Classify each number below as an integer or not.

Classify Each Number Below As An Integer Or Not.

Answers

Answer 1

Answer:

1. yes

2. no

3. yes

4. no

5. yes

Step-by-step explanation:

The method i use is if the number is not a fraction than it is an integer. besides 6 for some reason.

Here is the catch if the fraction can be simplified into a whole number than it is an integer.


Related Questions

The coordinates of the verticals of JKL are J(-2,1), K(-1,3) and L(-3,4). Can someone please check my answer?

Answers

Your answer is correct

Use complete sentences to describe what it means to prove a statement in Geometry.

Answers

Answer:

Step-by-step explanation:

To use the information and to show, using work, how to step by step solve a problem.

Answer:

He's correct.

Step-by-step explanation:

A pond is being drained through an outlet pipe, then will be filled through an inlet pipe. If the inlet pipe can fill the pond in 9 hours and the outlet pipe can empty the pond in 15 hours, how long would it take to fill the pond if the outlet pipe was left open?

Answers

Answer:

22.5 hours

Step-by-step explanation:

I am using "1 pond" to mean the volume of water that fits in the pond.

The inlet pipe fills the pond in 9 hours.

The filling rate is (1 pond)/(9 hours) = 1/9 pond/hour

The outlet pipe empties the pond in 15 hours.

The emptying rate is (1 pond)/(15 hours) = 1/15 pond per hour

The difference in rates is the net rate at which the pond is filling up.

1/9 pond/hour - 1/15 pond/hour =

= 5/45 pond/hour - 3/45 pond /hour

= 2/45 pond/hour

The pond is filling at a rate of 2/45 pond/hour.

To find the time it takes to fill the pond, we divide 1 pond by the rate.

(1 pond)/(2/45 pond/hour) = 45/2 hour = 22.5 hours

What are the solutions of the following equation?
4|x -9| +9 = -3|x -9| +9 4∣x−9∣+9=−3∣x−9∣+9

Answers

Answer:

x = 9

Step-by-step explanation:

4∣x−9∣+9 = −3∣x−9∣+9

cancel equal terms on both sides of the equation

4∣x−9∣+9 = −3∣x−9∣+9

the statement is true but only if both sides equal 0

4∣x − 9∣= −3∣x − 9∣4 x | x - 9| = 0−3∣x − 9∣= 0

solve the equation for x

4x |x -9| = 0

divide both sides of the equation by 4

|x-9| = 0

when the absolute value of x - 9 equals 0, then x - 9 = 0

x - 9 = 0

move the constant to the right side and change it´s sign

x - 9 = 0x = 9

so the answer would be x = 9

Answer: it's x=9

Step-by-step explanation:

In which pair of numbers is the first number a multiple of the second number?

Group of answer choices

27, 9

25, 6

8, 72

52, 3

Answers

Answer:

27,9

Step-by-step explanation:

9x3=27

To do such problems we need to know the concept of multiple of a number.

A multiple is a number that is the result of multiplying a number by an integer (not a fraction).

Given options,

a.)  27, 9

We can write 27 as 9 x 3, therefore, we can see that 27 is a multiple of 9.

b.)  25, 6

We can write 25 as 5 x 5, we can see that 25 is not a multiple of 6.

c.) 8, 72

We can write 8 as 2 x 2 x 2, we can see that 8 is not a multiple of 72.

d.)  52, 3

We can write 52 as 2 x 2 x 13, we can see that 52 is not a multiple of 3.

Learn more about Multiple:

https://brainly.com/question/1562995

what is the numerical coefficient of the term 10x

Answers

Answer:

10

Step-by-step explanation:

10x = 10 · x =(10)(x)

The numerical coefficient of the term 10x is 10.

HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16​

Answers

Answer:

Step-by-step explanation:

Oof, all 6?  That's not fun.  

