Pencils cost $0.24 each , and pens cost $.79 each. Mrs. Trevino bought 6 pencils and 5 pens. How much did she pay for the pencils and pens in dollars and cents?

Answers

Answer 1

Answer:

$5.39

Step-by-step explanation:

5 x .79 = 3.95

6 x .24 = 1.44

3.95 + 1.44 = 5.39

Answer 2

Answer:

For the pencils, she paid: $1.44

For the pens, she paid: $3.95

Step-by-step explanation:

Pencils cost $0.24each.

Pens cost $0.79 each.

Mrs. Trevino bought 6 pencils and 5 pens.

For the pencils, she paid: 6 × $0.24 = $1.44

For the pens, she paid: 5 × $0.79 = $3.95


Related Questions

Which ordered pair is a solution of the equation? -3x-y=6

Answers

There are an infinite number of solutions, but some that work are (-2,0), (1,-3), and (0,-6)

The correct answer is (B) Only (-3, 3).

To determine which ordered pair is a solution of the equation, you need to substitute the values of \( x \) and \( y \) into the equation and see if it holds true. Let's check:

For option A: (-4, 4)
Substituting into the equation: \( -3(-4) - 4 - 6 = 12 - 4 - 6 = 2 \) which is not equal to 0, so it's not a solution.

For option B: (-3, 3)
Substituting into the equation: \( -3(-3) - 3 - 6 = 9 - 3 - 6 = 0 \) which is equal to 0, so it is a solution.

Thus, the correct answer is (B) Only (-3, 3).

Complete question :

Which ordered pair is a solution of the equation?

-3x-y-6

Choose 1 answer:

A Only (-4, 4)

B Only (-3, 3)

C Both (-4, 4) and (-3,3)

D Neither.

What fraction of an inch is 1 cm? I know the answer but don’t know how to show it.

Answers

Final answer:

1 cm is approximately 0.394 inches which is the fraction of an inch for 1 cm. This can be discovered by inverting the known relation (1 in = 2.54 cm) or by using dimensional analysis method.

Explanation:

The subject of your question concerns the conversion between the units of length, centimeters and inches. In measurement, it is known that 1 inch is equal to 2.54 centimeters. However, you asked what fraction of an inch is 1 centimeter. To find this, we need to invert the relation we know. Thus, 1 cm = 1/2.54 inches.

For a clearer understanding, 2.54 cm is exactly 1 inch (by definition). To find the fractional value of 1 cm in inches, we simply take the reciprocal (invert) of 2.54, because we are essentially asking the question, 'How many cm are there in 1 inch?'. This yields about 0.394, and thus 1 cm = 0.394 inch approximately.

Using Dimensional Analysis

Another method to understand this conversion is dimensional analysis. It tells us that we're able to convert one unit to another as long as the units are in the same dimension (in this case, length). So based on the relation 1 inch = 2.54 cm, we establish the conversion factor of 1/2.54 = 0.394 inch/cm. So 1 cm * 0.394 inch/cm gives us 0.394 inch.

Learn more about Unit Conversion here:

https://brainly.com/question/19420601

#SPJ12

The graph shows the relationship between the volume of a rectangular prism and the volume of a square pyramid with an identical base and height. A coordinate plane showing Prism versus Pyramid. The x-axis shows Pyramid Volume in cubic units and the y-axis shows Prism Volume in cubic units. The line starts at (0, 0) and passes through (1, 3), (2, 6) and (3, 9). What is the slope of the line?

Answers

Answer:

The slope of the line is 3

Step-by-step explanation:

we know that

A relationship between two variables, x, and y, represent a proportional variation if it can be expressed in the form [tex]y/x=k[/tex] or [tex]y=kx[/tex]

In a proportional relationship the constant of proportionality k is equal to the slope m of the line and the line passes through the origin

In this problem we have a line that passes through the origin,

so

The graph shows a proportional relation ship

[tex]k=y/x[/tex]

For (1,3) ------> [tex]k=3/1=3[/tex]

For (2,6) ------> [tex]k=6/2=3[/tex]

For (3,9) ------> [tex]k=9/3=3[/tex]

The equation is

[tex]y=3x[/tex]

The slope of the line is 3

Answer:

The slope of the line is 3.

Step-by-step explanation:

In the graph x-axis shows Pyramid Volume in cubic units and the y-axis shows Prism Volume in cubic units.

