Emma took a taxi from the airport to her house. She paid a flat fee of $5$5 plus $3.70 per mile. The fare came to $42. For Emma's taxi ride, which equation gives the correct distance (
d.d in miles?

Answers

Answer 1
$42/$3.70=11.35 miles to the airport
Answer 2

Answer:

5+3.7⋅d=42

Welcome!


Related Questions

what is the value of z so that -9 and 9 are both solutipns fo x^2+z=103

Answers

well, we know the solutions are -9 and 9, so, let's just FOIL them then

[tex]\bf \begin{cases} x=-9\implies &x+9=0\\ x=9\implies &x-9=0 \end{cases} \\\\\\ (x+9)(x-9)=\stackrel{original~polynomial}{0}\implies x^2+0x-81=0 \\\\\\ x^2\underline{-81}=0\qquad \textit{and we can write }-81=\underline{-103+22} \\\\\\ x^2\underline{-103+22}=0\implies x^2+22=103[/tex]

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

Need help asap please.

Answers

y intercept  replace x with 0 and solve = -3

axis of symmetry =  x = 3/2

coordinates of the vertex = (2,-9)

vertex form =  y = (x-7)^2-19

solution set = no real solution
 

the area of a rectangle is 20x^2-27x-8.the length is 4x+1. What is the width?

Answers

w= (5x - 8) this is your answer
⇒w=(5x−8)
Explanation:
Let width be w
Then w(4x+1)=20x2−27x−8
So
(?x+?)(4x+1)=20x2−27x−8
Note that
5×4=20 and (−8)×(+1)=−8
⇒w(4x+1)
=(5x-8)(4x+1)=20x2+5x−32x−8
⇒w(5x−8)

helppppppppppppppppppppppppppppppppppp

Answers

Answer: the third option m(x) = - 7x

Justification:

1) For a function to have inverse function, the original function has to be one to one. This is for the original function two (or more) images cannot have different inputs. That condition is satisfied by the function m(x) = - 7x, since it is a straigh line.

2) the function b (x) = x^2 + 3 is a parabola. That means that, except by the vertex, every image is realated with two inputs.

For example, b(x) = 103 => x^2 = 103 - 3 = 100 => x = 10 and x = -10.

3) For the function d(x) = - 9, you cannot tell the input value for the image because it is the same image for any value of x.

4) The function p(x) = |x| also has a pair of images for the same value of x (excpet for the vertex).

For example, for x = - 100 and x = 100, p(x) = 100, so you cannot tell the x value given the p(x) value.


Mario bought a shirt priced at $ 24.99 and a pair of pants priced at $ 39.99. For these items, he paid a total of $ 69.53 , sales tax included. What was the sales tax rate?

Answers

24.99 + 39.99 = 64.98

69.53-64.98 = 4.55


4.55/69.53 = 0.0654 = 6.5% sales tax

Choose the correct sum of the polynomials (4x3 − 2x − 9) + (2x3 + 5x + 3). 6x3 − 3x − 6 2x3 − 7x − 12 6x3 + 3x − 6 2x3 + 3x − 3

Answers

(4x^3 - 2x - 9) + (2x^3 + 5x + 3) 

= 4x^3 - 2x - 9 + 2x^3 + 5x + 3

= 6x^3 + 3x - 6 (Answer: C)

Answer:

[tex]6x^3+3x -6[/tex]

Step-by-step explanation:

(4x3 − 2x − 9) + (2x3 + 5x + 3)

[tex](4x^3 - 2x - 9) + (2x^3 + 5x + 3)[/tex]

To add two polynomials, we remove the parenthesis

[tex]4x^3 - 2x - 9+2x^3 + 5x + 3[/tex]

To add it , we combine like terms. we add the like terms

[tex]4x^3+2x^3- 2x+ 5x - 9+ 3[/tex]

[tex]6x^3+3x -6[/tex]

a) Explain...
b) What is the probability that a person without HIV will have a test come out positive?
c) What is the probability that a person with HIV will have a test come out negative?
d) What is the probability that a person with HIV will have a test come out positive?

