A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

Answer 1
1.6/sin(28)
The answer is B
Answer 2

Answer:

B.

Step-by-step explanation:


Related Questions

Find two consecutive even integers such that the smaller added to three times the larger gives a sum of 54

Answers

Let n be the first even integer, and n+2 will be the second even integer. (Why? Think 2 and 4, 2+2=4. This is the case for every consecutive even integers).

n + 3(n+2) = 54
n + 3n + 6 = 54
4n = 48
n = 12, n+2 = 14
Let's call x  the smaller integer and x + 2 the larger one.

[tex]x+3(x+2)=54[/tex]
[tex]x + 3x + 6 = 54[/tex]
[tex]4x = 48[/tex]
[tex]x= \frac{48}{4}=12[/tex]

And [tex]x+2=12+2=14[/tex]

Hope this helps !

Photon

If a couple has three children, let x represent the number of girls. what is the probability that the couple does not have boys for all three children?

Answers

There is a 12.5% chance of having three girls in a row. ([tex] \frac{1}{2}^{3} [/tex])

Tickets to a school play cost $3 for students and $8 for adults. On opening night, $1000 was collected and 150 tickets sold. How many of each kind of ticket were sold? Write a system of equations and use substitution to solve.

Answers

Let the number of students who bought tickets be s,
Let the number of adults who bought tickets be a,

Equation 1:

[tex]3s \: + \: 8a \: = \: 1000[/tex]

Equation 2:

[tex]s \: + \: a \: = \: 150 \\ s \: = \: 150 \: - \: a[/tex]

Substitute ( 2 ) into ( 1 ),

[tex]3(150 \: - \: a) \: + \: 8a \: = \: 1000 \\ 450 \: - \: 3a \: + \: 8a \: = \: 1000 \\ 5a \: = \: 550 \\ a \: = \: 110[/tex]

Substitute a = 110 into ( 2 ),

[tex]s \: + \: 110 \: = \: 150 \\ s \: = \: 40[/tex]

Ans: 40 Student Tickets, 110 Adult Tickets
Final answer:

To solve this problem, set up a system of equations representing the number of student and adult tickets sold. Solve the system using substitution to find the numbers of each type of ticket sold.

Explanation:

To solve this problem, we can set up a system of equations to represent the number of student tickets and adult tickets sold.

Let x be the number of student tickets sold and y be the number of adult tickets sold.

We know that the total number of tickets sold is 150, so we have the equation:

x + y = 150

We also know that the total amount collected is $1000, so we have the equation:

3x + 8y = 1000

We can solve this system of equations using substitution.

From the first equation, we can solve for x in terms of y as:

x = 150 - y

Substituting this into the second equation, we have:

3(150 - y) + 8y = 1000

Simplifying, we get:

450 - 3y + 8y = 1000

Combining like terms, we get:

5y = 550

Dividing both sides by 5, we get:

y = 110

Substituting this value back into the first equation, we have:

x + 110 = 150

Simplifying, we get:

x = 40

Therefore, 40 student tickets and 110 adult tickets were sold.

The first pentagon is dilated to form the second pentagon. Drag and drop the answer to correctly complete the statement. The scale factor is . A pentagon with a side length of 4. An arrow points to a larger pentagon with a side length of 5
A 0.8 B 1.25 C 4 D 5

Answers

Dilation is a transformation that either stretches or diminishes an object. It is described by giving the scale factor and the center of dilation.
The dilation factor may be given by the ratio of the image side to that of the object.
Therefore, in this case, the dilation factor is 5/4
= 1.25

Answer:

1.25

Step-by-step explanation:

Quick help: Explain how to solve the following system of equations. What is the solution to the system?

