What is the ph of a solution with a hydroxyl ion (oh-) concentration of 10-10 m? what is the ph of a solution with a hydroxyl ion (oh-) concentration of 10-10 m? ph 10 ph 12 ph 4 ph 2?

Answers

Answer 1
According to this formula:
pH = - log [H]
And, pOH = - log [OH] >>> (1)
Where, pH + pOH = 14  >>> (2)
∵ the hydroxide ion concentration = (OH-) = 10 ^ -10 M
from (1) and (2) and by substitution: 
∴ pOH = - log [10^-10] = 10 
∴ pH = 14 - 10 = 4 
Answer 2

The pH in chemistry has been defined as the "power of hydrogen" that specifies and estimates the acidity and basicity. The pH of the solution with a hydroxyl concentration of 10⁻¹⁰ is 4. Thus, option c is correct.

What is pH?

pH has been defined as the  "potential of hydrogen" that is used to define the specificity of the acid and alkaline behavior of the solution. It has been the measure of the hydrogen or the hydroxide ions concentration dissociated into the solution.

pH is calculated as:

pH = −log ([H⁺])

Given,

Hydroxide ion concentration = 10⁻¹⁰

The relation between pH and pOH is given as:

pOH = - log [OH⁻]

pH = 14 - pOH

pOH is calculated as:

pOH = - log [OH⁻]

pOH = - log [10⁻¹⁰]

pOH = 10

Substituting values in the formula for pH as:

pH = 14 - pOH

pH = 14 -10

= 4

Therefore, option c. the pH is 4.

Learn more about pH, here:

https://brainly.com/question/4884748

#SPJ2


Related Questions

Chemoautotrophs use ___ as an energy source and ___ as a carbon source. select one:
a. inorganic compounds: organic compounds
b. light: organic compounds
c. organic compounds: organic compounds
d. light: co2
e. inorganic compounds: co2

Answers

The answer is E.
Chemoautotrophs are organisms that use inorganic compounds as an energy source and CO2 as a carbon source. The organisms live in hostile environments like dark depths of the sea. Inorganic energy sources that they use are mostly hydrogen sulfide, elemental sulfur, ferrous iron, molecular hydrogen, and ammonia. 

autotrophs are organisms that can synthesise organic compounds (e.g.: carbohydrates) from inorganic C compounds (e.g.: CO2)

Phototrophs are those use photons also known as light energy, chemotrophs are those who utilize chemical energy as their source of energy. chemotrophs can either use inorganic or organic molecules as source of energy. from the options given there are 2 answers with CO2, the correct combination is CO2 with inorganic compounds

Therefore chemoautotrophs use inorganic compounds as an energy source and CO2 as a carbon source

Two liquids, 1 and 2, are in equilibrium in a u-tube that is open at both ends. the liquids do not mix, and liquid 1 rests on top of liquid 2. what is the ratio ρ1/ρ2 of the densities?

Answers

Final answer:

The ratio of densities (ρ1/ρ2) of two non-mixing liquids in a U-tube that are in equilibrium can be found by equating the hydrostatic pressures of the liquids at the same height, resulting in the ratio ρ1/ρ2 = h2/h1.

Explanation:

The student is inquiring about the ratio of densities (ρ1/ρ2) of two non-mixing liquids in a U-tube that are in equilibrium. To find this ratio, we use the fact that the pressure at the same height must be the same in both arms of the U-tube if they are in the same liquid. Considering the point at the interface on the side with Liquid 1 and a point at the same level in the arm with Liquid 2, we can write the pressure due to Liquid 1 as P1 plus the atmospheric pressure. Likewise, the pressure due to Liquid 2 is P2 plus the atmospheric pressure. Because these pressures must be equal, we can set up the equation P1 + atmospheric pressure = P2 + atmospheric pressure.

