Which two blue rectangles have the same total area as the red rectangle

Which Two Blue Rectangles Have The Same Total Area As The Red Rectangle

Answers

Answer 1

D is the correct answer

Answer 2

Answer: D

Hope this Helps!


Related Questions

Rewrite the equation below so that is does not have fractions

Answers

Hey there!

The first thing we should do is to make the fractions have a common denominator.

The least common multiple of 4 and 6 is 12, which we can find by taking the multiples of both and finding the smallest one they have in common.

What we should do it multiply both sides of the equation by 12, which eliminates both fractions.

We now have:

9x - 60 = 10

Hope this helps!

The results of the equation without fraction is 118x = 175

Given the equation

[tex]\frac{3}{5} x - 5 = \frac{5}{6}\\[/tex]

Step 1: Add 5 to both sides of the equation:

[tex]\frac{3}{5} x - 5 +5= \frac{5}{6} + 5\\\frac{3}{5} x= \frac{5}{6} + 5\\[/tex]

Multiply through by 30:

[tex]\frac{3}{5} x \times 30= (\frac{5}{6} \times 30 )+( 5 \times 30)\\(3x \times 6) = (5\times 5) + 150\\18x = 25 + 150\\18x = 175[/tex]

Hence the result of the equation without fraction is 118x = 175

Learn more here: https://brainly.com/question/17788156

Jack mows the lawns to earn money. he charges a flat fee of $20 for showing up plus $15 for each hour it takes him to mow the lawn. Write an equation that models this situation for the money Jack makes Y in terms of the hours he works X

Answers

Answer:

y = 15x + 20

Step-by-step explanation:

He charges a flat rate of $20, so any total for hours worked will have an additional $20 added to it.  

The 15x represents his earnings per hour.  He makes 15 per every hour worked, x represents the number of hours worked

what is the probability of spinning b

Answers

Answer:

45%

Step-by-step explanation:

It is 45% because is 1/4 of the circle

Answer:

37.5%

Step-by-step explanation:

The probability is 3/8, which is 37.5%.

HELP QUICKLY

The graph shows the total number of hours Katrina worked over a 10-day period.

Answers

Answer:

Option C From day 7 to day 8

Step-by-step explanation:

The given graph shows the total number of hours Katrina worked over the period of 10 days.

Now we will calculate the number of hours worked by Katrina for every given options in the question.

Option A - From day 1 to day 2

Katrina worked (6 - 3) = 3 hours

Option B - From day 4 to day 5

Katrina worked (12-12) = 0 hours between the period of 4 to 5 days

Option C - From day 7 to day 8

Katrina worked (18-12) = 6 hours

Option D - From day 9 to day 10

Katrina worked ( 18 - 18) = 0 hours so she took the rest.

According to this, options C represents the work done for maximum hours in one day interval.

You and another person are sunbathing on the beach near a lifeguard station. The other person chooses a spot that is the same distance from the shoreline but 11 feet closer to the station than you. The angles of elevation from you and the other person to the top of the lifeguard station are 36 degrees and 46 degrees, respectively. Estimate the height of the lifeguard station to the nearest tenth of a foot.

Answers

Answer: 26.8 feet

Step-by-step explanation:

In the figure attached you can see two right triangles  triangle ABD and a triangle ACD.

You are located at point B and the other person at point C.

The approximate height of the lifeguard station is x.

