What is the volume of this rectangular prism.

What Is The Volume Of This Rectangular Prism.

Answers

Answer 1

Answer:

Volume of Rectangular Prism:

V = lwh thus: V = 5 cm³

Step-by-step explanation:

Answer:

l = 2.5 cm

w = 4 cm

h = 0.5 cm

d = 4.74342 cm

S = 26.5 cm²

Agenda:

l = length

w = width

h = height

d = diagonal

S = surface area  

V = volume

Answer 2

Answer:

The answer is 5 cm cubed.

Step-by-step explanation:

First, use the formula for solving rectangular prisms, l*w*h(length times width times height). If you do that, 4*1/2 is 2. 2*5/2 is 5. Thus, the answer is 5.

Hope this helps!


Related Questions

What is the difference between arithmatic and geometric sequences ​

Answers

Arithmetic sequences use addition, so each term is a constant amount (common difference) more or less than the last.

Geometric sequences use multiplication, so each term is multiplied by a constant amount (common ratio) to get the next one.



Please consider marking this answer as Brainliest to help me advance.
A sequence is a set of numbers, called terms, arranged in some particular order. An arithmetic sequence is a sequence with the difference between two consecutive terms constant. The difference is called the common difference. A geometric sequence is a sequence with the ratio between two consecutive terms constan

Which number line shows the solution set for |h-2| = 4

Answers

Answer:

The Second Option is your Answer ( Option 2)

Step-by-step explanation:

1) proof ( replace h with -2)

|-2-2| = 4

|-4| = 4

2) proof ( replace h with 6)

|6-2| = 4

|4|=4

Hopes this helps !

Answer:

[tex]h = -2\\h = 6[/tex]

Step-by-step explanation:

The absolute value is a function that transforms any value x into a positive number.

Therefore, for the function [tex]f(x) = |x|[/tex]  x> 0 for all real numbers.

Then the equation:

[tex]|h-2| = 4[/tex] has two cases

[tex](h-2) = 4[/tex]    if [tex]h > 2[/tex]  (i)

[tex]-(h-2) = 4[/tex]    if [tex]h < 2[/tex] (ii)

We solve the case (i)

[tex]h = 4 + 2\\h = 6[/tex]

We solve the case (ii)

[tex]-h +2 = 4\\h = 2-4\\h = -2[/tex]

Then the solution is:

[tex]h = -2[/tex] or [tex]h = 6[/tex]

You have just spoken to your insurance agent and you are interested in investing in a 20-Payment Life insurance policy. Given that you are a 25-year-old healthy female, determine the annual premium for a policy with a face value of $55,000.Use the table provided below and round your answer to the nearest cent where necessary.

a.
$1,377.20
c.
$1,427.80
b.
$790.90
d.
$1,475.65

Answers

Answer: You can use this to help you out:

Determine the term life insurance amount per thousand on a 20-year-old male for a 10-year policy given that the face value of the policy is $65,000 and the annual premium is $291.85.

a.

$0.00449

c.

$0.2227

b.

$4.49

d.

$222.72

First find how many thousands on the amount of the face value

You do that by dividing the amount of the face value by 1000

65,000÷1,000=65

So the term life insurance amount per thousand is

291.85÷65=4.49...answer

Read more on Brainly.com - https://brainly.com/question/4241979#readmore

Answer:

a.  $1,377.20

Step-by-step explanation:

To determine the annual premium for the policy, you have to divide the face value by 1,000:

$55,000/1,000= $55

Then, you have to multiply this result for the rate found on the table, which according to the information given is $25.04:

$55*$25.04= $1,377.20

The annual premium for the policy is $1,377.20.

what is the value of p, rounded to the nearest tenth

Answers

Answer:

Step-by-step explanation:

Triple 15 = p

(236 + 542) + N = 863

Answers

♫ - - - - - - - - - - - - - - - ~Hello There!~ - - - - - - - - - - - - - - - ♫

236 + 542 = 778

778 + N = 863

Subtract 778 from both sides:

N = 85

Hope This Helps You!

Good Luck (:

Have A Great Day ^-^

↬ ʜᴀɴɴᴀʜ

Answer:

85

Step-by-step explanation:

(236+542)+N=863 add the parenthesis first which gives you 778 subtract 778 by 863 which gives you 85 therefore your answer is 85

Which equation can be used to find the value of x in this figure. I’m so stumped but I think it is c

Answers

Answer:

[tex]106\°+x=180\°[/tex]

Step-by-step explanation:

Observing the figure

we know that

[tex]106\°+x=180\°[/tex] ----> by supplementary angles

Solve for x

[tex]x=180\°-106\°=74\°[/tex]

The population of certain region is 60 people per square kilometer If the region convers 23 square kilometer what is the population of the region

Answers

Just multiply 60 people * 23 square kilometers to get 1,380 people.