Now, if we consider the column of Liquid 1 to have a height of h1 and the column of Liquid 2 to have a height of h2, we can equate the hydrostatic pressures using ρ1gh1 for Liquid 1 and ρ2gh2 for Liquid 2. The resulting equation is ρ1gh1 = ρ2gh2, where g is the acceleration due to gravity. Canceling out the common factor of g, we have ρ1h1 = ρ2h2. Dividing both sides by h2 and ρ1, we get the ratio of densities as ρ1/ρ2 = h2/h1.

What is the molar mass of gas that has a density of 1.97 g/L at STP?

Answers

Final answer:

The molar mass of a gas can be calculated using the ideal gas law equation at STP. The molar mass of the gas with a density of 1.97 g/L at STP is 44.1 g/mol.

Explanation:

The molar mass of a gas can be calculated using the ideal gas law equation, PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature. At STP (Standard Temperature and Pressure), the pressure is 1 atm and the temperature is 273 K. We can rearrange the equation to solve for the molar mass, M:

M = (PV) / (nRT)

Given that the density of the gas is 1.97 g/L at STP, we can calculate its molar mass by converting the density to grams per mole:

Density = Molar mass / Molar volume

Molar volume at STP = 22.4 L/mol

Thus, Molar mass = Density * Molar volume

Molar mass = 1.97 g/L * 22.4 L/mol = 44.1 g/mol

The molar mass of the gas is 44.1 g/mol.

Write the balanced equation for the decomposition of hydrogen peroxide to form water and oxygen.

Answers

Hydrogen peroxide is H2O2, while water is H2O and oxygen (a diatomic gas) is O2. The (unbalanced) reaction is:
H2O2 --> H2O + O2
Notice that the H2O2 has 2 H atoms, and so does H2. This means that both must have the same coefficients, and we can adjust the coefficient of O2. Since H2O2 has 2 O atoms, and H2O has 1, we multiply O2 by 1/2:
H2O2 --> H2O + (1/2)O2
This has an equivalent number of H and O atoms on either side, but we want the coefficients to be whole numbers, so we multiply everything by 2:
2H2O2 --> 2H2O + O2
Final answer:

The balanced chemical equation for the decomposition of hydrogen peroxide into water and oxygen is 2 H2O2 (aq) → 2 H2O (l) + O2 (g).

Explanation:

The student has asked for the balanced chemical equation for the decomposition of hydrogen peroxide (H2O2) into water (H2O) and oxygen gas (O2). The reaction can be represented as follows:

2 H2O2 (aq) → 2 H2O (l) + O2 (g)

Here, the hydrogen peroxide molecules are breaking down into water molecules and oxygen gas. The equation is balanced with four hydrogens and four oxygens on both sides; therefore, adhering to the law of conservation of matter.

What is desertification

Answers

Desertification is when fertile land becomes desert, hence the name, usually because of deforestation or a drought.
Desertification is the process whereby arable lands are turned to deserts. I hope this helps

Which best explains how two oxygen atoms, each with six valence electrons,can bond with each other ?

Answers

I think each oxygen atom can share two electrons with the other so that each atom has eight valence electrons. The oxygen atoms forms each two covalent bonds since two pairs of electrons are shared in an oxygen molecule. The sharing of electrons helps the atom to achieve stable structures.

Answer:

The correct answer is "the double covalent bond theory".

Explanation:

Each oxygen atom has 6 valence electrons in the outermost layer. To have greater stability you need to gain two electrons per atom. Therefore two oxygen atoms form a double bond by sharing two electrons each, completing the Lewis octet to acquire greater stability.

Have a nice day!

Chemistry helps firefighters _____.

Answers

Determine which chemicals to use to fight different types of fires.

4. Which of the following is an accurate description of the relationship demonstrated in Ohm's Law? A. The electric potential (volts) multiplied by the resistance (ohms) equals the current (amperes). B. The electric potential (amperes) divided by the resistance (ohms) equals the current (volts). C. The electric potential (volts) divided by the current (amperes) equals the resistance (ohms). D. The resistance (ohms) divided by the current (amperes) equals the electric potential (volts).

