Don Price bought a house for $70,000. He rents the house for $900 per month. He has $700 in monthly expenses.
What is the amount of the annual rent?
What is the amount of annual expenses?
What is his rate of income to the nearest tenth of a percent?

Answers

Answer 1
Annual rent=$10,800
Annual Expenses=$8,400
Rate of income=moneyt
Answer 2
the annual rent is 900*12, which is 10800
The annual expense is 700*12, which is 8400

Related Questions

Suppose you borrow 13,000 for four years at 7% toward the purchase of a car.

Answers

Amount borrowed, P = 13000
Interest, i = 0.07/12 per month
number of periods (months),  n = 4*12 = 48

Monthly payment, 
[tex]A=\frac{P(i*(1+i)^n)}{(1+i)^n-1}[/tex]
[tex]=\frac{13000(.07/12*(1+.07/12)^{48}}{(1+.07/12)^{48}-1}[/tex]
=311.30   (to the nearest cent)

can someone help me with this

Answers

x is the supplement to 40°.
x is 140°.

Oliver earns $93 per week mowing lawns in his neighborhood. Which expression can be used to show how much money he earns in 6 weeks?

Answers

1 week  = $93
6 weeks = $93 x 6 
6 weeks = $558

what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

Find a rational number that is between 9.5 and 9.7

Answers

9.5000032 is one such number

9.5000032 i think i'm not sure

Subtract -7a^2 + 3a -9 from 5a^2 - 6a -4

Answer should be polynomial in standard form

Answers

5a^2 - 6a -4 - (-7a^2 + 3a -9)
=5a^2 - 6a -4 + 7a^2 -  3a + 9
=12a^2 - 9a + 5

answer
12a^2 - 9a + 5

The polynomial in standard form after subtraction will be 12a² - 9a + 5.

What is polynomial?

A polynomial expression is an algebraic expression with variables and coefficients. Unknown variables are what they're termed. We can use addition, subtraction, and other mathematical operations. However, a variable is not divisible.

It simply implies subtracting something from an entity, group, location, etc. Subtracting from a collection or a list of ways is known as subtraction.

The polynomial is given below.

-7a² + 3a - 9 and 5a² - 6a - 4

Subtract -7a² + 3a - 9 from 5a² - 6a - 4, then we have

(5a² - 6a - 4) - (-7a² + 3a - 9)

Simplify the equation, then we have

(5a² - 6a - 4) - (-7a² + 3a - 9)

5a² - 6a - 4 +  7a² - 3a + 9

12a² - 9a + 5

The polynomial in standard form after subtraction will be 12a² - 9a + 5.

More about the polynomial link is given below.

https://brainly.com/question/17822016

#SPJ5

Which tax bracket a person Falls into is determined by his or her ?
A. Salary
B. Taxable income
C. AGI
D.Gross income

Answers

Answer:

B. Taxable income

Step-by-step explanation:

Taxable income is the amount of money that a person earns in a period of time that can be taxated by the government, you could earn money that is not taxated, for example life insurances from deceased family members is not taxable, also upto a certain amount of money as a gift is not taxable. So the tax bracket a person falls into depends solely on the taxable income that they make in a year.

Final answer:

B: Taxable income

A person's tax bracket is determined by their taxable income, which is their adjusted gross income minus any deductions and exemptions.

Explanation:

The tax bracket into which a person falls is determined by his or her taxable income.

Taxable income is the amount of income that is subject to the official tax rates for each bracket.

This figure is the result of subtracting deductions and exemptions from your adjusted gross income (AGI). It's important to note that taxable income and AGI are not the same, as the latter is your income from various sources minus specific adjustments but before deductions and exemptions.

To calculate taxable income, the equation used is: taxable income = adjusted gross income - (deductions + exemptions).

Income Tax Brackets are the thresholds of income that are taxed at varying rates. As an individual’s taxable income increases, not only does the amount of tax paid increase, but typically so does the percentage of tax on additional income, as the tax rates in higher brackets are usually higher.

