What is the perimeter of triangle ABC with the vertices A(-2,9), B(7,-3),C(-2,-3) in the coordinate plan
A)21 units
B) 15 units
C)34 units
D)36 units
PLZZZZZZZZZZ HELPPPPPPP MEDALS AND FAN

Answers

Answer 1

Final answer:

The perimeter of triangle ABC with the given vertices can be found by calculating the distances between the points. The lengths are 15 units for AB, 9 units for BC, and 12 units for AC, and their sum is 36 units. The correct option is D.

Explanation:

To determine the perimeter of triangle ABC with the given vertices A(-2,9), B(7,-3), C(-2,-3), we first need to calculate the lengths of the sides of the triangle using the distance formula, which is d = √((x₂ - x₁)² + (y₂ - y₁)²).

Length of AB: √((7 - (-2))² + ((-3) - 9)²) = √(81 + 144) = √225 = 15 unitsLength of BC: √((-2 - 7)² + ((-3) - (-3))²) = √(81 + 0) = √81 = 9 unitsLength of AC: √((-2 - (-2))² + (9 - (-3))²) = √(0 + 144) = √144 = 12 units

The perimeter is the sum of the lengths of the sides, so P = AB + BC + AC = 15 + 9 + 12 = 36 units.

The correct answer is 36 units which corresponds to option D.


Related Questions

If you ever swam in a pool and your eyes began to sting and turn red, you felt the effects of an incorrect pH level. pH measures the concentration of hydronium ions and can be modeled by the function p(t) = −log10t. The variable t represents the amount of hydronium ions; p(t) gives the resulting pH level.

Water at 25 degrees Celsius has a pH of 7. Anything that has a pH less than 7 is called acidic, a pH above 7 is basic, or alkaline. Seawater has a pH just more than 8, whereas lemonade has a pH of approximately 3.

Create a graph of the pH function either by hand or using technology. Locate on your graph where the pH value is 0 and where it is 1. You may need to zoom in on your graph.
The pool maintenance man forgot to bring his logarithmic charts, and he needs to raise the amount of hydronium ions, t, in the pool to 0.50. To do this, he can use the graph you created. Use your graph to find the pH level if the amount of hydronium ions is raised to 0.50. Then, convert the logarithmic function into an exponential function using y for the pH.
The pool company developed new chemicals that transform the pH scale. Using the pH function p(t) = −log10t as the parent function, explain which transformation results in a y-intercept and why. You may graph by hand or using technology. Use complete sentences and show all translations on your graph.
p(t) + 1
p(t + 1)
−1 • p(t)

Answers

For a better understanding of the explanation provided here, please go through the graphs in the attached files. The first file contains the explanations to the first part of the question and the second file contains the three graphs required to explain the second part (the y intercept part) of the question.

It has been given to us that the pH concentration equation is:

[tex] p(t)=-log_{10}t [/tex]

where, The variable t represents the amount of hydronium ions and p(t) gives the resulting pH level.

As can be seen from the first graph, pH is 1 when the amount of hydronium ions, t is 0.1. This is as expected, because, from the concept of logarithms we know that:

[tex] log_{10}(0.1)=log_{10}(\frac{1}{10})=log_{10}(10^{-1})=-1\times log_{10}10=-1\times 1=-1 [/tex]

Thus, [tex] p(0.1)=-1\times-1=1 [/tex]

Again, the value of pH, p(t) is 0 when the concentration of the Hydronium ions, t is 1. This, again, is as expected, because, from the concept of logarithms we know that [tex] log(1)=0 [/tex].

If the pool maintenance man uses our graph and needs to find the the pH level if the amount of hydronium ions is raised to 0.50, then to do so, the pool maintenance man must draw a vertical line from t=0.5 and check the x coordinate of the point where this vertical line intersects the p(t) graph. As we can see from the graph this roughly comes out to be the horizontal line y=0.3.