Answers

C. The electric potential (volts) divided by the current (amperes) equals the resistance (ohms)

The correct answer is option C, that is, the electric potential (volts) divided by the current (amperes) equals the resistance (ohms).  

According to the Ohm's law, the current via a conductor between the two points is directly equivalent to the voltage through the two points. With the introduction of resistance, that is, the constant of proportionality, the mathematical equation, which describes the association is:  

I = V/R

Here, I is the current via the conductor in the units of amperes, R is the resistance of the conductor in the units of ohms, and V is the voltage determined across the conductor in the units of volts.  


Which of the following best describes the relationship between products and reactants in an endothermic reaction?

Answers

Hello!

In an endothermic reaction, The potential energy of the products is greater than the potential energy of the reactants.

Any chemical reaction that absorbs energy is called an Endothermic Reaction. In this reactions, the reactants absorb energy from the surroundings to carry out the reaction. As a result, the products have a higher potential energy than the reactants. Photosynthesis is an example of an Endothermic Reaction, as the plant uses energy from the sun to generate the products. 

Have a nice day!

which statement describes the types of change and the chemical properties of the product and reactants

Answers

I believe the equation represents a chemical change, with the product and reactants having different chemical properties. In a chemical reaction there is a change in the composition of the substances in question and also a new substance is formed, while in physical reactions or changes there is a difference in appearance and no new substance is formed.  
Final answer:

Chemical reactions involve transforming reactants into products, altering their molecular structure and leading to different chemical and physical properties. These transformations are represented by chemical equations, which ensure the conservation of atoms in the reactants and products.

Explanation:

Chemical Changes and Chemical Reactions

When discussing the types of change and the chemical properties of the product and reactants, we're looking at chemical reactions. A chemical change transforms one molecular substance into another, altering its molecular structure and creating new substances with different properties. For example, when gasoline burns, it reacts with oxygen to produce heat, light, carbon dioxide, and water vapor. This transformation is represented by a chemical equation, which shows the reactants on one side and the products on the other, linked by an arrow indicating the direction of change.

Reactants are the starting materials in a chemical reaction, and products are the substances formed as a result of the chemical reaction. During this process, chemical bonds in the reactants are broken, and new bonds are formed in the products, leading to a different arrangement of atoms and thus new chemical and physical properties of the substances involved.

How many milliliters of a 5.0 M H2SO4 stock solution would you need to prepare 108.0 mL of 0.45 M H2SO4?

Answers

Final answer:

To prepare 108.0 mL of a 0.45 M H2SO4 solution, you would need to measure 9.72 mL of the 5.0 M H2SO4 stock solution.

Explanation:

To solve this problem, we can use the concept of dilution. The formula for dilution is C1V1 = C2V2, where C1 and V1 are the concentration and volume of the stock solution, and C2 and V2 are the concentration and volume of the diluted solution.

In this case, the given concentration of the stock solution is 5.0 M and the volume of the stock solution needed is unknown. The desired concentration of the diluted solution is 0.45 M and the volume of the diluted solution is 108.0 mL. Plugging in these values into the dilution formula will give us the volume of the stock solution needed.

Let's solve for V1:

(5.0 M)(V1) = (0.45 M)(108.0 mL)

V1 = (0.45 M)(108.0 mL)/(5.0 M)

V1 = 9.72 mL

Therefore, you would need to measure 9.72 mL of the 5.0 M H2SO4 stock solution to prepare 108.0 mL of 0.45 M H2SO4.

Which level comes just after atoms in the organization chart of living things? Cells Molecules Organs Tissues

Answers

Hello,

100% Correct

The correct answer is B) Molecules

Hope this helps!!!! :)

(Took the Science test)

**Please don't forget to mark brainliest answer!

Molecules come just after atoms in the organization chart of living things. Therefore, option B is correct.