Keep on mind that:

[tex]tan\alpha=\frac{opposite}{adjacent}[/tex]

Therefore:

For the triangle ABD:

[tex]tan(36\°)=\frac{x}{DC+11}[/tex]    [EQUATION 1]

For the triangle ACD:

[tex]tan(46\°)=\frac{x}{DC}[/tex]    [EQUATION 2]

Solve from DC from [EQUATION 2]:

[tex]DC=\frac{x}{tan(46\°)}[/tex]

Substitute into [EQUATION 1] and solve for x:

[tex]tan(36\°)=\frac{x}{(\frac{x}{tan(46\°)}+11)}\\tan(36\°)(\frac{x}{tan(46\°)}+11)=x\\11*tan(36\°)=x-\frac{xtan(36\°)}{tan(46\°)}\\7.991=0.298x[/tex]

[tex]x=26.81ft[/tex]≈26.8ft

Watts per square meter

Answers

1 kilowatt hour= 1KWH=1000 Watts
Average over the entire earth = 164 watts per square meter over a 24 hr day

18x__=504 plz help quickly

Answers

Answer:

28 times

Step-by-step explanation:

18 x 28 = 504

Find the perimeter of the larger flag.

Answers

Again, scale factor is 12 / 4 = 3.

So Perimeter = 16 * 3 = 48.

Final answer:

The perimeter of the larger flag, which is a square with each side measuring 8 inches, is 32 inches. This is calculated by multiplying the side length by 4, as a square has four sides.

Explanation:Finding the Perimeter of a Larger Square

To find the perimeter of the larger flag, which resembles a larger square, you need to know the length of one of its sides. Since the problem states that the dimensions are twice that of a smaller square, first, determine the side length of the smaller square. If the side length of the larger square is 8 inches, obtained by scaling up the smaller square's side length by a factor of 2 (4 inches x 2 = 8 inches), you can find the perimeter by multiplying the side length of the larger square by 4 (since a square has four sides).

The calculation for the perimeter of the larger square is as follows: 8 inches x 4 = 32 inches. Therefore, the perimeter of the larger flag is 32 inches.

One tossed coin landing heads and the next landing tails

Answers

Answer:

1/4 or 0.25

Step-by-step explanation:

*I'm assuming you're asking about the probability of this happening...

There are 4 different results you can get when flipping a coin twice...

First Flip: heads

Second Flip: tails

First Flip: heads

Second Flip: heads

First Flip: tails

Second Flip: heads

First Flip: tails

Second Flip: tails

only one of these is heads, then tails, so our probability is

1/4, or 0.25

Angie is x years old. Her sister is 12 years older than her while their mother is twice as old as her sister. Betty is 3 years younger than angie while Betty's mother is 4 times as old as Betty. Express Angie's mother's age in terms of x. express Betty's mother's age in terms of x. if Angie's mother is 6 years older than Betty's mother, find Angie's age​

Answers

Step-by-step explanation:

Parking lot:

Angie=x

Sister=x+12

Amom=2•(sister) or 2(x+12)=2x+24

Betty=x-3

Bmom=4•(betty) or 4(x-3)=4x-12

--------

Part A: Amom=2x+24

Part B: Bmom=4x-12

PartC:

x=angie

Amom=Bmom+6

2x+24=4x-12+6

2x+24=4x-6

24-6=4x-2x

18=2x

9=x

Angie is 9 years old.

estimate the measure of <1

Answers

I think the answer is most likely 80

Determine the measures of the angles. 25 points!
A 35
B 70
C 75
D 100
E 105
F 110

Match the tiles to the numbers in the image.

Answers

Answer:

1: f; 110

2: b; 70

3: e; 105

4: c; 75

5: a; 35

Step-by-step explanation:

Start with one that is easy to find, like 5, 4, or 3.

5. We know that 5 is on a 180 degree line with the angle of 145. Subtract 145 from 180 to find 5. This angle is 35.

4. We also know that 4 is a vertical angle to 75, which means 4 will also be 75.

3. Solve like you did for 5. 180 - 75 = 105.

2. First, find another angle inside the triangle shape. Look at the angle for 5 for this one. We know it is 35. That means the vertical angle inside is also 35. Subtract both interior angles to find 2. 180 - 75 - 35 = 70.

1. Finally, take the angle you got for 2, 70, and subtract it from the straight line, 180. 180 - 70 = 110.

Answer:

1: f; 110

2: b; 70

3: e; 105

4: c; 75

5: a; 35

Step-by-step explanation:

Which of the following represents the value of the nearest side? Round to the nearest tenth.