2x+2y+z=-5
3x+4y+2z=0
x+3y+2z=1

Answers

-3x - 4y - 2z = 0
x + 3y + 2z = 1

-2x - y = 1

-4x - 4y - 2z = 10
3x + 4y +2z= 0

-x = 10. x = -10

-2(-10) - y = 1
20 - y = 1
-y = -19
y = 19

-10 + 3(19) + 2z = 1
-10 + 57 + 2z = 1
47 + 2z = 1
2z = -46
z= -23

check: 2(-10)+2(19)-23=-5
-20+38-23=-5
-43+38=-5
-5=-5

Given equations: 
2x+2y+z = -5 -----------(1)
 3x+4y+2z = 0 ----------(2)
 x+3y+2z = 1 ---------(3)
 Subtract equation (3) from equation (2) to eliminate z
 3x+4y+2z =0
 -x-3y-2z=-1
 __________
 2x+y=-1 -------------------(4)
 Multiply equation (1) by 2 and subtract it from equation (3) to eliminate z
 x+3y+2z=1
 -4x-4y-2z=10 ____________
 -3x-y=11 --------(5)
 Add equation (4) and (5) to eliminate y
 2x+y=-1
 -3x-y=11 _______
 -x=10
 X=-10
 Substitute the value of x in equation (4) to find y
 2(-10)+y=-1
 -20+y=-1
 y=-1+20
 y=19
 Substitute the values of x and y in any one of the 3 equations, to find z.
Let’s substitute in equation (1)
 2(-10)+2(19)+z=-5
 -20+38+z=-5
 18+z=-5
 z=-5-18
 z=-23
 Therefore the solution is: x=-10, y=19, z=-23

Robby and Tony both took a 25 question test.  Robby completed 25 questions and Tony completed 14 questions.  Can we conclude that Robby will make a higher grade than Tony?  Explain why or why not. - 

Answers

No, we can't conclude who will achieve the highest result, because we don't know who answered most of the questions CORRECTLY.
no because robby could get them all wrong and tony get them all right

Write a decimal that represents the value of $1 bill and 5 quarters

Answers

The correct answer for this would be 1.00 1.25. Hope this is helpful.
So, you know $1=1.00. And 5 quarters= $1.25. (0.25x5). So, if you want to add them together, you get $2.25.

If you work 52 weeks/year and 40 hours/week, how many hours would you work in one year? quizlrt

Answers

52×40=2080
You will work 2080hours in the year

Final answer:

To find the total hours worked in a year, multiply the number of hours worked per week by the number of weeks in a year.

Explanation:

To calculate the total hours worked in a year:

Hours worked per week = 40 hours

Weeks worked per year = 52 weeks

Total hours worked in a year = 40 hours/week x 52 weeks = 2080 hours

How many solutions exist for the given equation? 3(x+10)+6=3(x+12)

Answers

3x+30+6=3x+36

⇒3x+36=3x+36

⇒3x−3x=36−36

⇒0⋅x=0 
infinite solutions of x  for all  x∈R

There would be no solutions

It takes mario 5 minutes to type 225 words.how many many minutes does it take him to type 360 words?enter your answer in the box.

Answers

225/5 = 360/x

225x = 1,800

225x/225 = 1,800/225 = 8

It would take him 8 minutes

Answer:

the answer is 8

Step-by-step explanation:

because if you multiply 8 times 45 it equals 360

There is your answer

are the graphs of the lines in the pair parallel? Explain. y = 5x + 6 –18x + 3y = –54

Answers



The answer is: they are not parallel because they do not share the same slope. 


 Facts: 
1. Two parallel lines share the same slope.
2. To determine a slope, express the equations in this form: 
3. m = slope 
The slope of  is zero, because it represents a horizontal line in the cartesian plane.
We know that a slope = rise/run... in this case there is no rise and the run goes to infinity (+ and - directions). When zero is divided by any number, the result is zero... thus the slope is zero.



the slopes are diffrent 

A florist sold 15 arrangements in its first month of business. The number of arrangements sold doubled each month.


What was the total number of arrangements the florist sold during the first 9 months?

Answers

Answer:

total number of arrangements the florist sold during the first 9 months = 7665 arragements

Explanation:

Florist start a business.

In his 1st month Florist sold 15 arrangement.

He grow his business, he sold twice arrangements as compare to the previous month.

First month = 15

Second month = 2*15 = 30

Third month = 2*30 = 60

15, 30, 60 .....

we need to find the total number of arrangements in first nine months

This sequence is geometric series.

