Can someone help me with this math question

Can Someone Help Me With This Math Question

Answers

Answer 1

Answer:

The coordinates of D' are (1,-1)

Step-by-step explanation:

The point D in the figure has co-ordinates (2,-2) as shown in the figure.

The figure is dilated by a factor of 1/2

So, multiply the coordinates of D (2,-2) by 1/2

D' = (1/2*2, 1/2*-2)

D' = (1,-1)

So, the coordinates of D' are (1,-1)


Related Questions

Which statement wether Shannon is correct ?

Answers

Answer:

Option B A rectangular prism in which BA=30 and h=5 has a volume of 150 units³, therefore, Shannon is correct

Step-by-step explanation:

step 1

Find the area of the base of the rectangular pyramid

The volume of the rectangular pyramid is equal to

[tex]V=\frac{1}{3}BH[/tex]

where

B is the area of the base and H is the height of the pyramid

we have

[tex]V=50\ units^{3}[/tex]

[tex]H=5\ units[/tex]

substitute and solve for B

[tex]50=\frac{1}{3}B(5)[/tex]

[tex]B=30\ units^{2}[/tex]

step 2

Find the volume of the rectangular prism with the same base area and height than the rectangular pyramid

The volume of the rectangular prism is equal to

[tex]V=BH[/tex]

where

B is the area of the base and H is the height of the pyramid

we have

[tex]B=30\ units^{2}[/tex]

[tex]H=5\ units[/tex]

substitute

[tex]V=(30)(5)=150\ units^{3}[/tex]

step 3

Compare the volumes

Volume of the rectangular pyramid -------> [tex]50\ units^{3}[/tex]

Volume of the rectangular prism -------> [tex]150\ units^{3}[/tex]

therefore

The volume of the rectangular prism is three times the volume of the rectangular pyramid

Shannon is correct

$1000 is invested at 8%/a compounded daily for 10 years. What is the total interest earned?
Please help

Answers

[tex]\bf ~~~~~~ \textit{Continuously Compounding Interest Earned Amount} \\\\ A=Pe^{rt}\qquad \begin{cases} A=\textit{accumulated amount}\\ P=\textit{original amount deposited}\dotfill & \$1000\\ r=rate\to 8\%\to \frac{8}{100}\dotfill &0.08\\ t=years\dotfill &10 \end{cases} \\\\\\ A=1000e^{0.08\cdot 10}\implies A=1000e^{0.8}\implies A=2225.54~\hfill \stackrel{interest = A - P}{1225.54}[/tex]

btw, we could have used the compound formula just the same, by simply using a compounding cycle of 365, namely daily, assuming a year has 365 days.

Determine the slope of the line that contains the given points T(4,6) a V(8,7)

A) -1/2
B) 4
C) 1/4
D) -4

Answers

The answer is C. 1/4

Finding the slope using two points:

The formula for slope is

[tex]\frac{y_{2}-y_{1}}{x_{2}-x_{1}}[/tex]

In this case...

[tex]y_{2} =7\\y_{1} =6\\x_{2} =8\\x_{1} =4[/tex]

^^^Plug these numbers into the formula for slope...

[tex]\frac{7 - 6}{8 - 4}[/tex]

C) [tex]\frac{1}{4}[/tex]

^^^This is your slope

Hope this helped!

~Just a girl in love with Shawn Mendes

Milford Company uses the​ percent-of-sales method to estimate uncollectibles. Net credit sales for the current year amount to $ 140 comma 000​, and management estimates 2​% will be uncollectible. The Allowance for Uncollectible Accounts prior to adjustment has a credit balance of $ 3 comma 000. The amount of expense to report on the income statement will be?

Answers

Amount of expenditure to be shown on the income statement = 0 and Income from the reversal of additional balance = $200

What are Arithmetic operations?

Arithmetic operations can also be specified by subtracting, dividing, and multiplying built-in functions.

Given that the Allowance for Uncollected Accounts is at 2% based on the percentage of sales method, the closing amount for the current year must be 2% of credit sales.

Current year credit sales = $140,000

Allowance for Uncollected Accounts = $140,000 × 2% = $2,800

the current amount of Allowance for Uncollected Accounts is $3,000, it is already $200 in excess of the threshold ($3000 - $2800), hence it must be reversed by $200.

Amount of expenditure to be shown on the income statement = 0.