Please consider marking this answer as Brainliest to help me advance.

Find the area of the unshaded portion of this figure. The figures shown below are a trapezoid and a rhombus. Show your work.

Answers

Answer:A-1/2h(b1+b2)

A-1/2*(10.1)*(30.5+21.4)

A-3296.135 i think

Step-by-step explanation:

Final answer:

To find the area of the unshaded portion of a figure containing a trapezoid and a rhombus, calculate the area of each figure first using their respective formulas. Subtract the area of the overlapping (shaded) region from the total to find the area of the unshaded portion.

Explanation:

The problem asks to find the area of the unshaded portion of a figure, which includes a trapezoid and a rhombus. Since we don't have the specific values of the sides and heights of each figure, a general approach would be to calculate the area of each figure first, then subtract the area of the shaded (overlapping) region from it.

The formula for the area of a trapezoid is A = 1/2 (a+b)h, where 'a' and 'b' are the lengths of the parallel sides and 'h' is the height. For the rhombus, the formula is A = 1/2 (d1 * d2), where 'd1' and 'd2' are the diagonals.

Assuming you can measure and determine the shaded region, you would compute its area as well and subtract this from the total of the previous two calculations. This would give you the area of the unshaded portion.

Learn more about Area Calculation here:

https://brainly.com/question/34380164

#SPJ12

How many different outfits can be made when choosing between 3 shirts, 4 pairs of shorts and 2 pairs of shoes? Show work.

Answers

Answer:

24 outfits

Step-by-step explanation:

Since you have 4 choices of shirts, then 3 choices of shorts, and then 2 choices of shoes, the formula should be set up as 4 x 3 x 2. This gives you 24 outfit options.

Minerva buys used bicycles, repairs them, and sells them for a profit. She bought a bicycle for $10, repaired it, and sold it for $50. What was the percent increase in the price of the bicycle.

A. 400%
B. 80%
C. 40%
D. 4%

Answers

it is an increase of 400%

Final answer:

The percent increase in Minerva's bicycle price is calculated by subtracting the original price from the new price, dividing by the original price, and then multiplying by 100%. The calculation results in a 400% increase.

Explanation:

The percent increase in the price of the bicycle that Minerva bought and sold is calculated using the formula for percent change, which is (New Price - Original Price) / Original Price times 100%. In this case, the original price is $10 and the new price is $50.

To calculate the percent increase:
($50 - $10) / $10 times 100% = $40 / $10 times 100% = 4 times 100% = 400%.

Therefore, the correct answer is 400%, which is option A.

Find the percent of discount. Round to the nearest tenth

Original price: $24,365
Sale price: 16,820

Answers

Answer: 69%

Step-by-step explanation:

16820x100= 1682000

1682000÷24365=69.033

Katie needs to figure out how much space a shoe box takes up. It is 13 1/2 inches long and 5 inches high and 6 2/3 inches wide. What is the shoe box's volume?

Answers

Answer:

you multiply all three of these numbers to get an answer of 450

Step-by-step explanation:

Final answer:

The volume of the shoe box is calculated using the formula for the volume of a rectangular prism, resulting in a total of 450 cubic inches.

Explanation:

The formula for finding the volume of a rectangular prism (which is the shape of a shoe box) is Volume = Length × Width × Height. However, before calculating, we need to ensure all dimensions are in the same unit. Since the given width is in mixed number form, we will convert 6 2/3 inches to an improper fraction which is 20/3 inches. We then multiply the length, width, and height.

Volume = (13.5 inches) × (20/3 inches) × (5 inches)
Volume = (13.5 × 20/3 × 5) cubic inches
Volume = (270/3 × 5) cubic inches
Volume = (90 × 5) cubic inches
Volume = 450 cubic inches

The shoe box's volume is 450 cubic inches.

COCIOLTO
2 Points
At a hardware store, the probability that a customer buys nails is 0.10. The
probability that a customer buys nails given that the customer buys a
hammer is 0.40.
Which statement is true?
O
A. Every customer who buys nails also buys a hammer.
O
B. Buying a hammer and buying nails are independent events.
O
C. Buying a hammer and buying nails are dependent events.
O
D. The probability that a customer buys a hammer and nails is 0.30.
SUBMIT

Answers

Answer: The answer is C

Step-by-step explanation:

Answer:

Option C is correct.