The line starts at (0, 0) and passes through (1, 3), (2, 6) and (3, 9).

If a line passes through two points [tex](x_1,y_1)[/tex] and [tex](x_2,y_2)[/tex], then the slope of the line is

[tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]

Consider any two points of the line: (0, 0) and (1, 3). So, the slope of the given line is

[tex]m=\frac{3-0}{1-0}[/tex]

[tex]m=3[/tex]

Therefore, the slope of the line is 3.

(Geometry) The answers are x = 15 and y = 9 but I don't know how. Help me understand this

Answers

Check the picture below.

[tex]\bf \stackrel{\measuredangle DAC}{4y+2x}~~=~~\stackrel{\measuredangle BCA}{9y-x}\implies 2x=5y-x\implies 3x=5y\implies \boxed{x=\cfrac{5y}{3}} \\\\[-0.35em] ~\dotfill\\\\ \stackrel{\measuredangle DAB}{[(4y+2x)+35]}~~+~~\stackrel{\measuredangle ADC}{5x+4}~~=~~180\implies 4y+2x+5x+39 = 180 \\\\\\ 4y+7x+39=180\implies 4y+7x=141\implies \stackrel{\textit{substituting "x"}}{4y+7\left( \boxed{\cfrac{5y}{3}} \right)} = 141[/tex]

[tex]\bf 4y+\cfrac{35y}{3}=141\implies \stackrel{\textit{multiplying both sides by }\stackrel{LCD}{3}}{3\left( 4y+\cfrac{35y}{3} \right)=3(141)}\implies 12y+35y=423 \\\\\\ 47y=423\implies y=\cfrac{423}{47}\implies \blacktriangleright y = 9 \blacktriangleleft \\\\[-0.35em] ~\dotfill\\\\ \stackrel{\textit{since we know that}}{x=\cfrac{5y}{3}}\implies x = \cfrac{5(9)}{3}\implies \blacktriangleright x = 15 \blacktriangleleft[/tex]

What are the solutions to 3x2 + 12x +6=0 ?

Answers

Answer:

[tex]\large\boxed{x=-2-\sqrt2\ or\ x=-2+\sqrt2}[/tex]

Step-by-step explanation:

[tex]3x^2+12x+6=0\qquad\text{divide both sides by 3}\\\\\dfrac{3x^2}{3}+\dfrac{12x}{3}+\dfrac{6}{3}=\dfrac{0}{3}\\\\x^2+4x+2=0\qquad\text{subtract 2 from both sides}\\\\x^2+4x+2-2=0-2\\\\x^2+4x=-2\\\\x^2+2(x)(2)=-2\qquad\text{add}\ 2^2\ \text{to both sides}\\\\x^2+2(x)(2)+2^2=-2+2^2\qquad\text{use}\ (a+b)^2=a^2+2ab+b^2\\\\(x+2)^2=-2+4\\\\(x+2)^2=2\iff x+2=\pm\sqrt2\qquad\text{subtract 2 from both sides}\\\\x=-2\pm\sqrt2[/tex]

Find the derivative of y = 2(x^2) - x + 4 at x = 2​

Answers

Answer:

7.

Step-by-step explanation:

y = 2x^2 - x + 4

The derivative y' = 2*2x^(2-1) - 1

= 4x - 1

At x = 2 y' = 4(2) - 1 = 7.

Answer:

7

Step-by-step explanation:

Differentiate using the power rule

[tex]\frac{d}{dx}[/tex](a[tex]x^{n}[/tex]) = na[tex]x^{n-1}[/tex]

Given

y = 2x² - x + 4, then

[tex]\frac{dy}{dx}[/tex] = (2 × 2)x - 1 = 4x - 1

At x = 2 ⇒ [tex]\frac{dy}{dx}[/tex] = (4 × 2) - 1 = 8 - 1 = 7

1.
A ball is thrown into the air with an initial velocity of 22 meters per second.
The quadratic function h(t) = -4.9t2 + 22t + 5.5 represents the height of
the ball above the ground, in meters, with respect to time t, in seconds.
Part A: Determine h(3) and explain what it represents.

Answers

Answer:

The ball throw into the air with an initial velocity of 22 meters per second is 27.4 meters above the ground after 3 seconds.