Income from the reversal of additional balance = $200

Learn more about Arithmetic operations here:

brainly.com/question/25834626

#SPJ2

Final answer:

To calculate the expense for uncollectibles using the percent-of-sales method, multiply the net credit sales by the estimated percentage of uncollectibles. For Millford Company, this calculation is $140,000 * 2%, resulting in an expense of $2,800, ignoring the existing allowance balance.

Explanation:

The student has asked how to calculate the expense to report on the income statement for uncollectibles using the percent-of-sales method. Millford Company estimates that 2% of their net credit sales of $140,000 will be uncollectible. To find the uncollectible expense, you multiply the total net credit sales by the estimated percentage, which is $140,000 * 2% = $2,800. Since the Allowance for Uncollectible Accounts has a prior credit balance of $3,000, the current period's expense recognized in the income statement is calculated by adjusting for this existing balance. However, if the question simply asks for the expense amount based on current sales, it ignores the pre-adjustment balance and focuses solely on the estimated uncollectibles from current sales, which is $2,800.

Paul and Tom both commute to work. Paul's commute on the train takes 15 minutes more than one third as many minutes as Tom's commute by car. It takes Paul 45 minutes to get to work. Write an equation to determine how many minutes it takes Tom to get to work.

45 = one thirdx − 15
45 = one thirdx + 15
45 = 3x − 15
45 = 3x + 15

Answers

Answer:

  45 = (one third)x + 15

Step-by-step explanation:

If x represents the number of minutes Tom commutes, then (1/3)x is "one-third as many minutes as Tom's commute." 15 minutes more than that is ...

  (1/3)x + 15

We are told this is the length of Paul's commute, and that it is 45 minutes. So, the appropriate equation is ...

  45 = (1/3)x +15

Answer: 45 = (one third)x + 15

Step-by-step explanation:

Find the longer leg of the triangle.


A. 3

B. [tex]\sqrt{3}[/tex]

C. 9

D. [tex]\sqrt{6}[/tex]

Answers

Answer:

Choice A. 3.

Step-by-step explanation:

The triangle in question is a right triangle.

The length of the hypotenuse (the side opposite to the right angle) is given. The measure of one of the acute angle is also given.

As a result, the length of both legs can be found directly using the sine function and the cosine function.

Let [tex]\text{Opposite}[/tex] denotes the length of the side opposite to the [tex]30^{\circ}[/tex] acute angle, and [tex]\text{Adjacent}[/tex] be the length of the side next to this [tex]30^{\circ}[/tex] acute angle.

[tex]\displaystyle \begin{aligned}\text{Opposite} &= \text{Hypotenuse} \times \sin{30^{\circ}}\\ &=2\sqrt{3}\times \frac{1}{2} \\&= \sqrt{3}\end{aligned}[/tex].

Similarly,

[tex]\displaystyle \begin{aligned}\text{Adjacent} &= \text{Hypotenuse} \times \cos{30^{\circ}}\\ &=2\sqrt{3}\times \frac{\sqrt{3}}{2} \\&= 3\end{aligned}[/tex].

The longer leg in this case is the one adjacent to the [tex]30^{\circ}[/tex] acute angle. The answer will be [tex]3[/tex].

There's a shortcut to the answer. Notice that [tex]\sin{30^{\circ}} < \cos{30^{\circ}}[/tex]. The cosine of an acute angle is directly related to the adjacent leg. In other words, the leg adjacent to the [tex]30^{\circ}[/tex] angle will be the longer leg. There will be no need to find the length of the opposite leg.

Does this relationship [tex]\sin{\theta} < \cos{\theta}[/tex] holds for all acute angles? (That is, [tex]0^{\circ} < \theta <90^{\circ}[/tex]?) It turns out that:

[tex]\sin{\theta} < \cos{\theta}[/tex] if [tex]0^{\circ} < \theta <45^{\circ}[/tex];[tex]\sin{\theta} > \cos{\theta}[/tex] if [tex]45^{\circ} < \theta <90^{\circ}[/tex];[tex]\sin{\theta} = \cos{\theta}[/tex] if [tex]\theta = 45^{\circ}[/tex].

Answer:

A

Step-by-step explanation:

Since the triangle is right use the cosine ratio

cos30° = [tex]\frac{adjacent }{hypotenuse}[/tex] = [tex]\frac{adj}{2\sqrt{3} }[/tex], so

[tex]\frac{\sqrt{3} }{2}[/tex] = [tex]\frac{adj}{2\sqrt{3} }[/tex]

Multiply both sides by 2[tex]\sqrt{3}[/tex]

adj = [tex]\frac{\sqrt{3} }{2}[/tex] × 2[tex]\sqrt{3}[/tex] = 3

In? 2008, a country used ?twenty-five percent or 100 million tons of all the grain grown that year to produce ethanol. How much grain was grown in the country in? 2008?

