What is the mass in grams of 6.5×10^20 molecules of aspirin (C9H8O4) ?

Answers

Answer 1

The mass in grams of 6.5×10²⁰ molecules of aspirin (C₉H₈O₄) is 0.194 g

From Avogadro's hypothesis,

6.02×10²³ molecules = 1 mole of C₉H₈O₄

Next, we shall determine the mass of 1 mole of C₉H₈O₄.

1 mole of C₉H₈O₄ = (12×9) + (1×8) + (16×3)

= 180 g

Therefore, we can say that:

6.02×10²³ molecules = 180 g of C₉H₈O₄

With the above information, we can obtain the mass of 6.5×10²⁰ molecules of aspirin (C₉H₈O₄). This can be obtained as follow:

6.02×10²³ molecules = 180 g of C₉H₈O₄

Therefore,

6.5×10²⁰ molecules = [tex]\frac{180 * 6.5*10^{20} }{6.02*10^{23}}\\\\[/tex]

6.5×10²⁰ molecules = 0.194 g

Thus, the mass of 6.5×10²⁰ molecules of aspirin (C₉H₈O₄) is 0.194 g

Learn more: https://brainly.com/question/8933381

Answer 2

The mass in grams of the aspirin is 0.194 g

From the question,

We are to determine the mass in grams of  6.5×10²⁰ molecules of aspirin (C₉H₈O₄)

First, we will determine the number of moles of aspirin present

Using the formula

[tex]Number\ of\ moles = \frac{Number\ of\ molecules}{Avogadro's\ constant}[/tex]

Avogadro's constant = 6.022 × 10²³ mol⁻¹

From the given information

Number of molecules of aspirin = 6.5×10²⁰ molecules

∴ Number of moles of aspirin present = [tex]\frac{6.5 \times 10^{20} }{6.022 \times 10^{23} }[/tex]

Number of moles of aspirin present = 0.0010793756 moles

Number of moles of aspirin present = 1.0793756 ×10⁻³ mole

Now, to determine the mass of aspirin present

From the formula

Mass = Number of moles × Molar mass

Molar mass of aspirin = 180.158 g/mol

∴ Mass of aspirin = 0.0010793756 × 180.158

Mass of aspirin = 0.194458 g

Mass of aspirin = 0.194 g

Hence, the mass in grams of the aspirin is 0.194 g

Learn more here: https://brainly.com/question/24800303


Related Questions

For each reaction, identify the precipitate or lack thereof bacl2 naoh

Answers

The precipitate formed from the reaction of BaCl2 and NaOH is Barium Hydroxide. Barium Hydroxide is a white precipitate. The reaction that proceeds is a double replacement reaction. This means that the anions and the cations of the two different molecules switch places, forming entirely new compounds.

Find the current through the 30.0 ω resistor.

Answers

Final answer:

Without the total voltage or detailed circuit configuration, it's not possible to determine the current through the 30.0 ω resistor. An example using Ohm's law has been provided for a hypothetical scenario.

Explanation:

To find the current through the 30.0 ω resistor, we would need to apply Ohm's law, which states that I = V/R, where I is the current, V is the voltage, and R is the resistance. However, the provided information is insufficient to determine the current, as we are not given the total voltage across the resistor or the configuration of the circuit (whether it is series, parallel, or a combination).

If the 30.0 ω resistor were the only resistance in the circuit and the voltage across it was provided, we could directly use Ohm's law to calculate the current. For example, if the voltage was 10 V, the current would simply be I = 10V / 30.0ω = 0.333 A.

Without additional information, such as the configuration of the circuit and the total voltage, we cannot accurately calculate the current. The problem might be missing details or might require knowledge about the rest of the circuit to solve.

Learn more about current through a resistor here:

https://brainly.com/question/30905506

#SPJ3

If the length of one side of a square is 12.0 m, what is the perimeter of the square? Express the perimeter with the appropriate units

Answers

The perimeter of a square whose length is 12.0 m is 48 cm.