Answers

I think it’s b I’m currently learning the same thing in my class

Answer:

The answer is A. 2.0

Step-by-step explanation:

One of the angles is a right angle, because x is the tangent of that circle. The other radius is 1.5, since all radius are equal to each other. Then you use the Pythagorean theorem (a²+b²=c²). C is always the hypotenuse. The hypotenuse in this triangle is the 1.5 + 1 line. A and b can be changed within each other. I put A = 1.5, B = x, and C = 2.5. My equation was 1.5²+x²=2.5². Remember the formula can also be x²+1.5²=2.5² as well. Then you solve the equation you just made. You multiply everything by each other, because of the ² (I forgot the name of it, hehehe). You will get 2.25+x²=6.25. Then you subtract 2.25 to both side. x²= 4. Then you square root both sides to make x by itself. x=2. That's how you get 2 as your answer

Show steps: Find the volume of a rectangular prism with a length of x + 9, a width of x – 7, and a height of x – 1. What is its volume expressed as a polynomial?

Answers

Answer:

Please see attached picture

Step-by-step explanation:

A rectangular prism has its volume defined as

V_rect_prism = length * height * width

V_rect_prism = (x+9) * (x-1) * (x-7)

The volume expressed as a polynomial can be seen in the picture below.

A red die is tossed and then a green die is tossed. What is the probability that the red die shows an even number or the green die shows an even number? Make sure your answer is reduced

Answers

Final answer:

To find the probability that the red die shows an even number or the green die shows an even number, we can use the concept of probability of a union of two events. The probability is 3/4.

Explanation:

To find the probability that the red die shows an even number or the green die shows an even number, we can use the concept of probability of a union of two events. Let's denote the event that the red die shows an even number as E and the event that the green die shows an even number as F.

Since each die has 6 equally likely outcomes, the probability of rolling an even number on the red die is P(E) = 3/6 = 1/2, and the probability of rolling an even number on the green die is P(F) = 3/6 = 1/2.

To find the probability of the union of two events (E or F), we add the probabilities of E and F and subtract the probability of their intersection (E and F) to avoid double-counting. In this case, the intersection is the event that both dice roll an even number, which has a probability of P(E and F) = (1/2) × (1/2) = 1/4.

Therefore, the probability that the red die shows an even number or the green die shows an even number is P(E or F) = P(E) + P(F) - P(E and F) = 1/2 + 1/2 - 1/4 = 3/4.


Use the model to write the equation that represents the problem.

I have one-half of a square and I want to divide it by one-eighth. How many pieces would I have?
A) 1
2
÷ 1
8
= 4
B) 1
2
÷ 1
8
= 1
4

C) 1
8
÷ 1
4
= 2
D) 1
8
÷ 1
4
= 1
2
(look at the photo)

Answers

It’s 4! Those seem wrong lol

Answer: is A 4

Step-by-step explanation:

Which of the following data represents an actual probability?

A computer randomly generates 6 out of 100 numbers.

An observer notes the number of pepperoni, cheese, vegetarian pizzas are ordered out of 100 orders.

A card shuffling machine picks cards from a standard deck.

None of the above

Answers

A card shuffling machine picks cards from a standard deck.

A pair of linear equations is shown below:

y = −2x + 3
y = −4x − 1

Which of the following statements best explains the steps to solve the pair of equations graphically?

A. Graph the first equation, which has slope = 3 and y-intercept = −2, graph the second equation, which has slope = −1 and y-intercept = −4, and find the point of intersection of the two lines.
B. Graph the first equation, which has slope = −3 and y-intercept = 2, graph the second equation, which has slope = 1 and y-intercept = 4, and find the point of intersection of the two lines.
C. Graph the first equation, which has slope = −2 and y-intercept = 3, graph the second equation, which has slope = −4 and y-intercept = −1, and find the point of intersection of the two lines.
D. Graph the first equation, which has slope = 2 and y-intercept = −3, graph the second equation, which has slope = 4 and y-intercept = 1, and find the point of intersection of the two lines.