Item 6 Find the amount of time. I=$30, P=$500, r=3% The amount of time is years.

Answers

Use the interest formula, fill in the given numbers, and solve for the remaining value.
.. I = Prt
.. 30 = 500*.03*t . . . . . substitute the given values
.. 30/15 = t = 2 . . . . . . . divide by the coefficient of t and evaluate

The time is 2 years.

What percent of 20 is 2?

Answers

2 is 10% of 20.

2/10 = 1/10 = 10%

Hope this helps!

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

Tim and Maria went on a cruise together, but agreed to divide their expenses. The cost of the room was R. The cost of the horseback riding excursion was $125 per person. The historic tour was $214 per couple. Tim and Maria equally split the cost of the room, but Tim also paid for both his and Maria's horseback riding excursion. Maria was to pay for the historic tour but only had to paid half price because the cruise line scratched their luggage, so they offered to pay the other half.

Answers

Tim paid more. $250 + 1/2R 
Maria only paid 107+ 1/2R
Hope that helps.

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

holly is making a stir fry holly measures 5/8 cup of chicken and then adds 1/9 cup more how much chicken did holly use altogether?

Answers

Final answer:

Holly used a total of 53/72 cup of chicken for her stir fry, by adding 5/8 cup and 1/9 cup together after converting them to have a common denominator.

Explanation:

Holly is making a stir fry and needs to calculate the total amount of chicken she has used.

Initially, she measures 5/8 cup of chicken and then adds 1/9 cup of chicken.

To find the total amount of chicken used, we need to add these two fractions together.

This is a simple arithmetic operation called fraction addition.

First, we find a common denominator for the two fractions, which in this case is 72 (the least common multiple of 8 and 9).

Next, we convert each fraction to an equivalent fraction with the common denominator.

The fraction 5/8 converts to (5×72)/(8×72) = 45/72, and 1/9 converts to (1×72)/(9×72) = 8/72.

Now that the fractions share a common denominator, we can add them:

45/72 + 8/72 = 53/72

The sum of the two fractions gives us the total amount of chicken used by Holly, which is 53/72 cup.

Final answer:

To find out how much chicken Holly used altogether, we need to add the two fractions together. First, we find a common denominator, then convert the fractions to have that denominator. Finally, we add the numerators and keep the denominator the same. Holly used a total of 53/72 cup of chicken for her stir fry.

Explanation:

To find out how much chicken Holly used altogether, we need to add the two fractions together.

First, we need to find a common denominator for these fractions. The smallest number that both 8 and 9 can divide into is 72.

Next, we need to convert both fractions to have a denominator of 72. To do this, we multiply the numerator and denominator of each fraction by the same number.

For the first fraction, we multiply both the numerator and denominator by 9, obtaining 45/72. For the second fraction, we multiply both the numerator and denominator by 8, obtaining 8/72.

Now that we have both fractions with a denominator of 72, we can add them together. 45/72 + 8/72 = 53/72.

Therefore, Holly used a total of 53/72 cup of chicken for her stir fry.

you have 3 bolts that are 3/8, 5/16 and 5/8 long. Which is the shortest?

Answers

5/16 is the shortest

explain why the pattern for the products of 10s facts is a straight column.

Answers

When we are multiplying our 10's, we are basically adding another 10 each time.  Since the number grid is in rows of 10, adding another 10 is the same as moving down one row, which makes a straight column.

You can use the fact that when staying in the same column and walking from row to row, there is addition of 10.

Why is there straight column for multiple of 10 in number counting having 10 columns?

First choose a row. Since there are 10 columns per row, thus changing the row by choosing same column will give difference of 10.

Go down in rows on same column and you'll see increment of 10, and go up in rows with same column and you'll see decrement of 10.

]This is the key reason behind that straight columns of multiples of 10s.

Let the number be x

Then moving from row to row on the same column, we will get:

x, x + 10, x + 20, x + 30, ...