Answers

Answer:

400,000,000 tons

Step-by-step explanation:

You could reword this sentence to ask the question, "100,000,000 is 25% of how much?"

The word "is" means equals, the percent will be .25 in decimal form, the word "of" means to multiply, and "how much" is x, our unknown.  In equation form, then, this looks like

100,000,000 = .25 × x

We will divide both sides by .25 to get that

x = 400,000,000

That's how much grain was grown in 2008

Answer: 400 million tons

Step-by-step explanation:

100 millions is 1/4 of 400 million

How many positive integers are there whose digits strictly increase from left to right?

Answers

infinitely many, I am like 97.3% sure

There are 511 positive integers whose digits strictly increase from left to right.

To determine how many positive integers have digits that strictly increase from left to right, we need to consider combinations of digits. Since the digits must strictly increase, we cannot repeat any digit, and we can only use digits from 1 to 9.

Each number can be considered a unique combination of these digits, where the order of digits matters. For example, the digits {1, 2, 3} can only form the number 123. The total number of such combinations is given by the binomial coefficient C(9, k), where k is the number of digits.

For 1-digit numbers, the count is :C(9, 1) = 9For 2-digit numbers :C(9, 2) = 36For 3-digit numbers :C(9, 3) = 84And so on, up to 9-digit numbers which is :C(9, 9) = 1Summing these values, we get the total number of positive integers with strictly increasing digits :9 + 36 + 84 + 126 + 126 + 84 + 36 + 9 + 1 = 511Therefore, there are 511 positive integers whose digits strictly increase from left to right.

Suppose that a single card is selected from a standard​ 52-card deck. What is the probability that the card drawn is a clubclub​?

Now suppose that a single card is drawn from a standard​ 52-card deck, but it is told that the card is blackblack. What is the probability that the card drawn is a clubclub​?

Answers

Answer:

The probability that the card drawn is a club is 0.25.

The probability that card drawn is a club, when it is given that the card is black is 0.5.

Step-by-step explanation:

In a standard​ deck of cards:

Total number of cards = 52

Total number of cards of each suit (club, spade,heart, diamond) = 13

The probability that the card drawn is a club is

[tex]P=\frac{\text{Favorable outcomes}}{\text{Total outcomes}}[/tex]

[tex]P=\frac{^{13}C_1}{^{52}C_1}=\frac{13}{52}=0.25[/tex]

Therefore the probability that the card drawn is a club is 0.25.

Let A and B represents the following events:

A : Card is black

B : Card is a club

Total number of black cards = 26

[tex]P(A)=\frac{26}{52}=\frac{1}{2}=0.5[/tex]

From the above parts

[tex]P(B)=0.25[/tex]

Total number of black club cards = 13

[tex]P(A\cap B)=\frac{13}{52}=\frac{1}{4}=0.25[/tex]

We need to find the probability that card drawn is a club, when it is given that the card is black.

[tex]P(\frac{B}{A})=\frac{P(A\cap B)}{P(A)}[/tex]

[tex]P(\frac{B}{A})=\frac{0.25}{0.5}=0.5[/tex]

Therefore the probability that card drawn is a club, when it is given that the card is black is 0.5.

You have recorded your car mileage and gasoline use for 5 weeks. Estimate the number of miles you can drive on a full 15-gallon tank of gasoline.

Answers

Answer:

I think its 21.6 or 22 (Mostly 21.6 though) Sorry if its not right but i'm mostly sure of it like this!

HELP ME!!!
Select the correct answer from the drop-down menu.

The value of x that satisfies the equation is °.

Answers

Answer:

210 is the only choice I see listed that works.

Step-by-step explanation:

I don't know if you know this but you can apply a co-function identity here giving you the equation:

[tex]cos(x)=-\frac{\sqrt{3}}{2}[/tex].

If you are unsure of the identity sin(90-x)=cos(x) then I can show you another identity that leads to this one.

The difference identity for sine is sin(a-b)=sin(a)cos(b)-sin(b)cos(a).

Applying this to sin(90-x) gives you sin(90)cos(x)-sin(x)cos(90).