Further Explanation Area Area is a measure of how much space is occupied by a given shape.Area of a substance is determined by the type of shape in question.

For example;

Area of a rectangle is given by; Length multiplied by widthArea of a triangle = 1/2 x base x heightArea of a circle = πr². where r is the radius of a circle,Area of a square = S², Where s is the side of the square.etc.Perimeter Perimeter is defined as the distance along a two dimension shape.  Perimeter of different shapes is given by different formulas

For example;

The perimeter of a rectangle = 2(length+width)The perimeter of a triangle = a+b+c; where a, b and c are the sides of the triangle. etc.

In this case;

We are given one side of a square as 12.0 cm

But Perimeter of a square is given by; 4 × s

Thus; Perimeter = 4 × 12 units

                           = 48 units

Keywords; Perimeter, Area

Learn more about;Perimeter of a square example: brainly.com/question/3619302Area of a square: https://brainly.com/question/1322653

Level: Middle school

Subject; Mathematics

Topic: Area and Perimeter

Final answer:

The perimeter of the square with a side length of 12.0 m is 48.0 m.

Explanation:

The perimeter of a square is the sum of all its sides.

Since all the sides of a square are equal, we can find the perimeter by multiplying the length of one side by 4.

For the given square with a side length of 12.0 m, the perimeter would be:

Perimeter = 12.0 m x 4

= 48.0 m

Which of the following represents a compound?
A) H
B) H-3
C)H2O
D) O-16

Answers

C, H2O represents the compound responsible for constituting water.
The answer is C. H2

To be considered as a compound, it need to contain two on more elements.
From the option above, only H2O contains 2 elements, H is for Hydrogen and O is for oxygen. This compound formed a substance that we most commonly know as water.

Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.

Answers

Ans. : Volatile liquids with lower boiling points often gives better result than those with higher boiling points because for the liquid for the higher boiling might evaporate before it boils because of its volatility. For the one with higher boiling point it would take longer to boil than the one with a lower boiling point therefore it has a longer time for the liquid to evaporate before it boils.

A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?

Answers

I need to know the answer of the above question.

What role does the oxidation agent play in a redox reaction

Answers

The oxidizing agent receives electrons from the reducing agent.  Keep in mind that the reducing agent is the element in an oxidation-reduction reaction that gives an electron to another species. And since the reducing agent always loses its electrons, it is considered to call its condition 'oxidized'.

The oceanic crust is made primarily from this type of rock.

Answers

Im pretty sure its basalt

Answer:

Igneous rock basalt.

Explanation:

The ocean crust is made mostly of igneous rock basalt, which comes from lava and the movement of tectonic plates.

what location on earth experiences the least change in the number of daylight hours throughout the year?

Answers

The areas around the equator. The equator is an invisible line going around the middle of the earth. Because of our tilted axis we get more light in some parts of the year, and less in others. But because the equator is right in the middle, the sun goes from east to west in the middle of the sky every day, meaning they get the same amount of daylight all year.

How many grams of CO2 are used when 7.0 g of O2 are produced?

Answers

Final answer:

The question cannot be answered as posed because a specific chemical reaction and balanced equation are needed to relate the masses of O2 and CO2.

Explanation:

To answer how many grams of CO2 are used when 7.0 g of O2 are produced, we assume the process is a typical combustion or respiration reaction, where CO2 is generated from O2, or vice versa. The balanced chemical equation for the combustion of carbon would typically be C + O2 → CO2. However, since we are given the mass of O2 produced, and not the mass of a carbon-containing fuel that reacts, we cannot proceed to calculate the mass of CO2 without additional information on the specific reaction involved, including the stoichiometry that defines the mass relationship between O2 and CO2. Therefore, we must have a balanced equation or a known reaction to relate the masses of O2 and CO2 produced in order to provide a specific answer.

Learn more about Chemical Reaction Stoichiometry here:

https://brainly.com/question/30415532

#SPJ12

9.62 grams of [tex]\( \text{CO}_2 \)[/tex] are used when 7.0 grams of [tex]\( \text{O}_2 \)[/tex] are produced.

