Which function represents the sequence?

11

Question 11 options:

f(n)=n+3

f(n)=7n−4

f(n)=3n+7

f(n)=n+7

Which Function Represents The Sequence?11Question 11 Options:f(n)=n+3f(n)=7n4f(n)=3n+7f(n)=n+7

Answers

Answer 1

Answer: SECOND OPTION

Step-by-step explanation:

Substitute any value of n shown in the table attached into each function given in the options, and observe if you obtain the value of [tex]a_n[/tex] shown in the table.

Let's substitute n=1 (According to the table, you need to obtain [tex]a_n=3[/tex]):

For the first option:

[tex]f(1)=1+3=4[/tex]

For the second option:

[tex]f(1)=7(1)-4=3[/tex]  THIS IS THE FUNCTION

For the third option:

[tex]f(1)=3(1)+7=10[/tex]

 For the fourth option:

[tex]f(1)=1+7=8[/tex]

Therefore, the answer is the second option.

Answer 2

ANSWER

[tex]f(n) = 7n - 4[/tex]

EXPLANATION

The terms of the sequence are;

[tex]3,10,17,24,31,...[/tex]

This implies that,

[tex]a_1=3[/tex]

The constant difference is

[tex]d = 10 - 3 = 7[/tex]

The nth term of the sequence is;

[tex]a_n=a_1+d(n-1)[/tex]

[tex]a_n=3+7(n-1)[/tex]

[tex]a_n=3+7n - 7[/tex]

[tex]a_n=7n-4[/tex]

Or

[tex]f(n) = 7n - 4[/tex]

The correct choice is B.


Related Questions

is 6/15 equivalent to 2/3​

Answers

Answer:
No
Step-by-step explanation:
To get like terms you would convert the denominator to the same as the first number so it would be 10/15 because 3 x 5 = 15 so you do the same to the numerator multiply it by 5, then 2 x 5 = 10 so 10/15 is not equal to 6/15.

2/3miles equal how many feet

Answers

Answer: 3,520 feet

Step-by-step explanation:

To solve this exercise you must apply the proccedure shown below.

You know that 1 miles is equal to 5,280 feet.

1 mile=5,280 feet (This is the conversion factor that you should use)

Then, keeping the above on mind, you can convert 2/3 miles to feet as following:

[tex](\frac{2}{3}miles)(\frac{5,280feet}{1mile})=3,520feet[/tex]

What is the distance between begin ordered pair 8 comma negative 3 comma 4 end ordered pair and begin ordered pair 6 comma negative 4 comma 1 end ordered pair? Round to the nearest tenth of a unit.

Answers

Answer:

[tex]d = \sqrt{14} = 3.74...[/tex]

Step-by-step explanation:

To find the distance between (8, -3, 4) and (6, -4, 1), use the distance formula for (x,y,z) points. It is very similar to (x,y) points.

[tex]d = \sqrt{(x_2-x_1)^2 + (y_2-y_1)^2 + (z_2 - z_1)^2} \\d = \sqrt{(8 - 6)^2 + (-3--4)^2 + (4-1)^2} \\d = \sqrt{(2)^2 + (1)^2 + (3)^2} \\d = \sqrt{4 + 1 + 9}\\ d = \sqrt{14} = 3.74...[/tex]

20×(6/ 8) = □



20×(4/3) = □


20×(8/6) = □


20×(3/4) = □


6×(8 /20) = □


the parentheses are fractions

Answers

Answer:

1. 15

2. 26.6666666667

3. 26.6666666667

4. 15

5. 8

Step-by-step explanation:

A parallelogram has one angle that measures 90°. What are the measures of the other three angles in the parallelogram?

Answers

Final answer:

If one angle in a parallelogram is 90°, all four angles are 90°, making the parallelogram a rectangle.

Explanation:

When dealing with a parallelogram, it is important to remember certain properties about its angles. A parallelogram has opposite angles that are equal and consecutive angles that are supplementary (add up to 180 degrees). If one angle is 90°, then the opposite angle must also be 90°. Since one pair of opposite angles are right angles, this parallelogram is actually a rectangle. This means the other two angles in the parallelogram must also be 90° each.