Let's simplify that using that sin(90)=1 while cos(90)=0:

sin(90-x)=sin(90)cos(x)-sin(x)cos(90)

sin(90-x)=1cos(x)-sin(x)(0)

sin(90-x)=cos(x)

You can also prove this identity using a right triangle like the one in this picture:  

That missing angle is 90-x since we need the angles in this triangle to add up to 180 which it does:

(x)+(90)+(90-x)

x+90+90-x

x-x+90+90

0+180

180

Anyways you should see that sin(90-x)=b/c while cos(x)=b/c.

Since they are equal to the same ratio, then you can say sin(90-x)=cos(x).

There are other co-function identities you can get from using this idea.

Anyways back to the problem.

We are solving:

[tex]cos(x)=-\frac{\sqrt{3}}{2}[/tex].

It looks like you have a drop-down menu with answers ranging from 0 to 360.

So I'm going to answer in degrees using the unit circle.

cosine value refers to the x-coordinate.

We are looking for when the x-coordinate is [tex]-\frac{\sqrt{3}}{2}[/tex] which is at [tex]\theta=150^\circ , 210^\circ[/tex].

A small amphitheater has 8 rows that have 42 seats in each row. If an act needs to keep the first row empty but has all the rest of the seats sold, then what expression can be used to find the total attendance? 8 × 40 + 8 × 2 8 × 40 – 8 × 2 7 × 40 + 7 × 2 7 × 40 – 7 × 2

Answers

The expression that shows the total attendance is 7 x 40 + 7 x 2.

What is an algebraic expression?

An algebraic expression is consists of variables, numbers with various mathematical operations,

Given that,

Total number of rows = 8.

Number of seats in each row = 42.

Total number of seats = 42 x 8 = 336.

Since, an act needs to keep first row empty, but rest of the seats sold.

So the remaining seats = 336 - 42 = 294.

So, the expression for the total attendance can be given as,

7 x 40 + 7 x 2 = 280 + 14 = 294.

The required expression is 7 x 40 + 7 x 2.

To know more about Algebraic expression on:

https://brainly.com/question/19245500

#SPJ5



What is the volume of the following triangular prism?

288 ft3
480 ft3
96 ft3
576 ft3

Answers

The base is a right triangle with side lengths of 6 and 8 ft.

The area of a triangle is 1/2 x base x height = 1/2 x 6 x 8 = 24 square feet.

Now to find the volume, multiply the area by the height:

24 square ft x 12 ft = 288 ft^3

Answer:

i think it is 288 ft^3

Step-by-step explanation:

2x+y= 3
x-2y= -1
If equation two is multiplied by -2, and then the equations are added, the result is

Answers

Answer:

  5y = 5

Step-by-step explanation:

When the second equation is multiplied by -2, it becomes ...

  -2(x -2y) = -2(-1)

  -2x +4y = 2

Adding this to the first equation gives ...

  (2x +y) +(-2x +4y) = (3) +(2)

  2x +y -2x +4y = 5 . . . . . . . . . eliminate parentheses

  5y = 5 . . . . . . . . . . . . . . . . . . .collect terms

A lopsided coin has a probability of 1/3 for coming up heads and 2/3 for coming up tails. On average, how many flips of this coin are needed to have both heads and tails appear at least once? Give your answer as a reduced fraction.

Answers

Answer with explanation:

For a Lopsided coin ,probability of getting Head is equal to [tex]\frac{1}{3}[/tex] For a Lopsided coin ,probability of getting Tail  is equal to [tex]\frac{1}{3}[/tex].

Probability of getting Tail > Probability of getting Head

→Coin is heavier from tail side and lighter from Head side.

→→We have to Calculate number of flips of coin that is needed to have both heads and tails appear at least once.

[tex]\rightarrow P(\text{Head})=\frac{1}{3}\\\\ \frac{1}{3} \times x=1\\\\x=3\\\\\rightarrow P(\text{Tail})=\frac{2}{3}\\\\ \frac{2}{3} \times y=1\\\\y=\frac{3}{2}[/tex]

→We need to find common multiple of 3 and [tex]\frac{3}{2}[/tex].

Least common multiple of 3 and [tex]\frac{3}{2}[/tex] is 6.

→So,on Average number of flips of this coin are needed to have both heads and tails appear at least once=6 tosses

                                                                             

A wholesaler requires a minimum of 4 items in each order from its retail customers. The manager of one retail store is considering ordering a certain number of sofas, x, and a certain number of pillows that come in pairs, y. Which graph represents the possible combinations of sofa and pillow orders the manager can have?