One common reaction where [tex]\( \text{O}_2 \)[/tex] is produced and [tex]\( \text{CO}_2 \)[/tex] is consumed is photosynthesis:

[tex]\[ 6 \text{CO}_2 + 6 \text{H}_2\text{O} \rightarrow \text{C}_6\text{H}_{12}\text{O}_6 + 6 \text{O}_2 \][/tex]

From this balanced equation, we see that 6 moles of [tex]\( \text{CO}_2 \)[/tex] produce 6 moles of [tex]\( \text{O}_2 \)[/tex]. This means that 1 mole of [tex]\( \text{CO}_2 \)[/tex] produces 1 mole of[tex]\( \text{O}_2 \).[/tex]

Step-by-Step Solution:

1. Determine the molar mass of [tex]\( \text{O}_2 \)[/tex]:

[tex]\[ \text{Molar mass of O}_2 = 2 \times 16.00 \text{ g/mol} = 32.00 \text{ g/mol} \][/tex]

2. Calculate the moles of \( \text{O}_2 \) produced:

[tex]\[ \text{Moles of O}_2 = \frac{7.0 \text{ g}}{32.00 \text{ g/mol}} = 0.21875 \text{ moles} \][/tex]

3. Use the stoichiometry from the balanced equation:

  From the balanced equation, the mole ratio between[tex]\( \text{CO}_2 \) and \( \text{O}_2 \) is 1:1.[/tex]

 Therefore, the moles of [tex]\( \text{CO}_2 \)[/tex] used is the same as the moles of [tex]\( \text{O}_2 \)[/tex]produced:

[tex]\[ \text{Moles of CO}_2 = 0.21875 \text{ moles} \][/tex]

4. Determine the molar mass of [tex]\( \text{CO}_2 \)[/tex] :

[tex]\[ \text{Molar mass of CO}_2 = 12.01 \text{ g/mol} + 2 \times 16.00 \text{ g/mol} = 44.01 \text{ g/mol} \][/tex]

5. Calculate the grams of \( \text{CO}_2 \) used:

[tex]\[ \text{Grams of CO}_2 = \text{Moles of CO}_2 \times \text{Molar mass of CO}_2 \][/tex]

[tex]\[ \text{Grams of CO}_2 = 0.21875 \text{ moles} \times 44.01 \text{ g/mol} = 9.62 \text{ g} \][/tex]

How many grams of hydrogen in 4.50 mol H2SO4

Answers

The awnser is 25 grams

If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.

Answers

Ethanoic (Acetic) acid is a weak acid and do not dissociate fully. Therefore its equilibrium state has to be considered here.

[tex]CH_{3}COOH \ \textless \ ---\ \textgreater \ H^{+} + CH_{3}COO^{-} [/tex]

In this case pH value of the solution is necessary to calculate the concentration but it's not given here so pH = 2.88 (looked it up)

pH = 2.88 ==> [tex][H^{+}][/tex]  = [tex]10^{-2.88}[/tex] =  0.001 [tex]moldm^{-3}[/tex]

The change in Concentration Δ [tex][CH_{3}COOH][/tex]= 0.001 [tex]moldm^{-3}[/tex]


                                  CH3COOH          H+           CH3COOH    
Initial  [tex]moldm^{-3}[/tex]                      [tex]x[/tex]           0                     0
                                                                                                                       
Change [tex]moldm^{-3}[/tex]        -0.001            +0.001           +0.001
                                                                                                       
Equilibrium [tex]moldm^{-3}[/tex]      [tex]x[/tex]- 0.001      0.001             0.001
                                                                              

Since the [tex] k_{a} [/tex] value is so small, the assumption 
[tex][CH_{3}COOH]_{initial} = [CH_{3}COOH]_{equilibrium}[/tex] can be made.

[tex] k_{a} = [tex]= 1.8*10^{-5} = \frac{[H^{+}][CH_{3}COO^{-}]}{[CH_{3}COOH]} = \frac{0.001^{2}}{x} [/tex]

Solve for x to get the required concentration.

note: 1.)Since you need the answer in 2SF don&t round up values in the middle of the calculation like I've done here.