So, in conclusion, if a parallelogram has one angle that measures 90 degrees, the measures of the other three angles in the parallelogram are also 90 degrees each. This is because a parallelogram with all right angles is a rectangle, and by definition, a rectangle has all angles measuring 90 degrees.

Learn more about Angle Measures in Parallelograms:

https://brainly.com/question/12435454

#SPJ2

In a parallelogram with one angle measuring 90°, the other three angles also measure 90°, making the parallelogram a rectangle.

In a parallelogram, opposite angles are equal, and adjacent angles are supplementary (sum to 180°). Since one angle measures 90°, its opposite angle must also be 90°. Therefore, the adjacent angles must each be 180° - 90° = 90°.

So, the measures of the other three angles in the parallelogram are all 90°.

Since one angle in a parallelogram measures 90°, the other three angles must also be 90°, making this parallelogram a rectangle.

please answer ASAP ​

Answers

The central angle is described by angle AOC

What is the central angle?

A central angle is an angle formed by two radii (lines from the center of a circle) that intersect at a point on the circle's circumference.

It is called "central" because it originates from the center of the circle.

In this case, the radii are AO and CO

Central angles are essential in geometry

can someone help me with these 2?

Answers

answer: 1 over 165 step by step: #1 Evaluate the power 5 to the power of 1= 5 because any expression raised to the power of 1 if u asking what's is an expression the expression is five and together is 5 to the power of 1) #2 if a term like five doesn't have a exponent the exponent is 1) #3 remove the parathesis ) #4 subtract 1 and -2 u get 1 over 5 to the power of -4 and 5 to the power of negative four is 1 over 165) the second I don't know

Which is the vertex of x2 + 10x = -17

(-5,-8)

(5,8)

(-5,8)

(5,-8)

Answers

Answer:

vertex = (- 5, - 8)

Step-by-step explanation:

Given a quadratic in standard form : ax² + bx + c = 0 : a ≠ 0

Then the x- coordinate of the vertex is

[tex]x_{vertex}[/tex] = - [tex]\frac{b}{2a}[/tex]

Given x² + 10x = - 17 ( add 17 to both sides )

x² + 10x + 17 = 0 ← in standard form

with a = 1, b = 10, c = 17, then

[tex]x_{vertex}[/tex] = - [tex]\frac{10}{2}[/tex] = - 5

Substitute x = - 5 into the quadratic for the corresponding value of y

y = (- 5)² + 10(- 5) + 17 = 25 - 50 + 17 = - 8

Hence vertex = (- 5, - 8)

Points A and B split the circle into two arcs. Measure of minor arc is 150°. Point M splits major arc with the ratio 2:5 (point M is closer to point B). Find m∠BAM.

Answers

Answer:

If point a and point b split the circle in 2 arcs.

One of the point take up way more space than the other one.

Answer:  Measure of ∠BAM is 30°.

Step-by-step explanation:  As shown in the attached figure, points A and B split the circle with center O into two arcs. Major of the minor arc is 150°. And, the point M splits the major arc in the ratio 2 : 5.

We are to find the measure of ∠BAM.

Since the measure of minor arc AB is 150°, so the measure of major arc AB will be

360° - 150° = 210°.

Also, point M divides the major arc AB in the ratio 2 : 5, so we have

[tex]\textup{arc }BM:\textup{arc }{MA}=2:5.[/tex]

Therefore, the measure of ∠BOM is given by

[tex]m\angle BOM=\dfrac{2}{2+5}\times 210^\circ=\dfrac{2}{7}\times210^\circ=2\times30^\circ=60^\circ.[/tex]

We know that the measure of the angle subtended at the center by an arc is equal to twice the measure of the angle subtended at the circumference by the same arc.

That is, for arc BC, we get

[tex]m\angle BOM=2\times m\angle BAM\\\\\\\Rightarrow m\angle BAM=\dfrac{m\angle BOM}{2}\\\\\\\Rightarrow m\angle BAM=\dfrac{60^\circ}{2}\\\\\\\Rightarrow m\angle BAM = 30^\circ.[/tex]

Thus, the measure of ∠BAM is 30°.