If x = 10, we get 10, 20, 30, 40 which are multiples of 10 since

[tex]10 + 10 = 10 \times 2\\10 + 20 = 10 \times 3\\...\\ 10 + 10y = 10 \times (y+1)[/tex]

See the given table below:

[tex]\begin{array}{cccc}\cdots&x&\cdots & 10\\\cdots & x + 10 & \cdots & 10 + 10 = 10 \times 2 = 20\\\cdots & x+ 10 + 10 = x + 20 & \cdots & 20 + 10 = 10 \times 2 + 10 = 10 \times 3 = 30\\\cdots & \cdots & \cdots & \cdots\end{array}[/tex]

The last column, therefore, has multiples of 10 since adding 10 for multiple of 10 is like multiplying 10 by one bigger number which is same as increasing multiples of 10.

Learn more about multiples here:

https://brainly.com/question/10520264

What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60

calculate the distance nathan rides his bike if he rides 9/12 mile each day for 3 days

Answers

[tex]\bf 3\cdot \cfrac{9}{12}\implies 3\cdot \cfrac{\underline{3}\cdot 3}{\underline{3}\cdot 4}\implies 3\cdot \cfrac{3}{4}\implies \cfrac{3\cdot 3}{4}\implies \cfrac{9}{4}\implies 2\frac{1}{4}[/tex]

Final answer:

Nathan rides a total distance of 2 1/4 miles when he rides 9/12 of a mile each day for 3 days. To calculate this, multiply the daily distance by the number of days and simplify the result.

Explanation:

To calculate the distance Nathan rides his bike if he rides 9/12 of a mile each day for 3 days, you need to multiply the distance he rides in a day by the number of days he rides.

Distance per day: 9/12 mileNumber of days: 3 days

So, the total distance Nathan rides is:

9/12 mile/day × 3 days = 27/12 miles

To simplify the fraction:

Divide the numerator (27) and the denominator (12) by their greatest common divisor, which is 3.This gives us 9/4 miles.Convert 9/4 to a mixed number: 9 ÷ 4 = 2 with a remainder of 1, so it's 2 1/4 miles.

Therefore, Nathan rides a total distance of 2 1/4 miles over the three days.

Can some explain this to me do i need to covert something or can someone explain it to me how in gonna get the answer i try to do it and i got 60 and i think it is wrong

Answers

cross multiply:

2.5 ft x 16.5 ft = 41.25 ft

now divide:

41.25 / 8.25 = 5

L = 5 feet 

The first Earth Day was observed on April 22, 1970. Since then, the week of April 22 has been Earth Week, a time for showing support for environmental causes. Fans Cafe is offering a reduced refill rate for soft drinks during Earth Week for anyone purchasing a Fans mug. The mug costs $2.95 filled with 16 ounces of soft drink. The refill price is $0.50. A 16-ounce drink in a disposable cup costs $0.85. What is the approximate break-even point for buying the mug and refills in comparison to buying soft drinks in disposable cups? a. (5, 7.8) c. (4, 6.7) b. (8, 0.5) d. (7, 5.95)

Answers

Let x specify the number of 16 ounce serving

 

If you buy the mug you acquire the first serving including the mug.

 

So the price of x is:

295 + 50(x - 1)

 

the x - 1 here shows that the first serving with the mug.

And then count the whole thing in cents.

The fee of throwaway cups is 85x

 

So breakeven is computed by:

295 + 50(x - 1) = 85x

295 + 50x - 50 = 85x

245 = 35x

x = 245/35 = 7

 

Checking this will give us:

mug 2.95 + 50*6 = 5.95

disposable

8.5*7 = 5.95

 

So the answer is D.

The break-even point occurs after nine soft drink purchases(8,0.5). Hence, the correct option is b.