I'm going to show you one for the first bunch, (4-12) and hopefully you can get the rest.  If not let me know and I can more carefully work you through some others on here.

4)  So first we need the angle.  How do we find that?  Well, we know it's somewhere between 270 and 360 degrees (or 3pi/2 and 2pi radians) since it's in the fourth quadrant.    The method to finding the angle is ifferent for each quadrant, but it's nice to know around where you'll get.  Anyway,, if we take 360 and subtract that little space  that is unlabeled  we will know  the rest.    Hopefully that makes sense, but let me know if not, it's important to understand.  Maybe think of what happens if you add the two together, you get around the whole circle then.  

Anyway, to find that little sliver, we are going to construct a right triangle wherethe x axis is one side.  If you draw a line connecting point p and the x axis you have this right triangle.  I am going to call this sliver we don't know s.  ANyway, now we use trig here.  

s = arcsin(3/5) (you can find 5 pretty easily but let me know if you don't see it.)

You may think to use -3 instead of 3, and  it wouldn't be a huge mistake, it will just give you the negative version of what we want.  

Anyway, now we know theta is 360-s (or 2pi-s).  You can solve s or leave it as arcsin(3/5) so you don't have to round.

Now we can solve the trig functions.  If you don't know the sum and difference trig identities  you will have to round.  They are pretty simple formula though.  For instance, sin(2pi - arcsin(3/5)) = sin(2pi)cos(arcsin(3/5))-cos(2pi)sin(arcsin(3/5)) = 0 - 3/5 = -3/5  You will also want to know that s = arcsin(3/5) = arccos(4/5) = arctan(3/4).  ROunding will get you close but not exact.

Again, let me know ifyou need any more help, they should just be a lot of doing the same thing over and over and over again though.  

14)  For 14 and 16 you just need to know how the graphs of sin, cos and tan look.  Is this something you have trouble with?  Like could you draw the graphs at the intervals of increasing/ decrasing and all.  if not I can give a quick explanation.

Donnie and Tania are math tutors. The amount Donnie charges for a session h hours long is represented by the function D(h) = 40h + 10. Tania charges a flat fee of $30 plus $15 an hour. Write a function, T(h), that represents the amount in dollars that Tania charges for h hours of tutoring. Graph both functions on the same coordinate grid, and label each line. Compare the slopes and y-intercepts of the graphs.

Answers

Answer:

Step-by-step explanation:

Answer:

[tex]T(h)=15h+30[/tex]

The graph is shown below.

Step-by-step explanation:

The amount Donnie charges for a session h hours long is represented by the function

[tex]D(h)=40h+10[/tex]

Tania charges a flat fee of $30 plus $15 an hour. The amount in dollars that Tania charges for h hours of tutoring is represented by the function

[tex]T(h)=15h+30[/tex]

Slope intercept form of a line is y=mx+b, where m is slope and b is y-intercept.

For Donnie:

Slope = 40 and y-intercept = 10

For Tania:

Slope = 15 and y-intercept = 30

It means slope of Donnie is greater than Tania and y-intercept of Tania is greater than Donnie.

Table of values for Donnie:

x      y

0     10

1     50

2     90

Table of values for Tania:

x      y

0     30

1     45

2     60

Plot these ordered pair on same coordinate plane and connect them to draw both functions.

The graph is shown below.

What is the lower quartile of 27,5,11,13,10,8,14,18,7 a. 7 b. 7.5 c. 8 d. 8.5

Answers

Answer:

Lower Quartile = 7.

Step-by-step explanation:

Given  : 27,5,11,13,10,8,14,18,7

To find : What is the lower quartile .

Solution : We have given 27, 5, 11, 13, 10, 8,  14 , 18 , 7.

Step 1 : Arrange in order

5 , 7 ,8 ,10 ,11, 13 , 14 ,18 , 27.

Step 2 : divide in to Quartile

Lower Q1 = 5 ,7 ,8

Middle Q2 = 10, 11 , 13.