Step-by-step explanation:

C. Buying a hammer and buying nails are dependent events. - This is correct.

Two events are said to be dependent on each other, if the occurrence of the first event affects the occurrence of the second event thus changing the probability. Here the probability for both the events is [tex]0.10\times0.40=0.04[/tex]

A veterinarian divided 2/5 of a bottle of medicine equally among some sick cats. She gave each cat 1/5 of a bottle of medicine. How many sick cats were there?

Answers

Final answer:

The veterinarian gave each cat 1/5 of a bottle of medicine. By dividing the total medicine (2/5 of a bottle) by 1/5, we find that there were 2 sick cats.

Explanation:

To find the number of sick cats, we need to divide the amount of medicine given to the cats by the amount given to each cat. Since each cat received 1/5 of a bottle, we can divide the total medicine (2/5 of a bottle) by 1/5 to find the number of cats. This can be done by multiplying the total medicine by the reciprocal of 1/5, which is 5/1.

Convert 2/5 to an improper fraction: 2/5 = 2 ÷ 5 = 2/5Multiply the total medicine by the reciprocal of 1/5: 2/5 × 5/1 = 2 × 5 / 5 × 1 = 10 / 5 = 2

Therefore, there were 2 sick cats.

Learn more about Dividing Fractions here:

https://brainly.com/question/1627825

#SPJ2

Will mark branliest if correct.

Using the distributive property, the sum of 44 + 12 can be expressed as 4(11 + 3).

Which math word identifies the number 4 in the rewritten expression?
A) Addend
B) Common Difference
C) Least Common Multiple
D) Greatest Common Factor

Answers

[tex]\huge\boxed{\text{Greatest common factor}}[/tex]

The greatest common factor is the greatest number that both [tex]44[/tex] and [tex]12[/tex] are divisible by. In this case, it is [tex]4[/tex]. Each number can then be divided by the greatest common factor using the reverse of the distributive property.

How many times does 7 go into 40

Answers

Answer:

5.7 times

Step-by-step explanation:

5.714285714285714 is the answer exactly

The dimensions of the nations smallest post office are 8 ft 4 in x 7 ft 3 in. Why would you use the measurement 8 ft 4 in. instead of 7 ft 16 in?

Answers

Answer:

The explanation in the procedure

Step-by-step explanation:

we know that

[tex]1\ ft=12\ in[/tex]

In this problem is correct to use the measurement [tex]8\ ft\ 4\ in[/tex] instead of [tex]7\ ft\ 16\ in[/tex]  

because

[tex]16\ in=12\ in+4\ in=1\ ft+4\ in[/tex]

therefore

[tex]7\ ft\ 16\ in=7\ ft\ +1\ ft+4\ in=8\ ft\ 4\ in[/tex]

I need help with this question??

Answers

Answer:

2d + 8

Step-by-step explanation:

twice the number d = 2 × d = 2d and 8 more means add on 8, that is

2d + 8 ← is the variable expression

(d x 2) + 8

deconstruct it from the end of the sentence- twice the number 'd' and add 8

When lines are perpendicular their slopes flip and?

Answers

Answer:

Their sign changes.

For this case we have to:

Given two lines:

[tex]y_ {1} = m_ {1} x_ {1} + b_ {1}\\y_ {2} = m_ {2} x_ {2} + b_ {2}[/tex]

By definition, if both lines are perpendicular to each other, then the product of their slopes is -1. That is to say:

[tex]m_ {1} * m_ {2} = - 1[/tex]

ANswer:

The product of the slopes of two perpendicular lines is -1.

Mr. Ramierz had $600. He gave 3/5 of it to his wife and spent 3/8 of the remainder. How much did he spend?​

Answers

Answer:

he spent $135

Step-by-step explanation:

He spent $135

1. 0.6(600)=360

2. 0.375(360)=135

Prove:Sinx-2sin3x+sin5x=2sinx(cos4x-cos2x)

Answers

A = sinx - sin3x,  

B = -sin3x + sin5x  

First A:  

The average of x and 3x is 2x, and they (x and 3x, that is) are each a distance of x from this average. That's fancy talk for:  

x = 2x-x,  

3x = 2x+x.  

