dimensions of the blackboard in the drawing

Divide by 4

[tex]\frac{9}{10}\ m=\frac{9}{10}/4=\frac{9}{40}\ in[/tex]

[tex]\frac{7}{10}\ m=\frac{7}{10}/4=\frac{7}{40}\ in[/tex]

Find the area of the blackboard

[tex](\frac{9}{10})(\frac{7}{10})=\frac{63}{100}\ m^2[/tex]

Find the area in the drawing

[tex](\frac{9}{40})(\frac{7}{40})=\frac{63}{1,600}\ in^2[/tex]

Find out the unit rate of area in square meters of the blackboard per square inch of area in the drawing

[tex](\frac{63}{100})/(\frac{63}{1,600})=\frac{1,600}{100}=16\ \frac{m^2}{in^2} [/tex]

a cylindrical well has a radius of 10 feet and a height of 15 feet what volume of water will it take to fill in the well

Answers

Volume of water will it take to fill in the well is 4710 cubic feet

Solution:

Given that a cylindrical well has a radius of 10 feet

Height of cylindrical well = 15 feet

To find: volume of water will it take to fill in the well

Since, the well is in the form of cylinder, This means that we need to find the volume of cylindrical well

The volume of cylinder is given as:

[tex]\text { Volume of water in the well }=\pi r^{2} h[/tex]

Where "r" is the radius and "h" is the height of cylinder

Substituting the given values we get,

[tex]\begin{array}{l}{\text { Volume of water in the well }=(3.14) \times(10)^{2} \times(15)} \\\\ {=(3.14) \times(1500)=4710}\end{array}[/tex]

[tex]\text { Volume of water in the well }=4710 \text { feet }^{3}[/tex]

Hence, the amount of water that can be stored in the well is 4710 cubic feet

Final answer:

The volume of water that will fill the cylindrical well with a radius of 10 feet and height of 15 feet is 1500π cubic feet.

Explanation:

To calculate the volume of water that will fill the cylindrical well, we need to use the formula: V = πr²h. Given that the radius is 10 feet and the height is 15 feet, we can substitute these values into the formula as follows:

V = π(10)^2(15) = 1500π cubic feet.

Therefore, it will take 1500π cubic feet of water to fill the well.

What is Y/2 +3.2=5.06

Answers

Answer:

y=3.72

Step-by-step explanation:

y/2+3.2=5.06

y/2=5.06-3.2

y/2=1.86

y=1.86*2

y=3.72

Answer:

y= 3.72

Step-by-step explanation:

reverse the operations

5.06-3.2= 1.86

1.86*2= 3.72

y=3.72

change 0.03 to mixed number​

Answers

Answer: 3/100

Step-by-step explanation: Using the place value chart, we can see that 0.03 means 3 hundredths so 0.03 can be written as the fraction 3/100.

3/100 is a proper fraction so it can't be changed to a mixed number.

Using a new app I just downloaded, I want to cut back on my calorie intake so that I can lose weight. I currently weigh 90 kilograms; my plan is to lose 1.2 kilograms a week until I reach my goal. How can I make an equation to model my weight loss for the next several weeks?

Answers

Answer:

[tex]W_{f}  = 90 - 1.2w[/tex]

Step-by-step explanation:

I want to cut back on my calorie intake so that I can lose weight.

I plan to lose 1.2 kg a week from my current weigh 90 kg until I reach my goal.

Therefore, I can model my weight loss for the next several weeks by the equation  

[tex]W_{f}  = 90 - 1.2w[/tex]  

where [tex]W_{f}[/tex] is my final weight after w weeks of treatment. (Answer)

Final answer:

To model your weight loss, you can create a linear equation using your current weight as the starting point, and representing your weekly weight loss as a negative rate of change. The equation W(t) = 90 - 1.2t will allow you to predict your future weight based on this rate of weight loss.

Explanation:

To develop an equation to model your weight loss, you need to translate the information about your weight loss goals into mathematical terms. You mentioned that your current weight is 90 kilograms and you plan to lose 1.2 kilograms per week.

Imagining that each week is a step forward in time, we can say time is represented by the variable 't' in weeks. Likewise, your weight, which will change as time increases, can be represented by 'w' in kilograms.

Giving weight loss a negative sign (since you are losing, not gaining weight), the amount of weight you will lose per week is -1.2 kilograms. When we start, at time t = 0, your weight is 90 kilograms. So we could represent your weight as a function of time with the equation W(t) = 90 - 1.2t.