What is a molecule?

A molecule can be defined as a combination or arrangement of two or more atoms that create the smallest unit into which the structure and chemical properties can be classified and preserved by a pure substance.

A molecule can be homonuclear if it exhibits atoms of a single chemical element such as hydrogen molecule (H₂) or it can be heteronuclear such as water (H₂O).

A molecule exhibits an arrangement of atoms held by the forces of valence. Two atoms of the same element that are chemically combined comprise diatomic molecules.

Heteronuclear diatomic molecules have two combined atoms of different elements such as hydrochloric acid (HCl), Carbon monoxide (CO), etc.

The molecules in living organisms are biomolecules such as carbohydrates, lipids, nucleic acids, proteins,

Learn more about molecules, here:

brainly.com/question/19556990

#SPJ2

At what temperature is more KCl able to dissolve: 40°C or 90°C?


(You don't have to give out a paragraph, but also explain why, so that I may understand)

Answers

I believe it would be 90° c, This is because solubility increases with increase in temperature, and therefore more solute would dissolve at a higher temperature. Hence, more KCl will dissolve at a temperature of 90°C as compared to a temperature of 40° C.

Which of the following has the strongest intermolecular forces?

A) Xe
B) H2
C)CO2
D)CH4

Answers

Hello!

The molecule with the strongest intermolecular forces is CO₂ (Carbon Dioxide)

All the listed substances are nonpolar molecules, meaning that there isn't a dipolar moment (a difference in polarity resulting from the arrangement of atoms and electronegativity differences). Nonpolar molecules only have intermolecular interaction in the form of London dispersion forces.

London Dispersion Forces
are stronger as the molecule size is bigger, so of the listed substances the biggest is CO₂, and it has the strongest intermolecular forces. This is evidenced by the fact that this substance has the highest boiling point of them all. 

Have a nice day!

Final answer:

Option C) CO2

Explanation:

All the substances listed are nonpolar, meaning they mainly experience London dispersion forces, which are the weakest intermolecular forces. However, they can vary in strength based on molecular mass and shape. Among the options, CO2 has more polarizable electrons due to its larger size and linear shape compared to Xe, H2, and CH4, thus exhibiting slightly stronger London dispersion forces. However, it's crucial to note that this comparison is subtle because the strengths of dispersion forces can be closely contested among molecules of similar sizes and molar masses. Therefore, CO2 would exhibit the strongest intermolecular forces among the given choices, but the difference might not be highly significant compared to the others, especially CH4.

half life worksheet answer key 1. How long does it take a 100.00g sample of As-81 to decay to 6.25g?

Answers

The half life of As-81 is 33 seconds;
6.25 g = 100 × (1/2)^n, where n is the number of half lives
(1/2)^n = 0.0625
        n = 4
Thus, the time taken = 33 ×4 = 132 seconds
Therefore, it takes 132 seconds or 2 mins 12 seconds for it to decay to 6.25 g

Answer:

132 seconds ( 2 Minutes 12 seconds).

Explanation:

Half life is basically the time it takes for a compound to decay to half of it's original mass.

In this problem, the compound is As. The half life of As-81 is 33 seconds. This means it takes 33 seconds for 100 g of As-81 to decay to 50g. The question however id to find the time it takes for it to decay to 6.25g.

We find how many half life's it would take,

100 --> 50 (First half life)

50 --> 25  (Second half life)

25 --> 12.5 (Third half life)

12.5 --> 6.25 (Fourth half life)

This means the total time is 4 * 33 (Half life) = 132 seconds ( 2 Minutes 12 seconds).

What happens to the shape of a liquid when you pour it into a container?

Answers

It shifts and the temperature changes I think hope this helps

Four different solutions (I, II, III, and IV) are labeled on the pH scale below. mc026-1.jpg Why would solution IV be considered the most concentrated base out of the four substances? It has the highest concentration of hydrogen ions. It has the highest concentration of hydronium ions. It has the highest concentration of oxide ions. It has the highest concentration of hydroxide ions.