Answers

Answer:

It is the last graph: solid line, shaded area over the line x = 2 - x/2

Explanation:

1) Set the algebraigic expression that represents the combinations of sofa and pillow orders:

Number of sofas: x (given)Number of pillows: 2y (given, since they come in pairs)Number of items = number of sofas + number of pillows = x + 2yMinimum of 4 items in each order (given) ⇒ x + 2y ≥ 4

2) Predict the graph of the inequality x + 2y ≥ 4

The border line is the equation x + 2y = 4You can choose two points to draw a lineChoose the axis-intercepst:

        x = 0 ⇒ 2y = 4 ⇒ y =4/2 ⇒ y = 2 ⇒ point (0,2)

        y = 0 ⇒ x = 4 ⇒ point (4,0)

        Then the lines goes through (0,2) and (4,0) ... [the four graphs meet this]

The shading area is above the line because when you solve for y you get y ≥   2 - x/2, and the line is included because the "equal to" part of the symbol (≥ means greater than or equal to).

 To state that the line is included the graph uses a continous line instead of a dotted one.

3) Conclusion:

That means that the correct graph is the last one: solid line, shaded area over the line y = 2 - x/2.

Note: a more detailed graph would include the fact that the items cannot be negative, i.e. x ≥ 0 and y ≥ 0, which would result in that the shaded area would be on the first quadrant.

   

Answer: D

Step-by-step explanation:

What requirements are necessary for a normal probability distribution to be a standard normal probability​ distribution?

Answers

Answer:

c

Step-by-step explanation:

Answer:

answer would be The mean must have a mean of 0 and a standard deviation of 1. hope this helps

Step-by-step explanation:

A person died leaving property worth rs.4000.40. His widow get 0.125 of the property and his son got 0.4 of the remainder. What did his widow and his son get

Answers

Answer:

Widow's Share = Rs 500.05

Son's share = Rs 1400.14

Step-by-step explanation:

Property = 4000.40

Widow get share = 0.125

So, Share of Widow = 0.125 * 4000.40

Widow's Share = Rs 500.05

Remaining Property = 4000.40 - 500.05

Remaining Property = 3500.35

Son's share = 0.4 * 3500.35

Son's share = Rs 1400.14

To solve this problem, we will follow these steps:
1. Calculate the widow's share of the property.
2. Determine the remainder of the property after the widow has received her share.
3. Calculate the son's share of the remainder of the property.
Step 1: Calculate the widow's share.
The widow gets 0.125 (or 12.5%) of the total property. The total property is valued at 4000.40 units (where the unit could be in rupees, dollars, etc.).
Widow's share = Total property * Widow's share percentage
              = 4000.40 * 0.125
Let's calculate that:
Widow's share = 4000.40 * 0.125
              = 500.05
So, the widow gets 500.05 units.
Step 2: Determine the remainder of the property.
Now, subtract the widow's share from the total property to find out how much is left for the son to receive his share from.
Remainder of property = Total property - Widow's share
                      = 4000.40 - 500.05
Let's calculate that:
Remainder of property = 4000.40 - 500.05
                      = 3500.35
Now we have 3500.35 units remaining after the widow has received her share.
Step 3: Calculate the son's share.
The son gets 0.4 (or 40%) of the remainder of the property.
Son's share = Remainder of property * Son's share percentage
            = 3500.35 * 0.4
Let's calculate that:
Son's share = 3500.35 * 0.4
            = 1400.14
So, the son gets 1400.14 units.
To summarize, the widow receives 500.05 units of the property, and the son receives 1400.14 units of the property after the widow has received her share.


At the movie theatre, child admission is $5.20 and adult admission is $9.80
. On Tuesday, 147 tickets were sold for a total sales of $1054.20. How many child tickets were sold that day?

Answers

Answer:

  84 child tickets were sold

Step-by-step explanation:

Had they all been adult tickets, revenue would have been ...

  $9.80 × 147 = $1440.60

It was less by ...

  $1440.60 -1054.20 = $386.40

The child's ticket costs less by ...

  $9.80 -5.20 = $4.60

so there must have been $386.40/$4.60 = 84 child tickets sold.

__

Replacing an adult ticket with a child ticket reduces the revenue by $4.60 without changing the number of tickets sold.

_____

You can let c represent the number of child tickets sold. Then (147 -c) is the number of adult tickets sold, and total revenue is ...