Answers

a) The cell corresponding to a positive diagnosis when the person has antibodies present as well as the cell for a negative diagnosis when the person has no antibodies present are the cells representing a CORRECT diagnosis.

The cell corresponding to a negative diagnosis when you actually have antibodies present is called a FALSE NEGATIVE and is considered as a TYPE II error.


The cell corresponding to a positive diagnosis when you actually don't have antibodies present is called a FALSE POSITIVE and is considered as a TYPE I error.

For the tree diagram for the questions below, refer to the picture attached.

b) To know the probability that a person without HIV will be diagnosed positive (false positive), we just trace the tree diagram from population to "antibodies not present" to "positive". The tree diagram will give us a value of 0.00588.

ANSWER: 
The probability of a false positive is 0.00588 or 0.588%.

c) We do the same thing as the previous subproblem to determine the probability that a person with HIV will be diagnosed as negative. We trace the tree diagram from population to "antibodies present" to "negative". The tree diagram will give us a value of 0.003.

ANSWER: 
The probability of a false negative is 0.003 or 0.3%.

d) Same thing for this subproblem. We trace the tree diagram from population to "antibodies present" to "positive" to know that the value is 0.01997.

ANSWER: 
The probability that a person with HIV will be diagnosed as positive is 0.01997 or 1.997%.

The bear population increases at a rate of 3% each year. There are 1462 bears this year. How many bears will there be in 10 years?

Answers

Final answer:

The bear population will be approximately 1965 bears in 10 years.

Explanation:

To calculate the bear population in 10 years, we can use the formula for exponential growth:

P = P₀(1 + r)ⁿ

Where:

P is the final population

P₀ is the initial population

r is the growth rate as a decimal

n is the number of years

In this case, the initial population (P₀) is 1462, the growth rate (r) is 3% (0.03), and the number of years (n) is 10. Plugging these values into the formula, we get:

P = 1462(1 + 0.03)¹⁰ ≈ 1965.32

Therefore, there will be approximately 1965 bears in 10 years.

There are 6 speakers at a conference: Ms. Sally, Ms. Elaine, Ms. Boo-Koo, Mr. Adam, Mr. Jones, and Mr. Tall. In how many ways can we order the speakers so that Mr. Adam doesn’t speak first?

Answers

Problems such as this are called counting problems. They often ask "in how many way" something can occur. Here we have 6 speakers and need to arrange them in order. We can use the counting principle which tells us that the number of ways can be obtained by considering how many speakers could be chosen for each position (first, second, third, ...  sixth) and multiplying these.

Even though there are 6 speakers, Mr. Adam cannot go first so there are 5 choices for who goes first. That leaves 5 speakers who can go second. As we already picked two people, there are 4 speakers who can go third and 3 who can go fourth. That leaves 2 that can go fifth and 1 that is left for the last slot.

The total number of ways is given by (5)(5)(4)(3)(2)(1) = 600

The length of a rectangle is 5 ft less than three times the width, and the area of the rectangle is 28 ft2 . find the dimensions of the rectangle.

Answers

Let the width = w.
Then the length is 3w - 5.
The area = LW = 28

w(3w - 5) = 28

3w^2 - 5w = 28

3w^2 - 5w - 28 = 0

(3w + 7)(w - 4) = 0

3w + 7 = 0 or w - 4 = 0

w = -7/3 or w = 4

The width of a rectangle cannot be a negative number, so we discard w = -7/3.

The width is 4 ft.
The length is 3w - 5 = 3(4) - 5 = 12 - 5 = 7
The length is 7 ft

Answer: The dimensions are length 7 ft and width 4 ft.
Final answer:

The rectangle has a width of approximately 4.18ft and a length of approximately 7.55ft. These are obtained by setting up and solving a system of equations based on the given information.

