A ball is dropped and falls with an acceleration of 9.8 m/s2 downward. It hits the ground with a velocity of 49 m/s downward. How long did it take the ball to fall to the ground?

Answers

Answer 1
Hey!

NOTE-:

u= initial velocity
v= final velocity
g= acceleration due to gravity
t= time

u= 0
v= 49 m/s
t=?
g= 9.8 m/s^2

Using first equation of motion -

v-u=at
49-0= 9.8×t
49 = 9.8t
49/9.8= t
t= 5 second


Hope it helps...!!!

Related Questions

What causes changes in weather?

Answers

Climate change caused by human activities that emit greenhouse gases into the air is expected to affect the frequency of extreme weather events such as drought, extreme temperatures, flooding, high winds, and severe storms.
Air masses move and meet.

Convert the temperature 288 K to degrees Celsius

Answers

Final answer:

To convert 288 K to degrees Celsius, subtract 273.15 from the Kelvin temperature. Using this method, 288 K is equivalent to 14.85°C.

Explanation:

The question requires converting the temperature from Kelvin to degrees Celsius. To convert temperature from Kelvin (K) to degrees Celsius (°C), you subtract 273.15 from the Kelvin temperature. The formula used is T°C = K - 273.15.

Given the temperature is 288 K, using the formula we get:

T°C = 288 K - 273.15 = 14.85°C

Therefore, the temperature of 288 Kelvin converts to 14.85°C in degrees Celsius.


what makes plants the beginning of the food chain?

A) Only plants use solar energy in a chemical process to produce food.
B) Plants make food for other organisms.
C) Plants can store chemical energy as glucose.
D) All organisms eat plants.

I think it might be C.

Answers

the answer to your question is A





Answer:

A) Only plants use solar energy in a chemical process to produce food.  

Explanation:

The primary source of energy on Earth is Sun. Green plants are at the beginning of food chain because only green plants can convert solar energy to a form which can be consumed by animals. Plants make food in process known as photosynthesis where in sunlight is used to convert carbon-dioxide and water to form glucose and oxygen. This glucose is eaten by animals from which they get energy to do work. Smaller animals are eaten by bigger continuing the food chain ahead.

What would we need to know to calculate both work and power?

a. energy, force, and time
b. force, distance, and time
c. force, mass, and distance
d. mass, force, and energy

Answers

b. force, distance, time

The equation for Work = Force * Distance

The equation for Power = Work / Time = Force * Distance / Time

Force , Time,and Distance

Which choice correctly lists the attributes a celestial body must posses in order to be labeled a planet?

Question 4 options:

1. Must have a moon

2. Must be large enough that its gravity forced it into a spherical shape,

3. Must be large enough that its gravity cleared away similar sized objects in its orbit around the star.




1. Must have a star orbiting around it.

2. Must be large enough that its gravity forced it into a spherical shape,

3. Must be large enough that its gravity cleared away similar sized objects in its orbit around the star.


1. Must orbit a star

2. Must be large enough that its gravity forced it into a spherical shape,

3. Must be able to plow through any objects in its orbit


1. Must orbit a star

2. Must be large enough that its gravity forced it into a spherical shape,

3. Must be large enough that its gravity cleared away similar sized objects in its orbit around the star.

Answers

I would think answer 2 would be the one to go with. 

The correct option is (4).

The International Astronomical Union (IAU) in 2006 decided that in order for a celestial object to be classified as a planet, it should possess the following attributes:

1. The celestial object should be a non luminous body, which should orbit a star.

2. The object's gravitational forces should be large enough such that the object assumes a spherical shape.

3. The object should be larger than asteroids or meteors.

4. Its gravitational force should be strong enough so that it clears away all the objects in its orbit, by either assimilating them into itself or shattering it. The object does not share its orbit with any other object.

The option that satisfies all these parameters is option 4.

A student is given a red and a blue liquid. The two samples of liquids are heated in identical beakers over identical Bunsen burners. The red liquid shows a dramatically faster increase in temperature. Which of these is the most likely explanation for this?
A) The red liquid has a greater mass.
B) The blue liquid has a smaller mass.
C) The red liquid has a greater specific heat.
D) The red liquid has a smaller specific heat.