  5.20c + 9.80(147 -c) = 1054.20

  -4.60c +1440.60 = 1054.20 . . . . simplify

  -4.60c = -386.40 . . . . . . . . . . . . . subtract 1440.60

  c = 386.40/4.60 = 84

What is the volume of the oblique cone? Round to the nearest tenth. 142.4 cubic units 142.4 square units 196.0 cubic units 196.0 square units

Answers

Answer:

142.4 cubic units

Step-by-step explanation:

Formula: π * r²

Radius = 4

Height = 8.5

Volume = 1/3 x 3.14 x (4)^2 x 8.5 =

142.4 cubic units

Final answer:

The volume of an oblique cone is given in cubic units. The two options presented as cubic units are 142.4 and 196.0. Without additional measurements, we cannot calculate the exact volume, but we know that the volume must be one of these two options.

Explanation:

The question is asking to determine which of the provided values represents the volume of an oblique cone. Volume is the measure of space occupied by a three-dimensional object and is expressed in cubic units. In general, the volume of a cone can be calculated using the formula V = (1/3)πr²h, where 'r' is the radius of the base, 'h' is the height, and π is Pi, approximately 3.14159. Since an oblique cone has a circular base but is tilted, the formula for its volume is the same as that of a right cone.

Looking at the options provided, we need to determine which value most likely represents the volume of a cone. Since volume is expressed in cubic units, the correct answer will be in cubic units, not square units. Therefore, we can immediately eliminate the options with 'square units' as they represent an area measure instead of volume.

Thus the potential answers could either be 142.4 cubic units or 196.0 cubic units. Without additional information, such as the dimensions of the base and the height, we cannot perform the calculation to further refine the answer. However, the question might be simplifying the process by providing the answer directly, and it is up to the student to choose between the given cubic unit options based on an understanding of volumes rounding procedures, if applicable.

The Greek mathematician Eratosthenes (ca. 276-195 BC) measured the circumference of the earthfrom the following observations. He noticed that on a certain day the sun shone directly down a deep wellin Syene (modern Aswan). At the same time in Alexandrea, 500 miles north (on the same meridian), therays of the sun shone at an angle of 7.2° to the zenith. Use this information to find theradius and circumference of the earth.

Answers

Answer:

Radius of the Earth is 3978.8 Miles

Circumference of the Earth is 25000 Miles

Step-by-step explanation:

The angle of the sun shone at an angle of 7.2° to the zenith

This means that the angle of the sector of the circle is 7.2° (θ)

S = Length of the sector of the circle = 500 miles

r = radius of earth

Converting 7.2° to radians

[tex]\theta =7.2\frac{\pi}{180}[/tex]

[tex]S=r\theta\\\Rightarrow r=\frac{S}{\theta}\\\Rightarrow r=\frac{500}{7.2\frac{\pi}{180}}\\\Rightarrow r=3978.8\ Miles[/tex]

∴ Radius of the Earth is 3978.8 Miles

[tex]C=2\pi r\\\Rightarrow C=2\times \pi \frac{500}{7.2\frac{\pi}{180}}\\\Rightarrow C=25000\ Miles[/tex]

∴ Circumference of the Earth is 25000 Miles

The radius and circumference are respectively; r = 3978.86 miles and C = 25000 miles

What is the radius and circumference?

We are told that the angle of the sun shone at an angle of 7.2° to the zenith. Thus, we can liken this to the angle of a sector and so;

Angle of the sector of the circle; θ = 7.2° = 0.125664 rad

Length of the sector of the circle; S = 500 miles

Formula for length of arc is;

S = rθ

where;

S is length of arc

r is radius

θ is angle of sector in radians

Thus;

r = S/θ = 500/0.125664

r = 3978.86 miles

Formula for circumference is;

C = 2πr

C = 2 * π * 3978.86

C = 25000 miles

Read more about Circumference at; https://brainly.com/question/14283575

Helppppppp please quickly

Answers

Answer:

For [tex]3,604\ books[/tex] the cost for both methods will be the same

Step-by-step explanation:

Let

y ------> the production cost

x ------> the number of books

we know that

First production Method

[tex]y=19.25x+22,427[/tex] -------> equation A

Second production Method

[tex]y=10.50x+53,962[/tex] -------> equation B

Solve the system of equations

Equate equation A and equation B and solve for x

[tex]19.25x+22,427=10.50x+53,962[/tex]

[tex]19.25x-10.50x=53,962-22,427[/tex]

[tex]8.75x=31,535[/tex]

[tex]x=3,604\ books[/tex]

The solution generated by the calculator is 5.779E–8. Describe how to interpret the solution.