         2.) The ICE (Initial, Change, Equilibrium) table may come in handy if you are new to problems of this kind

Hope this helps! 



If 50% of radioactive element remains after 4000 years what what is the half life

Answers

4,000 years is the half life of that element. Nope 8,000 years, there will be 25% remaining

Which equation best expresses the relationship between pressure and volume for gas?

Answers

It won't be possible for me to answer this question if there is no context. I tried to find a similar question and I came up with one. The problem is shown in the attached picture. From the given choices, all their units are atm*mL. So, that means that P*V. The answer could only be (2) or (4). Let's try the data in the table to find out.

PV = (0.5 atm)(1000 mL) = 500 atm*mL
PV = (1 atm)(500 mL) = 500 atm*mL
PV = (2 atm)(250 mL) = 500 atm*mL

Thus, the answer is choice (2).

Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.

Answers

Co-product (rather than side product) of Horner-Emmons Wittig reaction is alpha-hydroxy phosphonate which by definition is hydrophilic as opposed to triphenylphosphine oxide. In addition, the side groups in Horner-Wittig reagents are typically Me or Et which are less bulky than phenyls are more compatible with hydrophilicity.

Is the tetrapeptide ala-glu-gly-lys a good buffer at ph 7.0? will it move in an electric field at ph 7.0?

Answers

 pH is a measure of the effective concentration of H+ ions a solution. So, an electric field applied to a solution will create a pH gradient.

If pH is 7, means it is neutral. so it will not move in an electric field

How many liters of water are required to dissolve 1.00 g of barium sulfate?

Answers

Final answer:

To dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Explanation:

In order to calculate the amount of water needed to dissolve 1.00 g of barium sulfate, we need to use the molar mass of barium sulfate and the concept of molarity.

The molar mass of barium sulfate (BaSO4) is 233.43 g/mol. We can use this to convert the mass of barium sulfate to moles.

Once we know the number of moles of barium sulfate, we can use the molar ratio between barium sulfate and water to calculate the volume of water needed. The balanced equation for the dissolution of barium sulfate in water is:

BaSO4 (s) + H2O (l) → Ba2+ (aq) + SO42- (aq)

Based on this equation, 1 mole of barium sulfate dissolves to give 1 mole of water. Therefore, to dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Learn more about dissolving barium sulfate in water here:

https://brainly.com/question/5383482

#SPJ12

Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.

Answers

The (s) in the chemical name of (s)-3-iodo-2-methylnonane indicates an S-configuration using the Cahn-Ingold-Prelog system of stereochemical nomenclature. The S-configuration means that an "imaginary" rotation from the highest priority substituent group to the lowest priority substituent group of the chiral center moves counterclockwise (to the left), provided that the lowest priority group is oriented "towards the back" (symbolized by dashed lines). 

The highest priority group (iodine in this case) is the one with the highest atomic number and the lowest priority (hydrogen in this case) is one with the lowest atomic number.

If the atoms directly beside the chiral center have the same atomic number (Carbon-2 and Carbon-4 in this case), the atoms next to them will be evaluated until a point of difference is found. Carbon-2 is connected to 2 other carbon atoms and 1 hydrogen atom, while Carbon-4 is connected to only 1 carbon atom and 2 hydrogen atoms. Thus, Carbon-2 has a higher priority, with the point of difference being the carbon atom of the methyl group attached to Carbon-2. Both Carbon-2 and Carbon-4 are connected to one carbon atom from the main nonane chain, but the other atoms connected to Carbon-4 are hydrogen atoms only. Carbon-2 has an extra carbon connected to it and carbon has a higher atomic number than hydrogen.

If there is no point of difference, the central atom is not chiral and cannot be named using the Cahn-Ingold-Prelog system. 

Thus, the structure of (s)-3-iodo-2-methylnonane is


Final answer:

The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.

Explanation:

The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.

