A pendulum has 887 J of potential energy at the highest point of its swing. How much kinetic energy will it have at the bottom of its swing?

Answers

Answer 1
At the bottom of its swing all of the potential energy has been converted to kinetic energy. It will have 887 J of kinetic energy.

Related Questions

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

16. Which of the following are the measures of a right isosceles triangle?

a. 36°, 60°, 90°
b. 40°, 40°, 90°
c. 60°, 60°, 60°
d. 45°, 90°, 45°

17. Of the following triangles, which one is impossible to construct?

a. acute scalene
b. acute equilateral
c. obtuse scalene
d. obtuse equilateral

Answers

16. 
The angles of right isosceles triangle are such that there is the right angle, 90 degrees, and there are two identical angles that add up to 90.

17. 
It is impossible to have an obtuse equilateral because and obtuse triangle has an angle that is more than 90 but less than 190. The equilateral triangle has all the angles equaling the same; 60 degrees. 60 degrees isn't obtuse so it is impossible to have an obtuse equilateral triangle. 

Hope this helps :)

Solve the following inequality. 2x < 8

Answers

2x < 8
2x / 2 < 8/2
  x < 4

hope it helps

The required solution of the given inequality 2x < 8 is x < 4.

What is inequality?

The relation between two expressions that are not equal, employing a sign such as ≠ ‘not equal to’, > ‘greater than’, or < ‘less than’.

Given:

The given  inequality is

2x < 8

According to given question we have

Write inequality

2x < 8

Divide both sides by 2 we get,

x < 4

Therefore, the required solution of the given inequality 2x < 8 is x < 4.

Learn more details about inequality here:

https://brainly.com/question/20383699

#SPJ2

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

Sarah is shopping for groceries at the local supermarket. She paid for her groceries using a $100 bill recently issued by the US government. What type of money did Sarah use for this transaction? commodity money fiat money digital money representative money

Answers

It is not digital because that would something like applepay. It is also nt representative, since that would be something like food stamps. Commodity money is also a bad answer, since it is goods. You answer would be fiat money, which is paper tender issued by the government. Hope this helps.

First combined weight of three packages that weigh 5 1/2 pounds 4 7/16 pounds and 3 3/8 pounds

Answers

5 1/2 + 4 7/6= 9.9+3 3/8=13.37

Help me ASAP!!! THANKS!




RANDOM ANSWERS WILL BE MODERATED!

Answers

It isn't clear to me whether you want a graph of that region, or you want a graph of a function that has those characteristics. Either way, ....

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

urgent help needed!

write y = (-5/8)x + 3 in standard form using integers.
a. 5x + 8y = -24
b. 5x + 8y = 24
c. 5x - 8y = 24
d. -5x + 8y = 24

Answers

To write this in standard form, you need to eliminate the fraction in the coefficient of variable x. You can do this by multiplying 8 to the two sides of the equation:

8(y) = 8[(-5/8)x + 3]

8y = -5x + 24

Transpose the variable x to the other side:

5x + 8y = 24        

 

 

Anslee is designing a doll house shaped like a rectangular prism. The doll house is 8 feet long, 2 feet wide and 3 feet high. What is the surface area of the doll house?

Answers

we know that
L=8 ft
W=2 ft
H=3 ft
[surface area of the doll house]=2*[W*H]+2*[L*H]+2*[W*L]
[surface area of the doll house]=2*[2*3]+2*[8*3]+2*[2*8]
[surface area of the doll house]=2*[6]+2*[24]+2*[16]
[surface area of the doll house]=12+48+32--------> 92 ft²

the answer is 92 ft²

There are 6 speakers at a conference: Ms. Sally, Ms. Elaine, Ms. Boo-Koo, Mr. Adam, Mr. Jones, and Mr. Tall. In how many ways can we order the speakers so that Mr. Adam doesn’t speak first?

Answers

Problems such as this are called counting problems. They often ask "in how many way" something can occur. Here we have 6 speakers and need to arrange them in order. We can use the counting principle which tells us that the number of ways can be obtained by considering how many speakers could be chosen for each position (first, second, third, ...  sixth) and multiplying these.

Even though there are 6 speakers, Mr. Adam cannot go first so there are 5 choices for who goes first. That leaves 5 speakers who can go second. As we already picked two people, there are 4 speakers who can go third and 3 who can go fourth. That leaves 2 that can go fifth and 1 that is left for the last slot.