Explanation:

Let's start by setting up equations based on the problem statement. Let's denote the width of the rectangle as

w and the length as l. From the problem, we know two things: one is that the length is 5 feet less than three times the width, which can be written as  l = 3w - 5. The second thing we know is that the area of the rectangle, which is obtained by multiplying the length by the width, is 28 square feet, written as l*w = 28 . By substituting the first equation into the second, we can solve for w: (3w - 5)*w = 28

. This simplifies to a quadratic equation 3w^2 - 5w - 28 = 0 which can be solved to give w=~4.18 ft and w=-2.02ft. Because the width cannot be negative, we discard the second solution. Substituting w=~4.18ft into l = 3w -5 gives

l=~7.55 ft . Therefore, the dimensions of the rectangle are approximately 4.18ft (width) and 7.55ft (length).

Learn more about Algebra here:

https://brainly.com/question/32436021

#SPJ2

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

Please help ASAP!!! 42 points and will mark brainliest for RIGHT answer!!!

Answers

I am pretty sure its B, 

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

A waterfall has a height of 900 feet. A pebble is thrown upward from the top of the falls with an initial velocity of 12 feet per second. The​ height, h, of the pebble after t seconds is given by the equation h equals negative 16 t squared plus 12 t plus 900. How long after the pebble is thrown will it hit the​ ground?

Answers

A graphing calculator shows the time to be 7.884 seconds.

_____
The quadratic formula tells you the time is
.. t = (-12 -√(12^2 +4*16*900))/(-32) = (3/8)*(1 +√401) . . . seconds

Final answer:

To find when the pebble hits the ground, solve for time using the quadratic equation from the given height function, resulting in around 6 seconds.

Explanation:

To find how long the pebble takes to hit the ground, we need to find the time t when its height h becomes 0. This means we need to solve the equation for t when h = 0:

-16t² + 12t + 900 = 0

This is a quadratic equation, and we can solve it using various methods like factoring, the quadratic formula, or completing the square. Here, we'll use the quadratic formula:

t = (-b ± √(b² - 4ac)) / 2a

where a = -16, b = 12, and c = 900:

t = (-12 ± √(12² - 4 × -16 × 900)) / (2 × -16)

t = (-12 ± √(614400)) / -32

t ≈ (-12 ± 247.88) / -32

There are two possible solutions:

t1 ≈ 25.50 seconds

t2 ≈ -5.50 seconds (we can discard this since time cannot be negative)

The pebble will hit the ground approximately 6 seconds after it is thrown.

what is 1000x - 1x?

A) 101x
B) 1001x
C) 99x
D) 999x

Answers

Your answer is D) 999x
Hey there!

Let's think of what 1000x means.

We know that multiplication is repeated addition. For example, 5(5) = 5+5+5+5+5. It's 5 added five times.

It's no different here. That means we have x 1000 times. If we look at a simpler situation:

5x - 3x, we have (x + x + x + x + x) - (x + x + x)

That means we're getting rid of 3 x's, which means we have 2x. If we have different coefficients but the same variable, we can just subtract or add the coefficients but keep the variable. That means:

4x - 2x = 2x and 10x - 5x = 5x

Now, we can do this problem. We want:

(1000-1)x = 999x

Your answer is D.

Hope this helps!

What is the equation of the function y=3/x translated 4 units to the right and 5 units down

Answers

Translate 4 units right by replacing x with x-4. Translate down by subtracting that amount from the function.

y = 3/(x -4) -5

Answer:

The required equation is [tex]g(x)=\frac{3}{x-4}-5[/tex].

Step-by-step explanation:

The given function is

[tex]y=\frac{3}{x}[/tex]

It can be written as

[tex]f(x)=\frac{3}{x}[/tex]

The transformation of a function is defined as

[tex]g(x)=f(x+a)+b[/tex]

Where, a represents the horizontal shift and b represents the vertical shift.

If a>0, then the function f(x) shifts a units left and a<0, then the function f(x) shifts a units right.

If b>0, then the function f(x) shifts b units up and b<0, then the function f(x) shifts b units down.

Since the function translated 4 units to the right and 5 units down, therefore the value of a is -4 and bis -5.