Let us now move on to the second part of the question. For a better understanding of this part please go through the second graph which has been attached. This graph contains all translations on the original graph and the explanation to each one of them is provided below:

Let us start with the last one, -p(t). We know that, since, [tex] p(t)=-log_{10}(t) [/tex], therefore, [tex] -p(t)=log_{10}(t) [/tex], simply a vertical "flip" or reflection of the original graph. And because the original graph did not have a y intercept, this graph too will not have a y intercept.

Let us now move on to the first one. Here, [tex] p(t)+1=-log(t)+1 [/tex]. This graph will simply move the original graph vertically up by 1 unit and that will not have any bearing on the y intercept and thus, the graph of p(t)+1 will again, not have a y intercept.

Finally, let us move on to the graph of the equation p(t+1). As can be seen, this graph has a y intercept at the origin when t=0. This is because:

[tex] p(t+1)=log_{10}(t+1) [/tex]

and when t=0, [tex] p(t+1)=p(0+1)=log_{10}(0+1) [/tex]

[tex] p(1)=log_{10}(1)=0 [/tex]

Thus, when t=0, p(t+1)=0 too and thus we have a y intercept.

Therefore, out of the three transformations, only the middle transformation results in a y-intercept, the explanation for which has been provided.

Hey
Please someone help me!!!!!
Asap

Answers

(0,4) and (1,0)
Hope this helps

A triangular bandana has an area of 70 square inches.The height of the triangle is 8 3/4 inches. Write and solve an equation to find the length of the base of the triangle.

Answers

To find the area of a triangle it is a=(b*h)/2. Using this, we can find the length of the base by using the equation b=(a*2)/h. In these equations “a” is the area of the triangle, “h” is the height of the triangle, and “b” is the base of the triangle. The answer to this question is 16in =b

The required equation is  70 = (1/2) × base × 8.75, resulting in a base length of 16 inches.

To find the length of the base of a triangle when given the area and the height, we use the formula for the area of a triangle: Area = (1/2) × base × height. In this problem, the area is 70 square inches and the height is 8 3/4 inches.

First, convert the height from a mixed number to an improper fraction or decimal. We have:

8 3/4 inches = 8 + 3/4 = 8.75 inches

Next, write the equation based on the area formula:

70 = (1/2) × base × 8.75

To solve for the base, first multiply both sides of the equation by 2 to eliminate the fraction:

140 = base × 8.75

Then, divide both sides by 8.75 to isolate the base:

base = 140 / 8.75

Calculating this gives:

base = 16 inches

Therefore, the length of the base of the triangle is 16 inches.

The population of current statistics students has ages with mean mu and standard deviation sigma. samples of statistics students are randomly selected so that there are exactly 48 students in each sample. for each​ sample, the mean age is computed. what does the central limit theorem tell us about the distribution of those mean​ ages?

Answers

Answer: The central limit theorem tells us that when random samples are chosen the results tend to approach a normal distribution.

The basic idea is that the more random samples that you select, the closer you should get to the mean. In most cases, 30 or more samples is regarded as a large enough sample to get close to the mean. Our sample is 48, so we should be close to the mean.

Chris is building a large deck for the community center. The deck is shaped as a rectangle. The width of the deck is 29 ft. The perimeter of the deck is to be at least 134 ft. (please answer both questions)

1) Write an inequality that represents all possible values for the length of the deck.

2) Solve algebraically to find all possible values for the length of the deck.

Answers

Question 1)

Width of the deck = W = 29 feet.
Perimeter of the deck = P = At least 134 feet.

We can write the inequality for perimeter as:

[tex]P \geq 134[/tex]

Perimeter of rectangle = 2(Length + Width)
Perimeter of given rectangle = 2(Length + 29) = 2(L) + 58

So the inequality that represents all possible values for the length of the deck will be:

[tex]2L+58 \geq 134[/tex]

Question 2)

We can solve this inequality to find the range of values for the Length of the deck:

Using the values in inequality we can write: 

[tex]2(L) + 58 \geq 134 \\ \\ 2L \geq 76 \\ \\ L \geq 38[/tex]

So this means, for the perimeter to be at least 134 feet the length of the deck must be at least 38 feet.