The total number of ways is given by (5)(5)(4)(3)(2)(1) = 600

there are four brands of smartphones that are most popular in the united states . the number of people in the united states that have each brand is given.
brand A; 4.48x104;
brand b : 3.84 x107; brand c : 6.4x10^6; brand d: 1.50 x107
what is the order of these brands from most to least popular?

Answers

Brand B; brand D; Brand C; Brand A

For this case we must write the numbers from highest to lowest.

We observe that the numbers are written in exponential notation.

Therefore, by rewriting we have:

Brand A:

[tex] 4.48 * 10 ^ 4 = 44,800
[/tex]

Brand B:

[tex] 3.84 * 10 ^ 7 = 38,400,000
[/tex]

Brand C:

[tex] 6.4 * 10 ^ 6 = 6,400,000
[/tex]

Brand D:

[tex] 1.50 * 10 ^ 7 = 15,000,000
[/tex]

Ordering from highest to lowest we have:

[tex] 3.84 * 10 ^ 7 = 38,400,000

1.50 * 10 ^ 7 = 15,000,000

6.4 * 10 ^ 6 = 6,400,000

4.48 * 10 ^ 4 = 44,800
[/tex]

Answer:

The order of these brands from most to least popular is:

Brand B

Brand D

Brand C

Brand A

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.

Answer for number 5?

Answers

you should try to divide 192 by the 4 sides on the rectangle.
The first thing you should know is that the perimeter of a rectangle is given by:
 P = 2L + 2W
 Where,
 L: side
 W: width
 On the other hand we have that the ratio is:
 L / W = 5/3
 Clearing L we have:
 L = (5/3) * (W)
 Substituting in the expression of the perimeter:
 P = 2 ((5/3) * (W)) + 2W
 Rewriting:
 P = (16/3) W
 The perimeter is 192:
 192 = (16/3) W
 We cleared W:
 W = (3/16) * (192)
 W = 36
 Finally we substitute W in the expression for L:
 L = (5/3) * (W)
 L = (5/3) * (36)
 L = 60
 Answer: 
 The width and length are: 
 W = 36 yards 
 L = 60 yards


Hint: Omars equation doesn't work!
Identify his error and correct it by showing the steps Omar should have taken and determine the correct value of x.

Answers

His Error: He set the expressions 10x-1 and 59 equal to each other. Those two angles are not congruent. 

He should have added the two expressions to get 180
(10x-1) + (59) = 180
10x+(-1+59) = 180
10x+58 = 180
10x+58-58 = 180-58
10x = 122
10x/10 = 122/10
x = 12.2

Sarah draws a rectangle with an area of 4,875 square units and a length of 65 units. What is the width of the rectangle? 70 units 75 units 85 units 95 units

Answers

To calculate area of a rectangle you multiply the length and width together so to find the width you divide the area by the length: 4875÷65=75 so the width is 75 units.

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

How to find side of triangle if two sides and one angle is known?

Answers

The Law of Cosines can be used.

If the given angle is opposite one of the given sides, the Law of Sines can be used.

Law of Cosines:
.. c^2 = a^2 +b^2 -2ab*cos(C) . . . . . for any permutation of sides a, b, c, and opposite angle C

Law of Sines:
.. a/sin(A) = b/sin(B) = c/sin(C)

Singing "row, row, row your boat," in a round (each group starting at a different time) would be considered which texture? music appreciation

Answers

Yuh, ooh, brr, brr
Gucci gang, ooh
(That's it right there, Gnealz)
Yuh, Lil Pump, yuh
Gucci gang, ooh
(Ooh, Bi-Big Head on the beat)
Yuh, brr



The graph shows the path of a rider on a ride at an amusement park.

What does the x-coordinate of the vertex represent?



The rider’s minimum height above the ground is 25 ft.
The rider travels a total distance of 25 ft.
The difference between the rider’s maximum and minimum’s height above the ground is 25 ft.
The rider is closest to the ground when he is 25 ft from the left side of the ride.

https://static.k12.com/nextgen_media/assets/8090397-NG_AL1_O_07_U12_Quiz_08.png

Answers

The rider is closest to the ground when he is 25 ft from the left side of the ride.

Answer:

D. The rider is closest to the ground when he is 25 ft from the left side of the ride.

Step-by-step explanation:

The vertex of x-coordinate represents the distance from the from the origin of the pendulum, which is the closest to the ground when he is 25 ft away from 0.