HELP PLS ANSWER ASAP DUE TOMARROW

Answers

Answer:

they need to sell 15,000 because 42 percent of 15,00 is 6,300+2500=800

the inequality should be. 2500+0.42s≥8,800

and the number line should have a closed point on 15,000 with the line pointing to the right

I tried to solve this but I still don’t understand

Answers

Answer:

B

Step-by-step explanation:

given

f(x) = 3x + 2

To evaluate f(5) substitute x = 5 into f(x) that is

f(5) = (3 × 5 ) + 2 = 15 + 2 = 17 → B

Please help me find DG on the attached diagram. Thanks!

Answers

Answer:

Step-by-step explanation:

DG=x+20

DG=2x+17+8+2

x+20=2x+27

20=x+27

-7=x

DG=13

Answer:

DG = 20

Step-by-step explanation:

We are given a straight line DG with point E and F on it and we are to find the length of DG.

We have [tex] D E = 2 x + 7 [/tex], [tex] E F = 8 [/tex],  [tex] F G = 2 [/tex] and [tex] D G = x + 20 [/tex].

So we can write it as:

[tex] DG = DE + EF + FG [/tex]

[tex]x+20 = 2x+17+8+2[/tex]

[tex]2x-x=20-17-8-2[/tex]

[tex]x=-7[/tex]

Substituting this value of [tex]x[/tex] to find DG:

DG = [tex]+x+20 = -7+20[/tex] = 13

what is 0.01% in decimal value​

Answers

Answer:

your answer is 0.001

Step-by-step explanation:

you multiply by 100

move the decimal two places to the right

~~→hope this helps← ~~

║bangtanboys7║

Answer:

you get 0.001

Step-by-step explanation:

Convert the percentage to a fraction by placing the expression over  100 . Percentage means 'out of  100 '.

[tex]\frac{0.01}{100}[/tex]

Convert the decimal number to a fraction by shifting the decimal point in both the numerator and denominator. Since there are  2  numbers to the right of the decimal point, move the decimal point  2  places to the right.

[tex]\frac{1}{0000}[/tex]

Convert the fraction to a decimal by dividing the numerator by the denominator. then you get 0.001 as your answer

Hope This Helps

Have A Nice Day/Night (·❛ᴗ❛·)

Stay Safe,Stay Positive, Stay Gold ⭐

                                ~susu

Evaluate the function for the indicated values of x.

f(−10) =

f(2) =

f(−5) =

f(−1) =

f(8) =

Answers

Answer:

f(-10) = -19

f(2) = 4

f(-5) = -9

f(-1) = 1

f(8) = -5

Step-by-step explanation:

This is relatively simple if you understand the concept. All you have to do is take each number and then look at each inequality to see where it fits.

For example, if you take 2 and look at the first inequality, you see that 2 is not less than or equal to 5. Now if you look at the second inequality, you see that 2 is both greater than -5 and less than 5. Since 2 fits in the second inequality, you plug it into the second equation.

These functions where you have to see where the x-value fits are called piecewise functions and you will see them a lot in higher level math.

(disclaimer: I evaluated the numbers quickly, so I would doublecheck it, but I am pretty sure I didn't mess up)

Answer:

f(-10) = -19

f(2) = 4

f(-5) = -9

f(-1) = 1

f(8) = -5

Step-by-step explanation:

The domain for x is all real numbers (without restrictions). For instance, if f(x) = x^2, on -5 < x < 5, on negative x, you must use f(x) = (-1)^2 to get 1.

If x is >= 5, then the range is 3 - x, so f(x) = 3 - x, if x >= 5.

If x is <= -5, then the range is 2x + 1, so f(x) = 2x + 1, if x <= -5.

multiplying mixed numbers and whole numbers 1 1/2 x 2/1 =

Answers

Answer: 3

Step-by-step explanation:

1. Convert the mixed number to fraction:

- Multiply the denominator of the fraction by the whole number.

- Add the product obtained and the numerator of the fraction.

- Write the sum obtained as the numerator and rewrite the original denominator of the fraction.