Step-by-step explanation:

The quadratic function [tex]h(t) = -4.9t^2 + 22t + 5.5[/tex] represents the height of the ball above the ground, h(t), in meters, with respect to time, t, in seconds.

To find h(3), substitute t = 3 into the function expression:

[tex]h(3)=-4.9\cdot 3^2+22\cdot 3+5.5\\ \\=-4.9\cdot 9+66+5.5\\ \\=-44.1+71.5\\ \\=27.4[/tex]

Meaning: the ball throw into the air with an initial velocity of 22 meters per second is 27.4 meters above the ground after 3 seconds.

What is the change in temperature from -45°F to - 71°F?

1. 26°F
2. -116°F
3. 116°F
4. -26°F

Answers

The answer to this question would be -26

Hey there you answer is -26°F  Because, if you subtract -45 from -71 you would get -26 because it is still in the negative's place. Hope this helped! Your fellow Brainly user, GalaxyGamingKitty.

solve log2 [log3 (log4 x)]=0​

Answers

The correct answer is 2
Final answer:

Solving the nested logarithmic equation log2 [log3 (log4 x)] = 0 requires repeatedly using the concept that y = logb(x) is equivalent to x = by, resulting in x = 64.

Explanation:

To answer your question, we'll need to understand that logarithmic expressions such as log2 [log3 (log4 x)]=0 can be solved by step-by-step process called exponentiation.

First, knowing that y = logb(x) is equivalent to x = by, we can re-write the equation log2 [log3 (log4 x)] = 0 as log3 (log4 x) = 20.

Then, using the concept that the logarithm of a number raised to an exponent is the product of the exponent and the logarithm of the number, move forward to solve log4 x = 31.

Finally, applying the same rule once more gives us x = 43 = 64.

Learn more about Nested Logarithmic Equation here:

https://brainly.com/question/17260132

#SPJ11

What is the equation of the line that is perpendicular to Y= -2/3X+4 and that passes through (-2,-2)?

Y= 3/2x-10/3
Y=3/3x-5
Y=3/2x+1
Y=3/2x-2/3​

Answers

Answer:

[tex]y = \frac{3}{2}x + 1[/tex]

Step-by-step explanation:

-2 = 1½[-2] + b

-3

1 = b

y = 1½x + 1

** 1½ = 3⁄2

Perpendicular Lines have OPPOSITE MULTIPLICATIVE INVERSE RATE OF CHANGES [SLOPES]:

-⅔ →

I am joyous to assist you anytime.

Answer:

y=3/2x+1

Step-by-step explanation:

You’re trying to find the perpendicular like equation of y=-2/3x+4 that passes through (-2,-2). Use reciprocal of slope -2/3= 3/2. use y=mx+b and plug in info, (-2,-2) will be plugged in for both y and x and 3/2 will be plugged in for m making -2=(3/2)(-2)+b. Multiply the () to get -2=-3+b, add 3 to both sides of the equation to get 1=b. Use your info to make the finished equation y=3/2x+1

Please answer this correctly

Answers

Answer:

Julie

Step-by-step explanation:

She days she lives farther than Joseph and Joseph lives father than dalton

Answer:

Julie

Step-by-step explanation:

Joseph lives farther from the library than David and Dalton.

We are not sure who is closer to the library, David or Dalton, but Joseph is farther than both.

Joseph                         David          Dalton            Library

or

Joseph                         Dalton          David            Library

Julie lives farther from the library than Joseph, and David lives farther from the library than Dalton. Now we know where David and Dalton go in the figure.

Julie                 Joseph                         David          Dalton            Library

The farthest person from the library is Julie.

Answer: Julie

Imamu pays $30 each month for his gym membership. What is the change amount of money in his account after 2/3 of a year? A.-120 B.-240 C.-270 D.-360 Bob chose A as the correct answer. How did he get that answer?

Answers

Answer:

[tex]B.-240[/tex]

Bob got that by calculating the change amount of money in Imamu's account after [tex]\frac{1}{3}[/tex] of a year (4 months).

Step-by-step explanation:

You know that Imamu pays $30 each month for his gym membership.