What is the length of AA' ?

Answers

The length of AA' is the squareroot of 29.

From the given graph the length of the AA' is 5.39 units.

What are coordinates?

A pair of numbers called coordinates are used to locate a point or a form in a two-dimensional plane. The x-coordinate and the y-coordinate are two numbers that define a point's location on a 2D plane.

To find the length of AA', we can use the distance formula:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2 - y_1)^2}[/tex]

where (x₁, y₁) = (0, 0) is the coordinates of point A, and (x₂, y₂) = (5, 2) is the coordinates of point A'.

Substituting the values, we get:

[tex]d = \sqrt{(5 - 0)^2 + (2 - 0)^2}\\d = \sqrt{25 + 4}\\d = \sqrt{29}[/tex]

Therefore, the length of AA' is approximately 5.39 units (rounded to two decimal places).

Learn more about coordinates here:

https://brainly.com/question/20282507

#SPJ2

Solve for x. x/2 = -5

Answers

To solve for x you'll have to multiply 2 on both sides.

x/2 = -5
x = -5*2
x = -10

Hope this helps :)

1. Which of the following expressions is not equal to 0.00055?

55 • 10^-5
5.5 • 10^-4
5.5 • 10^4
0.55 • 10^-3
2. A satellite can move at 17,000 miles per hour. How many hours will it take to reach a star that is three light years away? Recall that 1 light year = 9.5 ∙ 10^12 kilometers and 1 kilometer = 0.62 miles. Show your work.

Answers

For number 1, I think its C because that makes the number 55000 
For 1 it is the third one

A restaurant owner is ordering new chef uniforms. Each uniform has a jacket and pants. The jackets cost $37.99 each, plus a one-time fee of $70.00 to add the restaurant's logo. The pants cost $27.99 each.
A. Write & simplify an expression for the total cost of n uniforms.
B. The restaurant owner can spend $550 for uniforms. Write an inequality to find the number of uniforms she can afford to buy.
C. Can the owner buy 8 uniforms? Explain your reasoning.
D. Suppose the restaurant owner decides not to have the logo put on the chef jackets. Does this decision change your answer to part c?

Answers

Answer: See each part below.

A: If you add the cost of the pants and jacket, you get $65.98 per set. Therefore, the equation will be y = 65.98x + 70, you have to add on the 70 because that is a one time fee.

B: To make the inequality, just add in that it must be less than 550.
550 > 65.98x + 70

C:  No, if you plug in 8 for x it will be $597.84 which is more than $550.

D:  Yes, if you subtract $70 from $597.84, you will be under $550.

Final answer:

The total cost for n uniforms is $65.98 * n + $70.

We use the inequality 65.98n + 70 ≤ 550 to figure out how many uniforms the owner can afford.

Without the logo fee, the owner can afford 8 uniforms since the cost is then less than $550.

Explanation:

To assist with the question regarding the cost of uniforms, let's look at each part individually:

A. Cost of uniforms

The cost of a jacket is $37.99 and the pants are $27.99. The restaurant's logo is a one-time fee of $70.00. So for n uniforms, the cost would be:

Total cost for n uniforms = (Cost of jacket + Cost of pants) * n + Logo fee
= ($37.99 + $27.99) * n + $70.00
= $65.98 * n + $70.00.

B. Inequality for the number of uniforms

We need to ensure the total cost of uniforms is less than or equal to $550. Thus, the inequality is:
65.98n + 70 ≤ 550.

C. Buying 8 uniforms

To determine if the owner can buy 8 uniforms, we substitute n with 8 in the cost expression:
65.98 * 8 + $70 = $597.84 + $70 = $667.84, which is more than $550.

D. Without the logo fee

If the logo is not added, the cost for 8 uniforms would be just the sum of the jackets and pants:
$65.98 * 8 = $527.84, which is less than $550, so yes, without the logo fee, 8 uniforms can be afforded.

If $3000 is invested at 7% for six months how much simple and trust is earned

Answers

I = Prt
I = $3000*0.07*(6/12)
I = $105

$105.00 is earned on the investment.