In this equation, simply substitute 't' for the number of weeks to predict your weight loss. For example, if you want to find out your weight after 3 weeks, you would calculate W(3) = 90 - 1.2 * 3 = 86.4 kilograms. This is a simplified model and actual weight loss may vary due to factors like metabolic rate, type of food ingested and the amount of calories burned per day.

Learn more about Weight Loss Equation here:

https://brainly.com/question/4326508

#SPJ12

14. Luis placed $4500 in a certificate of deposit. He earns $20 each month
for the next 36 months. Find the annual simple interest rate for the
certificate of deposit.

Answers

Final answer:

To find the annual simple interest rate for the certificate of deposit, divide the total interest earned by the principal amount. In this case, the annual interest rate is 16%.

Explanation:

The amount of simple interest Luis earns each month is $20, and he earns this for the next 36 months. We can find the total interest earned by multiplying the monthly interest by the number of months: $20 x 36 = $720.

To find the annual simple interest rate for the certificate of deposit, we need to divide the total interest earned by the principal amount. In this case, the principal amount is $4500. So, the annual interest rate is calculated as: $720 / $4500 = 0.16 or 16%.

Therefore, the annual simple interest rate for the certificate of deposit is 16%.

A ladder is resting against a wall. The top of the ladder touches the wall at a height of 12 feet. Find the length of the ladder if the length is 4 feet more than its distance from the wall.

Answers

Answer:

I believe the answer is 48

Step-by-step explanation:

10. Which of the following functions is the inverse of the function {(1,2).(3,4).(6,8)) ? (1 point)
A. {(6,8).(3,4),(1,2))
B. {(2,1),(4,3).(6,8)}
C. {(2,1),(4,3), (8,6)
D. {(2,1),(3,4).(8.6)]

Answers

Answer:

C

Step-by-step explanation:

Inverse of function(x,y) is equal to (y,x)

Please help me the brainliest.

Answers

Answer:

A² - B² = 0 (Proved).

Step-by-step explanation:

Given that  

[tex]A = \frac{\cot \theta + \csc \theta - 1}{\cot \theta - \csc \theta + 1}[/tex]

⇒[tex]A = \frac{\csc \theta + \cot \theta - (\csc^{2} \theta - \cot^{2} \theta)}{\cot \theta - \csc \theta + 1}[/tex]

{Since, we know the identity as [tex]1 = \csc^{2} \theta - \cot^{2} \theta[/tex]}

⇒ [tex]A = \frac{\csc \theta + \cot \theta - (\csc \theta + \cot \theta)\times (\csc \theta - \cot \theta)}{\cot \theta - \csc \theta + 1}[/tex]

⇒ [tex]A = \frac{(\csc \theta + \cot \theta) (\cot \theta - \csc \theta + 1)}{\cot \theta - \csc \theta + 1}[/tex]

[tex]A = \csc \theta + \cot \theta[/tex]

Again, given that [tex]B = \csc \theta + \cot \theta[/tex]

So, A = B . ⇒ (A - B) = 0.

Hence, A² - B² = (A + B)(A - B) = 0 (Proved)

Paul has 30$ to spend at the fair if the admission to the fair is 5$ and the rides cost 3.50 each how many rides can paul go on

Answers

Answer:

7

Step-by-step explanation:

Start with $30.

Subtract $5 for the admission: $30 - $5 = $25.

Now he has $25 to spend on rides. Each ride costs $3.5, so we divide $25 by $3.50.

$25/$3.50 = 7.14

Since the number of rides must be a whole number, he can go on 7 rides.

by the time Paul got into the fair he would have already paid admission with his 30 bucks meaning that he would have 25 dollars left for rides and 25 divided by 3.50 is 7.blah blah blah the rest dosent matter so Paul could go on a maximum of 7 rides

The three-dimensional figure below is a solid rectangular prism with a hole in the shape of another rectangular prism going through the center of it. Find the volume of the solid in cubic centimeters.


A solid rectangular prism with a hole in the shape of another rectangular prism going through the center of it is shown. The rectangular prism is 20 centimeters long, 5 centimeters wide, and 5 centimeters high. The rectangular prism-shaped-hole is 20 centimeters long, 2 centimeters wide, and 2 centimeters high.