First, let's consider the cost of the mug with a soft drink:

Mug + Soft drink = $2.95

Next, the cost of each refill:

Refill = $0.50

Then, the cost of a soft drink in a disposable cup:

Disposable cup soft drink = $0.85

To find the break-even point, let's set up the equation. Let x be the number of refills (including the initial drink from the mug):

Cost of mug with initial drink + (Cost per refill × number of refills) = Cost of disposable cup × number of drinks

2.95 + 0.50x = 0.85x

Now we solve for x:

2.95 = 0.85x - 0.50x

2.95 = 0.35x

x = 2.95 / 0.35

x = 8.43

Since we cannot have a fraction of a refill, we will round up to the nearest whole number. Therefore, the break-even point is after 9 refills (including the initial drink from the mug).

The approximate break-even point is after purchasing nine 16-ounce drinks. Therefore, the correct answer is (8, 0.5).

the model below represents the equation 2x + 3 = 11. What is the first step in finding the value of x?

Answers

do 2 times a number(4), and see if when you add 3 you get 11. Hope i can help out!

Answer:

B

Step-by-step explanation:

picture:)

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

A deck of cards has three yellow cards and five green cards. One green card is drawn from the deck and not replaced. One more card is random drawn. Find the probability that the second card is yellow.
3/8
3/7
15/56

Answers

3/7 seven because it is 3 yellow out of 7 cards

The probability that the second card is yellow after one green card is drawn and not replaced from a deck of 8 (3 yellow, 5 green) cards is 3/7. The correct answer is option b) 3/7.

To find the probability that the second card is yellow after drawing one green card (and not replacing it), we can follow these steps:

Determine the total number of cards in the deck after the first green card is drawn. Initially, we have 3 yellow + 5 green = 8 cards. After drawing one green card, there are 7 cards left (2 yellow and 5 green).Since one green card is drawn and not replaced, the number of green cards that remain in the deck is now 4, and the total number of cards left in the deck is 7.Calculate the probability of drawing a yellow card from the remaining 7 cards. There are still 3 yellow cards, so the probability is 3 yellow cards divided by the 7 total remaining cards.

Thus, the probability that the second card is yellow is 3/7, which is corresponding to (b).

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

write the computation in words for an expression that uses all four operations (addition, subtraction, multiplication, and division). Then write the expression for the words

Answers

Expression that has all the four basic mathematical operators can be written as [tex](\dfrac{a+b}{2}) \times [c-(a+b)][/tex].

What is an Expression?

In mathematics, an expression is defined as a set of numbers, variables, and mathematical operations formed according to rules dependent on the context.

Let's take three numbers, a, b, and c.

Now, the expression in the word can be written as, The product of the addition of the first two numbers (a and b), divided by 2 and the sum subtracted from c.

If we try to write the above statement as an expression then we can write it as,

[tex](\dfrac{a+b}{2}) \times [c-(a+b)][/tex]

Hence, An expression that has all the four basic mathematical operators can be written as [tex](\dfrac{a+b}{2}) \times [c-(a+b)][/tex].

Learn more about Expression:

https://brainly.com/question/13947055

Final answer:

The computation described involves multiplying six by three, adding eight, subtracting two, and then dividing the result by four. This results in the expression ((6 * 3) + 8 - 2) / 4, incorporating all four basic mathematical operations.

Explanation:

Writing the computation in words for an expression that uses all four operations - addition, subtraction, multiplication, and division - helps in understanding the application of these operations in a complex expression. Here's an example:

First, multiply six by three, then add eight to the product. From this sum, subtract two. Finally, divide the result by four. This sequence of operations involves all four basic mathematical operations.

The corresponding expression for the described computation is: ((6 * 3) + 8 - 2) / 4.

Breaking down the expression:

Multiplication: 6 * 3Addition: + 8Subtraction: - 2Division: / 4

What is the volume of a cylinder with a radius of 5cm and height of 10cm? Use 3.14 for pi.

Answers

Volume of a cylinder an be found using the formula πr²h.

(3.14)(5)²(10)
785.