Highest Q3 = 14 ,18 , 27.

Hence Lower Quartile = 7.

Therefore, Lower Quartile = 7.

Answer:

A=7!

Step-by-step explanation:

Fill in the table using this function rule.
y=28 - 3x
X Y
1
3
4
6

Answers

Answer:

So, you just end up plugging in your numbers.

y = 28 - 3(1)

y = 28-3

y = 25

Y = 28 - 3(3)

y = 28 - 9

y = 19

y = 28 - 3x

y = 28 - 3(4)

y = 28 - 12

y = 16

y = 28 - 3x

y = 28 - 3(6)

y = 28 - 18

y = 10

Step-by-step explanation:

The completed table is:

X   Y

1   25

3   19

4   16

6   10

How to fill the table

To fill in the table using the function rule y = 28 - 3x, we can substitute the given values of x into the equation to find the corresponding values of y.

X Y

1 28 - 3(1) = 28 - 3 = 25

3 28 - 3(3) = 28 - 9 = 19

4 28 - 3(4) = 28 - 12 = 16

6 28 - 3(6) = 28 - 18 = 10

So, the completed table is:

X Y

1 25

3 19

4 16

6 10

For each value of x, we substituted it into the function rule and performed the necessary calculations to determine the corresponding value of y.

Learn more about function rule at

https://brainly.com/question/30139621

#SPJ6

Assume that a bacteria population doubles every second. Which of the following tables of data, with X representing time in seconds and y representing the count of bacteria, could represent the bacteria population with respect for time?
(answers in the pic)​

Answers

Answer: Table A

Step-by-step explanation:

Because it doubles every second. At 0s, its 3. Then at 1s, it doubles which means 3x2=6, which is in table. then at 2s, that doubles to 6x2=12....and so on

What type of number is -5.41? 1. Whole number 2. integer 3. Rational 4. Irrational

Answers

3. it’s rational ...........
Final answer:

The number -5.41 can be classified as a Rational number because it can be expressed as a fraction where both the numerator (-541) and the denominator (100) are integers and it's not a whole number or an integer because it's negative and has a decimal part.

Explanation:

The number -5.41 is a type of number classified as a Rational number. Rational numbers are numbers that can be written as a fraction, where both the numerator and the denominator are integers (whole numbers), and the denominator is not zero. They can also be positive, negative, or zero, and they can be represented as decimals that terminate (like 0.2 or -1.75) or repeat (like 0.333... or -0.666...).

The number -5.41 is not a positive whole number nor an integer because it is negative and has a decimal part, which disqualifies it from both categories. An irrational number, on the other hand, is a number that cannot be expressed as a simple fraction, which clearly does not apply to -5.41 as it can be easily expressed by the fraction -541/100.

Learn more about Rational Numbers here:

https://brainly.com/question/24398433

#SPJ3

Find the sum. Write the addition property you used. 28+29+42=

Answers

Step-by-step explanation:

28+29=57

57+42=99 so 99 should be your answer

Answer:

Step-by-step explanation:

First your gonna brake up each number and seperate them for example

28

29

42

then your going to add up the ones side, 8,9,2, to get 19.

Then your going to add the tens side, 2,2,4, to get 8.

take the one from 19 and put it in the tens place to get 9 in the tens and 9 in the ones.

put 9 and 9 together to get 99.

I can’t do math someone help me out lol 6.51-9.32+h=1.02

Answers

Answer:

h = 3.83

Step-by-step explanation:

Solve for h:

h - 2.81 = 1.02

Add 2.8100000000000005` to both sides:

h + (-2.81 + 2.81) = 2.81 + 1.02

2.81 - 2.81 = 0:

h = 1.02 + 2.81

1.02 + 2.81 = 3.83:

Answer: h = 3.83

In A ABC and ARST, BC = 15, AC = 9, and RS = 6. Find the lengths of the missing sides of AABC and
ARST that would make a ABC ~ ARST by a scale factor of Include a sketch and show your work.