Learn more about Organic Compound Structure here:

https://brainly.com/question/35316125

#SPJ3

If 150 g of phenacetin were dissolved in 100 ml of water, how much ether would be required to extract 90% of phenacetin in a single extraction?

Answers

Distribution coefficient in ether to water Kew = (1/90) ether /(1/1310) water = 14.56 (b) If 50 mg of phenacetin were dissolved in 100 mL of water.

Which of the following is the correct formula for barium (II) sulfate?

Answers

BaSO4 is the correct formula for barium (ll) sulfate
BaSO4 is the correct formula for barium (ll) sulfate

At which stage does a gas form in a gas formation reaction?

the reactants stage
the product stage
the liquid stage
the solid stage

Answers

B, the product stage. I just took this test and got this answer right. Happy to help!

Answer: b

Explanation:

A concentrated solution in water will always contain a strong or weak electrolyte true or false

Answers

This is a false statement. While a solution in water might have a strong or weak electrolyte, there are also occasions where it might contain a non-electrolyte. Two examples of these types of solutions that will not be electrolytic would be a sugar solution or ethanol.

There are three common functional groups in organic chemistry that are readily ionized by adjusting the ph of the aqueous solution during an extraction. name and write the chemical structure of these three functional groups and show each

Answers

The three functional groups are carboxylic acids, amines and phenols. These functional groups can be turn to ions by adjusting their pH during extraction.
Their chemical strictures are as follows:
Carboxylic acid: RCOOH
Amines: RNH2
Phenols: C6H6O.

If a feather and an iron bar is released from a same height in a room without any air resistance, which one(s) will impact the ground first.
A) neither one, because without air resistance gravity is absent
B) iron bar
C) both
D) feather

Answers

Final answer:

Both a feather and an iron bar will impact the ground at the same time if released from the same height in a room without air resistance, demonstrating that gravity causes all objects to fall with the same acceleration, disregarding their mass.

Explanation:

If a feather and an iron bar are released from the same height in a room without any air resistance, both the feather and the iron bar will impact the ground at the same time. The correct answer is C) both. This outcome occurs because in the absence of air resistance, all objects fall at the same rate due to gravity. This phenomenon was famously demonstrated on the Moon by astronaut David R. Scott in 1971, where, despite the Moon's lower gravitational acceleration of 1.67 m/s² compared to Earth's 9.81 m/s², both a hammer and a feather were shown to fall at the same rate when dropped from the same height. This validates that acceleration due to gravity is constant and does not depend on the mass of the objects involved.

Learn more about Free-fall in a vacuum here:

https://brainly.com/question/28228808

#SPJ3

4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place

Answers

To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.

In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.

Why does ferrocene undergo the acylation reaction more readily than benzene?

Answers

A combination of Pd-catalyzed arene–alkynyl couplings and Cu(OAc)2-promoted internal alkyne dimerization furnishes novel ferrocene-based dehydroannulenes in high yield.

The essential oil found in cloves, eugenol, can be isolated by steam distillation because it is insoluble in water and has a measurable vapor pressure at 100 °c even though it has a much higher boiling point than water. use data from the table to calculate the volume of eugenol in 30 ml of distillate.

Answers

Molar Mass of Water: 18 g/mol
Molar Mass of Eugenol: 164 g/mol
Boiling point of water: 100 degrees C
Boiling point of eugenol: 254 degrees C
Vapor pressure of Water at 100 degrees C: 760 mmHG
Vapor pressure of Eugenol at 100 degrees C: 4.0 mmHG


HINT: Steam distillation is particularly useful for purifying materials that decompose before reaching their normal boiling point. Steam causes high-boiling components that are immiscible in water to boil at significantly lower temperatures than their normal boiling point. Because the mole fraction of the components only depends on the vapor pressure of the components:

I have attempted this problem numerous times here is what i am doing what am i doing wrong?

Xorg = 4.0/4.0+760 = 0.0053
1-0.0053=0.9947 = XH20

mH2O = 0.9947 * 18 = 17.9046
morg = 0.0053 * 164 = 0.8692

m%org = [0.8692/ (0.8692 + 17.9046)] * 100 = 4.62%
Rounded to 5%

One radioactive isotope of calcium has an atomic mass number of 47. How many neutrons are in the calcium-47 nucleus?