The sum of three consecutive odd integers is 327. find the integers

Answers

Final answer:

To find the three consecutive odd integers whose sum is 327, we set up an equation with n as the first odd integer, resulting in the integers being 107, 109, and 111.

Explanation:

The question asks for the three consecutive odd integers whose sum is equal to 327. To solve this, we can represent the first integer as n, the second as n+2, and the third as n+4 because odd numbers are two units apart. We can then set up the following equation to find the value of n:

n + (n + 2) + (n + 4) = 327

Simplifying this equation, we get:

3n + 6 = 327

Subtracting 6 from both sides gives us:

3n = 321

Dividing both sides by 3, we find that n = 107. Therefore, the three consecutive odd integers are 107, 109, and 111.

Dan bought a home theater system for $178.99 on the installment plan. The term of the contact said that he would pay $35 a month for 6 months. How much are his total payment.
$30.01
$210
$178.99
$35

2. How much is Dan's finance charge?
$31.01
$210
$178.99
$35

Answers

Given that Dan bought a home theater system for $178.99 on the installment plan, and the terms of the contract is such that he will pay $35 in 6 months.
The total amount he paid by the end of the term will be:
amount=(monthly payment)*(number of months)
=35*6
=$210

b] Dan's Finance charge will be given by:
(total amount he paid)-(price of home theater)
=210-178.99
=$31.01

helppppppppppppppppppppppppppp

Answers

The equation is:
y = 10 sin(π/15 t) + 30 
where 30 represents the initial height of the blade above the ground and π/15 represents the period as we are given that the blade completes two rotation every minute.Finally the 10 represents the length of the blades.

Hope this helps :)

Please help i will medal
y = 192(.25) + .25x
75 = 192(.25) + .25x
27 = .25x
x = 108

Jenny has been saving quarters in a piggy bank since she was born. She currently has 192 quarters in her piggy bank. She wants to save $75 to buy a new Ipod, so she decides to add 2 quarters every day.

She sets up and solves the equation shown. What does her solution mean?
A) She needs to save an additional $108.
B) She needs to save 216 more quarters.
C) She needs to save for 108 more days.
D) She needs to save an additional 108 quarters,

Answers

The answer to this is D. She needs to save an additional 108 quarters
The answer is that she needs to saw 108 more quarters to reach her goal!!

Jonas jogged up the hill at an average rate of of a mile per minute and then walked down the hill at an average rate of of a mile per minute. The round trip took him 42 minutes. What is the missing value in the table that represents the distance of the trip down the hill?

Answers

Answer: option d) (1/16) (42 - x)

Explanation:

1) You forgot to include the table.

This is the table:

                                    Rate              time                 distance
                                 (mi / min)         (min)                   (mi)

up the hill                    1/12                  x                     (1/12)x

down the hill                1/16                 42-x                     ?

2) You also forgot to include the set of answerchoices. This is it:

a) x
b) -x
c) 42 - x
d) (1/16) (42-x)

3) Solution:

The missing value is the distance of the trip down the hill.

The distance is the rate times the time, i.e.:

distance = rate * time

the rate is given as 1/16, and the time is given as 42 - x, so the distance is:

distance = (1/16) (42 - x), which is the answer.
the correct answer is D

Solve 2x2 + 3x = −8.

Answers

Solving the quadratic equation 2x² + 3x = - 8 for x, x = - 3/4 ± i√55/4

To solve 2x² + 3x = - 8, we proceed as follows.