[tex]g(x)=f(x-4)-5[/tex]

[tex]g(x)=\frac{3}{x-4}-5[/tex]                         [tex][\because f(x)=\frac{3}{x}][/tex]

Therefore the required equation is [tex]g(x)=\frac{3}{x-4}-5[/tex].

Y varies directly as x and inversely as the square root of w; write the sentence as an equation.

Answers

Y varies directly as x
y = kx

Y varies inversely as the square root of w
y = [tex] \frac{k}{ \sqrt{w} } [/tex]
Final answer:

The relationship where y varies directly as x and inversely as the square root of w can be represented by the equation y = k * (x / sqrt(w)). Here, k is a constant of proportionality.

Explanation:

From the statement given, we can deduce an equation representing a direct proportionality to x and an inverse proportionality to the square root of w.

In mathematics, direct and inverse proportionality relationships are commonly depicted as y = kx and y = k/x respectively, where k is a constant. For direct proportionality, as x increases, y also increases. Contrastingly, for inverse proportionality, as x increases, y decreases.

Given the statement, we can represent the relationship as follows: y = k * (x / sqrt(w)).

Here, y varies directly as x and inversely as the square root of w. The constant k is the constant of proportionality which can be determined based on specific values of x, y and w.

Learn more about Proportionality here:

https://brainly.com/question/32437705

#SPJ3

Look at the picture below // 99 points // PLEASEE HELPP

Answers

The answer will be A





area of hexagon = 3√3a^2 / 2 = 3√3 (18^2) / 2 = 842
area of rectangle = 21*18 = 378

area of shaded = 842 - 378 = 464

answer
A) 464  square units

Write an equation for the line that is parallel to the given line and that passes through the given point.

y =3/4 x – 9; (–8, –18)

Answers

Parallel to y = 3/4x - 9 and passes through (-8, -18)

Identify the slope : our slope is 3/4

Remember that parallel equations have the same slope, so both slopes are 3/4

Now, we have to find the y-intercept. Simply plug everything into the slope intercept form equation.

y = mx + b

(-18) = (3/4)(-8) + b

Simplify.

-18 = -6 + b

Add 6 to both sides.

-18 + 6 = b

Therefore, our y-intercept is -12.

Now plug everything into the slope intercept form.

y = mx + b

y = 3/4x - 12

~Hope I helped!~
Final answer:

To write an equation for a line that is parallel to a given line and passes through a given point, use the point-slope form of the linear equation. The slope of the parallel line is equal to the slope of the given line. Plug in the values and simplify to get the equation.

Explanation:

To find an equation for a line that is parallel to the given line and passes through the given point, we need to use the fact that parallel lines have the same slope. The slope of the given line is 3/4, so the slope of the parallel line will also be 3/4. Using the point-slope form of a linear equation, we can write the equation:



y - y1 = m(x - x1)



where (x1, y1) is the given point and m is the slope. Plugging in the values, we get:



y - (-18) = 3/4(x - (-8))



Simplifying the equation gives:



y + 18 = 3/4(x + 8)



Next, we can distribute the 3/4 to both terms in the parentheses:



y + 18 = 3/4x + 6



To isolate y, we subtract 18 from both sides:



y = 3/4x - 12

Learn more about the Equation of a Parallel Line here:

https://brainly.com/question/402319

#SPJ11

Help me ASAP!!! THANKS!




RANDOM ANSWERS WILL BE MODERATED!

Answers

It isn't clear to me whether you want a graph of that region, or you want a graph of a function that has those characteristics. Either way, ....

Which of the following is the solution of 5e^2x-4=11

Answers

Asked and answered elsewhere.
https://brainly.com/question/9020620

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

Makhaya is required to spend more than 300 minutes to complete assignments, and he can use at most 20 paper sheets. Let W denote the number of writing assignments he completes and M the number of math assignments he completes.

Write an inequality that represents the condition based on the number of minutes.

Write an inequality that represents the condition based on the number of paper sheets.