Answers

The volume of the solid is 420 cm³

Step-by-step explanation:

The volume a rectangular prism is calculated as the product of its length, width and height.

Mathematically, V=l*w*h where l is length of the prism, w is width and h is the height

Given that the dimensions of the rectangular prism as;

Length=20 cm

Width= 5 cm

Height = 5 cm

V=20*5*5= 500 cm³

The rectangular prism shaped hole dimensions are;

Length= 20 cm

width= 2 cm

Height= 2 cm

Volume= 20*2*2=80 cm³

The volume of the solid will be: volume of rectangular prism-volume of the hole

Volume= 500-80=420 cm³

Learn More

Volume of a rectangular prism : https://brainly.com/question/11906792

Keywords : Volume, rectangular prism, cubic centimeters

#LearnwithBrainly

The volume of the solid rectangular prism with a hole is 420 cm³.

To find the volume of the solid rectangular prism with a hole, we follow these steps:

Volume of the Outer Rectangular Prism:

Using the formula V = l * w * h, where l is the length, w is the width, and h is the height of the outer rectangular prism:

Volume of the outer prism (V_outer) = 20 cm * 5 cm * 5 cm = 500 cm³.

Volume of the Rectangular Prism-shaped Hole:

Using the same formula for the inner rectangular prism:

Volume of the hole (V_hole) = 20 cm * 2 cm * 2 cm = 80 cm³.

Volume of the Solid:

Subtracting the volume of the hole from the volume of the outer prism:

Volume of the solid (V_solid) = V_outer - V_hole = 500 cm³ - 80 cm³ = 420 cm³.

Therefore, the volume of the solid rectangular prism with a hole is 420 cm³.

To learn more about volume

https://brainly.com/question/27710307

#SPJ6

A cylinder and a cone have the same volume. the cylinder has a radius of 2 inches and a height of 3 inches. the cone has a radius of 3 inches. What is the height of the come?

Answers

Answer:h = y^2 / 27

Step-by-step explanation:

Volume of a cylinder = pi*(xx)^2*yy

= x^4*pi*yy

Volume of a cone = 1/3*pi*(9x^2)^2*h

= 27pi*x^4*h

x^4*pi*y^2 = 27pi*x^4*h

h = y^2 / 27

Answer:

4 inches

Step-by-step explanation:

The volume of the cylinder is:

V = π r² h

V = π (2)² (3)

V = 12π

The cone has the same volume, so its height is:

V = ⅓ π r² h

12π = ⅓ π (3)² h

12π = 3π h

h = 4

The height of the cone is 4 inches.

8y - 6(3y - 7) what is this simplified?

Answers

Answer:

-10y+42.

Step-by-step explanation:

Distribute.

8y-18y+42

-10y+42

:D I hope this helped you!

Answer:

-10y + 42 would be the answer

Which of the following point-slope form equations could be produced with the points (2, -6) and (4, -3)?
y - 6 = 3/2(x + 2)
y - 6 = 3/2(x - 2)
y + 6 = 3/2(x - 2)
y + 6 = -3/2(x + 2)

Answers

Answer:

y+6=[tex]\frac{\textbf{3}}{\textbf{2}}[/tex](x-2)

Step-by-step explanation:

       A line passes through the points [tex](2,-6)[/tex] and [tex](4,-3)[/tex].

To find the point-slope form of the line, we need a point on the line and the slope of the line.

As we have two points [tex](x_{1},y_{1})[/tex] and [tex](x_{2},y_{2})[/tex], the slope can be calculated as [tex]\dfrac{y_{2}-y_{1}}{x_{2}-x_{1}}[/tex].

       Slope of the line = [tex]\dfrac{-3-(-6)}{4-2}=\dfrac{3}{2}[/tex]

Given a line with slope [tex]m[/tex] and a point [tex](x_{1},y_{1})[/tex], slope-point form is [tex]y-y_{1}=m(x-x_{1})[/tex]

       Line is given by [tex]y+6=\frac{3}{2}(x-2)[/tex]

∴ The line is given by [tex]y+6=\frac{3}{2}(x-2)[/tex]

Final answer:

The correct point-slope form equation with the points (2, -6) and (4, -3) is y + 6 = 3/2(x - 2), after finding the slope of 3/2 and applying it to the point-slope formula using either of the points.

Explanation:

Firstly, let's find the slope of the line passing through the points (2, -6) and (4, -3). The slope formula is
(y₂ - y₁) / (x₂ - x₁), so plug in the values to get (-3 - (-6)) / (4 - 2) = 3 / 2.