Then:

[tex]1\ 1/2=\frac{(1)(2)+1}{2}=\frac{3}{2}[/tex]

2. Multiply the numerators.

3. Multiply the denominator.

4. Reduce the fraction.

Then:

[tex](\frac{3}{2})(\frac{2}{1})=\frac{6}{2}=3[/tex]

please help!!!!!!!!!

Answers

Hello!

The answer is:

C. [tex]\frac{x-\sqrt{5x}}{x-5}[/tex]

Why?

Since we have rational numbers on both numerator and denominator, we need to rationalize (simplify) using the conjugate method on the denominator, for this case, the conjugate will be the same expression changing the positive sign "+" to a negative sign "-". Conjugate method means that we need to multiply and divide for the same term in order to not affect the expression.

Also, for solving this problem, we need to remember the following:

[tex]a^{2}-b^{2}=(a+b)(a-b)[/tex]

And,

[tex]\sqrt[n]{a}*\sqrt[n]{b}=\sqrt[n]{a*b}[/tex]

So, the conjugate for the expression will be:

[tex]\sqrt{x}-\sqrt{5}[/tex]

Applying the conjugate for the expression, we will have:

[tex]\frac{\sqrt{x} }{\sqrt{x}+\sqrt{5}}*\frac{\sqrt{x}-\sqrt{5}}{\sqrt{x}-\sqrt{5}}=\frac{\sqrt{x}*\sqrt{x} -\sqrt{x}*\sqrt{5}}{(\sqrt{x})^{2}-\sqrt{x}*\sqrt{5}+\sqrt{5}*\sqrt{x}-(\sqrt{5})^{2}}\\\\\frac{(\sqrt{x})^{2}-\sqrt{5x}}{x-5}=\frac{x-\sqrt{5x}}{x-5}[/tex]

So, the rationalized form of the expression is:

[tex]\frac{x-\sqrt{5x}}{x-5}[/tex]

Have a nice day!

a computer store sells computers for 10% more than they pay for them . if the store pays x dollars for a computer , which expression would represent the prince for which the store would sell the computer? a. 0.10x / b. 0.9x / c.1.1x / d. 10x

Answers

Answer: C

Explanation:

If a store paid x dollars to buy the computer and they sold it for 10 percent extra, it would be x+.1x. We can use the distributive property to get that x+.1x=x(1+.1) to get 1.1x, or C

Answer: c.1.1x

Step-by-step explanation:

Hi, the correct option is c.1.1x.

Since the price they paid for the computer is 100%, if they sell them for 10% more:

100%+10% =110% (sales percentage)

So, for a price x, to obtain the selling price we have to multiply the price (x) by the sales percentage in decimal form (110/100= 1.1)

The final expression is:

1.1x

if f(x)=-4x^2-6x-1 and g(x)=-x^2-5x+3, fine (f-g)(x)

Answers

Answer:

[tex]\large\boxed{(f-g)(x)=-3x^2-x-4}[/tex]

Step-by-step explanation:

[tex](f-g)(x)=f(x)-g(x)[/tex]

[tex]f(x)=-4x^2-6x-1,\ g(x)=-x^2-5x+3\\\\(f-g)(x)=(-4x^2-6x-1)-(-x^2-5x+3)\\\\(f-g)(x)=-4x^2-6x-1-(-x^2)-(-5x)-3\\\\(f-g)(x)=-4x^2-6x-1+x^2+5x-3\qquad\text{combine like terms}\\\\(f-g)(x)=(-4x^2+x^2)+(-6x+5x)+(-1-3)\\\\(f-g)(x)=-3x^2-x-4[/tex]

Determine the binomial probability

Answers

Answer:

21. Option d

22. Option b

23. Option b

Step-by-step explanation:

The formula to calculate the binomial probability is represented as follows.

[tex]P(X=x) = \frac{n!}{x!(n-x)!}p^x(1-p)^{n-x}[/tex]

The formula to calculate the binomial probability is represented as follows.

In this formula x represents the number of successes, n represents the number of times the experiment is repeated, p represents the probability of success.