Answers

The constraint on time is
.. 75W +15M ≥ 300 . . . . . . . minutes

The constraint on paper is
.. 3W +M ≤ 20 . . . . . . . . . . . sheets of paper

An airline requires carry on luggage to weigh at most 40 pounds. Your suitcase currently weighs 10 pounds. How many pounds p are available for you to fill your suitcase with other items?

Answers

30 pounds is available to fill the suitcase with other items.

What is Algebra?

A branch of mathematics known as algebra deals with symbols and the mathematical operations performed on them.

Variables are the name given to these symbols because they lack set values.

In order to determine the values, these symbols are also subjected to various addition, subtraction, multiplication, and division arithmetic operations.

Given:

An airline requires carry on luggage to weigh at most 40 pounds.

The Suitcase presently carry 10 pounds.

Let  p be the pound available to fill your suitcase with other items.

So, p= 40- 10

p = 30 pounds

Hence, 30 pounds is available to fill the suitcase with other items.

Learn more about Algebra here:

https://brainly.com/question/24875240

#SPJ5

PLEASE SOMEONE HELP ON THIS !!!
BRAINLIEST WILL BE GIVEN TO CORRECT ANSWER

TRY TO EXPLAIN IT....

Answers

The order will be B,C,A

B and C are both 30cm of water, but B filled up 1 minute faster than C

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

helpp me pleasweeee?!??!!

Answers

f(1/3) = 8^(1/3) +1 = 2 +1 = 3

The 2nd selection completes the table.

Match the reasons with the statements in the proof.

1. j||k, m∠3 = m∠1
If alternate interior angles are =, then lines are ||.
2. m∠1 = m∠2
Substitution
3. m∠2 = m∠3
Given
4. l||m
If lines are ||, then corresponding angles are =.

Answers

1. j||k, m∠3 = m∠1
Given

2. m∠1 = m∠2
If lines are ||, then corresponding angles are =.


3. m∠2 = m∠3
Substitution 

4. l||m
If alternate interior angles are =, then lines are ||. 

Answer:

1-given

2-if lines are parallel, then corresponding angles are equal

3-Substitution

4-if alternate interior angles are equal then lines are parallel.

Step-by-step explanation:

Given j is parallel to k,[tex]m\angle3 =m\angle 1[/tex]

We have to prove that line l is parallel to m

We  have to match reason with its correct statement in given proof.

1.j is parallel to k,[tex] m\angle 3=m\angle 1[/tex]

Reason:given

2.[tex]m\angle 1=m\angle 2[/tex]

Reason:if the lines are parallel , then corresponding angles are equal.

3.[tex]m\angle 2=m\angle 3[/tex]

Reason: substitution

4.line l is parallel to m

Reason: If alternate interior angles are equal ,then lines are parallel.

Which logarithmic equation is equivalent to the exponential equation below?
4c = 256

A. log256 c = 4
B. logc 256 = 4
C. log4 c = 256
D. log4 256 = c

Answers

The answer is D. C= log4 256

The logarithmic equation is equivalent to the exponential equation is [tex]log_4[/tex] 256 = c

The correct option is (D).

What is Logarithm Function?

Logarithms are useful for solving exponential equations and investigating the properties of exponential functions. They will also be incredibly useful in calculus, where they will be used to compute the slope of various functions and the area circumscribed by various curves.

Given:

[tex]4^c[/tex] = 256

Now, writing into Logarithmic Function we can write it as

[tex]log_4[/tex] 256 = c

If we further solve it we get

256 = [tex]4^c[/tex] (log become exponential we move from either side of Equal Sign.)