Answers

Answer:

5.779 x 10^-8 =0.00000005779

Step-by-step explanation:

The E-8 at the end means the number is multiplied by 10^-8.

So 5.779E-8=5.779 x 10^-8

A negative power means move the decimal place that many places to the left

So 5.779 x 10^-8 =0.00000005779

Answer:

Sample response: The E indicates scientific notation. The first number is the coefficient of the number in scientific notation. This number is multiplied by a power of 10. The number following the E, which is –8, is the exponent, and the base is 10.

Step-by-step explanation:

2020

Zoe has $3.25 worth of dimes and quarters. She has 6 more quarters than dimes. Determine the number of dimes and the number of quarters that Zoe has.

Answers

Answer:

quarters = 6+x

dimes = x

Total value = 325

Dime value = 10

Quarter value = 25

Step-by-step explanation:

25x+150+10x=325 (simplify)

35x=175

x=5  

6+5 = 11  

Hence Zoe has 5 dimes and 11 quarters.

Hope this helps!!❤

If a baseball player hits a baseball from 4 feet off the ground with an initial velocity of 64 feet per second, how long will it take the baseball to hit the ground? Use the equation h = −16t2 + 4t + 4. Round your answer to the nearest hundredth.
please answer asap

Answers

Answer:

t = 4.06 sec

Step-by-step explanation:

First of all, if the initial velocity is 64 feet per second, then the parabola should actually look like this:

[tex]h(t)=-16t^2+64t+4[/tex]

The initial velocity is in the place of our linear term, so it should be 64 not just 4.

Anyways, the h(t) value represents the height of the object after a certain number of seconds, t, it was launched from the initial height. We are looking for the length of time it takes the object to hit the ground.  The height of something on the ground is 0.  So we replace h(t) with a 0 and factor to solve for the values of t:

[tex]0=-16t^2+64t+4[/tex]

If you plug that into the quadratic formula to factor it, you will get that the values of t are

t = -.06 seconds and

t = 4.06 seconds

We all know that the 2 things in math that will never EVER be negative are time and distance/measures, so we can safely disregard the negative value of time.  

It takes the ball 4.06 seconds to hit the ground when it is launched from an initial height of 4 feet.

Let's say that you are interested in opening an inverstment account that you will keep for at least 20 years. Compare the future values of that account using simple interest and compound interest if the interest rate is 2.6% and is compounded annually. Which type of interest (simple or compound) would you choose for your investment and why?

Answers

Answer:

over 20 years, the value of the compound interest account is about 10% moremy choice is the compound interest account because of its higher earnings

Step-by-step explanation:

For principal amount P, the future value of the simple interest account will be ...

  P(1 + rt) = P(1 + .026·20) = 1.52P

The future value of the compound interest account will be ...

  P(1 +r)^t = P(1.026^20) ≈ 1.6708875P

The value of the compound interest account is about 10% greater after 20 years.

I would choose the compound interest account because it has a higher rate of return.

Dirt cut 2 ft deep from a section of land 33 ft by 65 ft is used to fill a section 23 ft by 22ft to a depth of 4 how many cubic yards of dirt are left after the fill

Answers

Answer:

  83 25/27 yd³

Step-by-step explanation:

Assuming a 4 ft depth of fill, the cut volume is ...

  (2 ft)(33 ft)(65 ft) = 4290 ft³

The fill volume is ...

  (23 ft)(22 ft)(4 ft) = 2024 ft³

The left over dirt occupies a volume of ...

  4290 ft³ -2024 ft³ = 2266 ft³ = (2266 ft³)(1 yd³)/(27 ft³) = 83 25/27 yd³

Of what numbers does the binary system consist of

Answers

Answer:

0 and 1

Step-by-step explanation:

binary

0 and 1


Binary numbers

URGENT PLEASE HELP WITH THIS MATH QUESTION ALSO IT WOULD BE GREAT IF SOMEONE CAN HELP ME WITH SOME OTHER QUESTIONS

Answers

Answer:

Area=14.22π

Step-by-step explanation:

Area=πr²(C/360)

C  is the central angle in degrees

r  is the radius of the circle of which the sector is part.

Area = π(8)²(80/360)

Area=π(64)(0.2222)

Area=π(14.22)

Area=14.22π....

What is the radius of the following circle?