Answers

Picture how you show picture if it not paper to sketch on

Please answer this correctly

Answers

Answer:

Kang

Step-by-step explanation:

Janelle ran longer than Kang

Janelle>Kang

Janelle ran shorter than Annette

Annette>Janelle>Kang

Janelle ran longer than John and John ran longer than Kang

Annette>Janelle>John>Kang

Kang will be the answer :DD

If y(x) = 3(x+5) +-, what is
a + 2)?

Answers

Answer:

f(a + 2) = 3a + 21

Step-by-step explanation:

f(x) = 3(x+5)

x = a + 2

f(a + 2) = 3(a + 2 + 5)

f(a + 2) = 3(a + 7)

f(a + 2) = 3a + 21


50 grams/Centimeters = kilograms/meters

Answers

Answer:

50g/cm is equal to 5 kg/m

Step-by-step explanation:

as we know that:

10g/cm = 1 kg/m

so,

50g/cm = 5kg/m

10g/cm = 1kg/m
50g/cm = ?? Kg/m
?? Kg/m = 50/10 = 5
So 10g/cm = 5 kg/m

in the diagram below, <AFB = <EFD. if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)°, find m<AFE​

Answers

Answer:

m<AFE​ =  128°.

Step-by-step explanation:

Step 1: Find the value of x

Angle EFD + Angle DFC = Angle EFC

5x + 6 + 19x - 15 = 17x + 19

24x - 9 = 17x + 19

7x = 28

x = 4

Step 2: Find all angles

Angle AFB=Angle EFD= 5x + 6

5(4) + 6 = 26°

Angle DFC = 19x - 15

19(4) - 15 = 61°

Step 3: Find angle AFE

Line BD is a straight line and all angles on a straight line are equal to 180°.

Angle AFB + Angle AFE + Angle EFD = 180°

26 + BFC + 26 = 180°

BFC = 180 - 52

BFC = 128°

Therefore, m<AFE​ is equal to 128°.

!!

The measure of m<AFE  if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)° is 128degrees

Angle is the point where two or more lines meet. From the given diagram:

m<EFC = m<EFD + m<DFC

Given the following:

m<EFC = 17x + 19

m<EFD = 5x+6

m<DFC = 19x - 15

Substitute the given values into the expression

17x + 19 = 5x + 6 + 19x - 15

17x - 5x - 19x = -19 - 9

12x - 19x = -28

-7x = - 28

x = 28/7

x= 4

Get the angle m<AFE

m<AFE  + m<ABF + m<EFD = 180

Since  <AFB = <EFD

m<AFE  + m<EFD + m<EFD = 180

m<AFE + 2m<EFD = 180

m<AFE + 2(5x+6) = 180

m<AFE + 2(5(4) + 6) = 180

m<AFE +2(26) = 180

m<AFE + 52 = 180

m<AFE = 180 - 52

m<AFE = 128 degrees

Hence the measure of m<AFE is 128degrees

Learn more here: https://brainly.com/question/16686601

If every 9 Points Equals 1 Dollar How Many Points Do I Need To Make One Thousand Dollars?


First One To Answer Correctly Gets Brainliest!


It has to be correct.

pls hurry

Answers

Since 9 points is a dollar and you need a thousand dollars multiply 1000 by 9

9*1000=9000

Answer: 9,000$

Step-by-step explanation: if 9 = $1

You multiply 9 by $1,000 and get 9,000

The following system has a solution: x= 10,y=-3,z = 14
3x + 7y-z= -5
9x-y-4z = 17
5x - 12y-z=0

Answers

Answer:

3x + 7y - z = -5

Step-by-step explanation:

[tex]3(10) + 7(-3) - 14 = -5 \\ \\ 30 - 21 - 14 = -5[/tex]

I am joyous to assist you anytime.