1. First we are asked to calculate the probability of obtaining 3 successes, with n = 6 and p = 0.35.

Then we substitute the values in the formula [tex]P(X=3) = \frac{6!}{3!(6-3)!}(0.35)^3(1-0.35)^{6-3}\\\\P(3) = 0.2354[/tex]

Option d.

2. Second we are asked to calculate the probability of obtaining 5 successes, with n = 20 and p = 60%, p = 0.6.

[tex]P(X=5) = \frac{20!}{5!(20-5)!}(0.6)^5(1-0.6)^{20-5}\\\\P(5) = 0.00129[/tex]

option b

3. Third we are asked to calculate the probability of obtaining 2 successes, with n = 10 and p = 1/2, p = 0.5.

[tex]P(X=2) = \frac{10!}{2!(10-2)!}(0.5)^2(1-0.5)^{10-2}\\\\P(2) = 0.04394[/tex]

option b

Solve for R. What will be the answer PV=nRT

Answers

Answer:

R = PV / nT

Step-by-step explanation:

PV = nRT solve for R

rewrite

nRT = PV

Divide both sides by nT

nRT / nT = PV / nT

Simplifying

R = PV / nT

First option is the answer

Which set of data contains two outliers

Answers

Answer:

you need to list the sets of data.

Step-by-step explanation:

Plz help !! Needed to graduate

Answers

Answer:   [tex]\bold{\dfrac{-5\pm 2\sqrt{10}}{3}}[/tex]

Step-by-step explanation:

[tex]5-10x-3x^2=0\quad \rightarrow \quad a=-3,\ b=-10,\ c=5\\\\\\\text{Quadratic formula is: }x=\dfrac{-b\pm \sqrt{b^2-4ac}}{2a}\\\\\\x=\dfrac{-(-10)\pm \sqrt{(-10)^2-4(-3)(5)}}{2(-3)}\\\\\\.\ =\dfrac{10\pm \sqrt{100+60}}{2(-3)}\\\\\\.\ =\dfrac{10\pm \sqrt{160}}{2(-3)}\\\\\\.\ =\dfrac{10\pm 4\sqrt{10}}{2(-3)}\\\\\\.\ =\dfrac{-5\pm 2\sqrt{10}}{3}[/tex]

one side of a sqaure is 10 units which is greater, the number sqaure units for the area of the sqaure or the number of units for the preimeter explain​

Answers

The area is greater because you multiply 10 by 10. The perimeter is all the sides added together so that would be 40 units. All sides of the square are the same. Area is length times width

The area of a square with a side of 10 units is 100 square units, which is greater than its perimeter of 40 units, because the area measurement squares the side's length, whereas the perimeter is a sum of side lengths.

To determine which is greater between the area of a square and its perimeter, we start by understanding that the area of a square is calculated by squaring the length of one side. In this case, the square's side is 10 units, so the area is 10 units  imes 10 units = 100 square units. The perimeter of a square is the sum of all its sides, which is 4 times the length of one side. Hence, the perimeter is 10 units times 4 = 40 units.

As a result, the area, which is 100 square units, is greater than the perimeter, which is 40 units. This demonstrates that while the perimeter is a measure of the distance around the square, the area represents the entire space enclosed within it, leading to larger numerical values when the sides of the square are squared as opposed to simply multiplied by four.

Hayden mixed 6 cups of blue paint with 8 cups of yellow
paint to make green paint. Write an equation that shows the
relationship between the number of cups of blue paint, b,
and the number of cups of yellow paint, y, that are needed to
create the same shade of green paint. The equation should
be in the form b=ky.

Answers

Answer:

the answer is probably 6x:8y

Step-by-step explanation:

Flora’s car is 59/100 meters longer than Sally’s car.Sally’s car is 2/10 of a meter longer then Trevor’s car.how many longer is flora’s car than trevor’s car?

Answers

Flora's car is 79/100 meters longer than Trevor's car after adding the separate differences between Flora's car and Sally's and Sally's car and Trevor's.

To find out how much longer Flora's car is than Trevor's, we need to add the two differences mentioned:

Flora's car is 59/100 meters longer than Sally’s car.