Hope i helped :)

Solve for x X^2+10+12=36
X=-12 or x=2
X

Answers

Are you saying the x=-12 and x=2 are given and used to substitute for x?
If meant to write [tex]x^2+10x+12=36[/tex], then your answer is correct; [tex]x=-12[/tex] or [tex] x=2 [/tex]

Can you prove that def=hgf? Justify your answer.

Answers

We can prove that ΔDEF = ΔHGF as follows; A: Yes, the triangles are congruent by SAS.

How to prove the congruence

Side DE is congruent to GH as seen in the fact that both have two line marks. These are opposite angles (EFD and HFG) and these angles are congruent.

Note that the opposite sides of a triangle are congruent and corresponding angles are also congruent. This is true of angles DEF and HGF. So, we can conclude that the triangles are congruent by SAS.

Complete Question:

Can you prove that ADEF = AHGF? Justify your answer:

A: Yes, the triangles are congruent by SAS. B: Yes, the triangles are congruent by SSS. C: Yes, the triangles are congruent by SSA. D: No, not enough information is given

Other Questions
Why were the citizens of Washington, DC, not allowed to vote in presidential elections until 1961? The Meiji reformers sent hundreds of Japanese to the United States and Europe to _____. Which of these BEST describes how public opinion is usually researched in the United States? Why did genie face stunted mental and physical growth o valor da expresso a=1,67 . 10 + 3,95 . 10 I need help with this question! Which sentence uses syntax for emphasis?Ask not what your country can do for you. . . John F. KennedyIt is easier to do a job right than to explain why you didn't. . Martin Van BurenThe price of freedom is eternal vigilance.. . .Thomas JeffersonThe brave men, living and dead, who struggled here, have consecrated it. . . Abraham Lincoln, the sum of two numbers is 40. the sum of the smaller and 5 times the larger is 144. find the numbers. converse of the Pythagorean theorem Ozone, O3(g), is a form of elemental oxygen produced during electrical discharge. Is Hf for O3(g) necessarily zero? Yes or no question? Please help me with this one. WILL MARK BRAINLIEST psilocybin is what type of drug Lee only wants to print columns A-D of a spreadsheet he is working on. What sequence should he use to accomplish this? select cell A1, File, Print, Print Selection, Print Active sheets select A-D with his mouse, File, Print, Print Selection, Print Active sheets, Print select cell A1, File, Print, Print Active sheets, Print Selection select A-D with his mouse, File, Print, Print Active sheets, Print Selection, Print Help me please I dont understand Anthony is passionate about politics and enjoys sharing and discussing his views with others over the internet. anthony regularly visits several popular political ____, which are web pages designed to facilitate written discussions between people on specific subjects. Suppose u1, u2, ..., un are independent random variables and for every i = 1, ..., n, ui has a uniform distribution over [0, 1]. define z = min(u1, ..., un). find thec.d.f. and the p.d.f of z. GIVE TWO EXAMPLES OF HOW YOUR PEERS INFLUENCE YOUR ACTIONS AND DECISIONS. In 1868, 32 African Americans who had been elected to the Georgia General Assembly were removed from office. What was a result of this illegal action? A) Georgia was placed under military control the following year. B) The Supreme Court ordered them to get their positions reinstated. C) All new elections were held for all positions in the General Assembly. D) Governor Rufus Bullock was impeached for violating the U.S. Constitution. What is the domain of the given function? {(3, 2), (6, 1), (1, 4), (5, 9), (4, 0)} {x | x = 4, 1, 3, 5, 6} {y | y = 2, 0, 1, 4, 9} {x | x = 4, 2, 1, 0, 1, 3, 4, 5, 6, 9} {y | y = 4, 2, 1, 0, 1, 3, 4, 5, 6, 9} What is the major goal in treating dissociative identity disorder (did)?? Eighty percent of the dogs have completed obedience classes. How many of the dogs have completed obedience classes? Five dogs of different breeds 4 dogs 3 dogs 2 dogs 1 dog