Since there are 12 months in a year, you can find the the number of months that [tex]\frac{2}{3}[/tex] of a year represents:

[tex](12\ months)(\frac{2}{3})=\frac{24\ months}{3}=8\ months[/tex]

Now, in order to find the change amount of money in his account after [tex]\frac{2}{3}[/tex] (8 months), you must solve the following multiplication:

[tex](-30)(8)=-240[/tex]

Bob chose [tex]-120[/tex] (Option A) as the correct answer, but that is incorrect, because he got it by calculating the change amount of money in Imamu's account after [tex]\frac{1}{3}[/tex] of a year (4 months).

what is 3/10 of the way from (-3,-6) to (9,4)

Answers

we'll first off put the two points in component form, then we'll multiply that by the fraction 3/10 and those coordinates we'll simply add to the first point, anyhow, let's proceed,

[tex]\bf \textit{internal division of a segment using a fraction}\\\\ A(\stackrel{x_1}{-3}~,~\stackrel{y_1}{-6})\qquad B(\stackrel{x_2}{9}~,~\stackrel{y_2}{4})~\hspace{8em} \frac{3}{10}\textit{ of the way from }A\to B \\\\[-0.35em] ~\dotfill\\\\ \stackrel{~\hfill \textit{component form of segment AB}}{ (\stackrel{x_2}{9}-\stackrel{x_1}{(-3)}, \stackrel{y_2}{4}-\stackrel{y_1}{(-6)})\implies (9+3~,~4+6)\qquad \implies \qquad (12,10)} \\\\[-0.35em] ~\dotfill[/tex]

[tex]\bf \stackrel{~\hfill \textit{values to be added to Point A coordinates}} {\cfrac{3}{10}(12,10)\implies \cfrac{3}{10}(12)~,~\cfrac{3}{10}(10)\qquad \implies \qquad \left(\frac{18}{5}~,~3\right)} \\\\\\ \stackrel{\textit{addition of Point A coordinates and values}} {A(-3,-6)+\left( \frac{18}{5},3\right)\implies \left( -3+\frac{18}{5}~~,~~-6+3 \right)\qquad \implies \left( \frac{3}{5}~,~-3\right)}[/tex]

[x+4y+z=3
2x + y +z=11
4x + y + 2z = 23​

Answers

x+4y+z=3 ————(1)
Make x the subject of the rule in (1)
:- x=-4y-z ————(2)
2x+y+z=11 ————(3)
Substitute (2) in (3)
2(-4y-z)+y+z=11
-8y-2z+y+z=11
-7y-z=11
-z= 11+7y
z= -11+7y ————(4)
4x+y+2z=23 ————(5)
Substitute (2) & (4) in (5)
4(-y-z)+y+2(-11+7y)=23
-4y-4z+y-22+14y=23 ————(6)
Substitute (4) in (6)
-4y-4(-11+7y)+y-22+14y=23
-4y+44-28y+y-22+14y=23
-17y+22=23
17y=22-23
17y=-1
y=-1/17 ————(a)
Substitute (a) in (4)
z=-11+y
z=-11+-1/17
z=(-187-1)/17
z=-188/17 ————(b)
Substitute (a) & )b) in (2)
x=-4y-z
x=-4(-1/17)-188/17
x= 4/17-188/17
x=-184/17 ————(c)

To make sure substitute (a),(b)&(c) in 1
x+4y+z=3
-184/17+4(-1/17)+2(-188/17)=3

Solve the following equation. Then place the correct number in the box provided. 5x/8+10=2

Answers

Answer:

3 with a remaider of 2

Step-by-step explanation:

10+8=18 5/18=3 with a remainder of 2

5x/8+10=2

-10 each side of the equation

5x/8=-8

multiply each side by 8

5x=-64

divide each side by 5

And then you have your answer x=12 4/5

15. The Salton Trough has an elevation of
69 meters below sea level.
The dead Sea Depression is almost 6 times deeper.
Write and find the value of an expression
for the approximate elevation of the Dead Sea Depression.

Answers

Expression:
-69 x 6

Answer:
-414

Answer:

6(-62)

Total: -141

the angle measures are represented by algebraic expressions. determine the values of x y and z

Answers

Answer:

The value of x = 0.5, y = 0.8 and z = 0.9

Step-by-step explanation:

From the given figure. Let's form the equations

50z + 13 + 45x + [tex]\frac{19}{2}[/tex] = 90°

45x + 50z + 13 + 9.5 = 90

45x + 50z + 22.5 = 90

45x + 50z = 90 - 22.5

45x + 50z = 67.5  --------------------------(1)

[tex]\frac{225y}{2} = 90[/tex]° Because it is a right angle.