Answers

Answer: It has the highest concentration of hydroxide ions.

Explanation:

1) The pH is the measure of the acidity of a solution

2) pH is the logarithm of the inverse of the concentration of hydronium ions.

The higher the concentration of hydronium ions the lower the pH. A low pH indicates a high acidity. A high pH indicates a low acidity.

So, a more concentrated acid is more acid and its pH is lower.

3) The basicity is calculated using the concentration of hydroxide ions. The pOH is the measure of basiciy.

4) pOH is the logarithm of the inverse of the concentration of hydroxide ions.

5) The higher the concentration of hydroxide the lower the pOH and the more basic the solution.

This is, a more concentrated base will be more basic.

So, the only answer possible is that solution IV is considered the most concentrated base out of the four substances because It has the highest concentration of hydroxide ions.


Answer:

D

Explanation:

I took the test

What is the rate of the reaction when the initial concentration of no is 0.400 m and that of br2 is 0.245 m ?

Answers

If the final concentration of NOBr = 0.250M
Change in concentration of NOBr = +0.250 M
Change in concentration of NO = -0.250 M
Change is concentration of Br2 = -0.125 M ( since number of moles of Br2 is 0.5 times the number of mole of NOBr)
Final concentration of NO = 0.400-0.250 = 0.150 M
Final concentration of Br2 = 0.245 - 0.125 M = 0.0120 M
Therefore;
Kc = conc (NOBr)^2/ ((conc NO)^2 ×(conc (Br2)
     = (0.250²)/(0.150²×0.120)
      = 23.148
      = 23.1 mol/dm³

If a particular ore contains 58.9 % calcium phosphate, what minimum mass of the ore must be processed to obtain 1.00 kg of phosphorus?

Answers

1 mole of phosphorous contains 31 g/ mol
Thus, 1000 g will contain 1000/31 moles
The RFM of calcium phosphate (Ca₃(PO₄)₂ = 310 G
1 Mole of calcium phosphate contains 2 moles of P
Therefore, the number of moles of Calcium phosphate that will contain 1000/31 moles will be;
 (1/2)× (1000/31) = 1000/62 moles
but 1 mole of calcium phosphate = 310 g
thus, (1000/62) moles calcium phosphate will contain;
= (1000/62)× 310
= 5000 g or 5 kg
Therefore, for 5 kg of calcium phosphate to be processed we will need
 (5000 /58.9)×100 
= 8488.96 g or 8.489 kg of the ore
Thus, a minimum of 8.489 kg of the ore must be processed to yield 1 kg of phosphorus



Final answer:

approximately 8.51 kg of the ore must be processed

Explanation:

To calculate the minimum mass of ore required to obtain 1.00 kg of phosphorus from an ore containing 58.9% calcium phosphate (Ca3(PO4)2), we follow these steps:

First, calculate the molar mass of calcium phosphate, Ca3(PO4)2. The molar mass is (3×40.08 for Ca) + (2×30.97 for P) + (8×16 for O) = 310.18 g/mol.

Next, understand that calcium phosphate contains two moles of phosphorus per formula unit, which means every mole of calcium phosphate yields 2 moles of phosphorus.

To get 1.00 kg (or 1000 g) of phosphorus, we need 1000 g / 30.97 g/mol = 32.29 moles of phosphorus.

Since 1 mole of Ca3(PO4)2 yields 2 moles of phosphorus, we need 32.29 / 2 = 16.145 moles of calcium phosphate.

To find the mass of calcium phosphate required, multiply the moles by its molar mass: 16.145 mol × 310.18 g/mol = 5006.05 g.

Given that the ore is 58.9% calcium phosphate, the total mass of the ore needed is calculated as 5006.05 g / 0.589 = 8505.18 g, or approximately 8.51 kg.