A geometric sequence is a sequence such that any element after the first is obtained by multiplying the preceding element by a constant called the common ratio which is denoted by r. The common ratio (r) is obtained by dividing any term by the preceding term, i.e.,

r = [tex] \frac{30}{15} = \frac{60}{30} = 2 [/tex]

Sum of Terms in a Geometric Progression ([tex] S_{n} [/tex])= [tex] \frac{a_{1} (r^{n} -1)}{r-1} [/tex]

where [tex] a_{1} [/tex] is first term = 15

n is the number of terms = 9

r is common ratio = 2

[tex] S_{9} =\frac{15(2^{9}-1)}{2-1} [/tex]

[tex] S_{9} =\frac{15*(512-1)}{1} [/tex]

[tex] S_{9} = 7665 [/tex]

total number of arrangements the florist sold during the first 9 months = 7665.






Answer:7665

Step-by-step explanation:

Segment AB has endpoints A(–4, 6) and B(1, 4). After a dilation, centered at the origin, the image of A is (–6, 9). Without measuring the distance, explain how you could find the image of B

Answers

If the image is centered at the origin you can divide the terms of the image from the preimage to find the scale or ratio at which it was dilated. In this case, you will use the points of A because the point b does not matter in this case.

[tex] \frac{-6}{-4} = 1.5 [/tex]  and [tex] \frac{9}{6} = 1.5[/tex] so the image is dilated by a scale of 1.5

now that we know the scale we multiply the points of B by the scale to get the image.    1*1.5 = 1.5  and 4*1.5 = 6 so the image for B is (1.5, 6) 

The image of point B is B'(1.5,6).and this can be determined by finding the dilation factor and then multiplying point B by the dilation factor.

Given :

Segment AB has endpoints A(–4, 6) and B(1, 4).After a dilation, centered at the origin, the image of A is (–6, 9).

In order to determine the image of point B, first, determine the dilation factor. let 'x' be the dilation factor, then:

[tex]-4\times x = -6[/tex]

[tex]x = \dfrac{3}{2}[/tex]

Now, after dilation the point B becomes:

[tex]\rm B(1,4)\to B'(1\times \dfrac{3}{2},4\times \dfrac{3}{2})[/tex]

Simplify the above expression.

[tex]\rm B'\left(\dfrac{3}{2},6\right) = B'(1.5,6)[/tex]

The image of point B is B'(1.5,6).

For more information, refer to the link given below:

https://brainly.com/question/19347268

FOURTH TIME POSTING! EXTRA POINTS!
Complete each function. ( y = -x )

Answers

y = -x means y would be the opposite of x

-2 = 2
-1 = 1
0 = 0
1 = -1
2 = -2
y = -x  
so 
 x          y
-2         2
 -1        1
0          0
1          -1
2         -2

What is the product? Zx(x-4)

Answers

For this case what you must multiply the variable Z for each of the terms that are within the parenthesis and then do the corresponding subtraction.
 We have then that the product will be given by:
 Zx (X-4) =
 (Z * X) - (Z * 4)
 Rewriting:
 ZX-4Z
 Answer:
 the product is:
 ZX-4Z

The product of Zx (x-4) is:

Zx2 - 4Zx

Explanation and Solution:

Multiply Zx to each term of the expression inside the parenthesis

Zx multiplied by x is equal to Zx2     

Zx multiplied by -4 is equal to -4Zx,

Combining all the product, we have Zx2 - 4Zx as the answer.

 

PS. The x2 there is X squared

 

 

Anybody got some answers????

Answers

The area of a circular segment is given by
.. A = (1/2)r^2*(θ -sin(θ)) . . . . . . . . . θ in radians
.. = (1/2)*(27.8 in)^2*(5π/6 -sin(5π/6))
.. ≈ 818.4 in^2

Simplify b ( a + b ) - a ( a - b ).
a^2 + 2 ab + b^2
a^2 - 2 ab + b^2
-a^2 + 2 ab + b^2
-a^2 - 2 ab - b^2

Answers

the answer is -a^2+2ab+b^2

Answer:

-a^2 + 2 ab + b^2

Step-by-step explanation:

To solve this, you need to distribute the letters into the parenthesis.

Then, you sum equal things, and you get the result.