Answers

I think the answer is a
the answer is most likely D

Bowling United States know that water boils at 212°F in Europe people know that the water boils at 100°C is the water in the US different than the water in Europe what explains the two different temperatures

Answers

Degrees feringhit is temp. we use in America while celcius is everywhere else.

What do biologist geologist have in common how are they different

Answers

The prefix for Bio is life so a biologist studies life of living organisms
The prefix for Geo is earth so it would be the study of earth.
What is in common would be animals and plants
what is different is an Geologist studies only earth Biologist studies everything living. I hope this was helpful and I didn't confuse you.

a car drives 215 km east and then 45 km north. what is the magnitude of the car's displacment

Answers

Final answer:

The magnitude of the car's displacement is approximately 220.7 km.

Explanation:

To find the displacement of a car, we can use the Pythagorean theorem. The car drives 215 km east and 45 km north. We can treat the east direction as the x-axis and the north direction as the y-axis. The displacement is the vector sum of the east and north components.

The east component of the displacement is 215 km and the north component is 45 km. Using the Pythagorean theorem, we can find the magnitude of the displacement:

|displacement| = sqrt((215 km)^2 + (45 km)^2) = sqrt(46625 km^2 + 2025 km^2) = sqrt(48650 km^2) ≈ 220.7 km

Therefore, the magnitude of the car's displacement is approximately 220.7 km.

Answer:

220

Explanation:

Which piece of evidence did Alfred winger used to develop the theory of continental drift

Answers

Fossils, They would find fossils in one are and in another area across the world, Or at-least that is what I learned.
Alfred Wegener developed the theory of continental drift by using several lines of evidence. One line of evidence is the fit of the continents. He noticed that specific regions such as western Africa and north-eastern South America seem as if they once fit together. 
Wegener noticed that the fossils of some plants and animals were very similar even though they were founds hundreds of miles away from each other. He also noted that the rocks in regions far apart were similar in their characteristics. 

a 2-kg object is dropped from a height of 1000 m. What is the force of air resistance on the object when it reaches terminal velocity

Answers

It stops accelerating when the air resistance is equal to its weight.
That's (m•g)

= (2 kg) • (9.8 m/s^2)

= 19.6 newtons

explain how sound travels through the air to observer

Answers

Sample:
As soon as the lightning is seen, sound travels in the air for several kilometers until it eventually reaches the observer.
Final answer:

Sound travels through the air to an observer in the form of sound waves. These waves are created by a vibrating source and propagate through the air by causing the air molecules to vibrate. When the sound waves reach the observer's ear, they cause the eardrum to vibrate and are then converted into electrical signals that the brain interprets as sound.

Explanation:

When sound travels through the air to an observer, it does so in the form of sound waves. These waves are created by a vibrating source, such as a musical instrument or a person's vocal cords. When the source vibrates, it creates a disturbance in the air molecules, causing them to move back and forth in a pattern. This pattern of motion is then carried through the air as sound waves.

As the sound waves travel through the air, they cause the air molecules in their path to vibrate. These vibrations are then passed on to neighboring molecules, creating a chain reaction that allows the sound to propagate through the air.

When the sound waves reach the observer's ear, they cause the eardrum to vibrate. These vibrations are then transmitted to the inner ear, where they are converted into electrical signals that can be interpreted by the brain as sound.

When would light travel the fastest?

A.in a swimming pool

B.through a railroad track

C.across a room

D.through outer space

Answers

Hello,

Here is your answer:

The proper answer to this question is option B "through a railroad track".

Here is how:

When light is shot through a railroad track it moves its fastest.

Your answer is B.

If you need anymore help feel free to ask me!

Hope this helps!
Option B. is correct
There are no objects or substances to refract or reflect the light.

Thank you for using Brainly!

What is the effect:

Cause: A stationary front forms

Effect: ________________________________________.

Answers

Warm Front brings gentle rain, or light snow

Final answer:

A stationary front leads to prolonged weather conditions, primarily characterized by mild but continuous precipitation and consistent cloud cover, due to the stalemate between two contrasting air masses. These conditions can persist for several days, potentially resulting in flooding or affecting local climate and activities.