Sally’s car is 2/10 of a meter (20/100 when having a common denominator with 59/100) longer than Trevor’s car.

First, we express 2/10 as 20/100 to have a common denominator with 59/100 for easier addition:

59/100 + 20/100 = 79/100

Now we add the two lengths to determine how much longer Flora’s car is than Trevor's.

79/100 meters

Therefore, Flora's car is 79/100 meters longer than Trevor's car.

Farimah and Helio are standing 15 ft. apart from each other and looking up at a kite that is with the flying between them. Farimah is flying the kite on a 57 ft. string at an angle of 68° with the ground. How far is Helio from the kite?

A. 64.1 ft.
B. 56.2 ft
C. 60.0 ft.
D. 53.2 ft.

Answers

Answer:

D. 53.2 ft.

Step-by-step explanation:

As you can see in the diagram, Farimah, Helio, and the kite are making a triangle. We know from our problem that the distance from Farimah to Helio is 15 ft, the distance from Farimah to the kite is 57 ft, and the angle of elevation from Farimah to the kite is 68°. From this situation, we can infer that we have two sides of the triangle and the angle between those sides; therefore, we can use the law of cosines to find the third side, which is the distance form Helio to the kite:

[tex]c^2=a^2+b^2-2abcos(C)[/tex]

[tex]c^2=57^2+15^2-2(57)(15)cos(68)[/tex]

[tex]c=\sqrt{57^2+15^2-2(57)(15)cos(68)}[/tex]

[tex]c=53.2[/tex]

We can conclude that Helio is 53.2 ft from the kite.

Answer:

D. 53.2

You can use the Law of Cosines to solve.

what is the following difference 11 sqrt 45 - 4 sqrt 5

Answers

Answer:

29*sqrt(5)

Step-by-step explanation:

Start with sqrt (45). You must reduce it to it's prime factors.

45: 9 * 5            9 is not prime so reduce it.

45: 3 * 3 * 5  

When you write √45, you should replace it with √(3*3*5)

The rule is

Rule: when you have a pair of equal prime factors under a root sign, you can take one out and throw one away.

Rule 2: If there are an odd number of equal primes one of them will be left underneath the root sign.

√45 = 3√5

11sqrt(45) - 4 sqrt(5)              Substitute for 45

11*3*sqrt(5) - 4sqrt(5)            Take out sqrt(5) using the distributive property.

(11*3 - 4)*sqrt(5)                      Combine 11 * 3  

(33- 4) * sqrt(5)                       Do the subtraction

29 * sqrt(5)                             Answer

The correct answer is 29[tex]\sqrt{5}[/tex]

The third option.

how many eighths of an inch are in 1/4​

Answers

Answer:

One eighth is one part of eight equal sections. Two eighths is one quarter and four eighths is a half. It's easy to split an object, like a cake, into eighths if you make them into quarters and then divide each quarter in half.

Final answer:

There are two eighths of an inch in a quarter of an inch.

Explanation:

The student is asking how many eighths of an inch are in 1/4 of an inch. To get the answer, you have to ask "how many 1/8's fit into 1/4". Since 1/4 is the same as 2/8, there are two eighths in one quarter.The student is asking how many eighths of an inch are in 1/4 of an inch. To get the answer, you have to ask "how many 1/8's fit into 1/4". Since 1/4 is the same as 2/8, there are two eighths in one quarter.The student is asking how many eighths of an inch are in 1/4 of an inch. To get the answer, you have to ask "how many 1/8's fit into 1/4". Since 1/4 is the same as 2/8, there are two eighths in one quarter.

Learn more about Fraction conversion here:

https://brainly.com/question/30775075

#SPJ2

Jamal performed an experiment flipping a coin. He did 10 trials and then his arm got tired. He recorded his results in the table. Based on the experimental probability, Jamal predicted that the number of times the coin lands heads up will always be greater than the number of times it lands tails up. What is the error in his prediction? He should have performed fewer trials before comparing them to the theoretical probability. He did not need to perform the experiment to compare theoretical and experimental probabilities. He should have subtracted the theoretical probability from the experimental probability. He did not perform enough trials to compare the theoretical and experimental probabilities.