Since we have the quadratic equation 2x² + 3x = - 8, to solve by completing the square, we rewrite the equation as

2x²/2 + 3x/2 = - 8/2

x² + 3x/2 = - 4

Next, we add the square of half the coefficient of x to both sides. So, we have that

x² + 3x/2 + (3/2 ÷ 2)² = - 4 + (3/2 ÷ 2)²

x² + 3x/2 + (3/2 × 1/2)² = - 4 + (3/2 × 1/2)²

x² + 3x/2 + (3/4)² = - 4 + (3/4)²

(x + 3/4)² = - 4 + 9/16

(x + 3/4)² = (-64 + 9)/16

Now, taking the square root of both sides, we have that

(x + 3/4)² = -55/16

√(x + 3/4)² = ±√(-55/16)

x + 3/4 = ±√-55/4

x + 3/4 = ±i√55/4

x = - 3/4 ± i√55/4

So, the value of x = - 3/4 ± i√55/4

Leah has a piece of cloth that is 3 ft 8 in long. She decides to cut 2/11 of the cloth off. How long is the cloth now?

Answers

Cloth is 44 inches long
2/11 * 44 = 8 inches
44 - 8 = Cloth is now 36 inches long.

. At a local bakery, all loaves of wheat bread come with 19 slices, while all loaves of rye bread come with 20 slices. If Grayson bought the same number of slices of each type of bread, what is the smallest number of slices of each type that Grayson could have bought?

Answers

To find the smallest number in common we multiply both numbers. Then we get 19 * 20 = 380 slices of bread. Sometimes we can divide this outcome by 2 and still have a good answer. In this case we would get 380 / 2 = 190 and that would be wrong.

Hence, the answer is 380.

Is the inequality always, sometimes or never true?
9(x+2) > 9(x-3)

answer is 2>3 and i said it's never true, right?

2. 6x-13 < 6(x-2)
answer is 6x-13 < 6x-12 my answer is sometimes

3. -6(2x-10) + 12x less than or equal to 180. im stuck.,

Answers

In order to understand if the inequalities are always, never or sometimes true, you need to perform the calculations:

A) 9(x+2) > 9(x-3)
9x + 18 > 9x - 27
the two 9x cancel out and you get:
+18 > -27
which is always true.

B) 6x-13 < 6(x-2)
6x - 13 < 6x - 12 
the two 6x cancel out and you get:
- 13 < -12
which is always true

C) -6(2x-10) + 12x ≤ 180
-12x +60 +12x ≤ 180
-12x and +12x cancel out and you get:
60 ≤ 180
which is always true.

All three cases are always true.

Also this one pls help I don’t know it.

Answers

this one you need to find the volume.

the formula for volume is V=LWH

substitute

V=3 1/2 x 3 1/2 x 9

turned into improper fractions

V= 7/2 x 7/2 x 9

multiply

V=441/4


turn into a mixed number (optional)

V=110 1/4

The carton can hold 110 1/4 in³






calculate the length of the circumference of a circle with diameter of 9cm

Answers

Hello!

We must use a certain formula to find the circumference of a circle. The formula is:

C = 2 × pi × r

We have the diameter of the circle, so we'll be able to find its radius, since radius is always half the diameter.

r = d ÷ 2

r = 9 ÷ 2

r = 4.5

So, the radius of the circle is 4.5 centimetres. Pi equals approximately 3.14. Substitute:

C = 2 × 3.14 × 4.5

C = 6.28 × 4.5

C = 28.26

ANSWER:

The circumference of the circle is 28.26 centimetres long.


The answer could be A or c but idk which one is the right one please help

Answers

The answer would be c


2x2 -2x - 9 = 0
 For this case, what we should do is use the resolver.
 We have then:
 x = (- b +/- root (b ^ -4ac)) / 2a
 a = 2
 b = -2
 c = -9
 Substituting the values:
 x = (- (- 2) +/- root ((- 2) ^ - 4 (2) (- 9))) / 2 (2)
 Rewriting:
 x = (2 +/- root (4 + 72)) / 4
 x = (2 +/- root (76)) / 4
 x = (2 +/- root (19 * 4)) / 4
 x = (2 +/- 2raiz (19)) / 4
 x = (1 +/- root (19)) / 2
 Answer: 
 option C
 x = (1 +/- root (19)) / 2

What is the answer plz help

Answers

-1 i think!!! thats what i got but i could be wrong 
Try x = 2.

f(x) = 2x^3 + 3x + 5

f(2) = 2(2)^2 + 3(2) + 5

f(2) = 2(4) + 6 + 5

f(2) = 8 + 6 + 5

f(2) = 19

Answer: x = 2

What is the measure of JGK shown in the diagram below

Answers

125-13 = 112

112/2 = 56

The answer is C. 56

Answer:Option C  : 56 °

Step-by-step explanation:

In the given circle the chords JH and KI  intersect outside the circle forming <JGK.