Explanation:

When a stationary front forms, the effect is typically prolonged weather patterns in the affected area due to the stalemate between two contrasting air masses. Neither air mass is able to dominate the other, leading to an extended period of clouds and mild but prolonged precipitation. This can result in several days of consistent weather, with potential impacts on local climate, agriculture, and daily activities. Stationary fronts are characterized by their lack of movement, meaning that the weather conditions they bring (like precipitation or cloud cover) can persist over an area much longer than with moving fronts.

Unlike cold fronts, which can bring rapid and significant changes in weather, including a drop in temperature and possible severe weather, stationary fronts lead to more steady weather conditions. However, the extended period of precipitation associated with stationary fronts can contribute to flooding and other water-related issues, depending on the region and other environmental factors.

What is the relative size and composition of the universe, a galaxy, and a solar system? Is the universe endless?

Answers

Answer:

The end of the solar system is about 122 astronomical units (AU) away from the sun, where one AU is 93 million miles (150 million kilometers).

Most of the galaxies are 1,000 to 100,000 parsecs in diameter

The size of the universe is unknown

Final answer:

The universe is the largest scale, consisting of all the galaxies. A galaxy is a system of stars, planets, gas, and dust. A solar system is a smaller part of a galaxy, consisting of a star and orbiting objects.

Explanation:

The universe, a galaxy, and a solar system differ in their relative size and composition. The universe is the largest scale, and it consists of all the galaxies and other celestial bodies. A galaxy is a vast system of stars, planets, gas, and dust held together by gravity. A solar system is a smaller part of a galaxy, consisting of a star (such as the Sun), planets, moons, and other objects that orbit the star.

The universe is believed to be endless, but it is expanding. The galaxies are distributed throughout the universe and are separated by large distances. So, while the galaxies and the solar systems within them have definite boundaries, the entire universe is continuously expanding and may not have a finite edge.

Most of the asteroids in the solar system circle the Sun in a large ring, which is located immediately between the orbits of and

Answers

Most of the asteroids spend most of their time in the belt between the orbits of Mars and Jupiter.

The rocky, airless worlds known as asteroids orbit our solar but are too tiny to be referred to as planets. The main asteroid belt, a large doughnut-shaped ring between the orbits of Mars and Jupiter, is home to tens of thousands of these minor planets. Near-Earth Objects are asteroids that pass by Earth quite closely.

What are asteroids ?

One of the smaller planets in the inner Solar System is an asteroid. Asteroids are stony, metallic, or ice worlds without an atmosphere, with sizes and forms ranging from 1-meter pebbles to a dwarf planet with a diameter of over 1000 km.

The bulk of asteroids that are now known orbit in the asteroid belt between Mars and Jupiter, often with orbits that are not overly elongated. Millions of smaller asteroids as well as between 1.1 and 1.9 million asteroids larger than 1 kilometer (0.6 miles) in diameter are thought to be present in the belt.

Rock fragments from the solar system's early history are dispersed in orbits around the sun. The majority of these things are planetoids or asteroids.

Thus, The rocky, airless worlds known as asteroids orbit our solar but are too tiny to be referred to as planets.

To learn more about asteroids, follow the link;

https://brainly.com/question/19161842

#SPJ6

What is the temperature of 45 degrees fahrenheit in degrees celsius?
A. about 7 degrees celsius
B. about 45 degrees celsius
C. about 113 degrees celsius
D. about -7 degrees celsius

Answers

D or A but most likely D. Hope i could help and please tell me if i'm wrong :)

 

To remove a tight-fitting lid from a jar, Megan runs the lid under hot water. What happens to the jar lid when it's temperature increases?

A- The temperature increases, and the lid expands

B- The temperature decreases, and the lid contracts

C- The potential energy decreases, and the lid expands

D- The potential energy increases, and the lid contacts

Answers

The answer is A - The temperature increases,and the lid expands.
Answer:

To remove a tight-fitting lid from a jar, Megan runs the lid under hot water because the temperature increases, and the lid expands

Explanation:

Metals have the tendency to become soft when energy is applied to them. Since heat is also a form of energy therefore when heat is applied to the lid it expands because it is also made up of metal or even plastic which also melts on heating. Heating allows the lid to produce a lose space and hence it become soft.

a train is moving on a flat, continuous track. label all forces acting upon the object

Answers

Final answer:

The primary forces acting on a moving train are its weight, normal force from the track, friction, air resistance, and the applied force from the engine. If the train moves at a constant velocity, the forces balance out; otherwise, the applied force from the engine causes acceleration or deceleration.