Answers

isotope means having the same number of protons but different number of neutrons.
Thus, by looking at the periodic table the prton number is 20.
no. of neutrons in the isotope of Ca=47-20
Therefore the number of neutrons in calcium-47 is 27 neutrons.

Answer: The number of neutrons in the given isotope are 27.

Explanation:

Atomic number is defined as the number of electrons or number of protons that are present in a neutral atom. It is represented as Z.

Z = Atomic number = Number of electrons = Number of protons

Mass number is defined as the sum of number of protons and number of neutrons present in an atom. It is represented as A.

A = Mass number = Number of protons + Number of neutrons

Number of neutrons = Mass number - Atomic number

We are given an isotope having representation:  [tex]_{20}^{47}\textrm{Ca}[/tex]

Atomic number or number of protons = 20

Mass number = 47

So, number of neutrons = 47 - 20 = 27

Hence, the number of neutrons in the given isotope are 27.

what is the definition of tributary

Answers

umm a tributary a stream of water that flows into another stream or a large body of water such as a river or lake 
Final answer:

A tributary is a smaller stream or river that flows into a larger one, contributing to its volume and influencing its navigability, ecosystem, and flooding potential.

Explanation:

The definition of a tributary is a stream or river that flows into a larger stream, river, or lake. These smaller watercourses contribute to the flow of the larger one, which is often referred to as the mainstem or parent river. Tributaries do not flow directly into the sea. They provide additional water volume to their parent river, which can then affect the river's ability to navigate, its ecosystem, and potential for flooding. For example, the Missouri River is a tributary of the Mississippi River because it flows into it.

moles of hydrogen in 9.15×10−2 mol C4H10

Answers

From the given formula, one mole of C4H10 contains 10 moles of hydrogen.

To know the number of moles of hydrogen in 9.15x10^-2, we will just do a cross multiplication as follows:
number of moles of hydrogen = (9.15 x 10^-2 x 10) / 1 = 0.915 moles
Other Questions
Caroline's Jewelry and Gifts is located between a hardware store and a sports bar. While her target market is adult women of medium income, who would be a logical secondary target market? A. Men who want to buy a gift B. Women with very high incomes C. The general public D. Grandparents How to find the slope of (20/8) and (9,16)? The transmission capacity of a computer or communications channel, measured in bits per second, is called the ________. a. none of these terms b. transmission rate c. subscription rate d. signal strength e. bandwidth Cheryl is moving to a new house. Her old house is 3 kilometers and 457meters from her new house. How many meters is her old house from her new house. If you injure yourself bungee jumping and sue the bungee jumping company, what might the bungee company claim in defense? Stimulants speed up brain and spinal cord activity. a. True b. False What are the solutions of 3x+5=2x-7 Which expressions are equivalent to ? Check all that apply. The idea that individuals learn to be deviant by interacting with others who are already deviant is called: Faites des dialogues.Que portez-vous le plus souvent au lyce, en ville, les jours de fete, pendant les vacances? Quelles couleurs aimez-vous? Quels accessoires preferez-vous? Aves-vous votre style? y=x+2;x=-3 solve each system by graphing step by step Which geochemical cycle involves mantle convection? if m On a nutrition label, what section tells you what is in the food in order from the largest amount to the smallest amount? what are some cultural experiences for Hannah Senesh poem my god Choose the correctly spelled words. Select all that apply. A. jointe B. hoist C. fountain D. foule E. stowt F. dawdle G. cautious H. turmole I. scrauny What is the perimeter of a polygon with vertices at(1, 3) , (1, 6) , (2, 10) , (5, 6) , and (5, 3) ? Enter your answer in the box. Do not round any side lengths. Why might algebra tiles not be a good tool to use to factor x2 + 18x + 80? Explain. why did most of the american and british battles take place near waterways Who is considered the father of the hebrews