Need help ASAP 3 question. WILL GIVE BRAINLIEST

Answers

Answer:

Exact form: 11/125

Decimal Form: 0.088

Step-by-step explanation:

The table shows the favorite subjects of students in a recent survey
Did more students choose art or math,Explain
Art:4/25
Math:0.28

Answers

Answer:

More students chose math

Step-by-step explanation:

4/25 can be converted into a percent and percents are out of 100, so 25x4 is equal to 100 and 4 x 4 is equal to 16

so 4/25 is 16%

    0.28 is 28%    Because you move the decimal to places to the right

A square painting measures 2 meters on each side. What is the area of the painting square centimeters?

Answers

Answer:

40,000cm

Step-by-step explanation:

there are 100cm in every meter, so each side of the square is 200cm long. to find the area multiply length times height (the length and the height are equal on a square)

200x200 = 40,000

Answer:

[tex]\boxed{\text{40 000 cm}^{2}}[/tex]

Step-by-step explanation:

A = l²

[tex]A = (\text{2 m})^{2} \times \left (\dfrac{\text{100 cm}}{\text{1 m}}\right )^{2} = \textbf{40 000 cm}^{2}\\\\\text{The area of the painting is $\boxed{\textbf{40 000 cm}^{2}}$}[/tex]

What is 40% of $20 show the work too please :)

Answers

Answer:

$8

Step-by-step explanation:

Convert 40% into decimal  form: 0.4

Multiply it by 20.

=0.4 * 20

Simplify 0.4 * 20

= 8

How to use Distributive property for -3 (z+2)

Answers

Answer:

Step-by-step explanation:

First multiply the number outside of the parentheses (-3) by the first number inside the parentheses (z). Next you can do that same thing but with multiplying the number outside of the parentheses by the second number in the parentheses (2). Then you add your two answers, but since you have a variable in there you just put down the simplified version which is just your two products from before.

It took Reza 2 hours to edit 6 math
problems. At that rate, how many math
problems could Reza edit in 45 hours?

Answers

Answer:

135

Step-by-step explanation:

My method 45 hours - 1  so i could divide by 2 because its 2 hours every 6 problems and 1 hour would be 3 math problems we can add that to the total

44 / 2 = 22, 22 * 6 = 132, 132 + 3 = 135

Alternate method

45 * 3 = 135

135
45/2 =22.5x 6 = 135

help please and thank you!!!

Answers

Hello!

So, let's go over some information we know. We know that all the interior angles of a triangle add up to 180 degrees. We know that a line measures 180 degrees. We, therefore, know that angles which make up a line are supplementary, and must add up to 180 degrees.

So, first, we can find angle ABC. We can find this because angle ABC and ABT add up to 180 degrees, and we know the measure of ABT to be 125 degrees. Therefore:

ABC + 125 = 180

ABC = 55 degrees

Now, we can find angle ACB. We can find this as we have angle ABC and CAB, and angle ACB + ABC + CAB = 180 degrees (as they are the three interior angles of triangle ABC). ABC measures 55 degrees, and CAB 60 degrees. Therefore:

55 + 60 + ACB = 180

115 + ACB = 180

ACB = 65 degrees

Finally, we can find angle ACR based off of ACB, as ACB and ACR make up one line, and, therefore, add up to 180 degrees. ACB measures 65 degrees.

ACR + 65 = 180

ACR = 115 degrees

Therefore, your answer is choice 2, or 115 degrees.

Hope this helps!

Answer:

115°

Step-by-step explanation:

m∠ABC = 180° - 125° = 55° (angles in a straight line add up to 180°)

Given that m∠CAB = 60°,

Then m∠ACR = m∠CAB + m∠ABC (exterior angle is equal to the sum of opposite interior angles).

m∠ACR = 60° + 55° = 115°

what is 25 ties 3 divited by 19

Answers

Answer:3.9

Step-by-step explanation:

Answer: 25 x 3 divided by 19 is 3.94736842105

Your water is 5/6 full. After Tennis Practice, the bottle is 3/8 full. How much water did you drink?