So, A = sin(2x-x) - sin(2x+x)  

Using angle sum formulas:  

A = (sin2x cosx - cos2x sinx) - (sin2x cosx + cos2x sinx)  

A = -2 cos2x sinx  

Similarly,  

B = -sin(4x-x) + sin(4x+x)  

= -(sin4x cosx - cos4x sinx) + (sin4x cosx + cos4x sinx)  

B = 2 cos4x sinx  

Now,  

sinx - 2sin3x + sin5x = A+B = -2 cos2x sinx + 2 cos4x sinx  

= 2 sinx (cos4x - cos2x).  

Answer:

Sinx-2sin3x+sin5x=2sinx(cos4x-cos2x)  

Step-by-step explanation:

sinx - 2sin3x + sin5x = sinx - sin(3x) + sin(5x)- sin(3x)

=  2· cos[(x+3x)/2] · sin[(x-3x)/2] + 2·cos[(5x+3x)/2]· sin[(5x-3x)/2]

= 2· cos(2x) ·sin(-x) + 2· cos(4x) · sin(x)

=  -2·cos(2x)·sinx + 2· cos(4x)·sinx

=  2·sinx · [ cos(4x)- cos(2x)]

Please answer quickly for me

Answers

Answer:

f(x)⁻¹ = x³ + 2

Step-by-step explanation:

Find the inverse of f(x) = ∛(x - 2).

The first step is to let f(x) = y

y =  ∛(x - 2)

Then make x the subject of the formula

y³ =  [∛(x - 2)]³

y³ = x - 2

x = y³ + 2

∴ f(x)⁻¹ = y³ + 2

Replacing y with x we have.

f(x)⁻¹ = x³ + 2

In the equation, what is the value of x? −4(x + 4x) = 2(2 − x) + 10 A) − 7/ 9 B) − 9/ 7 C) 7 9 D) 9/ 7 Submit

Answers

Final answer:

The solution to the given equation is x = -7/9, after simplifying and solving for x.

Explanation:

To simplify the equation -4(x + 4x) = 2(2 - x) + 10, start by combining like terms within the parentheses: -4(5x) = 2(2 - x) + 10. This leads to -20x = 4 - 2x + 10. Further simplifying, you get -20x = 14 - 2x. Now, add 2x to both sides to eliminate the variable on the right, resulting in -18x = 14. To isolate x, divide both sides by -18, yielding x = -14/18, which can be further reduced to x = -7/9. In summary, the equation simplifies to x = -7/9 after a series of steps.

Learn more about Solving the equation here:

https://brainly.com/question/14410653

#SPJ12

What is the equation of the line of best fit for the following data? Round the
slope and y-intercept of the line to three decimal places.
A y=-4.105x+1.560

B. y = 1.560x - 4.105

c. y= -1.560x+ 4.105

d. y = 4.105x – 1 560

Answers

Answer: B. y = 1.560x - 4.105*****

Answer:

Option B.

Step-by-step explanation:

The general equation of best fit line is

[tex]y=mx+b[/tex]              .... (1)

where, m is slope and b is y-intercept.

[tex]m=\frac{\sum_{i=1}^nx_iy_i-n\overline{x}\overline{y}}{\sum_{i=1}^nx_i^2-n\overline{x}^2}[/tex]

[tex]b=\overline{y}-b\overline{x}[/tex]

Using the graphing calculator we get

[tex]m=1.56015\approx 1.560[/tex]

[tex]b=-4.10526\approx -4.105[/tex]

Substitute m=1.560 and b=-4.105 in equation (1).

[tex]y=1.560x-4.105[/tex]

The equation of the line of best fit for the following data y = 1.560x - 4.105.

Therefore, the correct option is B.

A 1/2 yard of ribbon is needed for a craft project. How much ribbon will remain from a piece that measures 7/8 yard?

Answers

3/8 yards.



1/2 is the same as 4/8, since 4 is 1/2 of 8. So, you just need to subtract 4/8 from 7/8 to find the remaining ribbon.

7/8 minus 4/8 is 3/8, so there would be 3/8 yards of ribbon remaining.

To find out how much ribbon is left after using 1/2 yard from a piece that is 7/8 yard long, convert 1/2 yard to 4/8 and subtract from 7/8, leaving you with 3/8 yard of ribbon remaining.

To determine how much ribbon will remain after using 1/2 yard for a craft project from a piece that measures 7/8 yard, you need to subtract the amount used from the total length you have. Since we are working in yards, ensure both amounts are in the same units. Here are the steps to find the remaining ribbon:

Start with the total length of ribbon: 7/8 yard.

Subtract the length of ribbon used for the project: 1/2 yard.