225y = 180

y = [tex]\frac{180}{225}[/tex]

y = 0.8   --------------------(2)

44x + 125y + 80z -14 = 180° because they are supplementary angles add upto 180 degrees.

44x + 125y + 80z = 180 + 14

44x +125y + 80z = 194  ------------(3)

Now plug in y = 0.8 in the above equation (3), we get

44x + 125 times 0.8 + 80z = 194

44x + 100 + 80z = 194

44x + 80z = 194 - 100

44x + 80z = 94 ---------------------(4)

Now let's solve the equation (1) and (4) using elimination method.

x = 0.5

Now plug in x = 0.5 in the equation (4) and find the value of z

44(0.5) + 80z = 94

22 + 80z = 94

80z = 94 - 22

80z = 72

z = [tex]\frac{72}{80}[/tex]

z = 0.9

Therefore, the value of x = 0.5, y = 0.8 and z = 0.9

Which ratios are equal to each other?

A.1:16 and 2:8

B. 2:32 and 4:8

C. 1:64 and 4:16

D. 1:16 and 4: 64

Answers

Answer:D

Step-by-step explanation:1 divied by 16 =16

4 divied by 64 = 16

Determine whether each pair of triangles is congruent. If so, state whether they are congruent by
SSS, SAS, or ASA. If not, explain why.

Answers

Answer:

yes they're congruent.

Final answer:

The given information does not provide specific triangles or measurements needed to determine congruency, making it impossible to answer the question.

Explanation:

The question asks about determining whether pairs of triangles are congruent and identifying the congruence criteria (SSS, SAS, ASA).

Unfortunately, the provided information does not include any pairs of triangles or any specific measurements needed to determine congruency.

Therefore, it is not possible to answer the question based on the given information.

The formula to convert °F to °C is C =
Convert 50°C to °F
10°F
20°F
122°F
132°F

Answers

Answer: 113°F

Here you go

Answer:

The answer is 122°F

Step-by-step explanation:

[tex]formula \: (celcius° \times 9 \div 5) + 32[/tex]

F°=(c°×9÷5)+32

F°=(50°×9÷5)+32

F°=(50°×1.8)+32

F°=90+32

F°=122°F

could someone help with the question in the picture, thanks

Answers

Answer:

Step-by-step explanation:

CHALLENGE To find 1,188 divided by 12, I think about 1,200 divided hun
that's 100 groups of 12. 1,188 has 1 fewer group of 12.

Answers

Answer:

1188 divided by 12 is 99

Answer:

this is a hard one

Step-by-step explanation:

2) According to Consumer Reports magazine, the costs per pound of protein for 20 major-brand beef hot dogs are
$14.23, $21.70, $14.49, $20.49, $14.47, $15.45, $25.25, $24.02, $18.86, $18.86, $30.65, $25.62, $8.12, $ 12.74,
$14.21, $13.39, $22.31, $19.95, $22.90, and $19.78, respectively. If the least expensive is considered the top-
ranked, what is the position in terms of a z-score of Thorn Apple Valley beef hot dogs at $14.23 per pound of
protein?
A) -2.67
B) -0.85
C) 0.85
D) 1.42
E) 2.67
Statistics: How would I find the answer?

Answers

Answer: -0.85

Step-by-step explanation: a = score-mean/ standard deviation

Mean (add them all up and divide by amount) = 18.8745

Standard deviation =

σ2 = Σ(xi - μ)2/N

= 5.333458985499

SCORE = 14.23

= -0.85

8-5b=-7 solve please

Answers

Answer:

Step-by-step explanation:

subtract 8

-5b=-15

divide negative 5

b=3

Answer the answer to your question is b=3

bob has 5 apples now he has 5 how much does he have now​

Answers

Answer:

5

Step-by-step explanation: Mind/Bamboozling question

Answer:

Bob has 5 apples still

Step-by-step explanation:

All by the amazing scientific reasoning of

when you have 5 of something

you go away and you still have 5

YOU WILL ALWAYS HAVE 5

Find all natural values of x such that x/8 is a proper fraction, and x/4 is an improper fraction.