Answers

Answer:

r = +2√3

Step-by-step explanation:

The equation of a circle with center at (0, 0) and radius r is

x^2 + y^2 = r^2.

Here we have

x^2 + y^2 = 12,

and so we can deduce that r^2 = 12.  Then r = +2√3.

Answer:

The radius is: [tex]2\sqrt{3}[/tex]

Step-by-step explanation:

The equation of a circle in center-radius form is:

[tex](x - h)^2 + (y - k)^2 = r^2[/tex]

Where the center is at the point (h, k) and the radius is "r".

So, given the equation of the circle:

[tex]x^2+y^2=12[/tex]

You can identify that:

[tex]r^2=12[/tex]

Then, solving for "r", you get that the radius of this circle is:

[tex]r=\sqrt{12}\\\\r=2\sqrt{3}[/tex]

Other Questions
What is the beat solution to the system? X-y+2z=-7 y+z=1 x-2y-3z=0 Standing at an arrival gate, you scan the faces of the passengers as they walk off the plane as you look for your friend. This visual information is being processed in your _____ lobe. what is the midpoint of the line segment with endpoints ( 1,-6) (-3,4) m=7/8 divided by m= 1/7How do I solve for m? Why do mountains form around big bend When you eat pizza, the body will respond to the sodium you ingest by: a.controlling water movement tightly to prevent any fluctuations in body weight. b.turning off the thirst signal to reduce additional intake of fluids. c.signaling the kidneys to immediately begin removing fluid from the body. d.shifting water back into the bloodstream to reduce the sodium concentration. e.first signaling immediate thirst to offset the sodium intake. List fabrication methods of composite Materials. The primary function of the lymphatic system is In 20 to 25 words each, describe how socialization occurs in each of the following developmental periods: a. Childhood (birth to age 12): b. Adolescence (ages 13-17): c. Transitional Adulthood (ages 18-29): d. The Middle Years (ages 30-65): e. The Older Years (ages 65 and above): Which method would you use to prove that the two triangles are congruent?SASSSSAASASA What is the difference between a parameter and a statistic? A parameter is an aspect of an individual subject or object being measured. A statistic is a numerical measurement describing data from a sample. A parameter is an aspect of an individual subject or object being measured. A statistic is a numerical measurement describing data from a population. A parameter is a numerical measurement describing data from a sample. A statistic is an aspect of an individual subject or object being measured. A parameter is a numerical measurement describing data from a sample. A statistic is a numerical measurement describing data from a population. A parameter is a numerical measurement describing data from a population. A statistic is a numerical measurement describing data from a sample. A parameter is a numerical measurement describing data from a population. A statistic is an aspect of an individual subject or object being measured. Argentina.Nosotros noa. conocenb. conocemosconozcod. conocePlease select the best answer from the choices provided00< ooo0 A truck with 36-in.-diameter wheels is traveling at 55 mi/h.How many revolutions per minute do the wheels make? Find the GCF. 36x3 and 48x4 On January 1, 2018, Magnus Corporation had 60,000 shares of $1 par value common stock issued and outstanding. During the year, the following transactions occurred: Mar. 1 Issued 35,000 shares of common stock for $550,000. June 1 Declared a cash dividend of $2.00 per share to stockholders of record on June 15. July 30 Paid the $2.00 cash dividend. Dec. 1 Purchased 5,000 shares of common stock for the treasury for $22 per share. Dec. 15 Declared a cash dividend on outstanding shares of $2.20 per share to stockholders of record on December 31.Prepare journal entries to record the above transactions. El nio quiere que yo le ____________________ un regalo para su cumpleaos.a) dab) doc) dd) doy The equation of motion is not valid without the assumption of an inertial frame. a) True b)- false Consider a satellite in a circular low Mars orbit, 300 km above the planetary surface. Use Newton's Law of Universal Gravitation and the concepts introduced in this section to answer the questions below. Use the following quantities in your calculations and pay close attention to unit conversions.Radius of Mars: R=3396km Mass of Mars: M=6.4191023kg Universal gravitational constant: G=6.6741011m3/kg/s2 What is the orbital velocity of the satellite? g You've just attended a football game with your friend Kaylee, who has Type I diabetes mellitus. Though Kaylee drank only one beer during the game, she is having trouble walking straight, her speech is slurred, and she is not making sense. What is the most likely explanation for Kaylee's current behavior, and how could you help her? Happiness in marriage is entirely a matter of chance. True or false