[tex]b(a+b)-a(a-b)=\\ba + b^{2} -a^{2}  + ab=\\ b^{2} + 2ab -a^{2}[/tex]

So, the rigth answer is number three: -a^2 + 2 ab + b^2

A boat is 122 meters from the base of a lighthouse that is 34 meters above sea level. What is the angle of elevation from the boat to the top of the lighthouse? Round to the nearest degree. °

Answers

16 dergrees is the answer.

Answer: 16

Step-by-step explanation:

Ken, Justin, and Tiff have read a total of 90
books from the library. Justin read 3 times
as many books as Ken and Tiff read 2
times as many as Justin. How many books
did Justin read?

Answers

okay so we gonna use k for Ken and j for Justin and T for Tiff. we are gonna try to use one letter to solve this in order for It to be more efficient and easy. so if Justin reads 3 times the amount of Ken than that is just basically 3k. and if Tiff reads twice as much as Justin than it's basically 6k because Justin is reads 3 times as Ken and that times 2 is 6k. so we are solving for k in order to know how much Ken reads. so k (for Ken) + 3k ( for justin) + 6k (for tiff) leaves you with 9k and they read 90 books in total. so 10k=90. so than you divide it which results in k=9. lastly if Justin reads 3 times as much as Ken than all you have to do is multiply 9 × 3 and you get 27 as the answer

ILL GIVE BRAINLIEST IF YOU HELP

Find the hypotenuse of a right triangle with legs measuring 4 and 5 ft. 6.40

ANSWER a=4, b=5, so 42 + 52 = c2 and 16 + 25 = c2, so 41 = c2, then the square root of 41 =c

CAN SOMEONE EXPLAIN HOW TO GET THIS??!!

Answers

4^2 + 5^2 = X^2

16 + 25 = X^2
41 = x^2
X = sqrt(41)
x = 6.40

hypotenuse = 6.40

Answer:

4^2 + 5^2 = X^2

16 + 25 = X^2

41 = x^2

X = sqrt(41)

x = 6.40

hypotenuse = 6.40

Step-by-step explanation:

Two numbers have a sum of 22 and a difference of 6. find the two numbers.

Answers

Let the bigger number be x and the smaller one be y

Two numbers have a sum of 22
x+y = 22
y= 22 -x -------------------- (1)

The difference is 6
x - y = 6 ---------------------(2)

Sub (1) into (2):
x - (22 - x) = 6
x - 22 + 2 = 6
2x - 22 = 6
2x = 6 + 22
2x = 28
x = 14 -------- Sub into (1)

y= 22 -x 
y = 22 -14
y = 8

One of the number is 14 and the other is 8


Which of these sentences is always true with a parallelogram?

A.) all sides are congruent

B.) all angles are congruent

C.) the diagonals are congruent

D.) opposite angles are congruent

Answers

Answer:

Opposite angles are congruent

Step-by-step explanation:

The parallelogram has parallel opposite sides and also the opposite sides are congruent. Few other properties of parallelogram are -

It has two pairs of parallel opposite sides. Its diagonals bisect each other.It has two pairs of equal opposite angles. It has two pairs of equal and parallel opposite sides.

So, the answer is D.) opposite angles are congruent.

Answer:

D. Opposite angles are congruent.

Step-by-step explanation:

plato

Solve. x² + 20x + 100 = 50
A)x=−10±52√
​B)x=50±252√ ​
​C) x=10±52√ ​ ​
​D)x=50±52√ ​

Answers

x² + 20x + 100 = 50


x = −10 ± 5√2



Solve. x²+ 20x + 100 = 50

Subtracting 50 from both sides

[tex] x^{2} +20x+100-50=50-50 [/tex]

[tex] x^{2} +20x+50=0 [/tex]

To solve the quadratic equation, let us use quadratic formula

For, [tex] ax^{2} +bx+c=0 [/tex] , [tex] x=\frac{-b+-\sqrt{b^{2}-4ac}}{2a} [/tex]

So, a=1, b=20, c=50

So, we get,

x=[tex] \frac{-20+-\sqrt{20^{2}-4*1*50}}{2*1} [/tex]

[tex] x=\frac{-20+-\sqrt{400-200}}{2} [/tex]

[tex] x=\frac{-20+-\sqrt{200}}{2} [/tex]

[tex] x=\frac{-20+-10\sqrt{2}}{2} [/tex]

[tex] x=\frac{-10+-5\sqrt{2}}{1} [/tex]