Answers

Answer:

C. Graph the first equation, which has slope = −2 and y-intercept = 3, graph the second equation, which has slope = −4 and y-intercept = −1, and find the point of intersection of the two lines.

Step-by-step explanation:

The two equations are in slope intercept form which is y = mx + b where m is the slope and b is the y-intercept.

In the first equation (y = -2x + 3), -2 is the slope since it is the coefficient. "b" is 3 since it is the constant of the equation.

In the second equation (y = -4x -1), -4 is the slope is the coefficient, and the y-intercept is -1 since it is the constant.

To solve the equations graphically, graph them and find the point where they intersect.

The required explanation that is best for the solution of the given equation is given by option c. Option C is correct.

What is simplification?

The process in mathematics to operate and interpret the function to make the function or expression simple or more understandable is called simplifying and the process is called simplification.

Here,
Given a system of equations,
y = −2x + 3                 (1)
y = −4x − 1                   (2)

The slope of equation 1
m = -2 and y-intercept  = 3
The slope of equation 2
m = -4 and the y-intercept = -1
So, From option that matched the calculation is

Graph the first equation, which has slope = −2 and y-intercept = 3, graph the second equation, which has slope = −4 and y-intercept = −1, and find the point of intersection of the two lines.

Thus, the required explanation that is best for the solution of the given equation is given by option c. Option C is correct.

Learn more about simplification here:

https://brainly.com/question/12501526

#SPJ3


The population of a city in 2005 was 18,000. By 2010 the city's population had grown to 45,000. Economists have determined that the population growth follows an exponential model. If they are correct, what is the projected population for 2015?​

Answers

Step-by-step explanation:

First we have to find percent change by doing change/original

To find change: 45000-18000=27000

Now divide by original. 27000/18000=1.5

The change was 150 percent. Now we multiply 45000 by 150 percent to get the projected population for 2015.

45000*1.5=67500 people

Brainliest? :)

Projected population for 2015 using exponential growth model is 112,500, calculated with initial population of 18,000 and growth rate.

To determine the projected population for 2015 using an exponential growth model, we need to identify the growth rate and use it to extrapolate the population.

The exponential growth model can be represented as:

[tex]\[ P(t) = P_0 \times e^{rt} \][/tex]

Where:

- [tex]\( P(t) \)[/tex] is the population at time [tex]\( t \)[/tex]

- [tex]\( P_0 \)[/tex] is the initial population (in 2005)

- [tex]\( r \)[/tex] is the growth rate

- [tex]\( t \)[/tex] is the time in years since the initial population was measured

First, we need to find the growth rate [tex](\( r \))[/tex]. We can use the data provided from 2005 to 2010:

[tex]\[ P_0 = 18000 \][/tex]

[tex]\[ P(5) = 45000 \][/tex]

Using these values in the formula:

[tex]\[ 45000 = 18000 \times e^{5r} \][/tex]

Now, let's solve for [tex]\( r \)[/tex]:

[tex]\[ \frac{45000}{18000} = e^{5r} \][/tex]

[tex]\[ 2.5 = e^{5r} \][/tex]

Taking the natural logarithm of both sides:

[tex]\[ \ln(2.5) = 5r \][/tex]

Now, divide by 5:

[tex]\[ r = \frac{\ln(2.5)}{5} \][/tex]

Now, we have the growth rate [tex]\( r \)[/tex]. We can use this rate to project the population for 2015 [tex](\( t = 10 \) years)[/tex]:

[tex]\[ P(10) = 18000 \times e^{\frac{\ln(2.5)}{5} \times 10} \][/tex]

Now, calculate this:

[tex]\[ P(10) = 18000 \times e^{\ln(2.5) \times 2} \][/tex]

[tex]\[ P(10) = 18000 \times e^{\ln(2.5^2)} \][/tex]

[tex]\[ P(10) = 18000 \times e^{\ln(6.25)} \][/tex]

[tex]\[ P(10) = 18000 \times 6.25 \][/tex]

[tex]\[ P(10) = 112500 \][/tex]

So, the projected population for 2015 is 112,500.