The rate of disappearance of hbr in the gas phase reaction 2hbr (g) → h2 (g) + br2 (g) is 0.190 m s–1 at 150 °c. the rate of appearance of br2 is ________ m s–1

Answers

According to the balanced equation of this reaction :
2HBr(g) → H2(g) + Br2(g)

when we have the coefficient of the reactant is 2 and when the rate of disappearance is 0.19 m,
So the rate of appearance = the rate of disappearance^(the coefficient of the reactant)
                   = 0.19^2 
                   =0.0361 m.S^-1
Final answer:

The rate of appearance of Br2 in the gas phase reaction 2HBr(g) → H2(g) + Br2(g) when the rate of disappearance of HBr is 0.190 M/s at 150 °C is 0.095 M/s.

Explanation:

To determine the rate of appearance of Br2 in the reaction 2HBr(g) → H2(g) + Br2(g), we use the stoichiometry of the reaction. Given that the rate of disappearance of HBr is 0.190 M/s, and considering that 2 moles of HBr produce 1 mole of Br2, the rate of appearance of Br2 would be half of the rate of HBr's disappearance.

Therefore, the rate of appearance of Br2 is:

Rate of appearance of Br2 = 1/2 × Rate of disappearance of HBrRate of appearance of Br2 = 1/2 × 0.190 M/sRate of appearance of Br2 = 0.095 M/s

So, the rate of appearance of Br2 is 0.095 M/s.

The transition metals are located in what block of the periodic table

S block

P block

D block

F block

Answers

Located in the D block
Final answer:

The transition metals are located in the d block of the periodic table, which is found between Groups 3-12 and includes elements with partially filled d orbitals.

Explanation:

The transition metals are located in the d block of the periodic table. These elements, which have partially filled d orbitals, are found between Groups 3-12. The d block is characterized as the middle 10 columns of the periodic table. While the s block consists of the first two columns on the left side of the periodic table, and the p block refers to the right-most six columns, the d block is distinct in that it includes the transition metals known for their unique chemical and physical properties such as conductivity and malleability. The f block, often considered separate, is comprised of the lanthanides and actinides and does not include the transition metals.

Which of the following statements is true?
A. Stars that appear to move very much are very far from earth

B. The more a star appears to move, the farther is it from earth

C. Stars that do not appear to move are very close to earth

D. The less a star appears to move, the farther it is from earth.

Answers

D The less a star appears to move, the farther it is from earth.

Answer:

The correct answer is option D. The less a star appears to move, the farther it is from earth.

Explanation:

Hi!

Let's solve this!

The stars, like the Earth move. We see them still as they are far away, the distance is very large. The stars we see in motion are the ones that are very close.

Then, the further a star is, the quieter we will see it.

After the analysis, we conclude that the correct answer is option D. The less a star appears to move, the farther it is from earth.

what is the chemical formula of butter

Answers

Answer:

C15H8Cl8O2

Explanation:

C15H8Cl8O2

When a chemical substance has either lost an electron or gained an oxygen?

Answers

if atoms want to be constant, they should gain or loose electrons from their valence orbits.
for doing this, metals will loose electrons and non-metals will gain electrons from metals. this happens in ionic compounds.

What property of half-lives makes radioactive material so problematic?check all that apply?

Answers

I believe the best answer is both A and B, that is there is no known way to shorten a half life, radioactivity is limited by the natural decay-time to stable isotopes, and again all half-lives are long, there is no known way to measure half-lives are long, there is no known way to measure half-lives with any accuracy. Half life is the time taken by a radioactive material to undergo decay to reach half of its original mass. 

I'LL GIVE U BRAINLIEST

Which should be done in case of a laboratory accident? Check all that apply.

a)Stay calm.

b)Read directions completely.

c)Do not try to clean up a spill.

d)Follow the teacher’s directions.

e)Wear appropriate lab attire.

f)Leave the area.

Answers

a, b, c, d, e, f, all of them should be checked

Answer : The correct options are, (a), (c), (d) and (f).