Learn more about Logarithm Function here:

https://brainly.com/question/3181916

#SPJ5

Other Questions
Reba dixon is a fifth-grade schoolteacher who earned a salary of $38,000 in 2017. she is 45 years old and has been divorced for four years. she receives $1,200 of alimony payments each month from her former husband. reba also rents out a small apartment building. this year reba received $30,000 of rental payments from tenants and she incurred $19,500 of expenses associated with the rental. reba and her daughter heather (20 years old at the end of the year) moved to georgia in january of this year. reba provides more than one-half of heather's support. they had been living in colorado for the past 15 years, but ever since her divorce, reba has been wanting to move back to georgia to be closer to her family. luckily, last december, a teaching position opened up and reba and heather decided to make the move. reba paid a moving company $2,010 to move their personal belongings, and she and heather spent two days driving the 1,426 miles to georgia. during the trip, reba paid $200 for lodging Which of these statements is true for restriction enzymes? each restriction enzyme is able to make a staggered cut at its recognition site. a given restriction enzyme will always recognize the same dna sequence, but it will cut differently depending on the species of origin of the dna. a different restriction enzyme must be used to open the vector dna than to excise the gene sequence to be cloned. any restriction enzyme can cut any piece of dna. restriction enzymes are useful in genetic engineering when they make staggered cuts in dna? What is the length of YX? Enter your answer as a decimal in the box. Round your final answer to the nearest hundredth. m_https://static.k12.com/nextgen_media/assets/8107298-NG_GMT_SemB_10_UT_06.png' simplify 2d(3) expression solve for fd=16ef^2 Read this excerpt from"The World on Turtle's Back."The birds of the sea joined together to save the woman and they broke her fall. The great sea turtle floated in the ocean and received the woman on his back without harm. The frightened woman looked around and all she could see was water and sky. She felt helpless, but the animals were determined to save her. She told them that if they could find some soil, she could plant the roots from the Great Tree that were still tangled in her hands.Based on the animals' behavior toward the woman, it is reasonable to conclude that the animalswere frightened by a creature they had never seen.felt compassion for the woman because she was scared.were hoping to live on land that the woman would create.wanted the roots from the sacred Great Tree. Among 81678167 cases of heart pacemaker malfunctions, 457457 were found to be caused by firmware, which is software programmed into the device. if the firmware is tested in 33 different pacemakers randomly selected from this batch of 81678167 and the entire batch is accepted if there are no failures, what is the probability that the firmware in the entire batch will be accepted? is this procedure likely to result in the entire batch being Traditional TV families consisted of one mother, one father and their children. This type of family structure is called a/an _______ family. A. extendedB. polygamousC. residentialD. nuclear He definition "'oxygen' means an element having an atomic weight of 8 and an atomic number of 16" is an example of: According to osha regulations, if the load on a forklift blocks the forward view, what action should be taken What type of reaction is Na2S (I) + CdNO3 (I) => CdS (s) + 2NaNO3 (I) A. Double-Displacement B. Single-DisplacementC. DecompositionD. Synthesis A skier is gliding down a slope at a constant speed. what energy transformation is taking place? How do I double the volume of a pyramid Which rhetorical element is associated with the audience?A.ethosB.logosC.pathosD.syllogism The Democratic Republic of the Congo is recognized as being possibly the ________ country in the world. PLZ HELPPPP(03.05 LC) What is the best way to combine these sentences? An angler goes fishing at 4 o'clock in the morning. That's when the fish are biting.A) An angler goes fishing at 4 o'clock in the morning because that's when the fish are biting.B) An angler goes fishing at 4 o'clock in the morning, and that's when the fish are biting.C) When the fish are biting, an angler goes fishing at 4 o'clock in the morning.D) At 4 o'clock in the morning, an angler goes fishing when the fish are biting. Which of the following is a perfect square? A. 127 B. 100 C. 13 D. 102 The volume of a gas is 4.00 liters at 293 k and constant pressure. for the volume of the gas to become 3.00 liters, the kelvin temperature must be equal to The four Galilean moons were discovered in the year 1610, but the next moon of Jupiter to be discovered, Amalthea, was not found until 1892. The distinction that was most responsible for the early discovery of the Galilean moons was their: A. orbital speeds. B. orbital periods. C. average orbital radii. D. diameters. Which measures a change in position over a period of time? A. friction B. force C. periodic motion D. speed