How many possibly outcomes of flipping a coin four times?

Answers

8 times because you take 4 times 2 and get 8

Answer:  16

Reasoning:

There are 2 outcomes if you flip only one coin (H or T).

There are 2^2 = 2*2 = 4 outcomes if you flip two coins (HH, HT, TH, TT).

There are 2^3 = 2*2*2 = 8 outcomes if you flip three coins.

There are 2^4 = 2*2*2*2 = 16 outcomes if you flip four coins.

The ratio of the areas of two triangles is 5:2. the area of the larger triangle 60 cm² what is the area of the smaller triangle

Answers

Answer:

24 cm²

Step-by-step explanation:

Using proportion to solve

let the area of the smaller triangle be x, then

[tex]\frac{5}{2}[/tex] = [tex]\frac{60}{x}[/tex] ( cross- multiply )

5x = 120 ( divide both sides by 5 )

x = 24

Area of smaller triangle = 24 cm²

Answer:

24 cm²

Step-by-step explanation:

[tex]Let\\A_1,\ A_2-areas\ of\ triangles\ (A_1>A_2)\\\\A_1=60\ cm^2\\\\A_1:A_2=5:2\\\\\text{Substitute:}\\\\\dfrac{60}{A_2}=\dfrac{5}{2}\qquad\text{cross multiply}\\\\5A_2=(60)(2)\\\\5A_2=120\qquad\text{divide both sides by 5}\\\\A_2=24\ cm^2[/tex]

Graph f(x)=x and g(x) = 1/2x -5. Then describe the transformation from the graph of f(x)=x to the graph of g(x) - 1/2x -5

Answers

Answer:

Vertical Shrink by 1/2 and down 5

Answer:

The transformations are a rotation and a translation.

Solve the following system of equations below x-2y=3 2x-3y=9

Answers


[tex]x - 2y = 3 \\ 2x - 3y = 9 \\ \\ - 2x + 4y = - 12 \\ \: 2x - 3y = 9 \\ \\ y = - 3 \\ 2x + 9 = 9 \\ 2x = 0 \\ x = 0 \\ x = 0 \: \: y = - 3[/tex]

Answer:

(9, 3)

Step-by-step explanation:

I'd strongly suggest that you write these two equations one above the other:

x-2y=3

2x-3y=9

Let's eliminate x by addition / subtraction:  Multiply the first equation by -2 to obtain -2x in the first row over +2x in the second row:

-2x + 4y = -6

2x -  3y =  9

--------------------

           y = 3

Now subst. 3 for y in the first equation:  x - 2y = 3 becomes:

x - 2(3) = 3, or

x = 6 + 3  =  9

The solution is (9, 3).

functions......ugh
.​

Answers

the answer is (-2,-9) because x's cannot repeat

What is the result when you convert 7/8 to a percent?

Answers

Answer:

the answer is 87.5%

Step-by-step explanation:

first, we have to turn 7/8 into a fraction with a denominator of 100. to do that, we can divide 100 by 8 to get 12.5. now, we multiply 7/8 x 12.5 which equals 87.5/100 which is equal to 87.5%

Answer: the answer would be 90%

Step-by-step explanation:

i hate word problems...if i roll a regular 6 faced die 1200 times, about how many times would you expect to get a 4?

Answers

Answer:

200

Step-by-step explanation:

1/6 because the die has 6 sides so if you were to roll it 1200 times you would do 1/6*1200=200 , hope this helps!