Explanation :

There are some safety rules for science lab when we are performing the experiments :

Always wear the lab coat to protect you from chemicals. Always wear the gloves in your hands. Always wear the face mask to protect you from the pungent smell of chemicals. Always wear the glasses to protect the eyes. Before doing some experiment wash all the materials with distilled water.

There are some safety rules for science lab in case of a laboratory accident:

Always stay calm at that time. Do not try to clean up a spill. Always follow the directions of the teacher. Leave the area immediately.

Hence, the correct options are, (a), (c), (d) and (f).

During which of the following processes is energy absorbed?

i think evaporation

I. boiling

II. condensing

III. evaporating

IV. freezing

V. melting

VI. sublimating

Answers

It mayit could be freeazing however I am not sure

Answer:

I, V, VI

Explanation:

During a state change, e.g solid state to liquid state, energy (absorbed or released) is used to break the bonds between the molecules. In the case of boiling,melting, and sublimation energy is absorbed to break the molecule bonds.

According to Charles Law, if you have a balloon inside a car at noon during a hot summer day the balloon molecules inside will increase in pressure.

A. true
B. false

Answers

Final answer:

The claim that a balloon's internal pressure increases due to Charles's Law on a hot day is false; Charles's Law relates gas volume to temperature at constant pressure, meaning the balloon's volume would increase, not pressure.

Explanation:

The statement that balloon molecules inside a balloon will increase in pressure on a hot summer day according to Charles's Law is false. Charles's Law actually states that the volume of a given amount of gas is directly proportional to its temperature on the Kelvin scale when the pressure is held constant. When the temperature inside the car increases, the gas molecules inside the balloon move faster and if the balloon is elastic and can expand, the volume of the gas will increase while the pressure inside the balloon will not necessarily increase if it is free to expand.

If two covalently bonded atoms are identical, the bond is

Answers

Answer:
nonpolar covalent bond

Explanation:
A covalent bond occurs when two atoms share electrons between them so that they both become stable.
A nonpolar covalent bond means that the two atoms involved in the bond are identical and share the same number of electrons equally.

Hope this helps :)
Final answer:

A pure covalent bond occurs when two identical atoms share electrons equally, resulting in a nonpolar covalent bond.

Explanation:

A pure covalent bond occurs when two covalently bonded atoms are identical. In this type of bond, the electrons are shared equally between the two atoms, resulting in a nonpolar covalent bond. Nonpolar covalent bonds form between two atoms of the same element or between different elements that share electrons equally, such as molecular oxygen (O2).

Pure covalent bonds typically form in situations where the participating atoms are of the same element, such as in the case of molecular oxygen (O2), where two oxygen atoms share electrons equally. Understanding pure covalent bonds is essential in comprehending the nature of chemical bonding and the characteristics of various compounds.

Learn more about Covalent bonds here:

https://brainly.com/question/16655971

#SPJ11

In glacial erosion by abrasion, a glacier _____.

A. melts entirely before it begins eroding the landscape

B. produces rock flour by grinding the rock surface beneath it

C. loosens and lifts blocks of rock as it flows over the surface

D. plucks up rocks and incorporates them into its ice

Answers

During the Glacial erosion by abrasion the glaciers are loaded with other rock fragments as a tool for erosion of the bedrock. These rock fragments are dragged on the bedrock during the forward movement of the glacier and causes the rocks that comes in contact to abrade and the process is known as abrasion.

These abraded mass can also get trapped in the glacier as sub glacial, intra glacial and even super glacial deposit , causing the glacier to increase in mass and hence may flow easily where the glacier flow because of gravity. Abrasion also causes melting of snow because of the frictional heat produced during interaction of rock fragments and country rock.


option D

Answer:

The answer is D

Explanation:

plucks up rocks and incorporates them into its ice.