Explanation:

Forces Acting on a Moving Train

When a train is moving on a flat, continuous track, several forces are acting upon it. Firstly, there's the weight of the train, which is the force due to gravity acting vertically downward. In response to this, there is a normal force exerted by the track, which acts vertically upward and is equal in magnitude and opposite in direction to the weight if the train is not accelerating vertically. Additionally, if the train is moving, there's the force of friction acting at the wheels and the track interface, which resists the motion of the train. The engine of the train exerts a forward thrust or traction force which propels the train forward. If the train is accelerating, this traction force is greater than the frictional forces opposing it. Conversely, if the train is moving at a constant velocity, these forces balance out due to Newton's first law of motion. There may also be air resistance, a form of drag that opposes the train's motion through the air. Additionally, if the train starts or stops, there is an applied force from the engine driving the train's acceleration or deceleration.

Newton's first law of inertia indicates that an object will continue to move at a constant velocity unless acted upon by an external force. In the context of the train, these external forces that can affect the motion include the aforementioned friction, air resistance, and applied forces from the train's engine.

Final answer:

Forces acting on a moving train include gravity, the normal force from the track, frictional forces at the wheel axles and the wheels' contact point with the track, the applied force from the train's engines if accelerating, and possibly air resistance.

Explanation:

When a train is moving on a flat, continuous track, several forces act upon it. According to Newton's first law, an object will remain at rest or move at a constant speed in a straight line unless acted upon by an external force. For a train in motion, these forces include:

Gravity, which acts downwards and is equal to the weight of the train (W).The normal force (N) from the track, acting vertically upwards, which balances the gravitational force in the absence of vertical acceleration.Frictional forces, which can act at the wheel axles and the point where the wheels make contact with the track, resisting the train's motion.If the train is accelerating, there will be an applied force (Fapp) from the train's engines.There could also be air resistance, a form of friction, acting against the direction of motion.

It is important to note that every force acting on the train comes from an interaction with another object; no object can exert a force on itself. The train exerts a force on the track, and in return, the track exerts a force on the train.

the___________motion is considered the simplest form of oscillatory motion

Answers

The answer is either harmonic motion or simple harmonic motion.

A baseball team is practicing throwing balls vertically upward to test their throwing arms. A player manages to throw a ball that reaches a maximum altitude of 10 m above the launch point, before falling back down. The acceleration due to gravity is 9.80 m/s 2 . (a) With what initial speed was the ball thrown?

Answers

We can solve this problem using the law of conservation of energy.
This law states that energy in a closed system must stay same.
That means that the energy of a ball leaving the hand and the energy of a ball when it reaches its maximum height must be the same.
The energy of a ball leaving the players hand is kinetic energy:
[tex]E_k=\frac{mv^2}{2}[/tex]
The energy when the ball reaches its maximum height ( and has zero velocity) is potential energy in a gravitational field:
[tex]E_p=mgh[/tex]
As said before these energies must be the same, and that allows us to find the initial speed:
[tex]E_k=E_p\\ \frac{mv^2}{2}=mgh\\ v^2=2gh\\ v=\sqrt{2gh}[/tex]
When we plug in all the number we get that [tex]v=14\frac{m}{s}[/tex]

At the beach, differences in temperatures create wind which transfers heat between the land and the water. The same process is also seen in the ocean as the gulf stream carries heat from the tropics northward. Heat transfer through any intermediate fluid is known as A)condensation. B)conduction. C)convection. D)radiation.


Answers

Your answer is : C. Convection.

Answer: Option (C) is the correct answer.

Explanation:

When a fluid is heated then hot material, that is, less dense will rise at the top whereas cool material, that is, more dense will sink at the bottom. This process helps in exchange of heat within the molecules and it is known as convection.

Therefore, we can conclude that heat transfer through any intermediate fluid is known as convection.