*Will mark brainest!!* Write an equation in point slope form
(-9,7) m=4

Answers

Answer:

y-7 = 4(x+9)

Step-by-step explanation:

Point slope form is

y-y1 = m(x-x1)

where m is the slope and (x1,y1) is the point

y-7 = 4(x--9)

y-7 = 4(x+9)

Revenge of the mangled angles

Answers

Answer:

show me the other picture and closer up

Step-by-step explanation:

how do i solve 2k^2-5k-18=0

Answers

Answer:

factor left the side of the equation

(2k_9)(k+2)=0

set factors equal to 0

2k_9=0 or k+2=0

the answer is K= 9/2 or K =-2

2k^2 - 5k - 18 = 0 can be solved by splitting the middle term to get k = -2 and k = -4.5.

How to solve an equation?

An equation can be solved by many methods which include using the quadratic formula, splitting the middle term, etc. When an equation is solved, it means we are finding the value of the variable in the equation.

We can solve the given equation as folows:

Given : 2k^2 - 5k - 18 = 0

2k^2 - 5k - 18 = 0

⇒ 2k^2 +4k - 9k - (9*2) = 0

⇒ 2k( k + 2 ) -9( k + 2 )  = 0

⇒ ( 2k - 9 )( k+2 ) = 0

⇒ k = 4.5, k = -2

Therefore, we have solved 2k^2 - 5k - 18 = 0 to get k = 4.5 and k = -2.

Learn more about solving equations here: https://brainly.com/question/1214333

#SPJ2

i need this done asap pls

my dad said if i get my grades up he will raise my allowance and i rlly want airpods

Answers

Answer:

Step-by-step explanation:

t(1) = 4

t(n) = -4 * t(n - 1)

common ratio: -4

t(1) = -4 * t(0)

4 = -4 * t(0)

t(0) = -1

t(n) = -4n * -1

t(1) = -4 (1) * -1

= 4

t(n) = -4n * -1

t(6) = -4*6 * -1

t(6) = 24

Other Questions
The experimental probability of spinning a number greater than 3 is What does the quote the only way to get through a bigots door is to break it mean susan gets sick often and misses school as a result? which habit should she adopt? Coffee shops that reward customers with one free cup of coffee after every ten coffee purchases are using a ___________ reinforcement schedule. What company was credited with developing the first smartphone? the product of-5 and a number is greater than 35 or less than 10 Please help!!! Will mark brainliest!!! how is health care a problem in today's society 5 50/100 - 2 72/100= What is Hrxn for the following chemical reaction? CS2(g)+2H2O(l)CO2(g)+2H2S(g) You can use the following table of standard heats of formation (Hf) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218 N(g) 473 H2(g) 0 O2(g) 0 H2O(l) 285.8 O(g) 249 CS2(g) 116.7 H2S(g) 20.60kJ C(g) 71 CO2(g) 393.5kJ C(s) 0 HNO3(aq) 206.6 Express the standard enthalpy of reaction to three significant figures and include the appropriate units. View Available Hint(s) Why are publicly traded corporations required to release financial reports on a regular basis?A. because shareholders are entitled to transparencyB. so the government can determine the corporate taxes owedC. so owners know when it is time to hire a new board of directorsD. because it would be impossible to raise financial capital otherwise Find the slope of the line. 5x 2y = 7 which of the following groups is most likely to be dealing with eating disorders teenage girls pregnant women those who abuse alcohol young men in their 20s If you want to lift a 30-kg box to the height of 1 m how much work will it take How is the conflict in Black Cowboy, Wild Horses resolved? The base of a regular pyramid is a hexagon.What is the area of the base of the pyramid?Express your answer in radical form. How is editing for a broadcast different from editing for print journalism? Please and Thank you:) Julio is lifting weights. He wants to have 210 pounds on the bar. How many 15-pound weights should he put on the bar? what is the decimal form of 63/100 How many times smaller is the volume of a triangular prism if the height is divided by 4?