Convert 1/2 yard to an equivalent fraction with a denominator of 8, which is 4/8 yard.

Subtract 4/8 yard from 7/8 yard to find the remaining length.

7/8 yard - 4/8 yard = 3/8 yard remaining.

So, after using 1/2 yard of ribbon for a craft project, you will have 3/8 yard of ribbon left from the original 7/8 yard piece.

2x+x-6x combine terms

Answers

Answer:

-3x

Step-by-step explanation:

Combine like terms (terms with the same amount of variables). Note that + x = + 1x. First add, then subtract:

2x + x = 3x

3x - 6x = -3x

-3x is your answer.

~

Answer:

6x

Step-by-step explanation:

What is the perimeter of the triangle shown on the coordinate plane to the nearest 10th of a unit? Please help.

Answers

You can use the pythagorean theorem to find the side lengths. One is a straight line and it's 7 units. I'll attach a picture of what this looks like, but the side lengths of the other ones are √37 and √72. Add these up to get the perimeter → 21.568 or 21.6 units.

Find the value of x.
Answer options: 60, 57, 69, 63

Answers

Answer: First option

Step-by-step explanation:

By definition, you know that:

[tex]55\°=\frac{170\°-x}{2}[/tex]

Therefore, to calculate the measure of the missing angle, you must solve for x, as you can see below:

- Multiply both sides of the equation by 2.

- Subtract 170 from both sides of the equation.

- Multiply both sides of the equation by -1

Therefore:

[tex]55\°=\frac{170\°-x}{2}\\\\(2)55\°=\frac{170\°-x}{2}(2)\\\\110\°=170\°-x\\110\°-170\°=170\°-x-170\°\\(-1)-60\°=-x(-1)\\x=60\°[/tex]

Da la answer is 60

Step-by-step explanation:

Gradpoint approved

Three values on a number line are labeled F, G, and H . Which number line correctly shows the values of F, G, and H?​

Answers

Answer:

C

Step-by-step explanation:

F must be on -4

H must be on 4 (because it is -f=-(-4)=-1•-4=4)

Answer:

Step-by-step explanation:

the answer is c

Select either relation (if the set is a relation but not a function), function (if the set is both a relation and a function), or neither (if the set is not a relation). input -1 0 -1 -8 9 output 0 1 2 4 8 function relation neither

Answers

Answer:

Relation.

Step-by-step explanation:

This is a relation but not a function. The input -1 maps to both 0 and 2; this is a one-to-many relation  so it is not a function. Functions are either one-to-one or many-to-one.

Answer:

Relation cause its not a function

Step-by-step explanation:

This is a relation but not a function.

Other Questions
the product of-5 and a number is greater than 35 or less than 10 Please help!!! Will mark brainliest!!! how is health care a problem in today's society 5 50/100 - 2 72/100= What is Hrxn for the following chemical reaction? CS2(g)+2H2O(l)CO2(g)+2H2S(g) You can use the following table of standard heats of formation (Hf) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218 N(g) 473 H2(g) 0 O2(g) 0 H2O(l) 285.8 O(g) 249 CS2(g) 116.7 H2S(g) 20.60kJ C(g) 71 CO2(g) 393.5kJ C(s) 0 HNO3(aq) 206.6 Express the standard enthalpy of reaction to three significant figures and include the appropriate units. View Available Hint(s) Why are publicly traded corporations required to release financial reports on a regular basis?A. because shareholders are entitled to transparencyB. so the government can determine the corporate taxes owedC. so owners know when it is time to hire a new board of directorsD. because it would be impossible to raise financial capital otherwise Find the slope of the line. 5x 2y = 7 which of the following groups is most likely to be dealing with eating disorders teenage girls pregnant women those who abuse alcohol young men in their 20s If you want to lift a 30-kg box to the height of 1 m how much work will it take How is the conflict in Black Cowboy, Wild Horses resolved? The base of a regular pyramid is a hexagon.What is the area of the base of the pyramid?Express your answer in radical form. How is editing for a broadcast different from editing for print journalism? Please and Thank you:) Julio is lifting weights. He wants to have 210 pounds on the bar. How many 15-pound weights should he put on the bar? what is the decimal form of 63/100 How many times smaller is the volume of a triangular prism if the height is divided by 4? What is the inverse of the conditional statement if a polygon has five angles Which of these is a negotiation skill How did the English Bill of Rights change the government structure of England? the shape is a rhombus if and only if the diagonals are perpendicular and the sides are congruent Short poem multiple choice answers