Answers

Final answer:

The natural numbers for which x/8 is a proper fraction and x/4 is an improper fraction are 4, 5, 6, and 7.

Explanation:

Firstly, let's understand what proper and improper fractions are. A proper fraction is a fraction whose numerator is less than the denominator, and an improper fraction is a fraction whose numerator is equal to or greater than the denominator.

Given that x/8 is a proper fraction and x/4 is an improper fraction, we are looking for a number that is less than 8 (for the proper fraction) and equal to or greater than 4 (for the improper fraction). These restrictions on x mean that x must be in the range 4 ≤ x < 8.

When we consider that x should be a natural number, the only numbers that meet this criterion are 4, 5, 6, and 7. Hence, these are the natural values of x for which x/8 is a proper fraction and x/4 is an improper fraction.

Learn more about Proper and Improper Fractions here:

https://brainly.com/question/33440318

#SPJ2

Final answer:

The values of x that meet both conditions are 5, 6, and 7.

Explanation:

In order to find natural values for x where x/8 is a proper fraction and x/4 is an improper fraction, we must first understand what proper and improper fractions are. A proper fraction is one where the numerator is less than the denominator, whereas an improper fraction has a numerator larger than or equal to the denominator. Given that x/8 must be a proper fraction, x must be less than 8. For x/4 to be an improper fraction, x must be greater than or equal to 4. Therefore, to satisfy both conditions simultaneously, x must fall within the range of 5, 6, or 7. This is because these are the only natural numbers less than 8 and greater than 4.

In a given rectangle, the longer sides are 7 units longer than the shorter sides. If we let the shorter sides be represented as x, write an expression below that represents the perimeter.

A
2x + 7

B
4x2 + 49

C
4x + 49

D
4x + 14

Answers

Answer: D because the two longer sides are 7 unites longer, meaning you need to add 14 (7x2) to the final product

Answer:

Option D [tex]4x+14[/tex]

Step-by-step explanation:

Given: The longer sides are 7 units longer than the shorter sides. The shorter side is x.

To find: Write an expression below that represents the perimeter.

Solution: It is given that the shorter side is x.

The longer side is 7 units longer than the shorter side. So, the longer side is [tex]x+7[/tex]

We know that the perimeter of the rectangle is [tex]2(\text{length}+\text{breadth})[/tex]

So, the expression for the perimeter

[tex]=2(x+x+7)[/tex]

[tex]=2(2x+7)[/tex]

[tex]=4x+14[/tex]

Hence, the expression for perimeter is [tex]4x+14[/tex].

So, option D is correct.

Hector is dividing students into groups for an HR wants to divide the boys and girls so that each group has the same number of the boys and girls their 21 boys and 56 girls signed up for the hike to how many groups can the students be divided how many boys and how many girls will be in each group.​

Answers

Answer:

7 groups, 3 boys and 8 girls

Step-by-step explanation:

Let total number of groups be [tex]x[/tex]

and total hikers in one group be [tex]y[/tex]

if number of girls and boys in every group is same, then

[tex]\frac{21}{x} + \frac{56}{x} = y[/tex]

[tex]\frac{21 + 56}{x} = y\\x*y = 77[/tex] ....(1)

from (1) [tex]x[/tex] will either be 11 or 7

for [tex]x = 11[/tex] the values won't be real.

For [tex]x = 7\\y = \frac{77}{7} \\y = 11[/tex]

so there will be 7 groups with 11 hikers in each groups and every group will have [tex]\frac{21}{7} = 3[/tex] boys and [tex]\frac{56}{7} = 8[/tex] girls

What the value of the underline digit 213,669
One

Answers

Answer:

10,000

Step-by-step explanation:

Hope this helps!

Hey!

----------------------------------

Solution and Answer:

2 = hundred thousands

1 = ten thousands

3 = thousands

6 = hundreds

6 = tens

9 = ones

----------------------------------

Hope This Helped! Good Luck!