[tex] x=-10+-5\sqrt{2} [/tex]

Option(a) Answer

So, x=-10+5[tex] \sqrt{2} [/tex]

or, x=-10-5[tex] \sqrt{2} [/tex]

A pilot flies 720 miles from dallas, texas, to his first destination. after dropping off his cargo, he flies southeast 290 miles to his second destination. if the angle formed by his trip is 125°, what is the distance he will fly from the second destination back to dallas? 490 miles 918 miles 1,010 miles 842,026 miles

Answers

918 miles is the answer

Answer:

B) 918 miles

Step-by-step explanation:

Here with I have attached the figure of the story.

Here we need to find side c, which represents distance from the second destination back to Dallas.

We have to use the cosine formula to find the missing side.

If we are given two sides and one included angle, we can use the cosine formula and find the missing side.

a = 720, b = 290 and ∠C =125°

[tex]c^2 = a^2 + b^2 - 2ab cos C[/tex]

Now plug in the given values and simplify.

[tex]c^2 = {720}^2 + 290^2 - 2*720*290 cos 125[/tex]

[tex]c^2 = 518400 + 84100 - 417600 cos125[/tex]

[tex]c^2 = 602500 - (-239,525.5)\\c^2 = 602500 + 239,525.5\\c^2 = 842025.5[/tex]

Taking the square root on both sides, we get

c = 917.6

Which is equivalent to 918 miles (rounded off to the nearest whole number)

Devin is making a candle by pouring melted wax into a mold in the shape of a square pyramid. Each side of the base of the pyramid is 10 cm and the height of the pyramid is 11 cm. To get the wax for the candle, Devin melts cubes of wax that are each 3 cm by 3 cm by 3 cm. What is the minimum number of wax cubes Devin will need in need in order to make the candle? Show your work. Please explain.

Answers

The first thing you should do in this case is to calculate the volume of the square pyramid, which will be given by:
 V = (Ab * h) / 3
 Where,
 Ab: Area of the base.
 h: height of the pyramid.
 Substituting the values we have:
 V = ((10 * 10) * (11)) / 3
 V = 366.6666667 cm ^ 3
 We now calculate the volume of each cube, which will be given by:
 V '= L ^ 3
 Where,
 L: sides of the cubes.
 Substituting we have:
 V '= (3) ^ 3
 V '= 27 cm ^ 3
 The number of cubes will be:
 N = (V) / (V ')
 N = (366.6666667) / (27)
 N = 13.58024691
 Answer: 
 the minimum number of wax cubes Devin will need is 13 in order to make the candle

Julie spends 3/4 hour studying on Monday and 1/6 hour studying on Tuesday. How many hours does Julie study on the two days? (A 1/3 hour (B 2/5 hour (C 5/6 hour (D 11/12 hour (HELP ASAP 20 POINTS)

Answers

Equation: 3/4 + 1/6

3/4 = 18/24
1/6 = 4/24

18/24 + 4/24 = 22/24
22/24 = 11/12

Hope this helps!

Which dot plot has the smallest mode.

Answers

i think it is shield darter because the are less dots
The dot plot with the smallest mode is the plot that has the # of Zebra Mussel

The roof of a factory rises vertically 7 ft through a horizontal run of 42 ft. What is the pitch of the roof?

Answers

Final answer:

The pitch of the roof, which rises vertically 7 ft through a horizontal run of 42 ft, is 2. This means the roof rises 2 inches for every 12 inches of horizontal run.

Explanation:

The question asks about calculating the pitch of a roof with a vertical rise of 7 ft and a horizontal run of 42 ft. The pitch of a roof is generally expressed as the amount of vertical rise per 12 inches of horizontal run. To find the pitch, we first need to calculate the rise per 12 inches of horizontal run.

Given:

Rise = 7 ft

Run = 42 ft

To find how much the roof rises for every 12 inches of run, we use the formula:

Pitch = (Rise / Run) × 12

Plugging in the given values:

Pitch = (7 / 42) × 12 = 2

Thus, the pitch of the roof is 2, meaning the roof rises 2 inches for every foot (12 inches) of horizontal run.

need an answer quick. If a circle with a diameter of 124 m is inscribed in a square, what is the probability that a point picked at random in the square is in the shaded region? Round to the nearest thousandth.