Other Questions
Marble is a.foliated, b.used for statues, c.easy to break into thin sheets, d.formed from siltstone or mudstone NEED HELP ASAP!! WILL GIVE BRAINLIEST5. Marco wrote the equation below.cos(-pi/2)=cos(3pi/2)which statement best describes marcos equation?a. it is true because the cosine function is oddb. it is false because the cosine function is evenc. it is true because the cosine function has a period of 2pid. it is false because the cosine function has a period of pi. is the population of a country evenly distributed or is the population concentrated in certain areas ana le pide a su papa que no ____ con maria.A: salgoB:saleC:salga Which statement BEST summarizes the section entitled, The Pros of Teaching? A)Being a teacher means that you get to have a lot of days where you dont have to work. B)If you become a teacher, you will always have the teachers union and friends standing behind you in times of trouble. C)Teaching can be a very personally fulfilling jobeven if you dont make a lot of money, you can still get a lot of job satisfaction out of it. D)Being a teacher means having many benefits: personal job fulfillment, a strong union, supportive friends and colleagues, and many holidays and breaks off during the school year. Which schedule is most effective for maintaining behavior over the long term?a. fixed intervalb. fixed ratioc. variable ratiod. variable interval? A guy-wire is attached from the ground to the top of a pole for support. If the angle of elevation to the pole is 67 and the wire is attached to the ground at a point 137 feet from the base of the pole, what is the height of the pole (round to 2 decimal places)? Find the lateral area of the square pyramid. the elevation of Denver Colorado is 13 times greater than that of waikapu. hawaii.the sum of their elevations is 5600 ft. find the elevation of each city Map of Europe. In the center of the map, in orange, are Germany, Austria-Hungary, and Italy. To the east, highlighted in grey, is Russia. To the west, also highlighted in grey, is France and Britain. Public Domain What aspect of the Schlieffen Plan is illustrated by this map? If France and Russia attacked Germany, Germany would face a war on two fronts. If France attacked Russia, French troops would have to move through Germany. If Russia attacked Germany, France would be too far away to offer support. If Germany attacked Russia, France would be too far away to offer support. One of the major motivations for altering the environment in Mexico City was __________. A. creating arable land B. reducing population growth C. providing recreational opportunities D. reducing dependence on agriculture PLEASE SOMEONE HELPWhich of the following matches a human action with its impact? Construction of dam : Scarcity of water for animals Use of fertilizers : Increase in population of aquatic plants Decrease in honeybee population : Increase in plant population Construction of roads : Improvement in quality of water in local lakes The genetic coding or expression that determines our dna and messaging for cells is 16 POINTS. Find the x and y intercepts of number 8 show work. I think my points are wrong. lol i have a test to do today. but plz answer thisnquestion before i get a gucci grade.click on da link Air that has reached its water vapor capacity is said to be _____. . Read the following scenario. Then answer the question based on this scenario. Harper is a two-year-old girl in an Early Head Start classroom. She was born six weeks premature, and both she and her mother tested positive for cocaine at birth. Harper was diagnosed with developmental delay and was placed in a foster home during the period in which the mother successfully completed a drug treatment program. Harper thrived in her responsive and caring foster care home, where she had nurturing care with many opportunities for sensory experiences. She also received developmental therapy services through the state early intervention program. At 18 months, Harper was reunited with her mother and has attended Early Head Start for six months. Assessment at the Early Head Start indicates that Harper is meeting all of her developmental milestones. Harper can run and jump, has a vocabulary of 100 or more words, can help pull up her diaper, and is beginning toilet training. Developmental milestones Harper met are A. growth of the spinal cord. B. fetal growth. C. overcoming addiction to an illegal substance. D. running and jumping. If two quantities are added and the sum is zero, what do you know about the quantities? Josie selected a number n. She divided n by 2 and then subtracted 0.5 from the result. She took half of that result and then subtracted 0.5 to get the final result of 10. What is the value of n? On which day of the year does the sun reach the greatest altitude at solar noon in newyork city