Any tutors here for the ASVAB? I need immediate help. ​

Answers

Answer:

I can help :)

My sc is softgurlshere

Other Questions
Emily purchased a building to store inventory for her business. The purchase price was $760,000. Emily also paid legal fees of $300 to acquire the building. In March, Emily incurred $2,000 to repair minor leaks in the roof (from storm damage earlier in the month) and $5,000 to make the interior suitable for her finished goods and $300 for legal fees. What is Emily's cost basis in the new building? The black mamba is one of the worlds most poisonous snakes, and with a maximum speed of 18.0 km/h, it is also the fastest. Suppose a mamba waiting in a hide-out sees prey and begins slithering toward it with a velocity of +18.0 km/h. After 2.50 s, the mamba realizes that its prey can move faster than it can. The snake then turns around and slowly returns to its hide-out in 12.0 s. Calculate the mamba's average velocity for the complete trip. Five-year-old Jonah likes to play a scrabble-like game on the family computer. He plays against other family members, and usually does pretty well. When he gets a list of letter tiles that are too difficult for him to use, he asks his mother and father for help. The difference between letter tiles that Jonah can use and letter tiles with which he needs help typifies what Vygotsky called the zone of ____ development. The antibiotic rifampin inhibits the bacterial RNA polymerase, preventing it from binding to the promoter region. This inhibits ___________a. translationb. transcriptionc. transpositiond. transductione. transformation 6h-3=7h-13step by step pleasee We sometimes "signal" interest in someone without the use of words, which is part of how we establish a relationship with another person, possibly a lasting one. How would an anthropologist describe our behavior? The probability that a lab specimen contains high levels of contamination is 0.15. A group of 3 independent samples are checked. Round your answers to four decimal places (e.g. 98.7654). (a) What is the probability that none contain high levels of contamination? (b) What is the probability that exactly one contains high levels of contamination? (c) What is the probability that at least one contains high levels of contamination? Can i please have help i will rate 5 and thank. Song Title:Year Song Was Released:1.How many different instruments do you hear in this band or group? Identify and name the instruments you hearAnswer: 2.Is one instrument featured more prominently than the others? What is it about the sound of that instrument that makes a distinct impression on the listener? What is unique about this instrument? Answer:3.Choose an instrument that you normally dont pay much attention to (maybe the bass or the keyboard, for instance). Listen carefully to how it sounds in this song. Describe three interesting features that characterize this instrument and its sound. Why is this instrument crucial to the overall sound of this band? Explain your reasoning.Answer:4.Think about the singer and the instruments in the band. Are the instruments and the singer of equal importance? In your opinion, which is more important and why do you think so?Answer: which of the following is indicated by the arrow in the image Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2 name the property that is shown by the following expression (9x3)x4=9x(3x4) PLEASE HELPWhich of the following is TRUE about gothic master builders?A. They designed the structure of the church without supervising its constructionB. Their primary role was to construct the church the abbot designed.C. They worked closely with the abbot to design and build a church.D. They supervised construction without working with their own hands. Exotics Faucets and Sinks LTD., guarantees that its new infrared sensor faucet will save any household that has 2 or more children at least $30 per month in water costs beginning 1 month after the faucet is installed. If the faucet is under full warranty for 5 years, the minimum amount a family of four could afford to spend now on such a faucet at an interest rate of 1/2% per year, compounded monthly, is closest to(a) $149c) $1787(b) $1552d) $1890 Which terms are rational in the expansion of (\sqrt{3} + \frac{1}{\sqrt[4]{6}})^{15} . List the rational terms and justify why the others are not rational. Please help me answer these: (8.18*10^-6)(1.15*10^-5)and1.15*10^-7_______2.5*10^-3 It's scientific notation and please explain your answer What volume of phenytoin suspension 30 mg/5 mL is required to be added to a suitable diluent to obtain 150 mL phenytoin suspension 20 mg/5 mL? 100 Use Gaussian elimination on the augmented matrix, then use back substitution to find the solution of the system of linear equations.-2x + 3y - 4z = 75x - y + 2z = 133x + 2y - z = 17 Males of different species of the fruit fly Drosophila that live in the same parts of the Hawaiian Islands have different elaborate courtship rituals. These rituals involve fighting other males and making stylized movements that attract females. What type of reproductive isolation does this represent?a. habitat isolationb. temporal isolationc. behavioral isolationd. gametic isolation 53.010,000 in scientific nottation Even though the nation faces political instability, the island of Frollik with its wide, expansive beaches is a destination hub for cruise lines. Recently, a large theme park company showed strong interest in buying land in Frollik with the intent of building a park targeted toward families. The company wants to make a commitment to Frollik, including the hiring of several hundred local employees. Theyre using a global marketing strategy called ____________.