The Angle of intersecting chords Theorem states:

The measure of the angle formed by 2 chords that intersect inside the circle is 1÷2 the sum of the chords' intercepted arcs.

m<JGK=[tex]\frac{125-13}{2} =\frac{112}{2} =56[/tex]°

m<JGK=56°

In the diagram the figures are similar. What is x

A. 2.6ft
B. 3.4ft
C. 0.4ft
D. 2.3ft

Answers

i think its is B.  i hope you got the answer right 
I can't see the length very well. I think it's 8 so I'll work with that.
If the figures are similar, then their sides are proportional.
Set up the proportion 8 is to 7 as x is to 3.
8/7 = x/3
Multiply the means and extremes.
7x = 24
x = 3.4

The correct answer is B. 3.4

Hope this helps =)

PLEASE someone help me on this

Answers

[tex]3x \sqrt[3]{648x^4y^8} =3x \cdot 6xy^2 \ \sqrt[3]{3xy^2} = 18x^2y^2 \ \sqrt[3]{3xy^2}[/tex]

The answer is A

a survey asked 50 students if they play an instrument and if they are in band. 25 students play an instrument 20 are in a band and 30 are not in a band. which table shows these data correctly entered in a two way frequency table?

Answers

I would go with d .... If not it would be c...


Really hope I help but I would choose d

Answer:

Option 4th is correct.

Step-by-step explanation:

We have been the information 25 students play an instrument 20 are in a band 30 are not in a band.

We need to create a two way table:

                                      Band            Not in Band       Total

Play instrument                20                   5                     25

Do not play instrument     0                     25                 25

Total                                  20                    30                50

Option 4th is correct.

4 horses share apples evenly. what % of apples will each horse get?

Answers

100% : 4 = 25%


your answer is 25%

identify the image of xyz for a composition of a 90 degree rotation and a 180 degree rotation, both about point x.

Answers

Answer: 90° option a

180° option b

Step-by-step explanation: If we do a rotation of 90° about the X point, this means that the angle between the lines XZ and X'Z must be equal to 90°.

The options that have a 90° angle between these two lines are a and c.

And here you can see that, if the rotation is counterclockwise, the option a is a rotation of 90° and option c is a rotation of 270°, while if the rotation is defined clockwise, the option c is 90° and option a is 270°.

Usually, the rotations are defined as counterclockwise, so under this viewpoint, the right answer is option a.

For a 180° rotation the angle between XZ and X'Z' must be equal to 180°, the only option that has a 180° angle is option b, so here b is the answer.

Final answer:

To find the image of triangle XYZ after a 90 degree rotation followed by a 180 degree rotation about point X, we perform the rotations successively, leading to a total rotation of 270 degrees counterclockwise about point X.

Explanation:

To identify the image of the triangle XYZ after a composition of a 90 degree rotation and a 180 degree rotation, both about point X, we must perform the transformations step by step.

Firstly, we will apply a 90 degree rotation around point X. Imagine triangle XYZ in a coordinate plane where X is the origin. A 90 degree rotation would result in each point (x,y) of the triangle moving to (-y, x). The identity of triangle XYZ changes as each point follows this rule.

Next, we will apply a 180 degree rotation around point X. A 180 degree rotation is the same as an inversion of a point at (x,y) to (-x,-y). Again, each point of the already transformed triangle will follow this rule.

Overall, the composition of these two rotations is effectively a single rotation by 90 + 180 = 270 degrees. Triangle XYZ will thus have been rotated 270 degrees counterclockwise around point X to its final image position.