Answers

Answer: 11/24

Step-by-step explanation:

5/6 - 3/8 = 11/24

Other Questions
Which of the following reacts differently when exposed to strong acids than when it is exposed to weak acids? A. Electrical current conduction B. pH paper test C. Reaction with magnesium D. All of these What is 8363 x 9374)? Plz help which one is larger A satellite is launched 600 km from the surface of the earth, with an initial velocity of 8333.3 m./s, acting parallel to the tangent of the surface of the earth. Assuming the radius of the earth to be 6378 km and that is 5.976 * 10^6 kg, determine the eccentricity of the orbit. Safety symbols alert you to possible danger and identify safety equipment you should use true or false Students at a bake sale sell bags of cookies for $2.35 each and bags of miniature muffins for $1.75 each. While selling their baked goods, the students also received a $20 donation. The amount of money the students make from selling c bags of cookies and m bags of muffins can be modeled by the expression 2.35c + 1.75m + 20. Interpret the expression 2.35c + 1.75m in this context.AThe expression 2.35c + 1.75m represents the money earned from selling c bags of cookies.BThe expression 2.35c + 1.75m represents the money earned from selling m bags of muffins.CThe expression 2.35c + 1.75m represents the money earned from selling c bags of cookies and m bags of muffins.DThe expression 2.35c + 1.75m represents the money earned from selling one bag of cookies and one bag of muffins. The activities of people traveling to and staying in places outside their usual environments for not more than one consecutive year for leisure, business, and other purposes is called _____.A hospitalityB tourismC travelD transportation Suppose executives at an art museum know that 100 adults are willing to pay $12 for admission to the museum on a weekday. Suppose the executives also know that 200 students are willing to pay $8 for admission on a weekday. The cost of operating the museum on a weekday is $2,000. How much profit will the museum earn if it engages in price discrimination? $1,200 $2,600 $1,600$800 Help last question!!! 1. Quin sirve las comidas en un restaurante?2. Qu tienen que pagar los clientes en un restaurante?3. Cmo te gusta la carne?4. Cuando comes una ensalada, prefieres una salsa de aceite y vinagre o de mayonesa? Which statement describes a constitutional government? A The head of the government is chosen independently B The government's power over peoples lives is limited C The power of government is broadD Power is concentrated at the national level What is the suffix of the word resentment? A certain test preparation course is designed to help students improve their scores on the LSAT exam. A mock exam is given at the beginning and end of the course to determine the effectiveness of the course. The following measurements are the net change in 6 students' scores on the exam after completing the course:23,18,23,12,13,23Using these data, construct a 80% confidence interval for the average net change in a student's score after completing the course. Assume the population is approximately normal. Each floor in the old headquarters of Oldham Bank and Trust is 14 feet inheight except the ground floor, which is 24 feet high. There are 5 floors. Howtall is the building? PLEASE HELP ASAP 98 POINTS, WILL GIVE BRAINLIEST, 5 STAR RATING, AND THANKS.ONLY TO THE CORRECT ANSWERER! What strand of mRNA would be produced from the strand of DNA shownbelow?GCATTAO A. GCATTAO B. CGT AATO C. CGT UUTO D. CGU AAU Bringing supply and demand together in an efficient and orderly fashion is the primary role of _____________. _____ is a key ingredient in the philosophy of marketing; it occurs when people give up something in order to receive something that they would rather have. A farmer produces both beans and corn on her farm. If she must give up 16 bushels of corn to be able to get 6 bushels of beans, then her opportunity cost of 1 bushel of beans is _______(A) 0.38 bushels of corn(B) 16.00 bushels of corn(C) 2.67 bushels of corn(D) 2.99 bushels of corn Because God is faithful to us, what should our response to Him be?