Answers

Answer: ((( D )))He did not perform enough trials to compare the theoretical and experimental probabilities.

Step-by-step explanation:

Answer:

d on edu 2020

Step-by-step explanation:

mary lou is twice geoge's and kate is two years younger than george the sum of all of their ages is 46 how old is everyone​

Answers

Answer:

George is 12, Mary Lou is 24 and Kate is 10.

Step-by-step explanation:

To find these, start by setting George's age as x. This means that we can model Mary Lou's age as 2x, since she is twice as old. We can also model Kate's age as x - 2 since she is two years younger. Now we can add these 3 together and set equal to 46

x + 2x + x - 2 = 46

4x - 2 = 46

4x = 48

x = 12

This means that George is 12.

Mary Lou = 2x

Mary Lou = 2(12)

Mary Lou = 24

Kate = x - 2

Kate = 12 - 2

Kate = 10

Answer:

G 12 Mary L 24 and kate is 10

Step-by-step explanation:

Other Questions
How to solver this problem .Evaluate the series 1 + 0.1 + 0.01 + . . . How are microtubules thought to affect cell shape in plants? Microtubules of the plant cell cortex are thought to affect the movement of cellulose-synthesizing enzymes in the cell membrane, which, in turn, affect cell wall growth and shape. Microtubules of the plant cell vacuole are thought to affect the movement of cellulose-synthesizing enzymes in the cell membrane, which, in turn, affect cell wall growth and shape. Microtubules of the plant cell cortex are thought to affect the movement of lipid-synthesizing enzymes in the cell membrane, which, in turn, affect cell wall growth and shape. Microtubules of the plant cell wall are thought to affect the movement of cellulose-synthesizing enzymes in the cell membrane, which, in turn, affect cell wall growth and shape. 5. Microtubules of the plant cell nucleus are thought to affect the movement of cellulose-synthesizing enzymes in the cell membrane, which, in turn, affect cell wall growth and shape. List these solids in order from the one with least volume to the one with the greatest volume. A. A cube with edge 5 cm B. A cylinder with radius 4 cm and height 4 cm C. A square pyramid with base edges 6 cm and height 6 cm D. A cone with radius 4 cm and height 9 cm E. A rectangular prism with a 5 cm-by-5 cm base and height 6 cm A laptop was originally sold for $975. The laptop is now on sale for $828.75. What is the percent markdown. Which sound is part of the english sound system but not apart of the spanish sound system Based on the second law of thermodynamics why must a machine always be less than 100% efficient?A.Heat never moves from cold to hot.B.Heat is never converted completely into mechanical energy.C.Heat never flows from hot to cold.D.Entropy never increases. The Supreme Court chooses to hear cases that __________. A. affect only small groups of people B. are important to the president, since he/she appoints the justices to the court C. most often deal with international legal questions D. involve the Constitution Please select the best answer from the choices provided Someone knows the answer for this ? Which represents an exterior angle of triangle ABF?BADAFECADCAB Cecily is a suitable wife for her nephew Algernon? can someone pls help ASAP based on the context what is the meaning of sleights A rectangular prism has a length of 3 1/2 inches, a width of 5 inches, and a height of 1 1/2 inches. What is the volume of the prism? Answer ASAP What is the central idea of the letter to the editor?The citys center should be a mixed-use development.The center of the city is the most popular area.Urban sprawl has significant benefits for the city.Mixed-use developments are preferable to urban sprawl. a beach ball has a diameter of 2 feet. which of the following is closest to the volume of the beach ball. a.4.2ft b. 12.6ft c. 16.8ft d. 33.5ft I need help I do not understand. Original sentences: Within minutes, they had their equipment packed. They were off! Combined sentence: Within minutes, they had their equipment packed and were off! Does the combined sentence use a compound subject, compound verb, or compound object? compound verb compound object compound subject which of the following particles is the fundamental unit of all matter, both living and nonliving ?a)neuronb)electronc)atomd)cell Imagine you are working for the US government in 1946. What measure would you propose to help curb the development of atomic weapons? How about modern day Iran or Korea?