Simplify the imaginary number square root of -12

Answers

Final answer:

The square root of -12, an imaginary number, can be simplified to 2i√3. This involves breaking -12 into -1 * 12 and taking the square root of both parts to get 'i' and 2i√3 respectively.

Explanation:

The question asked is to simplify the imaginary number square root of -12. Imaginary numbers are those numbers whose square is less than or equal to zero. They are expressed in the form of 'i' where 'i' is the imaginary unit with the property i^2 = -1. When we take square root of a negative number, 'i' is involved in the solution.

To simplify the square root of -12, we can express -12 as -1 * 12. In this case, square root of -1 is 'i' and square root of 12 is 2 * square root of 3 (since 12= 4*3 and square root of 4 is 2).

Therefore, square root of -12 can be written as 'i' * 2 * square root of 3 or simply 2i√3.

Learn more about Imaginary Numbers here:

https://brainly.com/question/6748860

#SPJ12

Other Questions
Which model of urbanization did Edward ullman develop All of the following are true of the Wade-Davis Bill EXCEPT: A.The bill was written by the moderate Republicans in Congress. B.The bill made it nearly impossible for the Southern states to rejoin the Union. C.The bill contained an iron-clad oath that required that one had never born arms against the United States nor supported the Confederacy. D.The bill was pocket-vetoed by President Abraham Lincoln. What is the current in a series circuit with a resistance of 30 ohms and a potential difference of 120 volts? Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement? sin(76)cos(31)-cos(76)sin(31) John h. harland company is a large company with 5,200 employees and almost $800 million in annual sales. the company is best known for printing personal and business checks. harland analytical services is a technology company that produces software that enables banks to gauge the behavior of their customers by tracking their spending habits. in addition, harland owns scantron, a computerized testing and assessment company. the ________ for john h. harland company includes its check-printing business, its financial software business, and its testing and assessment business. a dos las termina la clase invert to question put the subject at the end When bill is alone with sally, he apologizes by saying, "i'm sorry about getting angry yesterday. i should have informed you sooner that i rescheduled my appointments." bill's apology could be even stronger if he had included? Why do you think Chopin does not elaborate more about Mrs.Mallard death? What is the solution set for 3x>6? What is one property of a wave that determines how much it will diffract when it encounters an obstacle?-speed-amplitude-polarization-wavelengthSuppose two waves collide, and the temporary combined wave that results is smaller than the original waves. What term best describes this interaction?-diffraction-destructive interfernce-standing wave formation-constructive interfernceThe formation of a standing wave requires-the traveling of a wave for a long distance-constructive interference between two waves of slightly different frequencies-that refraction and diffraction occur at the same time in a wave-interference between incoming and reflected waves In what way are Georgia's ports and Hartsfield-Jackson International Airport similar?Question 10 options:They both operate at a fiscal loss each year.They both are operated by the Federal government.They each receive imported goods and they both export goods.They each are located in the Coastal Plain Region of Georgia. While standing on a roof, you drop a hamner. The function y=16-64t^2 represents the height y (in feet) of the hammer t seconds after it is dropped. After how many seconds does the hammer land on the ground? Michael bought a $25.00 gift for a friend. After he bought the gift, Michael had $176.89. Write and solve an equation to calculate how much money Michael had before he bought the gift. Just want to know if this is right... A manufacturer uses a mold to make a part in the shape of a triangular prism. The dimensions of this part are shown below.Which estimate is closest to the volume in cubic millimeters of the part? (1 point) 306 768 1,008 2,016 Choose one tip for effective discipline. Explain why it is an effective method. Discipline tip and explanation: Sandra bought 120 square feet of carpet for a room in her new house. If the room is square, what is the length of each side of the room? Recall that the area of square is calculated by I square root 2, where I is the length of one side Think of a skill, activity or task that you are really good at. Carefully and logically, sequence instructions on how to perform that skill, activity or task. Then make a recording of directions on how to perform that skill, activity or task. Add comments about what was difficult about organizing your writing 20 PTS PLUS BRAINLEIST what are some positive behaviors and consequences