Which of the following is true about genes?
A.
Genes are responsible for all the traits of an organism.

B.
In humans, genes are passed to an offspring from two parents.

C.
The genes of a particular organism can never change throughout its lifetime.

D.
Genes are made up of smaller molecules known as chromosomes.

Answers

I think the answer may be B, but D is also true, because DNA is made of 23 chromosomes
Hey there!

Your answer is option B.

In humans, genes are passed to an offspring from two parents.
The other options are false statements about genes.

Hope this helps you.
Have a great day! (:

Which of the following represents the brightness of a celestial object measured from Earth?

Absolute brightness
Apparent magnitude
Luminosity
Proto-star

Answers

Answer:

Apparent magnitude

Explanation:

Brightness of a star depends upon the distance, size and temperature of the star. The brightness is represented by magnitude. These are the numbers which extend towards both negative and positive axis. more negative means more bright. Apparent magnitude represents the brightness of the star as observed from the Earth. Absolute magnitude represents the brightness of the star at a distance of 10 parsec from Earth.

The term that represents brightness of a celestial object is : ( B ) Apparent magnitude

The brightness of a celestial body depends on certain conditions which are :

Distance Size of celestial body Temperature of celestial body

Apparent Magnitude

The apparent magnitude of a clelestial body is the brightness of the body as measured from the earth's view. the brightness of a celestial body is measured on a scale of numbers ( magnitude ) which runs from positive tot negative values. The brighter the body the more negative the magnitude value

Hence we can conclude that The term that represents brightness of a celestial object is : ( B ) Apparent magnitude

Learn more about apparent magnitude : https://brainly.com/question/2511956

A Savior In Physics Please Help In This Question!!!!!!!!!!!!!!!!

Answers

Hello there!

To find the speed when you have the kinetic energy and the mass, you just start with the kinetic energy formula then solve for speed.

Kinetic energy =  [tex] \frac{1}{2} mv^2[/tex]

V = [tex] \sqrt{ \frac{2*K.E{} }m[/tex]

[tex]V = \sqrt{ \frac{2*1.09*10 ^{-3} }{9.34*10 ^{-2} } } [/tex]

V = [tex] \frac{0.00218}{0.0934} [/tex]

V = 0.02334

Thus, the speed is 0.02 m/s

I hope this helps!


If a star does not emit a significant amount of visible radiation, what could you conclude?

a)It will not be able to be seen

b)it is a black hole

c)It is a very intense star

d)It is not a very intense star

Answers

The answer is a) it will not be seen, or to expound it will be very difficult to be seen. Stars does not give off one type of radiation, light radiation emitted from the stars is just one, however the other types of radiations emitted by the stars are of different wavelength, most of the ranges of these wavelengths does not fall under the visible wavelength as such we cannot see them.

Answer:

definitely A) it will not be able to be seen

Explanation:

When you lift a book from the ground to your desk, what kind of work do you do, negative or positive? By lifting the book, what do you change? Does the book gain or lose energy? What kind of energy?

Answers

Ascencion means gain in potential energy and descing is the opposite, hence when you lift a book, you apply a positive work."
"You lose energy where as book gains energy. Therefore, positive work on book, negative on you."

Your doing positive work and the energy is called potential energy 

pls help asap Create a Punnett square to model asexual reproduction of bacteria with the dominate trait T, recessive trat t. Create another Punnett square to model sexual reproduction of the mother Tt, and father TT. In two to three sentences compare and contrast the genetic results of asexual and sexual reproduction. pls help asap

Answers

Asexual reproduction in bacteria involves one parent, resulting in genetically identical offspring. Sexual reproduction between a Tt mother and TT father produces offspring with genetic variation, either TT or Tt. Comparing both, asexual offspring are clones, whereas sexual offspring have varied genotypes.

In asexual reproduction of bacteria, there is only one parent, so the Punnett square will have only one genotype, which is T for the dominant trait. All offspring will also have the genotype T, as they are clones of the parent. However, for sexual reproduction involving a mother with genotype Tt and a father with genotype TT, the Punnett square will predict different genetic combinations. Here's how the Punnett square will look:

Mother (Tt): T and t allelesFather (TT): T alleles only

When these alleles are combined in a Punnett square for sexual reproduction, the resulting genotypes of the offspring can be TT or Tt. To compare and contrast, the offspring from asexual reproduction will all have identical genetic information (T), while sexual reproduction allows for genetic variation (TT or Tt).