Now we know the slope is 3/2, we can write a point-slope form equation, which is y - y₁ = m(x - x₁). We can use either of the given points; let's use (2, -6). Substituting these values into the point-slope formula gives us: y - (-6) = 3/2(x - 2).

Thus, the correct point-slope form equation produced with the points (2, -6) and (4, -3) is: y + 6 = 3/2(x - 2).

Other Questions
14. If the food is, a sauce should be poured beneath the food rather than over it.O A. pastaB. crispyO C. fishO D. cooked rare Why do we think Mercury has so many tremendous cliffs? A. They were probably carved in Mercury's early history by running water. B. They are almost certainly volcanic in origin, carved by flowing lava. C. They represent one of the greatest mysteries in the solar system, as no one has suggested a reasonable hypothesis for their formation. D. They probably formed when a series of large impacts hit Mercury one after the other. E. They were probably formed by tectonic stresses when the entire planet shrank as its core cooled. A scientific variable is something that Select in an experiment.Selectchangesmovesremains A bomb calorimetric experiment was run to determine the enthalpy of combustion of methanol. The reaction is CH3OH(l)+3/2O2(g)CO2(g)+2H2O(l) The bomb calorimeter has a heat capacity of 250.0 J/K. Burning 0.028 g of methanol resulted in a rise in temperature from 21.50 C to 23.41 C. Calculate the change in internal energy for the combustion of methanol in kJ/mol. Suppose the average return on an asset is 11.8 percent and the standard deviation is 21.4 percent. Further assume that the returns are normally distributed. Use the NORMDIST function in Excel to determine the probability that in any given year you will lose money by investing in this asset. An article reported that, in a study of a particular wafer inspection process, 356 dies were examined by an inspection probe and 163 of these passed the probe. Assuming a stable process, calculate a 95% (two-sided) confidence interval for the proportion of all dies that pass the probe. (Round your answers to three decimal places.) How do you determine the slope of a line Linda says she values education. Over the years she has had several employees who worked for her and earned their degrees at the same time. To support them, Linda allowed them to flex their daily work hours. In this example, Linda demonstrates_____________. A 1.00-L gas sample at 100.C and 500. torr contains 52.0% helium and 48.0% xenon by mass. What are the partial pressures of the individual gases? Consider this simplified balance sheet for Geomorph Trading: Current assets $ 275 Current liabilities $ 210 Long-term assets 650 Long-term debt 205 Other liabilities 120 Equity 390 $ 925 $ 925 a. What is the companys debt-equity ratio? 6% of what number is 2.36 GEICO has decided that everyone will work in units with people who perform similar jobs. All of the procurement employees work in one department. All of the human resource employees work in one department and all of the printing employees work in the print shop. This type of structure is called_________. Consider the reaction 2Na(s) + 2H2O(l)2NaOH(aq) + H2(g) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 1.74 moles of Na(s) react at standard conditions. Ssurroundings = J/K g A two party political system is defined as having: a. two parties on the ballot c. two dominant parties with numerous minor parties b. three parties at any given time d. two minor parties with multiple dominant parties A 28-year-old presets to the ER reporting severe chest pain that worsens with respirations or lying down. Other signs include a fever, tachycardia, and a friction rub. Assessment findings support which medical diagnosis?A. Acute pericarditis.B. Myocardial infarction (MI).C. Stable angina.D. Pericardial effusion. Which of the following was not a reason to call the period of time prior to 1890 the Gilded Age? Everyone was living a life of prosperity. There was a false sense of reality demonstrated in a few peoples life. Numerous men became rich during this time. People lived extravagantly. Third parties have influenced some elections in U.S. history by doing which of the following? why should we become more conscious while using non-renewablenatural resources? Justify with an example, A helicopter lifts a 60 kg astronaut 17 m vertically from the ocean by means of a cable. The acceleration of the astronaut is g/10. (a) How much work is done on the astronaut by the force from the helicopter? J (b) How much work is done on the astronaut by her weight? J (c) What is the kinetic energy? J (d) What is the speed of the astronaut just before she reaches the helicopter? A baseball team sells tickets for two games. The ratio of sold tickets to unsold tickets for the first game was 7:3. For the second game, the ratio was 13;2. There were 240 unsold tickets for the second game. How many tickets were sold for the first game?