Hope this will helpful.

Thank you.

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

Math help!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

6,023 
6,032
6,407
6,704
From least to greatest:

6,023; 6,032; 6,407; and 6,704.
From this list, the most accurate answer choice is the first one, A.

I hope this helps!

[100 POINTS]

Question 1)
The graph for the equation y = 2x - 2 is shown below.
If another equation is graphed so that the system has one solution, which equation could that be?
A) y = 2(x+1)
B) y = 2(x-1)
C) y = 2(x-2)
D) y = -2(x+1)

Question 2)
Solve the inequality and then graph its solution.
1/5(x-2) > -1

a) x > -7
b) x < -3
c) x > -3
d) x > 3

Answers

Question 1)

D

The answer is D because every other option has the same slope (2), and even if the intercepts are different, the lines would only be parallel, whereas in D, the slope is -2, which has one solution.

Question 2)

C

You would multiply everything by 5 to get rid of the fraction. Then, you can simplify and get the answer.

The first question is D, because when graphed, intercepts with the slope of 3, the only with the solution.

The second question is C, because u can multiple the LHS and RHS to get x-2 is greater than -5. Add 5 to get x is greater than -3

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8
Other Questions
How did Queen Victoria react to the industrial revolution? Faelyn noticed that she does not have a common factor. Which accurately describes what Faelyn should do next?Faelyn should realize that her work shows that the polynomial is prime.Faelyn should go back and regroup the terms in Step 1 as(6x4+ 3x2) (8x2+ 4).In Step 2, Faelyn should factor only 2xout of the first expression.Faelyn should factor out a negative from one of the groups so the binomials will be the same. hat is the equation of the trend line for the bivariate data shown in the scatter plot? Scatter plot shows trend line for bivariate data with coordinates (0, 0), (2, 6). Alcohol causes __________.A.a diminished ability to concentrate on multiple subjects at onceB.an increased ability to concentrate on one subjectC. an increase in emotional control Question 13 positive statements are:a. descriptive, making claims about how the world is.b. optimistic, putting the best possible interpretation on things.c. affirmative, justifying existing economic policy.d. prescriptive, making claims about how the world ought to be. TRIANGLE GEOMETRY PLEASE HELP In 1970 president Nixon began a program of detente in an attempt to _____.A) increase american stockpiles of nuclear weapons B) ease tensions with the soviet union and china C) support Afghanistan's fight against soviet forces D) achieve a decisive victory in the Vietnam war Ken is a very outgoing person. he makes friends easily, jokes with others, and is gullible (people love to play jokes on him because he is easily drawn into the game). ken is also considered a good friend because he is a good listener and seems to truly feel what the other person is going through. based on jungian theory, ken's seems to have a __________ personality. Algebraic expressionSeven points less than yesterdays score Amy notices that her credit card company has charged too high an interest rate for delayed payment this month. Which law protects her from this issue? Fair Debt Collection Practices Act Identity Theft and Assumption Deterrence Act Magnuson-Moss Warranty Act Fair Credit Reporting Act Credit Card Accountability, Responsibility and Disclosure Act The area of a sector of a circle is given by the equation A=3.14r^2S/360, where r us the radius of the circle and S is the angle measure of the sector. If Mia solved this equation for S, which of the following equations did she write? What is the major problem with using participant observation as a research tool? it often leads to findings that lack generalizability. it is unacceptable based on standards of the american sociological association. it lacks both validity and reliability. it is highly biased? A tree has 53 leaves. During a storm, it loses 29 leaves. How many leaves does the tree have left?29 leaves24 leaves82 leaves42 leaves Cubic bins with closed tops are used to transport melons to the farmers market. The edge length of each bin is 1.5 m. What is the surface area of the outside of one of the bins? Drag and drop the correct answer into the box. 3.375 91 1.25 13.5 m?? What does the union and the confederacy have in common together? Sorbet is a frozen dessert that is often made from fruit. how many portions each weighing 1/10 of a kilogram can a french dessert chef create from 3 kilograms of sorbet What was the basis of the Greek religion? The _____ psychologists asserted that with respect to perception, the whole is greater than the sum of the parts. Write the chemical reaction that is responsible for the ph of a buffer which contains nh3 and nh4cl. write the reaction in such a way that is appropriate for a ka. Aphotic zones can be found in____. A) rivers B) oceans C) reservoirs D) aquifers