Two different sub-atomic particles are described below: Particle Y: Carries a positive charge Particle Z: Orbits the nucleus Which statement is true? Y is an electron and Z is a proton. Y is a proton and Z is an electron. Y is an electron and Z is a neutron. Y is a proton and Z is a neutron.

Answers

Y is a proton and z is an electron. Protons and neutrons are in the nucleus.
B. Y is a proton & Z in a electronHope this helps, sorry if not tho

A student, standing on a scale in an elevator at rest, sees that his weight is 997 N. As the elevator rises, the scale reads 1226 N and then returns to normal. When the elevator slows to a stop at the top floor, the scale reads 650 N and then returns to normal. Determine the magnitude of the acceleration when the elevator is slowing to a stop. (no negative numbers)

Answers

The total force F on the student is given by:

F = N - mg = ma

N normal force of the scale on to the student(scale readout)
m mass of the student
g acceleration due to gravity
a acceleration of the elevator

997 = mg
650 = m(g - a)

ma = 997 - 650
a = g(997 - 650)/997 
a = 3,4

Other Questions
When methanol, ch3oh, is burned in the presence of oxygen gas, o2, a large amount of heat energy is released. for this reason, it is often used as a fuel in high performance racing cars. the combustion of methanol has the balanced, thermochemical equation ch3oh(g)+32o2(g)co2(g)+2h2o(l)h=764 kj how much methanol, in grams, must be burned to produce 541 kj of heat? Find the range of (x) = 2x 5 for the domain {2, 1, 1, 2}. In Your Brain on Blue what is the author saying impacts your performance in the classroom or on the sports field? A.Colors B.Teachers C.Uniforms D.Work ethicWILL give BRAINLIEST!!!!!!!!!!!!!!!!!!!!!! please HELP me!!!!!!!!!!!!!!!!!!! the cultural revolution primarily controlled information in order to? A.cause social change B.keep the government in power C.encourage literacy levels D.help economic growth What two things did the Soviet Union do that helped bring about the Sino-Soviet split?Russia denied financial aid to China when its Great Leap Forward failed.Russia kept its treaty with India even though India was at war with China.Russia refused to help Red China as it developed a nuclear weapons program.Russia would not help China back the North Vietnamese attempt to unify Vietnam. What is a locally stored url, or the address of a file or internet page saved as a shortcut? On a sheet of paper, create the "Imagery and Sound Devices" chart (as shown and modeled in the Introductory Lecture) and give an example of each term. Read the excerpt from Act III, scene i of Romeo and Juliet. Benvolio: I pray thee, good Mercutio, lets retire: The day is hot, the Capulets abroad, And, if we meet, we shall not scape a brawl; For now, these hot days, is the mad blood stirring. Mercutio: Thou art like one of those fellows that when he enters the confines of a tavern claps me his sword upon the table and says, God send me no need of thee! and by the operation of the second cup draws him on the drawer, when, indeed, there is no need. Benvolio: Am I like such a fellow? Mercutio: Come, come, thou art as hot a Jack in thy mood as any in Italy; and as soon moved to be moody, and as soon moody to be moved. Which detail from the excerpt most foreshadows that Benvolio and Mercutio will fight the Capulets? Benvolios observation that it is hot outside Mercutios comment that Benvolio is moody Benvolios urgent request that they go home Mercutios story about the man in the tavern Find a1 for the arithmetic series with s20 = 80 And d = 2 what it is the original price of a new board game that cost $31.25 after a 15% discount What is the lowest degree that a polynomial can have and explain. Which of the following is the most effective thesis statement? The law of segregation states that allele pairs separate during gamete formation. How then do we have two alleles for a trait? helpppppppppppppppppppppppppppppp what are the similarities and differences of plessy vs. ferguson and brown vs. board of education? 122% in simplest form Was the violence carried out by John brown justified A period of very low inflation would most likely lead to Que son las huellas de acahualinca en Nicaragua? principles of cognitive learning theory most strongly emphasize which of the following