A.
0.013
B.
0.032
C.
0.215
D.
0.785

Answers

Answer: C.  0.215


Step-by-step explanation:

Given: A circle with a diameter of 124 m is inscribed in a square .

Thus side of square =124 m

Now, area of square=[tex](side)^2=(124)^2=15,376\ m^2[/tex]

Radius of circle=[tex]\frac{d}{2}=\frac{124}{2}=62\ m[/tex]

Area of circle=[tex]\pi\ r^2=3.14\times(62)^2=3.14\times3.14=12,070.16\ m^2[/tex]

Now, Area of shaded region= Area of square-Area of circle

Area of shaded region=[tex]15,376-12,070.16=3,305.84\ m^2[/tex]

Probability that a point picked at random in the square is in the shaded region

[tex]=\frac{\text{area of shaded region}}{\text{area of square}}=\frac{3305.84}{15376}=0.215[/tex]



Which graph represents the function?

Answers

The upper left choice is the only one that has the absolute value right.
Other Questions
Joe is a student, a father, a son, a husband, a baptist, and a scout leader. all of these socially defined positions constitute a: Will mark brainiestMy teacher says everything is there to answer this question but I don't know. Someone please explain.Two travellers spend from 12 o'clock to 6 o'clock walking along a level road, up a hill and back again. Their pace is 4 mph on the level, 3 mph uphill, and 6 mph downhill.How far do they walk and at what time do they reach the top of the hill? Select the problems which show the correct answers. (1.12 x 105) (6.06 x 105) Answer: 6.79 x 1010 (2 x 101)(3.0 x 101) Answer: 6.0 x 101 (2.775 x 104) (4.775 x 104) Answer: 1.325 x 100 5 8.14 x 102 Answer: 6.14 x 103 how are the wives attitudes towards the respective journeys in A journey and Young Goodman brown similarA they are both excited about the journeys B they are both apprehensive about journeys C they are both prepared for the journeys D they were both hopeful about the journeys Explain how autotrophs and heterotrophs obtain energy from the sun. For an industry to be perfectly competitive, what must exist? What type of orbital do the lone pair electrons on oxygen occupy in ethanol? Which factor does not control climate?A. the kinds of land featuresB. the distance an area is from the sunC. the rate of primary productivityD. the amount of sunlight receivedNote that if you look up your answer, or just guess, (in which I'll know) you will be reported Simplify Expression-11. (n^4)^813. (q^10)^1015. (x^3)^-517. (z^8)^0z^519. (c^3)^5(d^3)^0@Phebe Last one i promise lol One thing thate. coli and other prokaryotes have in common with all eukaryotes is the presence of ___. Name the following compound:CH2 = CH2 CH2 CH3ButaneA. butylB. 1-buteneC. 1-butyne With the exception of those who murder their families, mass murderers appear to: What is the inverse of the function f(x)=1/3x-2 Please help me with this question Combustion analysis of 0.300 g of an unknown compound containing carbon, hydrogen, and oxygen produced 0.5213 g of co2 and 0.2835 g of h2o. what is the empirical formula of the compound? Find the volume of the cylinder if the diameter is 6 inches and the height is three times the radius. Round your answer to the nearest hundredth.The equation for volume is V = pi*r^2*hI got 169.73 what is the term to describe features that are changed from an ancestral form Used in conjunction with mechanical lifting devices, Patient Care Plans can help reduce on-the-job injuries. Examples of items in such plans include segregation of patients/residents based on need so equipment and trained staff are appropriately assigned and staggered staffing to provide additional manpower for peak periods. What else might be included in a Patient Care Plan that would reduce on-the-job injuries due to lifting? Which statement accurately describes the 13 American colonies?A. Though all colonies were established under the same charter, each had a distinct purpose and set of goalsB.The colonies were all established under the same charter, and thus shared similar goals,rights and lawsC. All colonial characters granted representation in Parliament and recognized the British king as the ultimate source of authorityD.Each colony had a different population and purpose, and each had a separate charter outlining its government She has four feet of ribbon, which must be cut into seven equal lengths. How long will each piece of ribbon be after she has finished cutting?